Chemistry for Engineering Students
3rd Edition
ISBN: 9781285199023
Author: Lawrence S. Brown, Tom Holme
Publisher: Cengage Learning
expand_more
expand_more
format_list_bulleted
Concept explainers
Textbook Question
Chapter 3, Problem 3.82PAE
3.92 Many
verter of a car. In one of these reactions, nitric oxide (NO)
reacts with ammonia (NH3) to give nitrogen (N2) and
water. Write a balanced equation for this reaction.
Expert Solution & Answer
Want to see the full answer?
Check out a sample textbook solutionStudents have asked these similar questions
The fuel tank of an automobile contains 62.0 kg of gasoline. If the gasoline reacts completely with excess oxygen (from the air) to form CO2 and H2O, what is the total mass of the products? For simplicity, assume that gasoline is comprised of 100% octane.(C8H18).
If 5.9 × 10²⁵ molecules of CO₂ are produced in a combustion reaction, what is the mass in kg of CO₂ that is produced?
Cephalexin is a semisynthetic cephalosporin antibacterial drug intended for oral administration. Cephalexin is an organic compound that has a molecular formula of C16H17N3O4S. If a medication bottle containing a suspension of cephalexin reads 0.720 g/0.5 cL, how many moles of cephalexin were administered to a patient which was given a dose of 12 mL?
Chapter 3 Solutions
Chemistry for Engineering Students
Ch. 3 - • describe the chemical processes used in biomass...Ch. 3 - Prob. 2COCh. 3 - list at least three quantities that must be...Ch. 3 - Write balanced chemical equations for simple...Ch. 3 - Prob. 5COCh. 3 - Prob. 6COCh. 3 - Interconvert between mass, number of molecules,...Ch. 3 - Determine a chemical formula from elemental...Ch. 3 - define the concentration of a solution and...Ch. 3 - Calculate the molarity of solutions prepared by...
Ch. 3 - Prob. 11COCh. 3 - Prob. 12COCh. 3 - Prob. 13COCh. 3 - write molecular and ionic equations for acidbase...Ch. 3 - Prob. 3.1PAECh. 3 - Prob. 3.2PAECh. 3 - Prob. 3.3PAECh. 3 - A newspaper article states that biomass has...Ch. 3 - Prob. 3.5PAECh. 3 - Prob. 3.6PAECh. 3 - Which symbols are used to indicate solids,...Ch. 3 - How is the addition of heat symbolized in a...Ch. 3 - Prob. 3.9PAECh. 3 - 3.10 Define the term stoichiometric coefficient.Ch. 3 - 3.11 Balance these equations. (a) Al(s) + O2(g)(...Ch. 3 - 3.11 Balance the following equations. (a) CaC2(s)...Ch. 3 - 3.13 An explosive whose chemical formula is...Ch. 3 - 3.14 A number of compounds are used in cement, and...Ch. 3 - 3.15 Ethanol, C2H5OH is found in gasoline blends...Ch. 3 - 3.16 Balance the following equations. (a) reaction...Ch. 3 - 3.17 Write balanced chemical equations for the...Ch. 3 - 3.18 Diborane and related compounds were proposed...Ch. 3 - 3.19 Silicon nitride, Si3N4, is used as a...Ch. 3 - The following pictures show a molecular-scale view...Ch. 3 - Prob. 3.21PAECh. 3 - Prob. 3.22PAECh. 3 - Prob. 3.23PAECh. 3 - Prob. 3.24PAECh. 3 - Prob. 3.25PAECh. 3 - 3.24 Classify the following compounds as...Ch. 3 - 3.25 The following compounds are water-soluble....Ch. 3 - 3.26 Decide whether each of the following is...Ch. 3 - Prob. 3.29PAECh. 3 - 3.28 A packaging engineer is working on a new...Ch. 3 - 3.29 Classify each of these as an acid or a base....Ch. 3 - 3.30 Define the term spectator ion.Ch. 3 - 3.31 What is the difference between a total ionic...Ch. 3 - 3.32 Balance the following equations and then...Ch. 3 - 3.33 Balance the following equations, and then...Ch. 3 - 3.34 In principle, it may be possible to engineer...Ch. 3 - 3.35 Explain the concept of the mole in your own...Ch. 3 - 3.36 How many entities are present in each of the...Ch. 3 - 3.37 If atypical grain of sand occupies a volume...Ch. 3 - 3.38 Estimate the size of a particle 1 mole of...Ch. 3 - 3.39 Calculate the molar mass of each of the...Ch. 3 - 3.40 Calculate the molar masses (in grams per...Ch. 3 - 3.41 Calculate the molar mass of each of these...Ch. 3 - Prob. 3.44PAECh. 3 - 3.43 Calculate the molar mass of the following...Ch. 3 - 3.44 Determine the molar mass of these ceramic...Ch. 3 - A chemist needs exactly 2 moles of KNO3 to make a...Ch. 3 - 3.46 What mass of ozone (O3) contains 4.5 moles of...Ch. 3 - 3.47 Calculate the mass in grams of each the...Ch. 3 - 3.48 Calculate the mass in grams of 13.5 mol of...Ch. 3 - 3.49 How many moles are present in the given...Ch. 3 - 3.50 A test of an automobile engine's exhaust...Ch. 3 - 3.51 Modern instruments can measure a mass as...Ch. 3 - 3.52 How many H atoms are present in 7.52 g of...Ch. 3 - 3.53 How many O atoms are present in 214 g of...Ch. 3 - A sample of H2C2O4.2H2O of mass 3.35 g is heated...Ch. 3 - 3.55 An average person inhales roughly 2.5 g of O2...Ch. 3 - 3.56 A large family of boron-hydrogen compounds...Ch. 3 - Prob. 3.59PAECh. 3 - 3.58 Determine the simplest formulas of the...Ch. 3 - 3.59 The composition of materials such as alloys...Ch. 3 - 3.60 Copper can have improved wear resistance if...Ch. 3 - 3.61 Calculate the molarity of each of the...Ch. 3 - 3.62 What is the molarity of each ion present in...Ch. 3 - 3.63 How many moles of solute are present in each...Ch. 3 - 3.64 How many grams of solute are present in each...Ch. 3 - 3.65 Determine the final molarity for the...Ch. 3 - Prob. 3.68PAECh. 3 - Prob. 3.69PAECh. 3 - 3.68 Magnesium is lighter than other structural...Ch. 3 - Prob. 3.71PAECh. 3 - Prob. 3.72PAECh. 3 - 3.71 What is meant by the term carbon reservoir?...Ch. 3 - Prob. 3.74PAECh. 3 - Prob. 3.75PAECh. 3 - Prob. 3.76PAECh. 3 - 3.87 Nitric acid (HNO3) can be produced by the...Ch. 3 - 3.88 One Step in the enrichment of uranium for use...Ch. 3 - 3.89 Pyridine has the molecular formula C5H5N....Ch. 3 - 3.90 Pyrrole has the molecular formula C4H5N. When...Ch. 3 - 3.91 Hydrogen cyanide (HCN) is extremely toxic,...Ch. 3 - 3.92 Many chemical reactions take place in the...Ch. 3 - 3.93 Adipic acid is used in the production of...Ch. 3 - 3.94 Calcium carbonate (limestone, CaCO3)...Ch. 3 - Prob. 3.85PAECh. 3 - Consider two samples of liquid: 1 mole of water...Ch. 3 - 3.95 Cumene is a hydrocarbon, meaning that it...Ch. 3 - 3.96 Methyl cyanoacrylate is the chemical name for...Ch. 3 - 3.97 A low-grade form of iron ore is called...Ch. 3 - 3.98 The characteristic odor of decaying flesh is...Ch. 3 - 3.99 Iron—platinum alloys may be useful as...Ch. 3 - 3.100 Some aluminum—lithium alloys display the...Ch. 3 - 3.101 Which (if any) of the following compounds...Ch. 3 - 3.102 Classify the following compounds as acids or...Ch. 3 - 3.103 What is the mass in grams of solute in 250.0...Ch. 3 - 3.104 What volume of 0.123 M NaOH in milliliters...Ch. 3 - 3.105 Nitric acid is often sold and transported as...Ch. 3 - 3.106 Twenty-five mL of a 0.388 M solution of...Ch. 3 - 3.107 As computer processor speeds increase, it is...Ch. 3 - 3.108 As chip speeds increase, the width of the...Ch. 3 - 3.109 Materials engineers often create new alloys...Ch. 3 - 3.110 The protein that carries oxygen in the blood...Ch. 3 - 3.111 The chlorophyll molecule responsible for...Ch. 3 - 3.112 In one experiment, the burning of 0.614 g of...Ch. 3 - 3.113 MgCl2 is often found as an impurity in table...Ch. 3 - Prob. 3.106PAECh. 3 - 3.115 The average person exhales 1.0 kg of carbon...Ch. 3 - 3.116 The simplest approximate chemical formula...Ch. 3 - 3.117 For the oxides of iron, FeO, Fe2O3, and...Ch. 3 - 3.118 Consider common sugars such as glucose...Ch. 3 - Prob. 3.111PAECh. 3 - 3.120 1f you have 32.6 g of sodium carbonate that...Ch. 3 - 3.121 If you have 21.1 g of iron(II) nitrate that...Ch. 3 - 3.122 What type of reasoning were we using when we...Ch. 3 - 3.123 Most periodic tables provide molar masses...
Knowledge Booster
Learn more about
Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.Similar questions
- 4.69 The pictures below show a molecular-scale view of a chemical reaction between H2 and CO to produce methanol, CH3OH. The box on the left represents the reactants at the instant of mixing, and the box on the right shows what is left once the reaction has gone to completion. Was there a limiting reactant in this reaction? If so, what was it? Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.arrow_forwardMethanol, CH3OH, is prepared industrially from the gas-phase catalytic balanced reaction that has been depicted here using molecular models. In a laboratory test, a reaction vessel was filled with 41.1 g CO und 10.2 g H2. How many grams of methanol would be produced in a complete reaction? Which reactant remains unconsumed at the end of the reaction? How many grams of it remain?arrow_forwardYou react nitrogen and hydrogen in a container to produce ammonia, NH3(g). The following figure depicts the contents of the container after the reaction is complete. a Write a balanced chemical equation for the reaction. b What is the limiting reactant? c How many molecules of the limiting reactant would you need to add to the container in order to have a complete reaction (convert all reactants to products)?arrow_forward
- 4.44 Industrial production of hydrogen gas uses the reaction shown below. If 1.00 metric ton of propane reacting with excess water yields 270 kg of H2, what is the percentage yield? C3H8(g)+3H2O(l)3CO(g)+7H2(g)arrow_forwardA sample of sandstone consists of silica, SiO2, and calcite, CaCO3. When the sandstone is heated, calcium carbonate, CaCO3, decomposes into calcium oxide, CaO, and carbon dioxide CaCO3(s)CaO(s)+CO2(g) What is the percentage of silica in the sandstone if 18.7 mg of the rock yields 3.95 mg of carbon dioxide?arrow_forwardThe following reaction, depicted using molecular models, is used to make carbon tetrachloride, CCl4, a solvent and starting material for the manufacture of fluorocarbon refrigerants and aerosol propellants. Calculate the number of grams of carbon disulfide, CS2, needed for a laboratory-scale reaction with 62.7 g of chlorine, Cl2.arrow_forward
- Carbon disulfide, CS2, burns in oxygen. Complete combustion gives the balanced reaction that has been depicted here using molecular models. Calculate the grams of sulfur dioxide, SO2, produced when a mixture of 35.0 g of carbon disulfide and 35.0 g of oxygen reacts. Which reactant remains unconsumed at the end of the combustion? How many grams remain?arrow_forward3.96 Methyl cyanoacrylate is the chemical name for the substance sold as Super Glue, and it has the chemical formula C5H5NO2. Calculate the number of molecules of this substance in a 1.0-ounce tube of Super Glue, assuming that the glue is 80% methyl cyanoacrylate by mass.arrow_forwardCalcium carbide, CaC2, used to produce acetylene, C2H2, is prepared by heating calcium oxide, CaO, and carbon, C, to high temperature. CaO(s)+3C(s)CaC2(s)+CO(g) If a mixture contains 8.49 kg of each reactant, how many grams of calcium carbide can be prepared?arrow_forward
- Hydrogen cyanide, HCN, can be made by a two-step process. First, ammonia is reacted with O2 to give nitric oxide, NO. 4NH3(g)+5O2(g)4NO(g)+6H2O(g) Then nitric oxide is reacted with methane, CH4. 2NO(g)+2CH4(g)2HCN(g)+2H2O(g)+H2(g) When 24.2 g of ammonia and 25.1 g of methane are used, how many grams of hydrogen cyanide can be produced?arrow_forward4.14 The combustion of liquid chloroethylene, C2H3Cl, yields carbon dioxide, steam, and hydrogen chloride gas. (a) Write a balanced equation for the reaction. (b) How many moles of oxygen are required to react with 35.00 g of chloroethylene? (c) If 125.00 g of chloroethylene reacts with an excess of oxygen, how many grams of each product are formed?arrow_forward3.91 Hydrogen cyanide (HCN) is extremely toxic, but it is used in the production of several important plastics. In the most common method for producing HCN, ammonia (NH3) and methane (CH4) react with oxygen (O2) to give HCN and water. Write a balanced chemical equation for this reaction. Hydrogen cyanide, HCNarrow_forward
arrow_back_ios
SEE MORE QUESTIONS
arrow_forward_ios
Recommended textbooks for you
- Chemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage Learning
- World of ChemistryChemistryISBN:9780618562763Author:Steven S. ZumdahlPublisher:Houghton Mifflin College DivWorld of Chemistry, 3rd editionChemistryISBN:9781133109655Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCostePublisher:Brooks / Cole / Cengage Learning
Chemistry for Engineering Students
Chemistry
ISBN:9781337398909
Author:Lawrence S. Brown, Tom Holme
Publisher:Cengage Learning
General Chemistry - Standalone book (MindTap Cour...
Chemistry
ISBN:9781305580343
Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; Darrell
Publisher:Cengage Learning
Chemistry
Chemistry
ISBN:9781305957404
Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste
Publisher:Cengage Learning
World of Chemistry
Chemistry
ISBN:9780618562763
Author:Steven S. Zumdahl
Publisher:Houghton Mifflin College Div
World of Chemistry, 3rd edition
Chemistry
ISBN:9781133109655
Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste
Publisher:Brooks / Cole / Cengage Learning
Bonding (Ionic, Covalent & Metallic) - GCSE Chemistry; Author: Science Shorts;https://www.youtube.com/watch?v=p9MA6Od-zBA;License: Standard YouTube License, CC-BY
Stoichiometry - Chemistry for Massive Creatures: Crash Course Chemistry #6; Author: Crash Course;https://www.youtube.com/watch?v=UL1jmJaUkaQ;License: Standard YouTube License, CC-BY