When 4.04 g of solid NH4NO3 dissolves in 50.0 g of water at 26.0°C in a calorimeter, the temperature decreases to 20.3°C. The value of q for this reaction is 1.29 kJ. Calculate the enthalpy of solution (ΔH for the dissolution) in kilojoules per mole of NH4NO3 under the given conditions.

When 4.04 g of solid NH4NO3 dissolves in 50.0 g of water at 26.0°C in a calorimeter, the temperature decreases to 20.3°C. The value of q for this reaction is 1.29 kJ. Calculate the enthalpy of solution (ΔH for the dissolution) in kilojoules per mole of NH4NO3 under the given conditions.

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter4: Energy And Chemical Reactions

Section: Chapter Questions

Problem 64QRT

See similar textbooks

Related questions

Q: Consider the following reaction: 2 Mg + O2 2 MgO, Hrxn = -1,203 kJ.Calculate the amount of heat…

A: The given balanced chemical reaction is as follows:

Q: The standard enthalpy change for the following reaction is 986 kJ at 298 K. Ca(OH)2(9) → Ca(s) +…

A: The given reaction is Ca(OH)2 -------> Ca(s) + O2(g) + H2(g) Delta H = 986 kl/mol

Q: 1. Describe enthalpy with respect to free energy change.

A: “Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: In the late eighteenth century Priestley prepared ammonia by reacting HNO3(g) with hydrogen gas. The…

A: A reaction can be categorized as an endothermic or exothermic reaction. If the energy is released…

Q: 10. Explain enthalpy, entropy, and internal energy.

A: Enthalpy:-Enthalpy is the measurement of energy in a thermodynamic system. The quantity of enthalpy…

Q: Given the thermochemical expression below: CaO (s) + 3C (s) ----> CaC2 (s) + CO (g)…

Q: A 5.00 grams of LiOH is dissolved in 100.0 grams of water in a perfect calorimeter. Calculate the…

A: Given data, Mass of LiOH = 5.00 g Mass of water = 100.0 g LiOH(s) --> Li+(aq) + OH-(aq) , ∆H…

Q: If 117.4 g of copper at 100.0 ℃ is added to 26.7 grams of water at 25.7 ℃, what is the final…

A: Given , 117.4 g of copper at 100.0 ℃ is added to 26.7 grams of water at 25.7 ℃

Q: The white pigment TiO2 is prepared by the reaction of titanium tetrachloride, TiCl4, with water…

Q: When a 2.00 g2.00 g sample of RbBrRbBr is dissolved in water in a calorimeter that has a total heat…

A: Given, Mass of sample RbBr = 2.00gram Total heat capacity = 0.779 KJ-1K-1 Temperature is decreased…

Q: 31. Without doing any calculations, determine the sign of ASy, for each chemical reaction. a. 2…

Q: Predict the sign of the enthalpy change for the following processes. Give a reason for your…

A: Hello. Since the question contains multiple subparts, the first three parts are solved. In case the…

Q: The same quantity of energy is added to 25.0 g pieces of gold ( molar heat capacity y = 25.41 J/ mol…

A: Given data,Mass of Au=Mg=Pt=25.0gCAu=25.41J/moloCCMg=24.79J/moloCCPt=25.95J/moloC

Q: 3.88 g of solid ammonium nitrate dissolves in 60.0 g of distilled water in a coffee-cup calorimeter.…

A: Given that: Mass of ammonium nitrate given = 3.88g Mass of water = 60.0grams Initial temperature of…

Q: If 240 kJ of heat is required at constant pressure to decompose 2.0 mol of a substances to form its…

A: Standard Enthalpy of formation(∆Hfº): The standard enthalpy of formation is defined as the energy…

Q: Given that at 298.15K the standard enthalpies of formation (AH,) of nitric oxide is 90.25 kJ and…

A: Since you have posted multiple questions. I will answer only first question as per our guideline.…

Q: When 5.40 g of a solid mixture composed of NH4Cl and CaCl2 was dissolved in 100.0 mL of water, the…

A: Given Mass of NH4Cl = 1.78 g Mass of CaCl2 = 3.26 g

Q: When a 4.00 g sample of KBr is dissolved in water in a calorimeter that has a total heat capacity of…

A: Given,4.00 g sample of KBrTotal heat capacity of 3.04 kJ K-1.The temperature decreased by 0.220…

Q: The ΔrH for the oxidation of solid sulfur to SO3 is -396 kJmol−1 and for the oxidation of SO2 to…

A: To solve this problem we will use the given enthalpy of formation to calculate the enthalpy of…

Q: Using enthalpies of formation (See the Supplemental Data), calculate ΔH° (in kJ) for the following…

Q: When 4.51 g of a solid mixture composed of NH¼CI and CaCI2 was dissolved in 100.0 mL of water, the…

Q: Use Hess’s Law to determineDH for the reaction CO(g) + ½ O2 (g) ® CO2(g), given that…

A: According to the Hess's law the change in enthalpy of a reaction is equal whether it happens in a…

Q: The standard enthalpy changes for the formation of aluminum oxide and iron (III) oxide are: 3 2 Al…

A: Given equations are : 1). 2Al (s) + 32 O2 (g) ---------> Al2O3 (s) , ΔH01 = -1676 KJ 2). 2Fe (s)…

Q: A calorimeter contains 20.0 mL of water at 14.5 ∘C . When 1.20 g of X (a substance with a molar mass…

A: From the given information, we can calculate the mass of water (solvent) and the mass of the…

Q: When 5.03 of solid potassium hydroxide are dissolved in 100.0 mL of distilled water in a coffee-cup…

Q: Explain how is enthalpy related to spontaneity of a reaction?

A: The Gibbs free energy is related with enthalpy and entropy. It is shown by the formula given below.

Q: The thermochemical reaction equation for photosynthesis is as follow: 6H2O (l) + 6CO2 (g) → C6H12O6…

A: Solution: The endothermic reaction shows the energy absorbed during the chemical reaction while…

Q: Magnesium reacts with hydrochloric acid to produce hydrogen gas. ΔH°f for HCl(aq) = –167.16 kJ/mol…

A: Given: ∆Hf° HCl(aq) = -167.16 kJ/mol ∆Hf° MgCl2= - 801.17 kJ/mol

Q: Provide the definition of the second law of thermodynamics. How does the second law explain why heat…

Q: Given the following data Calculate ΔH for reaction On the basis of the enthalpy change, is this…

A: Answer is explained below.

Q: Using the reactions below, determine the enthalpy of the following reaction 1 g S8(s) + 02(g) →…

A: Enthalpy of a chemical reaction can be calculated from the heat of the given reactions.

Q: The value of the enthalpy of the reaction for a reaction is equal to 200 KJ / mol at 25 °C, then the…

A: Enthalpy of the reaction at 25oC = 200 KJ/ mol…

Q: 0.700 moles of an unknown solid is placed into water to make 150.0 mL of solution. The solution's…

Q: Given the following thermochemical equations, calculate ΔH for the decomposition of one mole of…

A: The compound given is C2H2 (g). The elements present in the compound are C i.e carbon and H i.e…

Q: Using the equations 2 Fe (s) + 3 Cl, (g) → 2 FeCl, (s) AH° = -800.0 kJ/mol Si(s) + 2 CI, (g) → SICI,…

Q: Which of the following statements define the third law of thermodynamics? O Process that requires…

A: The statement which defines the third law of thermodynamics is to be explained. Third law of…

Q: Given the thermochemical formation reactions: 1/2 Br2(l) + F2(g) → BrF(g) ∆H˚ = -58. kJ and…

A: 1/2 Br2(l) + 1/2F2(g) → BrF(g) ∆H1˚ = -58. kJ ............................(1) 1/2…

Q: Using the equations Ca (s) + ½ O2 (g) → CaO (s) AH° = -635 kJ/mol CaO (s) + H2O (1) → Ca(OH)2 (s)…

A: Let Ca (s) + 1/2 O2 (g) → CaO (s) ΔHo = -635 kJ/mol this be equation 1CaO (s) + H2O (l) → Ca(OH)2…

Q: When a 7.00 g sample of KCl is dissolved in water in a calorimeter that has a total heat capacity of…

Q: When 4.20 g of solid NH4NO3 dissolves in 50.0 g of water at 26.8°C in a calorimeter, the temperature…

A: The heat of a substance is given as:

Q: When 1 mol of a fuel is burned at constant pressure, it produces 3455 kJ of heat and does 12 kJ of…

A: Delta E = q + w where Delta E = change in internal energy q = heat , w = workdone

Q: The standard enthalpy change for the following reaction is -92.2 kJ at 298 K. N2(g) + 3 H2(g)→2…

A: standard enthalpy change for the reaction is given as, ΔHrxn = -92.2 KJ Since the enthalpy change…

Q: Consider the two reactions. 2 NH, (g) + 3 N,O(g) → 4 N,(g) + 3 H,O(1) 4 NH, (g) + 3 0,(g) 2 N, (g) +…

Q: (a) Magnesium reacts with hydrochloric acid to produce hydrogen gas. AH°, for HCI(aq) = -167.16…

A: Enthalpy change of the reaction is given as follows. ∆H = ∆H(products) - ∆H(Reactants). As per our…

Q: The specific heat capacity of copper is 0.384 J/g⋅°C. What is the molar specific heat capacity of…

Q: Consider the following reaction: N2(g) + 3H2(g) - 2NH3(g); AH° = - 91.8 kJ The density of ammonia at…

A: Calculate the mass of nitrogen gas. Mass of nitrogen gas = Volume of nitrogen gas × Density of…

Q: When 5.28 g of a solid mixture composed of NH4Cl and CaCl2 was dissolved in 100.0 mL of water, the…

Q: When a 6.50 g sample of solid sodium hydroxide dissolves in 100.0g of water in a coffee-cup…

Q: Mg(s) + 2 H2O(l) ⟶ Mg(OH)2(s) + 2H2(g) | ∆Hrxn = —353.0 kJ/mol Calculate the number of grams of Mg…

A: Mg(s) + 2 H2O(l) ⟶ Mg(OH)2(s) + 2H2(g) | ∆Hrxn = —353.0 kJ/mol 99 mL of water temperature change =…

Question

When 4.04 g of solid NH₄NO₃ dissolves in 50.0 g of water at 26.0°C in a calorimeter, the temperature decreases to 20.3°C. The value of q for this reaction is 1.29 kJ. Calculate the enthalpy of solution (ΔH for the dissolution) in kilojoules per mole of NH₄NO₃ under the given conditions.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 3 steps

SEE SOLUTION Check out a sample Q&A here

Similar questions

Using the data in Appendix G, calculate the standard enthalpy change for each of the following reactions: (a) Si(s)+2F2(g)SiF4(g) (b) 2C(s)+2H2(g)+O2(g)CH3CO2H(l) (c) CH4(g)+N2(g)HCN(g)+NH3(g) ; (d) CS2(g)+3Cl2(g)CCl4(g)+S2Cl2(g)
From the data given in Appendix I, determine the standard enthalpy change and the standard free energy change for each of the following reactions: (a) BF3(g)+3H2O(l)B(OH)3(s)+3HF(g) (b) BCl3(g)+3H2O(l)B(OH)3+3HCl(g) (c) B2H6(g)+6H2O(l)2B(OH)3(s)+6H2(g)
The thermochemical equation for the burning of methane, the main component of natural gas, is CH4(g)+2O2(g)CO2(g)+2H2O(l)H=890kJ (a) Is this reaction endothermic or exothermic? (b) What quantities of reactants and products are assumed if H = 890 kJ? (c) What is the enthalpy change when 1.00 g methane burns in an excess of oxygen?
Consider the Haber process: N2(g)+3H2(g)2NH3(g);H=91.8kJ The density of ammonia at 25C and 1.00 atm is 0.696 g/L. The density of nitrogen, N2, is 1.145 g/L, and the molar heat capacity is 29.12 J/(mol C). (a) How much heat is evolved in the production of 1.00 L of ammonia at 25C and 1.00 atm? (b) What percentage of this heat is required to heat the nitrogen required for this reaction (0.500 L) from 25C to 400C, the temperature at which the Haber process is run?
At 298 K, the standard enthalpies of formation for C2H2(g) and C6H6(l) are 227 kJ/mol and 49 kJ/mol, respectively. a. Calculate H for C6H6(l)3C2H2(g) b. Both acetylene (C2H2) and benzene (C6H6) can be used as fuels. Which compound would liberate more energy per gram when combusted in air?
The enthalpy change for the following reaction is 393.5 kJ. C(s,graphite)+O2(g)CO2(g) (a) Is energy released from or absorbed by the system in this reaction? (b) What quantities of reactants and products are assumed? (c) Predict the enthalpy change observed when 3.00 g carbon burns in an excess of oxygen.
Given: 2Cu2O(s) + O2(g) 4CuO(s)H = 288 kJ Cu2O(s) CuO(s) + CuO(s)H = 11kJ Calculate the standard enthalpy of formation (Ht) for CuO(s).
For the reaction HgO(s)Hg(l)+12O2(g),H=+90.7kJ: a.What quantity of heat is required to produce 1 mole of mercury by this reaction? b.What quantity of heat is required to produce 1 mole of oxygen gas by this reaction? c.What quantity of heat would be released in the following reaction as written? 2Hg(l) + O2(g) 2HgO(s)