Compare the ATP yield from the complete oxidation of glucose, a sixcarbon carbohydrate, and hexanoic acid, a six-carbon fatty acid. Hexanoic acid is also called caprioic acid and is responsible for the “aroma” of goats. Why are fats better fuels than carbohydrates?
Q: Which substrate will NOT support synthesis of glucose in the presence of avidin? O Glyceraldehyde…
A: Gluconeogenesis is a ubiquitous process required for generation of glucose from non carbon…
Q: Calculate the ATP yield from complete oxidation of maltose by the reaction of glycolysis, citric…
A: Maltose is a disaccharide made up of two glucose molecules joined by alpha bond. Hydrolysis of…
Q: Fill in the missing numbers to complete the following statement regarding the pentose phosphate…
A: Pentose phosphate pathway: a. Pentose phosphate pathway is an alternative route for the metabolism…
Q: Calculate the energy savings (in ATP molecules per glucose monomer) obtained by phosphorolyzing…
A: Introduction The assault of inorganic phosphate on a substance is known as phosphorolysis. The…
Q: Consider the synthesis of lauric acid (12:0) by the fatty acid synthase. How many total ATPS are…
A: The fatty acid synthesis was initiated by carboxylation of acetyl CoA to malonyl CoA. This reaction…
Q: Provide a table for each question, listing all of the particular individual reactions that will…
A:
Q: Account for the fractions of ATP generated by fatty acid breakdown and the citric acid based on…
A: Lipid metabolism begins in the intestine where ingested triglycerides are broken down into smaller…
Q: describe the key points that change the 6 carbon compound into two molecule of 3 carbon compound.
A: Glycolysis is breakdown of 6 carbon glucose to 3 carbon pyruvate. This process generate energy in…
Q: Which is a metabolic pathway that links the Calvin cycle to lipid biosynthesis? 3PG → sucrose →…
A: Biochemical pathways refer to a series of biochemical reactions catalyzed by enzymes that result in…
Q: Choose A=if statement 1 and statement 2 are both true; B=if statement 1 is true but statement 2 is…
A: Disclaimer: Since you have asked multiple question, we will solve the first question for you. If you…
Q: Consider the energy budget of glycolysis as a whole a) How many ATP's are made total? b) How many…
A: Glycolysis is a set of reactions that takes place in the cytoplasm of prokaryotes and eukaryotes.…
Q: For each 2 carbons present in a fatty acid before beta oxidation how many acetyl-CoA molecules are…
A: Ans- 2
Q: Define the terms lipolysis and β-oxidation and explain, in general terms, how fat can be used for…
A: Fats and oils can be together called as lipids because they contain the fatty acids. These are one…
Q: Calculate the amount of ATP
A: Maltose is a disaccharide molecule formed from two molecule of glucose , those two molecule of…
Q: What percentage of ATP energy is produced when 9.0 moles of glucose react in the citric acid cycle?…
A: * metabolic pathways occur inorder to produce ATP . * The one mole of glucose we take then the…
Q: Calculate the energy savings (in ATP molecules per glucose monomer)achieved by breaking down…
A: Introduction Phosphorolysis is the process in which inorganic phosphate attacks a compound. This…
Q: Which of the following food molecules would generate the most ATP molecules, assuming that…
A: Cellular respiration is the process through which organisms break down glucose, produced as the…
Q: Calculate the energy produced (in ATP molecules) achieved by complete oxidation of the hydrolysis…
A: Glycolysis is an oxidative process that is common in both aerobic and anaerobic cellular…
Q: Which of the following statements is TRUE about fatty acid activation before ß-oxidation? O The…
A: β-oxidation is the process of breakdown of fatty acids, in order to release energy during the…
Q: After glycolysis, the steps of aerobic respiration proceed from to to acetyl-CoA formation the…
A: Aerobic respiration is a series of enzyme-controlled reactions that release the energy stored in…
Q: Define oxidation in carbohydrate metabolism. What are the roles of NAD+ and FAD+ in carbohydrate…
A: Carbohydrate metabolism It is defined as the biochemical processes through which the metabolic…
Q: After visiting a gym, a student had 250-300 g of carbohydrates for lunch and decided to rest. How…
A: Answer : After visiting a gym a student had 250 300 gram of carbohydrate for lunch and decided to…
Q: Explain what happens to glucose during glycolysis and respiration in terms of oxidation and…
A: Anabolism: synthesis of large molecules from smaller units. For example photosynthesis. Anabolic…
Q: upon digestion of starch maltose, one of its degradation products is further hydrolyzed into its…
A: When the process of cellular respiration takes place, then there is the production of three…
Q: Please explain the differences between 100% glucose and 0% glucose for all four processes：…
A: Cellular aerobic respiration is conversion of chemical energy in the form of Glucose into ATP which…
Q: Oxidation of fatty acids results in the production of approximately oxidation of glucose largely…
A: Glucose molecule is the chief monosaccharide that is catabolized. The pathways involved in deriving…
Q: How much fat (in grams) would the body have to burn to produce the daily minimum requirement of 40…
A: Answer :- Option (C) is correct. - approx 22 to 23 kg of fat.
Q: In glycolysis, 1-3-bisphosphoglycerate (1,3-BPG) is catalyzed by the enzyme to form…
A: * Glycolysis is an metabolic pathway consists of sequence of ten reactions which are catalyzed by…
Q: An individual weighing 68 kg jogging at 8 km/h for 30 minutes would burn 1138 kJ. How many moles of…
A: Cellular respiration is the process by which organisms combine oxygen with glucose, diverting the…
Q: Compare the ATP yields from catabolism of a stearic acid with the ATP produced from complete…
A: In the biochemical pathway of the cell, the fuel molecules are catabolized to produce energy in…
Q: Compare the energy yields from the oxidative metabolismof glucose and of stearic acid. To be fair,…
A: In the biological system, the oxidative metabolism of the fuels results in the production of the…
Q: Walking consumes approximately 100 kcal/mi. In the hydrolysis of ATP (ATP → ADP + Pi), the reaction…
A: The energy currency of a living cell is called ATP. It is then hydrolyzed into ADP or AMP. The…
Q: How many moles of ATP can be gained from the catabolism of the following substrates to pyruvate: a.…
A: Glycolysis is the metabolic pathway where the aldohexose was converted into three molecular…
Q: Explain why one more ATP is produced when glucose is obtained from glycogen than when it is directly…
A: Glucose is the most abundant monosaccharide made by plants and most algae during photosynthesis from…
Q: During strenuous exercise, the NADH formed in the glyceraldehyde 3-phosphate dehydrogenase reaction…
A: During strenuous exercise, the glycolysis that continues is known as anaerobic glycolysis and the…
Q: Which of the two set ups shall generate higher amount of energy in terms of net ATP generated? Set…
A: Oxidation of fats Oxidation of fats is a process by which the fats are hydrolysed into small…
Q: c.Acetyl
A: Glycolysis is the common pathway of aerobic as well as anaerobic (Fermentation) breakdown of fat ,…
Q: If the C-1 carbon of glucose is labeled with 14C, which C atom in the pyruvate is the labeled carbon…
A: Glycolysis is a process in which one mole of glucose is partially oxidized into two mole of pyruvate…
Q: Show the amount of ATP were produced in beta-oxidation of lauric acid, and differentiate both the…
A: Lauric acid has a 12-carbon backbone and is a saturated medium-chain fatty acid. Under anaerobic and…
Q: Explain the benefits of having triacylglycerols be the primary form of stored metabolic energy.
A: Triacylglycerols, also known as triglycerides, are the most basic lipids that fatty acids can…
Q: Citric acid (or citrate) is an allosteric inhibitor of one of the first enzymes in glycolysis. How,…
A: The allosteric inhibitor binds with an enzyme that inhibits the attachment of enzymes with the…
Q: Which of these processes is most exergonic? (Think VERY carefully!) Dephosphorylation of…
A: Exergonic reactions are the ones, which release energy to the surroundings. The energy is released…
Q: Write down the beta oxidation pathway of fatty acid metabolism.
A: Beta oxidation is a catabolic process of fatty acid molecules break down to produce energy. The long…
Q: Which of the following statements concerning ATP is true? a. The free energy value for the…
A: Glycolysis is the process of synthesis of pyruvate from the breakdown of glucose. The whole reaction…
Q: In energy production, cells make use of carbohydrates first, lipids second, and proteins (in cases…
A: In process of digestion, complex molecules are converted to simple molecules with the…
Q: If 1 mol of a fatty acyl-CoA containing 15 carbon atoms undergoes only four rounds of b-oxidation,…
A: Beta-oxidation is the catabolic process by which fatty acid molecules are broken down in the cytosol…
Q: One molecule of dietary glucose can be oxidized through glycolysis and the citric acid cycle to…
A: Glycogen is a polymer of glucose that was linked by α1-4 glycosidic bond and α1-6 glycosidic bond.…
Q: Determine the number of carbon atoms present and the the total number of phosphate groups present in…
A: Glycolysis is a major metabolic pathway in the breakdown of carbohydrates such as glucose.…
Compare the ATP yield from the complete oxidation of glucose, a sixcarbon carbohydrate, and hexanoic acid, a six-carbon fatty acid. Hexanoic acid is also called caprioic acid and is responsible for the “aroma” of goats. Why are fats better fuels than carbohydrates?
Trending now
This is a popular solution!
Step by step
Solved in 4 steps
- How much ATP will be produced from the Beta-oxidation of lauric acid a C 12 saturated fatty acid? Calculate the energy yield per gram of lauric acid.Consider fatty acids from the hydrolysis of the given TAG in a liver cell where amino acid and nucleotide biosynthesis is very active For each fatty acid given, determine the following. Gross ATP from b-oxidation cycles Gross ATP from acetyl CoA produced Gross ATP from conversion of propionyl CoA (if applicable) Total number of ATP deducted Total net ATPWhat will be the approximate energy yield through aerobic metabolism, of a 16-carbon fatty acid? Describe each of the major major reactions involved. Identify the important molecules produced by each reaction, and how the total energy yield is determined.
- Calculate the ATP yield from full oxidation of the fatty acids from a triglyceride with 3, 22 carbon fatty acid moleculesCompare the ATP yields from catabolism of a stearic acid with the ATP produced from complete oxidation of three glucose molecules.Complete the table below. Consider docosanoic acid (C21H43CO2H) Questions Show complete solutions Answers a. How many acetyl CoA molecules are formed by complete B-oxidation? b. How many cycles of B-oxidation are needed for complete oxidation? c. How many molecules of ATP are formed from the complete catabolism of this fatty acid?
- Calculate the ATP yield from complete oxidation of maltose by the reaction of glycolysis, citric acid cycle, electron transport chain and oxidative phosphorylation.Myristoleic acid is a monounsaturated fatty acid found in small amounts in a variety of foods. Calculate the net ATP yield from the complete β-oxidation of myristoleic acid. The formula of myristoleic acid is shown below (it is assumed that the total ATP production is the same for both saturated and unsaturated fatty acids having the same carbon chain length). CH3-(CH2)3-CHCH-(CH2)7-COOH (Given: The oxidation of one NADH yields 2.5 ATP; the oxidation of one FADH2 yields 1.5 ATP; and the oxidation of one acetyl CoA yields 10 ATP. ) Group of answer choices a. 96 ATP b. 92 ATP c. 94 ATP d. 34 ATP e. 36 ATPUnder aerobic conditions when glucose is limiting, with high ratios of NADH/NAD+ and ATP/ADP, as carbon-2 radiolabeled pyruvate is utilized for its carbon skeleton, which molecules would you expect to see significant radiolabeling in the liver? Select all that apply. (multiple answers) Glucose C-2 only Label is halved over many TCA cycles Oxaloacetate Glucose C-1 and C-6 Glucose C-2 and C-5 CO2 from TCA cycle shows some radiolabel Lactate C-2 for export Malate Pyruvate C-1
- Compare and contrast the following items related to lipid metabolism. Cite their main similarities/or differences. 1. Steroid hormones vs. prostaglandins (in terms of their biosynthetic pathways). 2. Fatty acid synthase complex vs. pyruvate dehydrogenase complex.Describe the activation of fatty acids. What is the energy cost for the process?Suppose that each fatty acid in a triglyceride can be converted into 8 molecules of acetyl CoA. How many ATP could be generated by breaking down one molecule of this triglyceride? Assume 3 ATP per NADH and 2 ATP per FADH2.