B. A sample of penguinium (m=24.5 grams) is exposed to 133 joules and its temperature rises from 12C to 355 C. What is its specific heat capacity? 9. A 84.5 gram sample of speedskatium (c=0.266 J/g C) is heated with 499 Joules. If its starting temperature is 21°C, what will its final temperature be? T-43.2 C 10. How many grams of water (c=4.18 J/g C) can be taken from 4°C to 97°C it 2193 Joules are used? 11. A 33.54 gram steel nail (c=0.41 J/g"C) is heated until it glows. It is then dropped into a cup with 103 grams of water (c=4.18 J/g "C) at a temperature of 5.9"C. If the water and steel reach an equilibrium temperature of 72.5 C, what was the hot temperature of the steel?

B. A sample of penguinium (m=24.5 grams) is exposed to 133 joules and its temperature rises from 12C to 355 C. What is its specific heat capacity? 9. A 84.5 gram sample of speedskatium (c=0.266 J/g C) is heated with 499 Joules. If its starting temperature is 21°C, what will its final temperature be? T-43.2 C 10. How many grams of water (c=4.18 J/g C) can be taken from 4°C to 97°C it 2193 Joules are used? 11. A 33.54 gram steel nail (c=0.41 J/g"C) is heated until it glows. It is then dropped into a cup with 103 grams of water (c=4.18 J/g "C) at a temperature of 5.9"C. If the water and steel reach an equilibrium temperature of 72.5 C, what was the hot temperature of the steel?

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter6: Thermochemistry

Section: Chapter Questions

Problem 143IP: A cubic piece of uranium metal (specific heat capacity = 0.117 J/C g) at 200.0C is dropped into...

See similar textbooks

Similar questions

A sample of ethanol, C2H5OH, weighing 2.84 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 33.73C. If the heat capacity of the calorimeter and contents was 9.63 kJ/C, what is the value of q for burning 1.00 mol of ethanol at constant volume and 25.00C? The reaction is C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) Is q equal to U or H?
9.86 You make some iced tea by dropping 134 g of ice into 500.0 mL of warm tea in an insulated pitcher. If the tea is initially at 20.0°C and the ice cubes are initially at 0.0°C, how many grams of ice will still be present when the contents of the pitcher reach a final temperature? The tea is mostly water, so assume that it has the same density (1.0 g/mL), molar mass, heat capacity (75.3 J K-1 mol-1), and heat of fusion (6.0 kJ/mol) as pure water. The heat capacity of ice is 37.7 J K-l mol-l.
Strontium metal is responsible for the red color in fireworks. Fireworks manufacturers use strontium carbonate, which can be produced by combining strontium metal, graphite (C), and oxygen gas. The formation of one mole of SrCO3 releases 1.220103 kJ of energy. (a) Write a balanced thermochemical equation for the reaction. (b) What is H when 10.00 L of oxygen at 25C and 1.00 atm are used by the reaction?
A 500-g sample of one of the substances listed in Table 7-1 was heated from 25.2C to 55.1C, requiring 133 J to do so. Which substance was it?
How many milliliters of water at 23 C with a density of 1.00 g/mL must be mixed with 180 mL (about 6 oz) of coffee at 95 C so that the resulting combination will have a temperature of 60 C? Assume that coffee and water have the same density and the same specific heat.
A sample of benzene, C6H6, weighing 3.51 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 37.18C. If the heat capacity of the calorimeter and contents was 12.05 kJ/C, what is the value of q for burning 1.00 mol of benzene at constant volume and 25.00C? The reaction is C6H6(l)+152O2(g)6CO2(g)+3H2O(l) Is q equal to U or H?
Hydrogen peroxide, H2O2, is a colorless liquid whose solutions are used as a bleach and an antiseptic. H2O2 can be prepared in a process whose overall change is H2(g)+O2(g)H2O2(l) Calculate the enthalpy change using the following data: H2O2(l)H2O(l)+12O2(g);H=98.0kJ2H2(g)+O2(g)2H2O(l);H=571.6kJ
Given the following data P4(s)+6Cl2(g)4PCl3(g)H=1225.6KJP4(s)+5O2(g)P4O10(s)H=2967.3KJPCI3(g)+Cl2(g)PCl5(g)H=84.2KJPCl3(g)+12O2(g)Cl3PO(g)H=285.7KJ calculate H for the reaction P4O10(s)+6PCl5(g)10Cl3PO(g)
A cubic piece of uranium metal (specific heat capacity = 0.117 J/C g) at 200.0C is dropped into 1.00 L deuterium oxide ("heavy water;" specific heat capacity = 4.21 I J/C g) at 25.5C. The final temperature of the uranium and deuterium oxide mixture is 28.5C. Given the densities of uranium (19.05 g/cm3) and deuterium oxide (1.11 g/mL). what is the edge length of the cube of uranium?
Microwave ovens convert radiation to energy. A microwave oven uses radiation with a wavelength of 12.5 cm. Assuming that all the energy from the radiation is converted to heat without loss, how many moles of photons are required to raise the temperature of a cup of water (350.0 g, specific heat =4.18J/gC) from 23.0C to 99.0C?
Given the following (hypothetical) thermochemical equations: A+B2C;H=447kJA+3D2E;H=484kJ2D+B2F;H=429kJ Calculate H, in kJ, for the equation 4E+5B4C+6F