Find the exact value of cos 240' using the compound angle formula. 1 ,and A is in the fourth quadrant. Without using calculator, 3 Given that sin A A determine cos

Q: 4. Apply half-angle formula to find a. cos 15° b. sin 15° C. COS

A: Given: cos15∘, sin15∘, cos5π8 We know that cos2x=cos2x-sin2x…

Q: Find the exact value of cos θ​, given that sin θ=12/13 and θ, is in quadrant II. Rationalize…

A: In quadrant II, cos θ is negative.

Q: θ

A: Please refer to the image below

Q: If cos a = 0.154 and sin B = 0.273 with both angles' terminal rays in Quadrant-I, find the values of…

A:

Q: Find the exact value of the expression arccos[cos(−3π/2)] , if possible.

A: Given: arccos[cos(−3π/2)]

Q: find the exact value of cos (a+b), if a,b in Quadrant IV with sin a= -3/5 and cos b= 5/13

A:

Q: Find the exact value of the expressions cos(a + B), sin(a + B) and tan(a + B) under the following…

A: Use quadrant to solve

Q: Suppose that 2 is an angle in quadrant 1 and that cos a = 41 Compute the exact value of cos (G). 841…

A: Given cosα=41841 and given α2 is an angle in first quadrant. We have to find the value of cosα2. We…

Q: Suppose cos ? =15/17 and ? lies in the 4th quadrant. Choose one of those ways to find sin ?.

A: Solution is in step 2

Q: Find the exact value of cos α = 8/17, α lies in quadrant IV, and sin β = - 1/2, β lies in quadrant…

A: Given that α is in 4th quadrant. There sinα will be negative.  Given that β lies in quadrant III,…

Q: Given an acute angle Cosx=2/7, find the exact value of cos(x/2). (Use a half-angle formula)

A: As we know from the half angle formula; cosx2=±1+cosx2   Given; cosx=27

Q: 3. Let cos(a)= 11 and tan(B) 21 for a in Quadrant IV and B in Quadrant II. 20 Find the following…

A: Given :           cos(α) = 1161 ; tan(β) = -2120 for α in Quadrant IV and β in Quadrant II.   To…

Q: 3 cos(8) and 0 is in Quadrant III, find tan(0) cot(0) + csc(0).

A:

Q: Use an appropriate Half-Angle Formula to find the exact value of the expression. s 77 cos

A: Use an appropriate half angle formula to find the exact value of the expression. Cos(7π/8). Here i…

Q: Find the exact values of sin(2r), cos(2æ) and tan(2r) without solving for a. 1 If sin a and a is in…

A: Trigonometric  identities           Sin2x+Cos2x=1            Sin2x=2sinx cosx…

Q: If you are given the value of cos θ and want the exact value of what form of cos(2 θ )the…

A: For example if cos(θ)=35  and θ is in first quadrant Double angle formula is…

Q: If cos(8) 3 and e is in the 3rd quadrant, find sin(e) 4 %3D sin(0) =

A:

Q: Use an appropriate compound angle formula to express as a single trig function, and then 3.…

A: Given query is to find the value of the trigonometric expression.

Q: Suppose A is an acute angle, and sin A cos A = 5 Find sin 2A and cos 2A. Give EXACT values. sin 2A…

A:

Q: 2 then which of the 5 An angle e drawn in standard position terminates in the fourth quadrant. If…

A:

Q: 2 If sin 0= - 0 in quadrant I, find the exact value of 5' Cos ()

A: Given that: sinθ=25 and θ lies in quadrant II.

Q: Find the exact value of the expressions cos(a B), sin(a B) and tan(a + B) under the following…

A: Given,

Q: Use the given information to find the exact value of the expression.  cos θ = 5/13 , θ lies in…

A: Given :cosθ=513

Q: 3. Use a calculator to find an approximate degree angle measure rounded to the nearest 100th. a) sin…

A: The values are given as sin-10.854=58.64o cos-123=48.18o

Q: Use the given information to find the exact value of the expression. sin θ = 24/26 , θ lies in…

A:

Q: If cos(0) 7. and 0 is in the 4th quadrant, find sin(0) 8. sin(A)

A: Since, cos θ=78and θ is in the fourth quadrant.Our Aim is to find sin θ=?

Q: Use the half-angle formula for cosine to compute cos() given cos(0) = 47 50 (Leave your answer in…

A: We can find the answer as below.

Q: If cos(θ)=−5 over 8 and θ is in the 2nd quadrant, find the exact value for sin(θ). sin(θ) =

A:

Q: State the exact value of the trigonometric ratio. •If Sin A = 1/7; find Cos A •If Tan B = 8; find…

A:

Q: Find the exact value of sine α​, given that cosine alpha equals cos α=− 6/11 and α is in quadrant…

A: Given, value of cosine in quadrant II. The value of cosine is negative in quadrant II

Q: Use an appropriate compound angle formula to express as a single trig function. Then evaluate the…

A: We know that  Sin(A-B)=sinAcosB-cosAsinB  Sin(7π/5)cos(π/15)-cos(7π/5)sin(π/15)

Q: Use the appropriate identity to find the exact value of the trig function given that -3 5 sina = 13…

A: Identity used-  Cos(A+B) = cosA cosB - sinA sinB

Q: If cos(θ)=−1/19cos and θ is in the 3rd quadrant, find the exact value of sin(θ)

A:

Q: If cos a = 0.366 and cos 3 = 0.593 (both angles are acute), Your answers should be accurate to 3…

A:

Q: if sin(0)=-7/25 with 0 quadrant IV, what is cos(0)?

A: Given

Q: Find the exact value of the expression using the provided information. 1 with s in quadrant IV, and…

A:

Q: 1519 Suppose that is an angle in quadrant 3 and that cos B Compute the exact value of 1681 (5) sin…

A:

Q: 3 and angle A is not in quadrant I, determine the exact value of sin A. /13 If COs A =

A: Sin is negative in 4th quadrant

Q: 119 Suppose that is an angle in quadrant 4 and that cos B 2 Compute the exact value of 169 sin 2 (4)…

A: Given, cosβ= -119169 β2  is an angle in quadrant 4We have to find the exact value of  sinβ2

Q: 6. Find the exact value by using a half-angle identity. Cos 165°

A:

Q: Find the exact value of the expressions cos(a B), sin(a + ) and tan(a B) under the following…

A: To calculate the value of the expression cos(α+β), sin(α+β) and tan(α+β) under the provided…

Q: 1. Find the value of cos(arctan(). As part of your solution, include the corresponding right angle…

A: solution :-

Q: If we know the value of cos x and the quadrant in which x/2 lies, we can find the value of sin1x/22…

A: If we know the value of cos x and the quadrant in which x/2 lies, we can find the value of sin(x/2)…

Q: 4. s in quadrant C

A:

Q: -what is sin(0)

A: Given that : The equation is cos θ = 27  and θ is in the first quadrant.

Q: Given sinα=−3/5 when 3π/2 ≤α≤ 2π , find the exact value of cos ⁡α/2, without using a calculator.

A:

Q: Find the exact value of cos (a + B) given that cos a = and sin B = - for a in Quadrant IV

A:

Q: If cos(θ)=1/3 and θ is in the 4th quadrant, find the exact value for sin(θ).

A:

Q: 161 Suppose that is an angle in quadrant 2 and that cos a = 2 . Compute the exact value of cos 289…

A:

Q: 2. Use a calculator to find an approximate radian angle measure rounded to the nearest 1,000th. a)…

A: d).  Given, cos-1-0.35 By using calculator, we get cos-1-0.35=1.928367≈1.928