(Q86) What is the value (in V) ofthe standard cell potential(E°CELL) for the followingreaction that occurs in anelectrochemical cell at 25°C?Fe3+ (aq) + Cu* (aq) ---> Fe2+ (aq)+ Cu2+ (aq)The reduction potentials for thetwo half-reactions involved are:Fe3+ + e- --> Fe2+ (E°RED) = 0.77VCu2+ + e- --> Cu* (E°RED) = 0.16V0.61

Here we are required to find the standard cell potential of the given electrochemical reaction

(Q86) What is the value (in V) of the standard cell potential (E°CELL) for the following reaction that occurs in an electrochemical cell at 25°C? Fe3+ (ag) + Cu* (aq) Fe2+ (aq) --- + Cu2+ (aq) The reduction potentials for the two half-reactions involved are: Fe3+ + e- --> Fe2+ (E°RED) = 0.77 V Cu2+ + e- --> Cu* (E°RED) = 0.16 V

(Q86) What is the value (in V) of the standard cell potential (E°CELL) for the following reaction that occurs in an electrochemical cell at 25°C? Fe3+ (ag) + Cu* (aq) Fe2+ (aq) --- + Cu2+ (aq) The reduction potentials for the two half-reactions involved are: Fe3+ + e- --> Fe2+ (E°RED) = 0.77 V Cu2+ + e- --> Cu* (E°RED) = 0.16 V

Fundamentals Of Analytical Chemistry

9th Edition

ISBN:9781285640686

Author:Skoog

Publisher:Skoog

Chapter21: Potentiometry

Section: Chapter Questions

Problem 21.21QAP

See similar textbooks

Similar questions

The saturated calomel electrode. abbreviated SCE. is often used as a reference electrode in making electrochemica1 measurements. The SCE is composed of mercury in contact with a saturated solution of calomel (Hg2Cl2). The electrolyte solution is saturated KCI. is +0.242 V relative to the standard hydrogen electrode. Calculate the potential for each of the following galvanic cells containing a saturated calomel electrode and the given half-cell components at standard conditions. In each case. indicate whether the SCE is the cathode or the anode. Standard reduction potentials are found in Table 17.1. a. Cu2++2eCu b. Fe3++e-Fe2+ c. AgCl+e-Ag+Cl- d. Al3++3eAl e. Ni2++2eNi
Consider only the species (at standard conditions) Na+, Cl, Ag+, Ag, Zn2+, Zn, Pb in answering the following questions. Give reasons for your answers. (Use data from Table 17-1.) a. Which is the strongest oxidizing agent? b. Which is the strongest reducing agent? c. Which species can be oxidized by SO42 (aq) in acid? d. Which species can be reduced by Al(s)?
What cathode potential (versus SCE) would be required to lower the total Hg(II) concentration of the following solutions to 1.00 10-6 M (assume reaction product in each case is elemental Hg): (a) an aqueous solution of Hg2+? (b) a solution with an equilibrium SCN- concentration of 0.100 M? Hg2+ + 2SCN- Hg(SCN)2(aq) = Kf = 1.8 107 c) a solution with an equilibrium Br- concentration of 0.100 M? HgBr42++ 2e- Hg(l) + 4Br- E0= 0.223 V
Calculate the standard potential for the half-reaction BiOCl(s)+2H++3eBi(s)+Cl+H2O given that Ksp for BiOCl has a value of 8.1 10-19.
Consider a voltaic cell in which the following reaction occurs. Zn(s)+Sn2+(aq)Zn2+(aq)+Sn(s) (a) Calculate E° for the cell. (b) When the cell operates, what happens to the concentration of Zn2+? The concentration of Sn2+? (c) When the cell voltage drops to zero, what is the ratio of the concentration of Zn2+ to that of Sn2+? (d) If the concentration of both cations is 1.0 M originally, what are the concentrations when the voltage drops to zero?
What is wrong with the following statement: The best concentration cell will consist of the substance having the most positive standard reduction potential. What drives a concentration cell to produce a large voltage?
The measurement of pH using a glass electrode obeys the Nernst equation. The typical response of a pH meter at 25 00C is given by the equation where contains the potential of the reference electrode and all other potentials that arise in the cell that are not related to the hydrogen ion concentration. Assume that = 0.250 V and that a. What is the uncertainty in the values of pH and [H+] if the uncertainty in the measured potential is 1 m V ( 0.001 V)? b. To what precision must the potential be measured for the uncertainty in pH to be 0.02 pH unit?
The cell Ag|AgCl(sat’d)||H+(a = x)|glass electrode has a potential of —0.2094 V when the solution in the right-hand compartment is a buffer of pH 4.006. The following potentials are obtained when the buffer is replaced with unknowns: (a) —0.2806 V and (b) —0.2132 V. Calculate the pH and the hydrogen ion activity of each unknown. (c) Assuming anuncertainty of 0.001 Vin the junction potential, what is the range of hydrogen ion activities withinwhich the true value might be expected to lie?
Consider a concentration cell that has both electrodes made of some metal M. Solution A in one compartment of the cell contains 1.0 M M2+. Solution B in the other cell compartment has a volume of 1.00 L. At the beginning of the experiment 0.0100 mole of M(NO3)2 and 0.0100 mole of Na2SO4 are dissolved in solution B (ignore volume changes), where the reaction M2+(aq)+SO42(aq)MSO4(s) occurs. For this reaction equilibrium is rapidly established, whereupon the cell potential is found to be 0.44 V at 25C. Assume that the process M2++2eM has a standard reduction potential of 0.31 V and that no other redox process occurs in the cell. Calculate the value of Ksp for MSO4(s) at 25C.