Name which, if any, of the following groups are notaldose–ketose pairs: d-ribose and d-ribulose, d-glucose and dfructose, d-glyceraldehyde and dihydroxyacetone.

Q: Why can only unsaturated triacylglyceroids undergo hydrogenation?

A: Lipids are one of the major classes of macromolecule and are essential for the formation of the cell…

Q: CH2OH -OH HO- H H- -O- H -OH ČH2OH

A: The oxidation reaction is the process of the addition of oxygen or the removal of hydrogen from the…

Q: Name the following compound: но H OH OHH H H. OH Но Он HO, a. Ketose b. Maltose c. Sucrose d. Aldose

A: Disaccharides are sugar formed by joining two monosaccharides by glycosidic linkage. Some examples…

Q: Can there be any chiral carbon atoms in triacylglycerols? If so, which ones can be chiral and what…

A: Chiral carbon centers are carbon atoms that are attached to four different substituents, that are…

Q: With alanine AA, and using citric acid cycee and glycolysis, which Carbon atom would be labeled 1st…

A: -COOH is labelled with 14C in alanine. The ketones becomes labeled with 14C in acetyl CoA,…

Q: Name the following fatty acid CH3-CH2-CH=CH-CH2-CH=CH-CH2- CH=CH-(CH2)7-COOH O 18: 346,9,12 18: 2 w3…

A: Fatty acids are the building blocks of the fat and they are named based on the structure they have…

Q: Identify the following carbohydrate: CH(O)-CH(OH)-CH(OH)-CH(OH)-CH(OH)-CH2(OH) a disaccharide…

A: A carbohydrate is a biomolecule consisting of carbon, hydrogen and oxygen atoms, usually with a…

Q: What is glycerol 3-phosphate?

A: As basically the Glycerol 3-phosphate is synthesized by reducing dihydroxyacetone phosphate (DHAP),…

Q: Explain why each of the following are reducing sugars: mannose, glucopyranose, fructofuranose, and…

A: DEFINITION FOR REDUCING SUGARS:- A  reducing sugar is any sugar that is capable of acting as  a…

Q: In the monosaccharide derivatives known as sugar alcohols, the carbonyl oxygen is reduced to a…

A: The D- and L- notation is a convenient way to designate enantiomers. For e.g., D-Glucose is the…

Q: What is the functional group that is usually associated with saponifiable lipid. Is it alcohol,…

A: Saponification: Saponification is the process of the conversion of fat, lipids, or fats into soap by…

Q: Classify each of the following sugar pairs as enantiomers, diastereomers, epimers, or an…

A: Since we answer only three sub-parts at a time, we are answering the first three sub-parts listed…

Q: Identify the structure and function of glycogen. Which monosaccharide(s) is (are) the building block…

A: Glycogen is polymer which is formed of multiple units of glucose molecule .It is basically reserved…

Q: . Identify the following carbohydrate: CH(O)-CH(OH)-CH(OH)-CH(OH)-CH(OH)-CH2(OH) a disaccharide…

A: Carbohydrates are referred to as the biomolecules containing carbon along with hydrogen and oxygen…

Q: Indicate whether each of the following pairs of sugars consists of anomers , epimers , or an…

A: Introduction: Anomers are epimers that differ from one another in C1 configuration if they are…

Q: In solution, glucose exists predominantly in the cyclic hemiacetal form, which does not contain an…

A: Glucose is the carbohydrate source. The glucose can be hemiacetal or hemiketal. They are formed when…

Q: Name the enantiomer of D-glucose.

A: Enantiomers are chiral molecules that are mirror images of one another. These molecules are…

Q: Name which, if any, of the following are epimers of d-glucose: Dmannose, D-galactose, D-ribose.

A: Epimers are diastereomers where two sugars differ only in configuration of a single chiral carbon…

Q: Which of the following is not the function of Glycosylation?

A: Answer:  GLYCOSYLATION = This is the important cellular mechanism of secondary proteins within the…

Q: This is the compound tagatose. Is this an aldose or a ketose?

A: Tagatose is a six-carbon monosaccharide. It is a rare sugar.  Tagatose is used as a low-calorie…

Q: Which set of amino acid contains 2 sulfur containing amino acids and 2 aromatic amino acids? F, P,…

A: We'll answer the first question since the exact one wasn't specified. please submit a new question…

Q: Explain the three-dimensional structure of a saturated triacylglycerol ?

A: Triglycerides- Triglycerides are a type of lipid, or fat, found in your blood. When you eat, your…

Q: Describe the common structural features and the differences for eachof the following pairs: (a)…

A: Carbohydrates comprise sugars, starch, and also fibers, found in different types of food such as…

Q: Write the saponification reaction of the following triglyceride with NaOH Н-С-О CH3 H-C-O- `CH3…

A: Triglycerides, also known as fat molecules, are composed of long chains of fat. In the presence of…

Q: The reaction of methoxy benzene with hydrogen iodide will yield a phenol and an alkyl halide. Which…

A: Organic chemical compounds are those that are made up of carbon, oxygen and hydrogen. They contain a…

Q: What type of hydrocarbons are their structures? Please describe their stability and chemical…

A: Introduction Hydrocarbons are the compounds containing carbon and hydrogen along with single or…

Q: Name which, if any, of the following groups are not aldose– ketose pairs: D-ribose and D-ribulose,…

A: An aldose is a carbohydrate that contains aldehyde as the functional group while a ketose is a…

Q: COOH H- H- -OH HO -H H- -OH ČOOH е.

A: ANSWER;- e.) Galactaric Acid.

Q: What three compounds are classified as ketone bodies? Why are they so designated? What process in…

A: Ketone bodies are produced by liver when the food intake in the body is very low. It is a molecule…

Q: Indicate which of the terms monosaccharide, disaccharide, reducing sugar, anomers, enantiomers, and…

A: Carbohydrate is a biomolecule consisting of carbon, hydrogen and oxygen where the ratio of hydrogen…

Q: Which of the following statements concerning glycolipids is true? a. All glycolipids contain…

A: There are three major components in the plasma or cell membrane, lipids, carbohydrates, and…

Q: Explain the three-dimensional structures of a saturated and unsaturated triacylglycerol ?

A: Triglycerides are form of esters which is formed by linking three fatty acids to a glycerol through…

Q: Which of an alpha-D-2,3-di-O-methylglucopyranose or alpha-D-2,3, 6-tri-O-methylglucopyranose…

A: Glucose is a type of carbohydrate, or specifically monosaccharide, which is formed during…

Q: Define omega-3 fatty acid.

A: Omega-3 fatty acid are polyunsaturated fatty acids characterised by the presence of a double bond,…

Q: Match the following compounds with choices (a) monosaccharide, (b) disaccharide, or (c)…

A: Biological macromolecules are those large molecules that are necessary for the survival and growth…

Q: Draw the respective enantiomer of the following sugar molecules: D-glyceraldehyde D-glucose…

A: Chiral molecules, which are mirror images of each other, are enantiomers. In addition, the molecules…

Q: Identify the following carbohydrate: CH(O)-CH(OH)-CH(OH)-CH(OH)-CH(OH)-CH2(OH) a disaccharide…

A: Carbohydrate is a type of macromolecule that is considered as an essential part of the diet. They…

Q: Give the lipid number for the following fatty acid:

A: The numbers are typically presented in the following template = (number of carbons in fatty acid…

Q: Indicate whether each of the following is a component of (1) a cerebroside but not a ganglioside,…

A: Cerebroside and ganglioside both are sphingolipids which are integral part of the plasma membrane.…

Q: These are the options: Given the choices of carbohydrates in the following list and provide the…

A: DNA is a double stranded molecule which is made up of nucleotides. Each Nucleotide is made up of a…

Q: Is D-2-deoxygalactose the same chemical as D-2-deoxyglucose? Draw a

A: In D-2-deoxygalactose, the hydrogel (-OH) group is replaced by hydrogen at second carbon chemical…

Q: Which of the following differentiates erythrose with erythrulose? Erythrose has 2 chiral carbon…

A: Erythrose and erythrulose are monosaccharide sugars that consist of four carbon atoms. They differ…

Q: A polyhydroxylated aldehyde or ketone containing 3 carbons or more is called

A: An aldehyde is a chemical compound that comprises of a functional group and resembles the structure…

Q: Draw the structure of a phosphoacylglycerol that contains glycerol, oleic acid, stearic acid, and…

A: Introduction: Lipids are water-insoluble that are not a polymer like other biomolecules such as…

Q: omega-3 fatty acids?

A: Omega-3 are nutrients you get from food  that help build and maintain a healthy body. They're key to…

Q: Carbons in a ribose or deoxyribose are numbered by ________

A: Nucleic acids such as DNA and RNA, contain genetic information and information about protein…

Q: Identify the following fatty acids present in fats and oils by their common names.            Which…

A: Fatty acids are composed of a long hydrocarbon chain attached to a carboxylic group. Long…

Q: Name which, if any, of the following are epimers ofd-glucose: d-mannose, d-galactose, d-ribose

A: Epimers are compounds, especially carbohydrates which differ in the position of the OH group at any…

Metabolic pathways

Metabolism is defined as the group of life-supporting, enzyme-mediated chemical reactions in organisms. A metabolic pathway is a set of these chemical reactions that involve anabolism (synthesis of complex biomolecules) and catabolism (breakdown of biomolecules into small molecules) that occur inside a cell. Metabolites are the reacting substances, products, and intermediate substances of an enzymatic process that are altered by a series of chemical events catalyzed by enzymes.