Chemistry for Engineering Students
4th Edition
ISBN: 9781337398909
Author: Lawrence S. Brown, Tom Holme
Publisher: Cengage Learning
expand_more
expand_more
format_list_bulleted
Question
Chapter 8, Problem 8.28PAE
Interpretation Introduction
Interpretation: What is a “III-V” semiconductor and its relation with silicon has to be determined.
Concept introduction:
- A semiconductor is made up of group IV elements such as Carbon, Silicon and when it is doped with group III element, it is called p-type extrinsic semiconductor and when it is doped with group V element, it is called n-type extrinsic semiconductor.
- Doping increases the electrical conductivity of the semiconductor.
- A III-V semiconductor is an alloy composed of group III elements (such as boron, aluminium) and group V elements (such as arsenic, phosphorus)
Expert Solution & Answer
Want to see the full answer?
Check out a sample textbook solutionStudents have asked these similar questions
4. Briefly explain why chemically similar alkali metal chlorides, NaCl and CsCl, have different crystalline structures, while MnS and NaCl pack in the same crystalline structure.
What is the electron sea model for bonding in metals?
Does aluminum chemically bond with sodium? Why or why not?
Chapter 8 Solutions
Chemistry for Engineering Students
Ch. 8 - Prob. 1COCh. 8 - • describe the arrangement of atoms in the common...Ch. 8 - • use bind theory to describe bonding in solids.Ch. 8 - Prob. 4COCh. 8 - Prob. 5COCh. 8 - Prob. 6COCh. 8 - Prob. 7COCh. 8 - • explain the connection between intermolecular...Ch. 8 - Prob. 9COCh. 8 - Prob. 10CO
Ch. 8 - Prob. 8.1PAECh. 8 - Why is the C 60form of carbon called...Ch. 8 - Prob. 8.3PAECh. 8 - Prob. 8.4PAECh. 8 - What is the relationship between the structures of...Ch. 8 - Use the web to look up information on nanotubes....Ch. 8 - Prob. 8.7PAECh. 8 - Prob. 8.8PAECh. 8 - Prob. 8.9PAECh. 8 - Prob. 8.10PAECh. 8 - Prob. 8.11PAECh. 8 - Prob. 8.12PAECh. 8 - 8.13 What is the coordination number of atoms in...Ch. 8 - Prob. 8.14PAECh. 8 - Prob. 8.15PAECh. 8 - 8.16 Iridium forms a face-centered cubic lattice,...Ch. 8 - 8.17 Europium forms a body-centered cubic unit...Ch. 8 - 8.18 Manganese has a body-centered cubic unit cell...Ch. 8 - Prob. 8.19PAECh. 8 - 8.20 How many electrons per atom are delocalized...Ch. 8 - Prob. 8.21PAECh. 8 - Prob. 8.22PAECh. 8 - Prob. 8.23PAECh. 8 - 8.24 What is the key difference between metallic...Ch. 8 - 8.25 Draw a depiction of the band structure of a...Ch. 8 - Prob. 8.26PAECh. 8 - Prob. 8.27PAECh. 8 - Prob. 8.28PAECh. 8 - Prob. 8.29PAECh. 8 - Prob. 8.30PAECh. 8 - Prob. 8.31PAECh. 8 - Prob. 8.32PAECh. 8 - Prob. 8.33PAECh. 8 - Suppose that a device is using a 15.0-mg sample of...Ch. 8 - 8.35 What is an instantancous dipole?Ch. 8 - 8.36 Why are dispersion forces attractive?Ch. 8 - 8.37 If a molecule is not very polarizable, how...Ch. 8 - 8.38 What is the relationship between...Ch. 8 - 8.39 Under what circumstances are ion-dipole...Ch. 8 - 8.40 Which of the following compounds would be...Ch. 8 - 8.41 What is the specific feature of N, O, and F...Ch. 8 - Prob. 8.42PAECh. 8 - 8.43 Identify the kinds of intermolecular forces...Ch. 8 - Prob. 8.44PAECh. 8 - 8.45 Describe how interactions between molecules...Ch. 8 - 8.46 What makes a chemical compound volatile?Ch. 8 - 8.47 Answer each of the following questions with...Ch. 8 - 8.48 Why must the vapor pressure of a substance be...Ch. 8 - Prob. 8.49PAECh. 8 - Prob. 8.50PAECh. 8 - 8.51 Suppose that three unknown pure substances...Ch. 8 - 8.52 Rank the following hydrocarbons in order of...Ch. 8 - Prob. 8.53PAECh. 8 - Prob. 8.54PAECh. 8 - Prob. 8.55PAECh. 8 - Prob. 8.56PAECh. 8 - Prob. 8.57PAECh. 8 - Prob. 8.58PAECh. 8 - Prob. 8.59PAECh. 8 - Prob. 8.60PAECh. 8 - 8.61 Distinguish between a block copolymer and a...Ch. 8 - Prob. 8.62PAECh. 8 - Prob. 8.63PAECh. 8 - Prob. 8.64PAECh. 8 - Prob. 8.65PAECh. 8 - 8.66 What structural characteristics are needed...Ch. 8 - Prob. 8.67PAECh. 8 - Prob. 8.68PAECh. 8 - Prob. 8.69PAECh. 8 - Prob. 8.70PAECh. 8 - Prob. 8.71PAECh. 8 - Prob. 8.72PAECh. 8 - Prob. 8.73PAECh. 8 - Prob. 8.74PAECh. 8 - 8.75 Using pentagons, draw arrangements that...Ch. 8 - 8.76 Using circles, draw regular two-dimensional...Ch. 8 - 8.77 What is the difference between a bonding...Ch. 8 - Prob. 8.78PAECh. 8 - 8.79 Most gaseous compounds consist of small...Ch. 8 - 8.80 Why are dipole—dipole forces typically...Ch. 8 - 8.81 Carbon tetrachloride (CCl4) is a liquid at...Ch. 8 - Prob. 8.82PAECh. 8 - Prob. 8.83PAECh. 8 - Prob. 8.84PAECh. 8 - Prob. 8.85PAECh. 8 - Prob. 8.86PAECh. 8 - 8.87 Use the vapor pressure curves illustrated...Ch. 8 - Prob. 8.88PAECh. 8 - 8.89 The following data show the vapor pressure of...Ch. 8 - Prob. 8.90PAECh. 8 - Prob. 8.91PAECh. 8 - Prob. 8.92PAECh. 8 - Prob. 8.93PAECh. 8 - Prob. 8.94PAECh. 8 - Prob. 8.95PAECh. 8 - 8.96 A business manager wants to provide a wider...Ch. 8 - 8.97 The doping of semiconductors can be done with...Ch. 8 - 8.98 If you know the density of material and the...Ch. 8 - Prob. 8.99PAECh. 8 - Prob. 8.100PAECh. 8 - Prob. 8.101PAECh. 8 - Prob. 8.102PAECh. 8 - 8.103 Cryolite (Na3AlF6) is used in refining...Ch. 8 - Prob. 8.104PAECh. 8 - Prob. 8.105PAE
Knowledge Booster
Similar questions
- 7.72 How does an MSN differ from amorphous silica so that is has improved biocompatibility?arrow_forward8.24 What is the key difference between metallic bonding (in the sea of electrons model) and ionic bonding (as described in Chapter 7) that explains why metals conduct electricity and ionic solids do not?arrow_forwardCarbon is used in countless ways in a modern automobile, with the most visible use being carbon fiber, which is utilized for everything from decoration to vehicle frames and body panels. What properties of carbon (C) allow for the formation of carbon fiber which is a polymer (made of very thin strands of the element carbon)? Explain by referring to the atomic structure of carbon. Compare between carbon fiber and iron (Fe) in terms of durability and performance.arrow_forward
- Explain basing on bonding the differences in properties of:(a) Diamond and Graphite (b) Sodium and Copper(c) Carbon and Lead, (d) Fluorine and Iodinearrow_forward8.96 A business manager wants to provide a wider range of p- and n-type semiconductors as a strategy to enhance sales. You are the lead materials engineer assigned to communicate with this manager. How would you explain why there are more ways to build a p-type semiconductor from silicon than there are ways to build an n-type semiconductor from silicon?arrow_forwardDefine the bonding that exists in metals and how this model explains some of the unique physical properties of metals. What are metal alloys? Identify the two main types of alloys, and describe how their structures differ. Give several examples of each type of alloy.arrow_forward
- Although nitrogen trifluoride (NF3) is a thermally stable compound, nitrogen triiodide (Nl3) is known to be a highly explosive material. NI3 can be synthesized according to the equation BN(s)+3IF(g)BF3(g)+NI3(g) a. What is the enthalpy of formation for NI3(s) given the enthalpy of reaction ( 307 kJ) and the enthalpies of formation for BN(s) (254 kJ/mol), IF(g) ( 96 kJ/mol), and BF3(g) ( 1136 kJ/mol)? b. It is reported that when the synthesis of NI3 is conducted using 4 moles of IF for every l mole of BN. one of the by-products isolated is [IF2]+ [BF4]. What are the molecular geometries of the species in this by-product? What are the hybridizations of the central atoms in each species in the by-product?arrow_forwardUse the web to look up information on nanotubes. Distinguish between single-walled and double-walled nanotubes.arrow_forwardIf a silicon is replaced by an aluminum in a silicon oxide structure, how is charge neutrality maintained?arrow_forward
- Briefly explain why steel, an alloy of iron, is usedto build the supporting structure of many buildings.arrow_forwardHow do the physical properties of a network covalent solidand a molecular covalent solid differ? Why?arrow_forwardOne famous application of nanomaterials are in the cosmetic industry, identify the nanometrials used in sunscreens. Explain the role of these materials in sunscreens.arrow_forward
arrow_back_ios
arrow_forward_ios
Recommended textbooks for you
- Chemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage LearningChemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning
- Chemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningIntroductory Chemistry: A FoundationChemistryISBN:9781337399425Author:Steven S. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage Learning
Chemistry for Engineering Students
Chemistry
ISBN:9781337398909
Author:Lawrence S. Brown, Tom Holme
Publisher:Cengage Learning
Chemistry: Principles and Practice
Chemistry
ISBN:9780534420123
Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer
Publisher:Cengage Learning
Chemistry & Chemical Reactivity
Chemistry
ISBN:9781337399074
Author:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel
Publisher:Cengage Learning
Chemistry & Chemical Reactivity
Chemistry
ISBN:9781133949640
Author:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel
Publisher:Cengage Learning
Introductory Chemistry: A Foundation
Chemistry
ISBN:9781337399425
Author:Steven S. Zumdahl, Donald J. DeCoste
Publisher:Cengage Learning
Chemistry
Chemistry
ISBN:9781305957404
Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste
Publisher:Cengage Learning