Express the function as a trigonometric function of x. tan 3x Choose the correct answer below. OA. B. 3 tanx-tan ³x 1-3 tan ²x 4 tan x-4 tan ³x tan^x-5tan ²+1 OC. 4tan ³x-3 OD. 2 tan x-tan ²x tan 4x-3 tan ²+1

Q: Find exact values for the following. cos(105°) =

A: Given: cos105° We can write, cos105°=cos45°+60° Now by using the identity, cosx+y=cosx cosy-sinx…

Q: Vector v is shown in the graph. a b C -1 d 24 Which are the magnitude and direction of v? Round the…

A: In diagram, given that the vector passing through the point (2,3) and (-1,-4) To determine magnitude…

Q: Given that 0 ≤ B < 2, find all the solutions to the equation 8sin²ß = -6sin ß + 5. Provide your…

A: 0 ≤ ẞ&lt; 2л, and equation is 8sin²ß = -6sin ẞ +5 Find the solution of equation

Q: Just computed. Find the direction angle of the vector v = (-18, 14). Then, draw a picture to…

A: v=&lt;-18,14&gt; u=&lt;9,2&gt;

Q: If -π ≤ 0 < π, find all values of that satisfy the equation 3 tan²0 = 3 tan 0. Select the correct…

A:

Q: Find the exact value of each of the following under the given conditions. a. cos (α + B) b. sin (a +…

A:

Q: Determine the exact value of 0 in the following equation if 0 ≤ 0 < 2T. -12 sin² 0 + 11 = 2 Select…

A:

Q: s=-5 and sint=5s and t in quadrant II your answer, including any radicals. Use integers or fractions…

A: We are given with cost and sint

Q: Solve the 0 < 0 < 2π. following equation for 0, where 1+tan²0 sec³(-0) 1 2

A:

Q: Write the function value in terms of the cofunction of a complementary angle. cos 50° cos 50° = (°)…

A:

Q: Spring Break is approaching and in class. You Scored. on You have noticed scorce 9.5 that decrcausar…

A:

Q: Let tan A sec(2A) = = 3 4 with A in QII and find

A:

Q: Rewrite cos (-) in terms of sin(x) and cos(x).

A: (i)  let G=cos(x-π3)formula used cos(A-B)=cosAcosB+sinAsinB

Q: Verify the identity. cos ² t 2 sin t Which of the following four statements establishes the…

A:

Q: 1. Which of the following statements best describes the figure in the image below?

A: An arc whose measure is less than 180 degrees is called a minor arc. An arc whose measure is greater…

Q: A small office purchases bottled drinking water. The water comes in containers that hold 7 gallons.…

A: Given A small office purchases bottled drinking water. The water comes in containers that hold 7…

Q: Verify the identity Sin t + sin 3t + sin 5t + sin7t = 4 cos t cos2t sin 4t

A:

Q: cos (15°) 2 Use the Pythagorean identity to compute sin(15°). = compute all of the other trig…

A:

Q: A vector has magnitude 60 and direction angle 143.75°. Find the components of the vector, and then…

A:

Q: Use a double-angle formula to find the exact value of the given expression. 2 cos²15⁰-1 2 cos…

A: let B=2cos215°-1

Q: HGE ft

A:

Q: Verify the identity. cscx- cScx cos x = sin x To verify the identity, start with the more…

A: Given trigonometric equation cscx - cscxcos2x = sinx Formula used sin2x + cos2x = 1 sinx = 1cscx

Q: Find the magnitude of (-6, 11). Then, draw a picture to illustrate what you have just computed.

A: v = -6, 11

Q: The figure shows an angle 0 in standard position with its terminal side intersecting the unit…

A: Solving the following problem

Q: Simplify sec(x)/csc(x) + csc(x)/sec(x): Step 1. Use sin and cos and simplify the compound fractions:…

A:

Q: Suppose that you are headed toward a plateau 40 m high. If the angle of elevation to the top of the…

A:

Q: 3. in IF each long side of the original triangle was 5 m long, how long are the other two sides?. If…

A: given triangle is a special triangle .   the length of other two sides are  32h and h2  where h is a…

Q: Prove the half-angle identity sin A/2 = +√((1 - cos A)/2) Square both sides: Multiply both sides by…

A: Cos(2x)=Cos2(x)–Sin2(x). 1–Cos2(x)=Sin2(x).

Q: You are given that tan(A) = and tan(B) = 7. Find tan(A - B). Give your answer as a fraction.

A: Tan( A - B ) = tanA - tanB1 + tanAtanBGiven tanA =112tanB = 7

Q: A helicopter hovers 950 feet above a small island. The figure shows that the angle of depression…

A: We need to find out the distance between the coast to the island and from the figure, we can say we…

Q: Fill in the blanks: 1. If tan x = -1 then tan(-x) 2. If sin x = 0.6 then sin(-x) = -.6 = 4. If tan x…

A: Solution given below

Q: 12. What is the measure of angle J in the triangle below? Drawing is not to s 17 097° 083° 0 35⁰ 0…

A:

Q: Write as a sum or difference of trigonometric functions: 6 cos 3x cos 2x =

A: formula used is 2cos(a)cos(b)=cos(a+b)+cos(a-b)

Q: You leave your house and run 7 miles due west followed by 5.5 miles due north. At that time, what is…

A:

Q: Given that - ≤ß<, which of the following gives all solutions to the equation Select the correct…

A: Formula used 1 + tan2β = sec2βsec2β - 1 = tan2βtan( -β ) = -tanβGiven sec2β - 1tan( -β ) = 1

Q: An analysis of first-year students at a college revealed that 1/4 of the first-year women were from…

A:

Q: (а) AQ бст 12 ст B

A: By using the Pythagorean Theorem to find the length of the third side in the  following triangle.…

Q: 10. Find the primary trigonometric (sin X, cos X & tan X) and the reciprocal trigonometric (sec Z,…

A:

Q: 5. Which of the following is a major arc in the figure shown below? Select that apply. K 53° N 52°…

A:

Q: 12. Use the appropriate reciprocal identity to find the exact value of a. tan 0, given cot 0 = - 1.6…

A: a) Cot θ = - 1.6 Find the value of tan θ.  b) Cos θ =6/7 Find the value of sec θ.

Q: Find exact values for the following. cos(165°) =

A:

Q: 11 sin 5 sin cos 10 Find the values of 0 in the interval 0° < 0 < 360° for which 2 sin 20 = √3 sin…

A: 2sin2θ=3sin2θcos2θ

Q: 10. Find the exact value of each of the remaining trig functions of 0. 8 sin 0: = given that 0 is in…

A:

Q: Given: sec 2θ = √10 and 2θ in quadrant IV. Find: cos 4θ.

A:

Q: Use the power-reducing formulas to rewrite the expression as an equivalent expression that does not…

A: 8 sin2x cos2x

Q: An object is attached to a coiled spring. The object begins at its rest position at t = 0 seconds.…

A: The general form of equation that models a wave equation is: ±A (sin/cos )(2π (t-p) / T)where:A =…

Q: Complete the table with exact trigonometric function values. Do not use a calculator. 0 tan 0 210° 0…

A:

Q: Solve the right triangle using the given information. a = 78.7 yd, b = 40.1 yd ..... C= C B = yd…

A:

Q: 4. Jason is 4.0 km from the launch pad of the space shuttle when the shuttle lifts off. Jason looks…

A: Here we are given that the distance from the launch pad of the space shuttle to Jason is 4 km. The…

Q: valuate tan(Arccos 12/13

A: