Verify the identity. sin (a + B) = tan a+ tan B cos a cos B Write the left side numerator in terms of a sum or difference formula for sine or cosine. sin (a + B) cos a cos B cos a cos B

Q: Verify the identity. sin (a + B) = tan a+ tan B cos a cos B Write the left side numerator in terms…

A:

Q: hewrite cos(a+ in terms Of Sinla) and cosca)

A:

Q: Verify the identity. sin (a- B) = tan a cot B-1 cos a sin B Write the left side numerator in terms…

A: Using compound angle (difference) formula of sin.

Q: Verify the identity. (Simplify at each step.) 6 cos? B - 6 sin? ß = 6 – 12 sin² B 6 cos? B – 6 sin²…

A: Simplify 6cos2β-6sin2β=6-12sin2β we know the formula that cos2x+sin2x=1 Implies that cos2x=1-sin2x

Q: Establish the identity. sin? 0 + cos 0 = sec 0 cos e

A: 1/cosθ=sec θ

Q: Find sin(x) and cos(ß), tan(x) and cot(B), and sec() and csc(ß). 4 7 (a) sin(x) and cos(ß) (b)…

A:

Q: Find sin(a) and cos(B), tan(a) and cot(ß), and sec(a) and csc(ß). 3 5 (a) sin(a) and cos(B) (b)…

A: We have to find trigonometry ratios

Q: "III. Find the value of the expression. 12.) csc 300• cos 60 sec 150° · sin 120°

A: SOLUTION-

Q: Verify the identity. sin Ix- - 4 (sin x- cos x) 2 Write the left side in terms of a sum or…

A:

Q: Find sin(a) and cos(ß), tan(a) and cot(B), and sec(a) and csc(B). 12 21 (a) sin(a) and cos(B) (b)…

A:

Q: A) Prove the identity Sin (A + B) + Sin (A - B) = 2SinA cosB

A:

Q: Find the exact value of cos(a+B) sin a = 12/13, -3pi/2<a<-pi tan B = -1/(sqrt)3 , pi/2 <B<pi

A: Given  sin a = 12/13, -3pi/2&lt;a&lt;-pi tan B = -1/(sqrt)3 , pi/2 &lt;B&lt;pi To find  cos( a +B)

Q: Verify the identity. sin (a+ B) = cot B+ cot a sin a sin B Write the left side numerator in terms of…

A:

Q: Verify the identity. sin (a + B) = tan a + tan ß cos a cos B Rewrite the numerator on the left side…

A:

Q: Use the cosine of a sum and cosine of a difference identities to find cos (s + t) and cos (s - t). 5…

A:

Q: Simplify: sin 0 cos 30 + cos 0 sin 30 A. cos 40 B. sin 40 C. cos 20 D. sin 20 O A OB OC O D

A: Using Trigonometry identities,

Q: Verify the identity. sin x- 4 (sin x+ cos x) 2 Write the left side in terms of a sum or difference…

A:

Q: 2.Find the exact value of the expression: sin("cos() - cos)sin(). CosB D. cos (A-B)=sinA cosB cosA…

A: Now, simplify the given expression with help of sum and difference identities. Therefore, the…

Q: Verify the identity. sin (a - B) cos a sin ß - = tan a cot ß – 1 Rewrite the numerator on the left…

A:

Q: Verify the identity. sin (a - B) = tan a- tan B cos a cos ß Write the left side numerator in terms…

A:

Q: Verify the identity. sin (a - B) = 1- cot a tan ß sin a cos B Write the left side numerator in terms…

A:

Q: 10. Simplify each expression to the equivalent expression shown. sin 2x a) 1- cos 2x' b) sin (x + y)…

A: 10. To determine :- Simplify each expression to the equivalent expression. (a) Solution :- sin 2x1-…

Q: Simplify the expression: (1 + cos a)(1- cos(-a)) O sin² a cos a 01 + 2 cosa + sin²a sin a

A: The given expression is 1+cosα1-cos-α

Q: Use the cosine of a sum and cosine of a difference identities to find cos (s + t) and cos (s- t).…

A:

Q: Prove that the following identity is true. tan A sec A = sin A We begin by writing the left side of…

A:

Q: Prove the identity. cot e csc e cos e We begin by writing the left side of the equation in terms of…

A: cot x = cos x /sin x

Q: Find the exact value of sin (a + B) if sin a = - 4 and sin B = with a in quadrant I and B in…

A: Given,            sinα=47 and sinβ=-16, with α in Quadrant I and β in quadrant III.We know that,…

Q: Verify the identity by converting the left side into sines and cosines. (Simplify at each step.)…

A:

Q: (a) If cos α = −√3/5 and α is in the third quadrant, find exact values for sin α and tan

A: SINCE YOU HAVE ASKED MULTIPLE QUESTIONS IN SINGLE REQUEST, WE WILL BE ANSWERING ONLY THE FIRST…

Q: Let sin t = a, cos t=b, and tant=c. Write the expression in terms of a, b, and c. 12 cos (-t)- cost…

A: Trigonometric functions:- The trigonometric functions are real functions that relate an angle of a…

Q: Verify the identity. (Simplify at each step.) 2 sin? α-2 sin# α-2 cos? α-2 cos α a 2 sin? a - 2 sin4…

A:

Q: Find sin(a) and cos(ß), tan(x) and cot(B), and sec(a) and csc(ß). 16 28 (a) sin(x) and cos(ß) (b)…

A: From the given figure, corresponding to the angle α.  Perpendicular=16Hypotenuse=28 As we know that…

Q: If sin A = where 0 < A < and cos B = where <B< 2n, fnd the exact, simplified value of Cos (A - B).…

A:

Q: Let sin t=a, cos t=b, and tant=c. Write the expression in terms of a, b, and c. 2 sin (-t) - sint 2…

A:

Q: Find the exact value of the expressions cos(a + B), sin(a + B) and tan(a + B) under the following…

A: Given information:: Find the exact value of the expressions cos(α+β), sin(α+β) and tan( α+β)…

Q: Find the exact value of the expressions cos(a + B), sin(a + B) and tan(a + B) under the following…

A:

Q: Verify the identity. cos B+ sin B tan B = sec B Use a Reciprocal Identity to rewrite the expression…

A:

Q: Verify the identity. (Simplify at each step.) 3 sin? a – 3 sint a = 3 cos? a - 3 cos“ a 3 sin? a – 3…

A: Given query is to verify the identity.

Q: Verify the identity. (Simplify at each step.) 3 sin2 a - 3 sin a = 3 cos? a 3 cost a 3 sin? a - 3…

A: Solution-  In the given question we use formula that is Sin2 x = 1-cos2 x Cos2 x = 1-sin2 x

Q: Prove that the following identity is true. tan A = sin A sec A We begin by writing the left side of…

A: Here we have to prove

Q: tan cos The value of 6 – is sin(60º) a) 4 b) 6 c) 8 d) 0

A: Complete solution is given below

Q: Verify the identity. sin(A) tan(0) cos(e) Use a Reciprocal Identity to rewrite the expression in…

A:

Q: Verify the identity. sec(t) – cos(t) = sin²(t) sec(t) Use a Reciprocal Identity to rewrite the…

A: Verify the identities

Q: Complete the identity. sin2 e-1 = ? sin e +1 O sin e O cos? e O sin e - 1 O sin e + 1

A:

Q: 3. Simplify a. cos 20 sin 90- cos 90 sin 20 cos A b. csc A (1- 1+sin A.

A:

Q: Find sin(a) and cos(B), tan(a) and cot(B), and sec(a) and csc(B). 14 (a) sin(a) and cos(B) (b)…

A:

Q: Use an addition or subtraction formula to find the exact value in simplest form. Rationalize your…

A: We know the subtraction formula cos(A)cos(B)+sin(A)sin(B)=cos(A-B)

Q: What is the value of the expression below? * sin(-1) cos (1) + cosn) sinGn) cos(1) sin-n) 8°

A: Consider the given expression sin7π6cos7π6+cos8π3sin8π3. Obtain the value of the given expression as…

Q: Simplify. 1 - 2sin? O cos X O sin x O cos 2x sin 2x

A: Consider the provided expression, 1-2sin2x2 Simplify the provided expression. Here use the identity…