III. Use the double angle identity to determine the exact value of each expression 1. Solve for sin 2 0 a. if cos 0 == and 0° <0 < 90° b. if cos e = = and 270° <0 < 360° C. if cot 0 = = and T <0 <

Q: If cos a = 0.154 and sin B = 0.273 with both angles' terminal rays in Quadrant-I, find the values of…

A:

Q: If sin  B  = -1/3 with A ,find the following  cot B/2

A: Given that sinB=-1/3 We need to find cot(B/2) First let us find the value of B sinB=-1/3…

Q: If sin A- where 5 <A<T, and cos B = where 13 B< 2n, find: 2 cos A b tan A cosec A d cot Be cos (A +…

A: We will find out the trigonometric ratios

Q: • Given that tan a = 8 and that a lies in quadrant III, find the exact value of the following: 15' •…

A: we have to evaluate the following

Q: 3 If cos(x) = 8 Give exact answers. sin() = COS I tan N (1) = - wwwwwww (in Quadrant 2), find

A:

Q: Given that tan a = 15' and that a lies in quadrant III, find the exact value of the following: • sin…

A:

Q: Given sin(A)= 이2 where 13 TT <A < π, and cos (B)= 4 where Tt < B < Зп find exact 5 values for sin(A…

A:

Q: for all Which expression is equivalent to sin ß values of B for which 1+cos B is defined? 1+cos B…

A:

Q: If sin t = * and t is in quadrant I, find the exact value of sin (2 t), cos (2 t), and 8° tan (2 t)…

A: THE EXPLANATION HAS BEEN GIVEN IN THE ATTACHED FILE.

Q: Find the exact value of each of the following under the given conditions:

A: As value of cosθ and sinθ revolves around +1 to -1 , they take different values depending on the…

Q: If cot(x) 3 8 Give exact answers. sin (-2) = cos (²) = | a(²/2) = tan || (in Quadrant 3), find

A: Explanation of the answer is as follows

Q: 1) * a) Complete each equation. sin 0 = cos 0 = た tan 0 = k b) If k = 9.4 and f = 12.7, what is the…

A:

Q: Find sin(a) and cos(B), tan(a) and cot(B), and sec(a) and csc(ß). 16 28

A:

Q: If cot 0 = and 0 lies on QIII, find the values of the following: 1. sin 0 [ Select ] 2. cos 0 […

A:

Q: Find the exact values of sin(2r), cos(2æ) and tan(2r) without solving for a. 1 If sin a and a is in…

A: Trigonometric  identities           Sin2x+Cos2x=1            Sin2x=2sinx cosx…

Q: Given: tan a = 216, 3 5' cos ß = αε[0,π] sin ß<0 Find the numerical value of: 1. tan 2 B

A:

Q: Assume sin(θ)=18/29 where π/2&lt;θ&lt;π and cos(ϕ)=−13/21 where π&lt;ϕ&lt;3π/2.Use the appropriate…

A: Given:

Q: If sin u = 5/13 and cos v = -3/5 and u and v are in Quadrant 2, find the exact answer a. sin (u - v)…

A:

Q: 19 21 Choose the function that could be used to find the measure of the angle with the "?". sin COS…

A: Given: A right-angled triangle with hypotenuse 21 units, and a side as 19 units. From the unknown…

Q: Given cos 0 0 < 0 < Find the EXACT values of the following sin 20 cos 20 tan 20

A:

Q: If sint=79, and t is in quadrant I, find the exact value of sin(2t), cos(2t), and tan(2t)…

A: Given: sin t=79t is in first quadrant.

Q: If sin (2a) cos (a +30), what is the value of a ? O20 O 20 O 30 О 50 O 110

A:

Q: If sin (B) = -1/2 with B in QIII, find cot (B/2). If sin (A) = 5/12 with A in QII, find sec (2A)…

A: We have to Solve this If sin (B) = -1/2 with B in QIII, find cot (B/2). If sin (A) = 5/12 with A in…

Q: If sin(x)=1/8 and x is in quadrant I, find the exact values of the expressions without solving for…

A:

Q: If cos θ = 1/6 and θ is acute, find cot (π/2 - θ).

A: We have to find cotπ2-θ if θ is acute and cosθ=16 We know that ratio of cosine function is base to…

Q: snip

A: Given: cosθ=14, θ in quadrant IV. We know that in quadrant IV, only cosine and secant are positive…

Q: For positive acute angles A and B, it is known that tan A = and 5 cos B=3. Find the value of sin(A -…

A: Sol:- tan(A)=pb=409 ; h = 402+92=41Therefore , sin(A)=ph=4041cos(B)=bh=513 ; p = 132-52=12Therefore…

Q: If Sin b= -1/3 with B in Q 3 find the following Cot B/2

A:

Q: If sin t =. and t is in quadrant I, find the exact value of sin (2 t), cos (2 t), and %3D tan (2 t)…

A: we use double angle formulas to solve these Questions

Q: If sin(a)= (in Quadrant 2), find 3 20 Give exact answers. sin (²) = COS 05 (-²) = N|HN| tan ™ (²7/7…

A:

Q: If tan(x) = −21/20 and x is in quadrant IV, find the exact values of the expressions without solving…

A:

Q: If sin t =2/3, and t is in quadrant I, find the exact value of sin(2t), cos(2t), and tan(2t)…

A:

Q: Find the exact value of the expressions cos(a B), sin(a B) and tan(a + B) under the following…

A: We have to find value of given trignometric function.Question is given below:

Q: 6. If sin 0 and <e<n, find the following. %3D a. sin e b. cos C. tan 612

A: We need to find trigonometric angles.

Q: if cot u = 7.827 and u is in Quadrant-III. 2 Find sin osent (5) sin Your answer should be accurate…

A:

Q: Given that sin u = 1 /3 and cos v = −3/5 and that u and v are both  in the second quadrant.  Find…

A:

Q: 2. Apply the compound angle formulas to solve the following: a) tan 750 (in degrees) b) cos (+)

A:

Q: Use the given information to find the exact value of a. sin 20, b. cos 20, and c. tan 20. 15 O lies…

A: We find here trigonometry value.

Q: If cot 0 = -, and 0 is in QII, find the value of sin 0. O 3V10 10 3/10 10 V10 - 10

A: Solving the problem by finding the value of sine.

Q: If cos a = 0.552 and sin B = 0.324 with both angles' terminal rays in Quadrant-I, find the values of…

A:

Q: If cos X = 0.4, and X is in Quadrant IV, then what is the value of sin X? O-J0.84 O 0.6 V0.84 -0.6

A:

Q: If cos 0 = the value of O √3 and tan 0 H √3 . where 00 27, calculate

A:

Q: Given sin A = 12/37, find cos A and tan A

A:

Q: Given that cos 0 = <0 <n, find the exact value of each of the following. 3 (a) sin (20) (b) cos (20)…

A:

Q: If sin r 2 and z is in quadrant I, find the exact value of sin (2x), cos (2x), and tan (2x)…

A:

Q: Find the exact values of the following a-e and show your complete Solution. (Circular Function) a.…

A: Since you have posted multiple subparts, as per our policy we will answer first three subparts.…

Q: 9. and cot o If tan 0 find the exact value of sin(0- p). 71

A: The sine (sin) of an acute angle in a right triangle is the ratio of the side opposite of the…

Q: It is known that sin A =, where < A < n, and cos B = n< B < . Find the exact values of: where 13 3x…

A: Given that, sinA=35,π2&lt;A&lt;πcosA=-513,π&lt;B&lt;3π2

Q: If cos θ =(1/6) and θ is acute, find cot.

A:

Q: 8. Given that sin 0 = , and the angle 0 is in the first quadrant, find the value for cos 0.

A:

Contingency Table

A contingency table can be defined as the visual representation of the relationship between two or more categorical variables that can be evaluated and registered. It is a categorical version of the scatterplot, which is used to investigate the linear relationship between two variables. A contingency table is indeed a type of frequency distribution table that displays two variables at the same time.

Binomial Distribution

Binomial is an algebraic expression of the sum or the difference of two terms. Before knowing about binomial distribution, we must know about the binomial theorem.