At
(a)
Calculate the standard enthalpy of neutralisation of
(b)
Using the value of -56.2 kJ as the standard enthalpy change for the reaction
calculate the standard enthalpy change for the reaction
Interpretation:
The standard enthalpy of neutralization for the given compound and the standard enthalpy change for the given reaction are to be calculated.
Concept introduction:
The standard enthalpy for a reaction is the amount of enthalpy that occurs under standard conditions.
The standard enthalpy of a reaction is determined by using the equation given below:
Here, the stoichiometric coefficients are represented by m for the reactants and n for the products and the enthalpy of formation under standard conditions is represented by
The value of the enthalpy of formation of an element is zero at its most stable state.
Answer to Problem 98AP
Solution:
(a)
(b)
Explanation of Solution
Given information:
a) The standard enthalpy of neutralization of
The given reaction is as follows:
Calculate the enthalpy of neutralization for the given reaction as follows:
Substitute
Hence, the enthalpy of neutralization for
b) The standard enthalpy change for the reaction
The given reaction with its enthalpy of reaction is as follows:
Calculate the standard enthalpy of reaction as follows:
Substitute
Rearrange the above equation for
as follows:
The reaction of hydrogen fluoride is as follows:
Calculate the standard enthalpy of the reaction as follows:
Substitute
Hence, the required enthalpy of reaction is
Want to see more full solutions like this?
Chapter 5 Solutions
Chemistry
Additional Science Textbook Solutions
Organic Chemistry
Organic Chemistry (8th Edition)
Inorganic Chemistry
Chemistry For Changing Times (14th Edition)
General Chemistry: Principles and Modern Applications (11th Edition)
- 9.53 Using these reactions, find the standard enthalpy change for the formation of 1 mol of PhO(s) from lead metal and oxygen gas. PbO(s)+C(graphite)Pb(s)+CO(g) H = 106.8 kJ 2C(graphite)+O2(g)2CO(g) H= -221.0 kJ If 250 g of lead reacts with oxygen to form lead(II) oxide, what quantity of thermal energy (in kJ) is ahsorhed or evolved?arrow_forwardCombustion of table sugar produces CO2(g) and H2O( l). When 1.46 g table sugar is combusted in a constant-volume (bomb) calorimeter, 24.00 kJ of heat is liberated. a. Assuming that table sugar is pure sucrose, C12H22O11 (s), write the balanced equation for the combustion reaction. b. Calculate E in kJ/mol C12H22O11 for the combustion reaction of sucrose.arrow_forwardWhen one mol of KOH is neutralized by sulfuric acid, q=56 kJ. (This is called the heat of neutralization.) At 23.7C, 25.0 mL of 0.475 M H2SO4 is neutralized by 0.613 M KOH in a coffee-cup calorimeter. Assume that the specific heat of all solutions is 4.18J/gC, that the density of all solutions is 1.00 g/mL, and that volumes are additive. (a) How many mL of KOH is required to neutralize H2SO4? (b) What is the final temperature of the solution?arrow_forward
- A 50-mL solution of a dilute AgNO3 solution is added to 100 mL of a base solution in a coffee-cup calorimeter. As Ag2O(s) precipitates, the temperature of the solution increases from 23.78 C to 25.19 C. Assuming that the mixture has the same specific heat as water and a mass of 150 g, calculate the heat q. Is the precipitation reaction exothermic or endothermic?arrow_forwardUsing the data in Appendix G, calculate the standard enthalpy change for each of the following reactions: (a) Si(s)+2F2(g)SiF4(g) (b) 2C(s)+2H2(g)+O2(g)CH3CO2H(l) (c) CH4(g)+N2(g)HCN(g)+NH3(g) ; (d) CS2(g)+3Cl2(g)CCl4(g)+S2Cl2(g)arrow_forwardUsing the data in Appendix G, calculate the standard enthalpy change for each of the following reactions: (a) N2(g)+O2(g)2NO(g) (b) Si(s)+2Cl2(g)SiCl4(g) (c) Fe2O3(s)+3H2(g)2Fe(s)+3H2O(l) (d) 2LiOH(s)+CO2(g)Li2CO3(s)+H2O(g)arrow_forward
- A piece of lead of mass 121.6 g was heated by an electrical coil. From the resistance of the coil, the current, and the Time the current flowed, it was calculated that 235 J of heat was added to the lead. The temperature of the lead rose from 20.4C to 35.5C. What is the specific heat of the lead?arrow_forwardHow much heat is produced when loo mL of 0.250 M HCl (density, 1.00 g/mL) and 200 mL of 0.150 M NaOH (density, 1.00 g/mL) are mixed? HCl(aq)+NaO(aq)NaCl(aq)+H2O(l)H298=58kJ If both solutions are at the same temperature and the heat capacity of the products is 4.19 J/g C, how much will the temperature increase? What assumption did you make in your calculation?arrow_forwardHow much will the temperature of a cup (180 g) of coffee at 95 C be reduced when a 45 g silver spoon (specific heat 0.24 J/g C) at 25 C is placed in the coffee and the two are allowed to reach the same temperature? Assume that the coffee has the same density and specific heat as water.arrow_forward
- Write reactions for which the enthalpy change will be a. Hf for solid aluminum oxide. b. the standard enthalpy of combustion of liquid ethanol, C2H5OH(l). c. the standard enthalpy of neutralization of sodium hydroxide solution by hydrochloric acid. d. Hf for gaseous vinyl chloride, C2H3Cl(g). e. the enthalpy of combustion of liquid benzene, C6H6(l). f. the enthalpy of solution of solid ammonium bromide.arrow_forwardGiven 2Al2O3(s)4Al(s)+3O2(g)H=3351.4kJ (a) What is the heat of formation of aluminum oxide? (b) What is H for the formation of 12.50 g of aluminum oxide?arrow_forwardWhat mass of acetylene, C2H2(g), must be burned to produce 3420 kJ of heat, given that its enthalpy of combustion is 1301 kJ/mol? Compare this with the answer to Exercise 5.91 and determine which substance produces more heat per gram.arrow_forward
- Chemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage LearningChemistry by OpenStax (2015-05-04)ChemistryISBN:9781938168390Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark BlaserPublisher:OpenStaxChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage Learning
- General Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry: Principles and ReactionsChemistryISBN:9781305079373Author:William L. Masterton, Cecile N. HurleyPublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning