Lactose is a disaccharide made of a glucose and a galactose bonded together. Lactose is found in milk yet does not taste sweet because our taste receptors do not sense lactose. Our taste receptors do sense galactose and glucose. How can a mug of warm milk taste sweet, without adding sugar? [Select the best answer.] The activation energy required for the hydrolysis of lactose into glucose and galactose is supplied by heating the milk. The milk proteins are denatured by the heat. The reaction is endergonic so the heat is the energy required for the reaction to occur. The lactose has less free energy than the glucose and galactose.

Lactose is a disaccharide made of a glucose and a galactose bonded together. Lactose is found in milk yet does not taste sweet because our taste receptors do not sense lactose. Our taste receptors do sense galactose and glucose. How can a mug of warm milk taste sweet, without adding sugar? [Select the best answer.] The activation energy required for the hydrolysis of lactose into glucose and galactose is supplied by heating the milk. The milk proteins are denatured by the heat. The reaction is endergonic so the heat is the energy required for the reaction to occur. The lactose has less free energy than the glucose and galactose.

Biology Today and Tomorrow without Physiology (MindTap Course List)

5th Edition

ISBN:9781305117396

Author:Cecie Starr, Christine Evers, Lisa Starr

Publisher:Cecie Starr, Christine Evers, Lisa Starr

Chapter4: Energy And Metabolism

Section: Chapter Questions

Problem 3CT: Dixie Bee wanted to make JELL-O shots for her next party, but felt guilty about encouraging her...

See similar textbooks

Similar questions

Which of the following is true about the phosphorylation of proteins? A. Proteins are usually phosphorylated at amino acids that have hydroxyl group-containing side chains. B. Phosphorylation of proteins is catalyzed by phosphatases. C. Phosphoryation always activates enzymes. D. The specificity in phosphorylation is conferred solely by the amino acid to be phosphorylated.
Give an example of a reducing sugar and a non-reducing sugar. What is the chemical group responsible for the reduction reaction in a reducing sugar? Certain fats are important components of a healthy diet. But transfats are associated with increased riskof heart disease. Are transfats saturated or unsaturated fatty acids? What is the difference in chemicalstructure between a transfat versus a cisfat? DNA and RNA are information molecules with different roles in gene expression. List three differences between these two types of molecules.
Which of the following is/are epimer/s of glucose?* A. Galactose only B. Mannose only C. Fructose only D. Galactose and mannose only E. Galactose, mannose, and fructose
Fatty acid chains after subjected to degradative enzymes in the intestines are hydrolyzed (hydrolysis) into 2 Carbon acetic acid fragments (Each fragment becomes an acetyl Co-A molecule). What stage of cellular respiration will this product of lipolysis enter? How many ATP can one fragment produce in cellular respiration?
Imagine a Glycogen molecule attached to Glycogenin with 8000 glucose residues. If branches occur every eight residues how many reducing ends does the molecule have?
A certain enzyme catalyzes a reaction that uses the compound shown as a substrate. Would the walls of the active site be likely to contain nonpolar, polar, or charged amino acid side chains? Why?
Which of these is an ketohexose? a) fructose b) glucose c) ribose d) erythrose Which of these is a constitutional isomer of d-glucose? a) fructose b) galactose c) l-glucose d) ribose Which of these is an enantiomer of d-glucose? a) d-fructose b) d- galactose c) l-glucose d) d-ribose Which of these is a diastereomer of d-glucose? a) d- fructose b) d-galactose c) l-glucose d) d-ribose
Arrange these four molecules in increasing order of their biological energy content per mole:(a) Mannose(b) Stearic acid, CH3(CH2)16COOH(c) Fructose(d) Palmitic acid, CH3(CH2)14COOH
A student is trying to determine the mechanism for a reaction that uses ATP to activate a carboxylate ion, which then reacts with a thiol. If the carboxyl-ate ion attacks the g-phosphorus of ATP, the reaction products are the thioester, ADP, and phosphate. However, whether it attacks the a-phosphorus or the b-phosphorus of ATP cannot be determined from the reaction products because the thioester, AMP, and pyrophosphate would be the products in both reactions. The mechanisms can be distinguished by a labeling experiment in which the enzyme, the carboxylate ion, ATP, and radioactively labeled pyro-phosphate are incubated, and then the ATP is isolated. If the isolated ATP is radioactive, attack occurred on the a-phosphorus. If it is not radioactive, then attack occurred on the b-phosphorus. Explain these conclusions.
The symbol for the fatty acid below is ________________: ________________, n-____________________. CH3(CH2)2(CH=CHCH2)2(CH2)4COOH (This is a multiple blank question, e.g. for 12:1, n-3 you would enter 12, 1, and 3.)
Compare the cellular energy (e.g. ATP) required and produced when glycogen is synthesize and hydrolyzed, respectively. Do the same for a molecular of triglyceride that contains three palmitoyl chains. Which seems to be the better way to store energy? Explain.
Which of the following homopolysaccharides produced by a plant cell contains only -1,4-glycosidicbonds between glucose monosaccharides (easily digested by most animal species)?A. amylopectin (produced by potato cells)B. amylose (produced by rice cells)C. glycogen (produced by liver cells)D. chitin (produced by fungal cells)E. cellulose (produced by corn cells)