A beaker has a mass of 225.08g . When a liquid is added to the beaker, the combined mass is 238.254g. What is the mass in grams of the liquid

Q: Consider the first three written formulas, and then use Hess’ law to find the change in enthalpy ,…

A: Hess's law states that when reactants are converted to products,the change of enthalpy is same,…

Q: Determine the cell potential and the equilibrium concentrations of the following concentration cell:…

A:

Q: which tube is hydrogen what was the final ratio and oxygen? of hydrogen to oxygen?

A: A question based on general chemistry that is to be accomplished.

Q: 3. Solutions of aqueous CaCl, and aqueous CuSO, are mixed in a beaker. a) Write the balanced…

A:

Q: How many grams of sodium hydroxide will react with a solution containing 73.00 g HCl? Molar masses…

A: Sodium hydroxide reacts with hydrochloric acid to form sodium chloride and water. The equation for…

Q: A certain solvent with the phase diagram above (axes are not to scale) has a triple point at -97.7…

A:

Q: temperature k 142.0 °C 6.1 x 10¹1 226.0 °C 3.7 x 10¹2 uming the rate constant obeys the Arrhenius…

A: According to the question, we need to determine the value of Activation energy.

Q: In N2O , 28 g N combines with 16  g O. Determine grams of O and N in NO2. Group of answer choices

A:

Q: Assign the absolute configuration of the asymmetric carbon in this structure as R or S. Br OS o…

A:

Q: Calculate the standard cell potential for each of the following reactions. a. 2Ag (aq) + Pb(s)…

A: Given reactions are :  a. 2Ag+ (aq) + Pb (s) ---------> 2Ag (s) + Pb2+ (aq)  b. 2ClO2 (g) + 2I-…

Q: B) Write the most stable enol forms of the following compound, and choose which of them is more…

A: Enolisation occurs via tautomerism (it is a phenomenon in which different structures ahave relative…

Q: te 1. NaH OTS PC1s Me/dietil éter, H₂O

A:

Q: Convert 3027.2ml to ounces

A: Recall that, Volume= 3027.2 ml  convert into ounces

Q: THNMR (ppm): 4.77 (1H, br s); 3.50 (1H, quintet); 1.55 (2H, quintet); 1.40 (1H, m); 1.11 (3H, d);…

A:

Q: Sn (s) + 2CO₂(g) → SnO₂ (s) + 2CO(g) TiCl (g) + 2H₂O(g) TiO₂ (s) + 4HCl(g) AH = -12. kJ J AS = -29.…

A:

Q: Mercuric oxidation in water, followed by NaBH4 reduction results in Markovnikov addition of water.…

A:

Q: A solution of 2.50 g of so What is the molar mass deally (d of H₂O at 25°C g/mol

A:

Q: Worksheet Question ID: W-5033 In an investigation, you construct a galvanic cell and compare your…

A: As per our guidelines we are supposed to answer only 3 sub-parts. Galvanic cell : Galvanic cells…

Q: 2. Circle the compound that matches the given spectrum. For "Excellent", rank from strongest to…

A: Presence of one chlorine atom gives M and M+2 peaks with 3:1 intensity ratio

Q: Suppose you have cooled 2 moles of an ideal monatomic gas from 400K to 300K whereby the gas lifted…

A:

Q: 1. 3-ethyl-2-methylhexane 2. 3,4-diethyldecane-1-ol 3. 2-methoxypropane 4. N-methyl-2-propanamine 5.…

A: Given compounds: 2. 3,4-diethyldecane-1-ol 3. 2-methoxypropane 4. N-methyl-2-propanamine 5. Octanal…

Q: How many chirality centers does the following molecule have? How many stereoisomers of the molecule…

A:

Q: R OH 1. NaH MOTS PCI; Mg/dietil éter, H,O

A:

Q: Q10. A runner runs 4875 ft in 6.85 minutes. What is the runner's average speed in miles per hour?…

A: 10) Given, Distance a runner runs = 4875 ft  Time taken = 6.85 min Runners average speed = ? mi/hr…

Q: Q3-A 1000 Liter of UST containing carbon tetrachloride, which has a water solubility of 911 mg/L and…

A: Given : Volume of UST containing CCl4 =1000 L Water solubility of UST containing CCl4 =  911 mg/L…

Q: Chemistry How do I know what Cyanide means?? QUESTION Write the formula for the compound magnesium…

A: A question based on general chemistry that is to be accomplished.

Q: A solution contains 10.0 g of carbon tetrachloride, CCl4, and 20.0 g of benzene, C6H6. Calculate the…

A:

Q: What is the evidence that a chemical reaction took place?

A:

Q: A 1.000 g sample of a mixture of K2CO3 and KHCO3 yielded 0.4000 g of Carbon dioxide (CO2) upon…

A:

Q: 13. Determine the shape of the following molecules and identify what intermolecular forces exist in…

A:

Q: Q/if the rotation constant of the CO₂ moiety is (B-04 emily, then the wave number Af |=AF(5)v) to…

A:

Q: Design a buffer that has a pH of 3.76 using one of the weak acid/conjugate base systems shown below.…

A: Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: H H Br Br Br Acetona/agua Reflujo Acetona/agua Reflujo MeOH Reflujo + NHƠN + NHƠN + MeONa + CH₂SNa…

A: These reactions are based on elimination and Substitution   Mechanism depending  upon the reagent…

Q: O Which is the most stable chair conformer of the following compound? EM NH NH NH₂ D. A. B. A D B C.

A: -> chair conformer must have same molecular formula to given compound . -> conformer is most…

Q: Please assist me with homework question 5. Thanks in advance

A: Ideal gas equation, pv=nRT dv= (dv/dp)t + (dv/dt)p

Q: What is the evidence that a chemical reaction took place?

A:

Q: What is the pH at the equivalence point in the titration of a 20.4 mL sample of a 0.444 M aqueous…

A:

Q: a. At equilibrium the concentrations of the ionized substances are: [C6H5NH₂] = 0.0537 mol/L…

A: Given , [C6H5NH2]=0.0537molL[C6H5NH3+]=4.79×10-6molL[OH-]=4.79×10-6molL

Q: Exothermic reactions are favored by high temperatures. True O False

A:

Q: 9. Determine if a precipitate forms when 800.0 mL of 2.00 x 10' M BINO) is added to 200.0 mL of 5.00…

A:

Q: Show the mechanism of conversion of benzene to o-dimethoxybenzene

A: Here we are required to find the mechanism for the conversion of benzene to o dimethyoxybenzene

Q: Be sure to answer all parts. Ethylene glycol (EG), CH₂(OH)CH₂(OH), is a common automobile…

A:

Q: 3. Solutions of aqueous CaCl, and aqueous CuSO, are mixed in a beaker. a) Write the balanced…

A: Given: Solutions of aqueous CaCl2 and aqueous CuSO4 are mixed in a beaker. We have to write the…

Q: Given the following information: hydrofluoric acid triethylamine HF (C₂H5)3N Ka = 7.2E-4 Kb = 5.2E-4…

A:

Q: QUESTION 3 33.64 grams of ammonium chloride ( NH4Cl ) is dissolved in 100.0 grams of water . For…

A: Here we are required to find the boiling point of solution

Q: How could you use chemical shift and integration data to distinguish between each pair of compounds,…

A:

Q: Draw the lewis structure for Na2Cl2??

A:

Q: analyze the following reaction by looking at the electron configurations given below each box. Put a…

A:

Q: How many grams of solid sodium nitrite should be added to 2.00 L of 0.117 M nitrous acid solution to…

A: Here we are required to find the mass of sodium nitrite needed to prepare buffer of pH =4.25

Q: 0 0 0 Oc D Indicate the line-angle structure that corresponds to the condensed structure,…

A: Line angle formula is also called skeletal structure in which carbon atom are implied at corners and…

Mole Concept

Mole concept is a method to determine the amount of any substance that consists of some elemental particles using a grouping unit called ‘mole’. The mole concept enables one to handle the large amount of small elementary particles. The mole concept can be used in many calculations related to mole calculation, molar amount, mole ratio, and so on, which are significant in chemistry.