Write a chemical equation for the reaction where potassium soap is converted into sodium soap

Q: How many grams of sodium acetate (salt) and acetic acid (acid) would be required to prepare 1 L of…

A: Here we are required to find the mass of sodium  acetate and acetic acid required to form buffer…

Q: Convert 0.0083 mile to cm

A:

Q: (i) Some chemical information about compound X is given below. X is a neutral organic compound. X…

A: The given information is-  X is an neutral molecule.  X has no effect of tollen's reagent.  X turns…

Q: 6. What is the solubility of Pbl, in 0.0426 M Pb(NO3)2 solution? Ksp = 7.9x10-⁹

A:

Q: Arsenic acid is a triprotic acid with the pKa values pK₁1 = 2.240, pKa2 = 6.960, and pK₁3 = 11.500.…

A: Here we have to determine the mass of NaH2AsO4 and NaH2AsO4 required to prepare 1L of buffer…

Q: When 66.8 grams of a solute (molar mass = 56.8 g mol–1) was dissolved in 375.4 grams of water, the…

A: Given data  T0 = boiling point of solvent(water) = 100.0 °C  Tb = boiling point of solution = 105.1…

Q: Many reactions that are thermodynamically possible do not occur at an appreciable rate because of…

A: Many reaction are not possible to occur because the reactant molecule not have sufficient energy to…

Q: A solution contains 14.6 g of the substance bolognium and 14.6 g of caterium. Assuming ideal…

A:

Q: What is the molecular shape of SrBr2? Why? What is the lewis structure of SrBr2 Is it polar or non…

A: Covalent bond:  It is formed due to sharing of electrons , in general in between to nonmetals…

Q: 3. Alcohol Starting Materials 1. methanol 2. ethanol 3. 1-propanol 4. 2-propanol 5. cyclohexanol a.…

A:

Q: There are three fundamental rules that we use in writing electronic configurations for atoms and…

A: This is the violation of Pauli's Exclusion Principle.

Q: A voltaic cell utilizes the following reaction: 4Fe²+ (aq) + O₂(g) + 4H+ (aq) +4Fe³+ (aq) + 2H₂O(1)…

A: Dear student ,   since you have posted multiple questions we will allow to solve only first question…

Q: 5. In each of the following cases compare the bonds identified in red, and determine which bond you…

A: -> Strength of bond is proportional to bond dissociation energy . ->Bond length is inversely…

Q: I. Consider the voltaic cell. Fe(s) Cr(s) Salt bridge containing KNO3(aq) IM Fe³+ 1M Cr³+ a.…

A: Given diagram is :

Q: For the reaction below, provide the IUPAC name of the product, and answer any additional questions.

A:

Q: Kindly please Write the calculation/solution. Thank you

A: We have given  [Na3PO4] = 0.200 N  Mass of dolomite = 1 g  Percentage of MgCO3 in dolomite = 14.01…

Q: Is interatomic bonding in ceramics always ionic? Or is that false?

A: Ceramics : These are very brittle , corrosion resistant material made from inorganic non metallic…

Q: A sample of xenon gas at a pressure of 0.806 atm and a temperature of 27.7 °C, occupies a volume of…

A:

Q: This is defenityly wrong

A: Using first order kinetics, concentration of CH3NC can be determined after 97.0 s.

Q: Calculate the value of [N 2] eq if [H 2] eq = 2.0 M, [NH 3] eq = 0.5 M, and K c = 2. N 2(g) + 3 H…

A:

Q: QUESTION 3 33.64 grams of ammonium chloride ( NH4Cl ) is dissolved in 100.0 grams of water . For…

A: Here we are required to find the boiling point of solution

Q: Give the order of reactivity of carboxylic acid and its derivatives. What is the significance of…

A: The group like acyl halides, acid anhydrides, esters, and amides are called Carboxylic acid…

Q: 9. A 0.2700 g of impure Na₂CO3 required 24.12 ml Of 0.1684 M HCl and a back titration with 2.96 ml…

A:

Q: Q) Write the structure of the Dieckmann cyclization product formed on treatment of each of the…

A:

Q: Calculate pH of a solution with [H+]=4.7x10-4M. a. 10.67 b. 4.7*10^-4 c. -3.3279 d. 3.33

A:

Q: Quien at noe 2 H₂0₂ (ar) → 2H₂0 (1) + 0₂ (g) Orien Laty [H₂0₂] M 1.22x10-2 8.04 x 10-3 5.30x10-3…

A:

Q: Name the alkene product obtained on dehydration of each of the following alcohols: 1-Butanol…

A:

Q: N 애 웅도

A:

Q: what would be the percent yeild for the reaction?

A:

Q: 1. 3-ethyl-2-methylhexane 2. 3,4-diethyldecane-1-ol 3. 2-methoxypropane 4. N-methyl-2-propanamine 5.…

A: Given compounds: 2. 3,4-diethyldecane-1-ol 3. 2-methoxypropane 4. N-methyl-2-propanamine 5. Octanal…

Q: * Module 3: In his experiment, Mashiho wanted to determine the molar mass of his unknown sample.…

A:

Q: Rank the following compounds toward increasing acidity as shown below CH3NO2 > CH3COCH3 > CH3COOCH3>…

A: Greater the stability of conjugate base higher is the acidicity

Q: The reaction CH3NC → CH3CN has a rate constant of 0.920 s-1 at a specific temperature. What is the…

A:

Q: What is the name of John dalton’s theory

A: The correct answer is given below

Q: Describe the preparation of 100 mL 0.050 M and 100 mL 0.0050 M phosphate buffer (both having pH =…

A: Given: The concentration of the stock phosphate buffer solution (pH 6.5) = 0.50 M The concentration…

Q: How many grams of solid sodium cyanide should be added to 1.00 L of 0.116 M hydrocyanic acid…

A: Given-> Volume of HCN = 1.00 L Molarity of HCN = 0.116 M pH = 9.990  Ka(HCN) = 4.00 × 10-10

Q: 1. Explain why the propane that is used as a fuel in a barbecue is a gas at room temperature,but…

A: It is because the intermolecular forces that is present between 2-propanol  are stronger than…

Q: What is the pH at the equivalence point in the titration of a 20.4 mL sample of a 0.444 M aqueous…

A:

Q: Identify the structure of the important fragments. Show the arrow pushing mechanism to form the…

A: To find: The absorption, appearance, and compound for the IR spectra Statement: The stretching and…

Q: II. Unexposed 4 Months 8 Months 1 Year 2 Years 3 Years 4 Years 5 Years 7 Years 10 Years 15 Years…

A: 1) The given picture above describe the change in colour of a statue with the passes of time.  The…

Q: The reaction below has Kp = 8.90 at 25°C. Br₂(g) + Cl₂(g) = 2 BrCl (g) If a sealed container…

A:

Q: 4. Which of the following would you expect to have the most negative AS? OH OH III IV A I 11 B. C.…

A:

Q: Consider the structure below. (1) Draw its conjugate base. (2) Draw its conjugate acid. H₂N- -OH

A:

Q: Which of these carboxylic acids is the most acidic? CI ОН О CI CI о ОН ОН ОН

A:

Q: a. At equilibrium the concentrations of the ionized substances are: [C6H5NH₂] = 0.0537 mol/L…

A: Given , [C6H5NH2]=0.0537molL[C6H5NH3+]=4.79×10-6molL[OH-]=4.79×10-6molL

Q: In the reaction 3 Ms-¹. i. What is the rate of reaction with respect to B? ii. What is the rate of…

A:

Q: A) Br B) E) Ο.Α.Α O B. B OC. C C) OD.D D) Which structure represents (E)-1-bromo-2-methyl-2-hexene?…

A: E-Alkene: In E configuration the higher priority groups on the two alkenic carbons are on opposite…

Q: a. b. HBr, A Peroxide NBR, A Peroxide

A: In  reaction a)  Alkene is treated with HBr  in presence of peroxide which follows anti markonikov's…

Q: Write the net ionic equation, including phases, that corresponds to the reaction…

A:

Q: Be sure to answer all parts. Which of the following arrangements of elements within the same group…

A: