293) What is the value of ECELL (in V) for the following unbalanced reaction: Mg²+ (aq) + Al(s) ---> Mg (s) + A1³+ (aq) when it occurs at 25°C and the concentrations of the species are as follows: Mg2+] = 0.151 M A1³+] = 4.82 x 10-5 M The reduction potentials for the two half-reactions involved are: Mg2+ + 2 e---> Mg (s) (E°RED) = -2.37 V 1³+ + 3 e- --> Al (s) (E°RED) = -1.66 V Please give me four decimal places - if Canvas will allow - so that it is easier for me to award partial redit as appropriate).

293) What is the value of ECELL (in V) for the following unbalanced reaction: Mg²+ (aq) + Al(s) ---> Mg (s) + A1³+ (aq) when it occurs at 25°C and the concentrations of the species are as follows: Mg2+] = 0.151 M A1³+] = 4.82 x 10-5 M The reduction potentials for the two half-reactions involved are: Mg2+ + 2 e---> Mg (s) (E°RED) = -2.37 V 1³+ + 3 e- --> Al (s) (E°RED) = -1.66 V Please give me four decimal places - if Canvas will allow - so that it is easier for me to award partial redit as appropriate).

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 160MP: The table below lists the cell potentials for the 10 possible galvanic cells assembled from the...

See similar textbooks

Similar questions

Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
An aqueous solution of an unknown salt of vanadium is electrolyzed by a current of 2.50 amps for 1.90 hours. The electroplating is carried out with an efficiency of 95.0%, resulting in a deposit of 2.850 g of vanadium. a How many faradays are required to deposit the vanadium? b What is the charge on the vanadium ions (based on your calculations)?
For the following half-reaction, = 2.07 V: A1F63(aq)+3eAl(s)+6F(aq) Using data from Table 17-1, calculate the equilibrium constant at 25C for the reaction A13+(aq)+6F(aq)A1F63(aq)K=?
An aqueous solution of an unknown salt of gold is electrolyzed by a current of 2.75 amps for 3.39 hours. The electroplating is carried out with an efficiency of 93.0%, resulting in a deposit of 21.221 g of gold. a How many faradays are required to deposit the gold? b What is the charge on the gold ions (based on your calculations)?
Atomic masses can be determined by electrolysis. In one hour, a current of 0.600 A deposits 2.42 g of a certain metal, M, which is present in solution as M+ ions. What is the atomic mass of the metal?
What is the standard cell potential you would obtain from a cell at 25C using an electrode in which I(aq) is in contact with I2(s) and an electrode in which a chromium strip dips into a solution of Cr3(aq)?
For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Zn(s)+Fe2+(aq)Zn2+(aq)+Fe(s) (b) AgCl(s)+Fe2+(aq)Ag(s)+Fe3+(aq)+Cl(aq) (c) Br2(l)+2Cl(aq)Cl2(g)+2Br(aq)
The Nernst equation allows determination of the cell potential for a galvanic cell at nonstandard conditions. Write out the Nernst equation. What are nonstandard conditions? What do , n, and Q stand for in the Nernst equation? What does the Nernst equation reduce to when a redox reaction is at equilibrium? What are the signs of G and when K 1? When K 1? When K = 1? Explain the following statement: determines spontaneity, while determines the equilibrium position. Under what conditions can you use to predict spontaneity?
Consider only the species (at standard conditions) Na+, Cl, Ag+, Ag, Zn2+, Zn, Pb in answering the following questions. Give reasons for your answers. (Use data from Table 17-1.) a. Which is the strongest oxidizing agent? b. Which is the strongest reducing agent? c. Which species can be oxidized by SO42 (aq) in acid? d. Which species can be reduced by Al(s)?
The saturated calomel electrode. abbreviated SCE. is often used as a reference electrode in making electrochemica1 measurements. The SCE is composed of mercury in contact with a saturated solution of calomel (Hg2Cl2). The electrolyte solution is saturated KCI. is +0.242 V relative to the standard hydrogen electrode. Calculate the potential for each of the following galvanic cells containing a saturated calomel electrode and the given half-cell components at standard conditions. In each case. indicate whether the SCE is the cathode or the anode. Standard reduction potentials are found in Table 17.1. a. Cu2++2eCu b. Fe3++e-Fe2+ c. AgCl+e-Ag+Cl- d. Al3++3eAl e. Ni2++2eNi
Calculate the standard potential for the half-reaction BiOCl(s)+2H++3eBi(s)+Cl+H2O given that Ksp for BiOCl has a value of 8.1 10-19.
Galvanic cells harness spontaneous oxidationreduction reactions to produce work by producing a current. They do so by controlling the flow of electrons from the species oxidized to the species reduced. How is a galvanic cell designed? What is in the cathode compartment? The anode compartment? What purpose do electrodes serve? Which way do electrons always flow in the wire connecting the two electrodes in a galvanic cell? Why is it necessary to use a salt bridge or a porous disk in a galvanic cell? Which way do cations flow in the salt bridge? Which way do the anions flow? What is a cell potential and what is a volt?