Classify each
(a)
Interpretation:
To classify the given alkyl halide as 1°, 2°, or 3°
Concept introduction:
Alkyl halides are organic molecules that contains a halogen atom X bonded to sp3 hybridized carbon atom. Alkyl halides are classified as primary (1°), secondary (2°), and tertiary (3°) depending on the number of carbons bonded to the carbon with the halogen.
Answer to Problem 7.1P
CH3CH2CH2CH2CH2-Br---➜ primary (1°)
Explanation of Solution
Alkyl halides are classified as primary (1°), secondary (2°), and tertiary (3°) depending on the number of carbons bonded to the carbon with the halogen.
primary (1°) = one carbon attached to carbon with halogen
secondary (2°) = two carbon attached to carbon with halogen
tertiary (3°) = three carbon attached to carbon with halogen
CH3CH2CH2CH2CH2-Br---➜ in this structure only one carbon attached to carbon with halogen so primary (1°)
Thus the given structure is primary (1°)
(b)
Interpretation:
To classify the given alkyl halide as 1°, 2°, or 3°
Concept introduction:
Alkyl halides are organic molecules that contains a halogen atom X bonded to sp3 hybridized carbon atom. Alkyl halides are classified as primary (1°), secondary (2°), and tertiary (3°) depending on the number of carbons bonded to the carbon with the halogen.
Answer to Problem 7.1P
------------➜ tertiary (3°)
Explanation of Solution
Alkyl halides are classified as primary (1°), secondary (2°), and tertiary (3°) depending on the number of carbons bonded to the carbon with the halogen.
primary (1°) = one carbon attached to carbon with halogen
secondary (2°) = two carbon attached to carbon with halogen
tertiary (3°) = three carbon attached to carbon with halogen
---➜ in this structure three carbons attached to carbon with halogen so primary (1°)
Thus the given structure is tertiary (3°)
(c)
Interpretation:
To classify the given alkyl halide as 1°, 2°, or 3°
Concept introduction:
Alkyl halides are organic molecules that contains a halogen atom X bonded to sp3 hybridized carbon atom. Alkyl halides are classified as primary (1°), secondary (2°), and tertiary (3°) depending on the number of carbons bonded to the carbon with the halogen.
Answer to Problem 7.1P
------------➜ secondary (2°)
Explanation of Solution
Alkyl halides are classified as primary (1°), secondary (2°), and tertiary (3°) depending on the number of carbons bonded to the carbon with the halogen.
primary (1°) = one carbon attached to carbon with halogen
secondary (2°) = two carbon attached to carbon with halogen
tertiary (3°) = three carbon attached to carbon with halogen
---➜ in this structure two carbons attached to carbon with halogen so secondary (2°)
Thus the given structure is secondary (2°)
(d)
Interpretation:
To classify the given alkyl halide as 1°, 2°, or 3°
Concept introduction:
Alkyl halides are organic molecules that contains a halogen atom X bonded to sp3 hybridized carbon atom. Alkyl halides are classified as primary (1°), secondary (2°), and tertiary (3°) depending on the number of carbons bonded to the carbon with the halogen.
Answer to Problem 7.1P
------------➜ tertiary (3°)
Explanation of Solution
Alkyl halides are classified as primary (1°), secondary (2°), and tertiary (3°) depending on the number of carbons bonded to the carbon with the halogen.
primary (1°) = one carbon attached to carbon with halogen
secondary (2°) = two carbon attached to carbon with halogen
tertiary (3°) = three carbon attached to carbon with halogen
---➜ in this structure three carbons attached to carbon with halogen so tertiary (3°)
Thus the given structure is tertiary (3°)
Want to see more full solutions like this?
Chapter 7 Solutions
Organic Chemistry
- Give a systematic (IUPAC) name for each diol. ) HO¬(CH2)8¬OHarrow_forwardDraw the products formed when each alcohol is dehydrated with H 2SO 4. Use the Zaitsev rule to predict the major product when a mixture forms.arrow_forwardArrange these compounds in order of increasing boiling point. (a) 1-butanol, butane, diethylether (b) hexane, 1-hexanol, dipropyletherarrow_forward
- List the following compounds in order of increasing water solubility: a.ethoxyethane b.propanoic acid c.pentane d.1 butanolarrow_forwardWhat alkenes are formed when each alcohol is dehydrated with TsOH? Label the major product when a mixture results.arrow_forwardWhat products are formed when an alcohol undergoes dehydration?arrow_forward
- Rank each set of compounds in order of increasing boiling points.(a) triethylamine, di-n-propylamine, n-propyl etherarrow_forwardGive a systematic (IUPAC) name for each diol.(a) CH3CH(OH)(CH2)4CH(OH)C(CH3)3 (b) HO¬(CH2)8¬OHarrow_forwardgive the structure corresponding to each IUPAC name 1. 6,6-diethyl-4-nonanolarrow_forward
- Draw the product resulting from mild oxidation of (a) 2-butanol; (b) 2-methylpropanal; (c) cyclopentanol.arrow_forwardWhat alkenes are formed when each alcohol is treated with H 2SO 4? Use the Zaitsev rule to predict the major product.arrow_forwardWrite names and formulas for simple ethers.arrow_forward
- Chemistry: Matter and ChangeChemistryISBN:9780078746376Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl WistromPublisher:Glencoe/McGraw-Hill School Pub CoOrganic And Biological ChemistryChemistryISBN:9781305081079Author:STOKER, H. Stephen (howard Stephen)Publisher:Cengage Learning,General, Organic, and Biological ChemistryChemistryISBN:9781285853918Author:H. Stephen StokerPublisher:Cengage Learning
- Chemistry for Today: General, Organic, and Bioche...ChemistryISBN:9781305960060Author:Spencer L. Seager, Michael R. Slabaugh, Maren S. HansenPublisher:Cengage LearningChemistry: Principles and ReactionsChemistryISBN:9781305079373Author:William L. Masterton, Cecile N. HurleyPublisher:Cengage Learning