1) For the reaction below, which way would the equilibrium shift, for each situation below, to the right or to the left? CH4 (g) + H2S (9) + CS2 (9) + H2 (9) (a) Decrease the concentration of dihydrogen sulfide. (b) Increase the pressure on the system.. (c) Increase the temperature of the system. (d) Increase the concentration of carbon disulfide. (e) Decrease the concentration of methane (CH4).

Q: 1. Which description best represents the process of equilibrium?

A: Since we know that  all reactions tend towards a state of chemical equilibrium, the point at which…

Q: Methane and water react to form carbon monoxide and hydrogen, like this: CH (8)+H,0(g) → co()+3H,(g)…

A: Answer :-    Perturbation  Change in composition  Shift in equilibrium  Some CO is removed…

Q: For the reaction  3H2(g)+N2(g)⟷2NH3(g) at 472°C equilibrium is established when [H2]= 0.0200 M,…

A: The equilibrium constant of a chemical reaction is the value of its reaction quotient at chemical…

Q: At 15°C, the value of Kw is 4.5 x 10-15. What is the equilibrium concentration of OH- at this…

A: The equilibrium constant for a reaction is expressed in terms of the ratio of the concentration of…

Q: 2. The following system is at equilibrium 2CO₂(g) 2CO(g) + O₂(g) Will an increase in pressure shift…

A: Given, 2CO2(g) ⇌ 2CO(g) + O2(g) Will an increase in pressure shift the equilibrium to the left or to…

Q: The equilibrium expression for Keq for the reaction below is __________. 2O3 ⇌ 3O2 (g)

A: Equilibrium is a state of a system in which reversible reaction takes place.  Concentration of…

Q: How does the equilibrium constant depend on temperature?

A: Since a reaction can be two types. 1) Endothermic reaction : reactions which absorbs heat from…

Q: Does the equilibrium 2 NO1g2 + O21g2 ∆ 2 NO21g2 shift to the right if  O2 is added to the system?

A: Given equilibrium  2 NO(g) + O2 (g) ⇔ 2 NO2 (g) In above reaction  reactant are NO and O2Product is…

Q: For the reaction CH4(g) + H2O(l) CO(g) + 3H2(g) if the system is at equilibrium and the volume of…

A:

Q: CoCl4-2 {blue} + 6 H2O Co(H2O)6+2 {red} + 4 Cl- + heat

A: Co(H2O)62+(aq) + 4 Cl-(aq) <=> CoCl42-(aq) + 6 H2O(g)      The Co(H2O)62+ complex is…

Q: What happens to the equilibrium 2NO(g)+O2 (g)↔2NO2 (g) if a) O2 were added to the system, and if b)…

A: According to Le-Chatelier’s principle, if a system in equilibrium is subjected to any change kin…

Q: 5a) If the pressure was increased, which way would the equilibrium shift? a) to the right b) to the…

A: Le Chatelier's principle: According to the Le Chatelier's principle when a change in concentration…

Q: Consider the equilibrium  2HCl(g) ⇌ H2(g) + Cl2(g), where K = 0.25 If 2.5 mol of HCl was placed in…

A:

Q: Numeric At 298 K the reaction N2 (g) + 3 H2 (g) 2 NH3(g) has K, = 4.2 x 108. What is the value of K.…

A: Applying concept of relationship between chemical constants of different type of reaction.

Q: Consider the following reaction at equilibrium. 2 H2S(g) + 3 O2(g) ⇌ 2 H2O(g) + 2 SO2(g) What effect…

A: According to Le Chateliers principle, when an equilibrium system is disturbed by changing…

Q: a The solid NH4HS decomposes in an endothermic process, NH,HS(s) 2 NH3(g) + H,S (g) What effect will…

A: Given reaction,  NH4HS(s) <=>NH3(g) +H2S(g) What effect of adding NH3 ?

Q: Consider the following reaction. What would be the equilibrium constant expression? CH4(g) + H₂O(g)…

A: Reactants are present on left side and products are present on right side of reaction.…

Q: Initially 3.0 mol of nitrosyl bromide, NOBr, is placed in a 5.0 L container and allowed to come to…

A: Solution The constant of a chemical process (usually denoted by the image K) provides insight into…

Q: N2+3H2 react to form a forward and reverse 2NH3. for the synthesis of ammonia at 500 degree celsius,…

A: Given information, N2 + 3H2 <=> 2NH3 Temperature (T) = 500°C Equilibrium constant (K) =…

Q: Answer should follow the format: a) The reaction quotient Q b) the direction of the equilibrium…

A:

Q: 4NH3 (g)  +  3O2 (g)  ⇔  2N2 (g) + 6H2O (g) b) Write the equilibrium constant expression for the…

A:

Q: 2. Consider the following equilibrium. Which way will the system shift, if at all? How would the…

A: “Since there are multiple sub-parts in this question and it is not mentioned that which one has to…

Q: Q1) Consider the two equilibrium systems involving bromine gas illustrated below. -piston bromine…

A: We are authorized to answer three subparts at a time since you have not mentioned which part you are…

Q: , Exothermic reaction equilibrium:   This reaction is exothermic:     C6H12O6(s) + 6O2(g)  6CO2(g)…

A: When factors like concentration, pressure, temperature, inert gases that affect equilibrium are…

Q: write the equilibrium constant of the following expression:  6Ca(s) + 2NH3 (g) 3CaH2(s) + CaN2(s)

A: Equilibrium constant is the ratio of product concentration raise to the power of its stoichiometry…

Q: What is the value for equilibrium (2)?

A:

Q: Write the equilibrium expression for the following reaction. H2SO (aq) + 2KOH(aq) 2H20(1) +…

A: General equilibrium constant is as: A + 2B ⇌ C + 3D Then,   Keq = productreactant Equilibrium…

Q: For the equilibrium below at 400 K, Kc = 7.0. Br2(g) + Cl2(g)  2 BrCl(g) If 0.15 mol of Br2 and…

A:

Q: CH;Cl½(g) CHL(g) + CC1,(g) reaction mixture was found to contain 1.20×1o² moles of CH,Cl½(g),…

A: The question is based on the concept of equilibrium. We have to calculate reaction quotient and then…

Q: What property of a reaction can we use to predict the effect of a change in temperature on the value…

A: Given What property of a reaction can we use to predict the effect of a change in temperature on the…

Q: Write the equilibrium expression of the following chemical reactions: 1. N2O4(g) ⇌ NO2(g) 2.…

A:

Q: 3. Indicate for the following the direction, if any, the point of equilibrium would be shifted by an…

A: Le Chatelier principle says that equilibrium will shift in such a way so as to undo the effect of…

Q: The following reaction is exothermic. C6H12O6 (s) + 6O2 (g) = 6CO2 (g) + 6H2O (g) Predict the effect…

A: Temperature is one of the factor that is capable of changing the state of the equilibrium. This…

Q: 2NO2(g)  +  7H2(g)   -----> 2NH3(g)  +  4H2O(g) Write the equilibrium constant expression, Kc, for…

A: using the equilibrium concept , reverse of reaction is  kC1=1kc if a reversible reaction is reversed…

Q: What can be said about the magnitude of the equilibrium constant in a reaction whose equilibrium…

A: The relationship between reactants and products of a reaction at equilibrium (where the…

Q: Ammonium carbamate, NH4CO2NH2, is a salt of carbamic acid that is found in the blood and urine of…

A:

Q: For the following equilibrium reaction%; H2 + 12 2HI If you were to remove some H2, the reaction…

A: Given H2 + I2 ↔2HI 1. some H2 is removed 2. some HI is removed

Q: 2SO2 (g) + O2 (g) ⇌ 2SO3 (g) Predict the direction of the shift if O2 is removed to the equilibrium…

A: Answer: Reaction shift backward direction  Left side/Reactants side.

Q: Consider the reaction represented by the equation 25O2g) + O2(g) 2S03(g). For the system at chemical…

A: Thermodynamics is concerned with the energy changes while kinetic is concerned with the rate of…

Q: Initially 3.0 mol of nitrosyl bromide, NOBr, is placed in a 5.0 L container and allowed to come to…

A:

Q: Given the following reaction at equilibrium, which of the following alterations will increase the…

A: Le Chatelier's principle: This principle is used to predict the effect of a change in conditions on…

Q: Ethyl acetate is synthesized in a nonreacting solvent (not water) according to the following…

A: At any time: Q = [CH3CO2C2H5][H2O]/[CH3CO2H][C2H5OH] If Q < K then reaction will occur in forward…

Q: What would you expect to be the effect of an increase of pressure on the following reaction?  H2(g)…

A:

Q: Which is true of a system at equilibrium when Kc < 1?

A: In these reactions reactants are not completely converted into products (100% completion not…

Q: 4 b. The following system establishes an equilibrium at 545 K NH₂ (8) + H₂S (8) AND > 0 NH₂HS (s)->…

A: 4) Le Chatelier's principle According to the Le Chatelier's principle when a change in concentration…

Q: 2SO2 (g) + O2 (g) ⇌ 2SO3 (g) Predict the direction of the shift if SO2 is added to the equilibrium…

A: 2SO2 (g) + O2 (g) ⇌ 2SO3 (g) If SO2 is added then equillibrm shifts obeying le Chatleir's Principle

Q: Write the equilibrium expression for 2NO(g) + 2H2(g) = N2(g) + 2H20(g). a. Ke = [H20]2 [N2] / [NO]²…

A: The equilibrium reaction is as follows: 2NO(g) + 2H2(g) ⇌ N2(g) + 2H2O(g) The equilibrium constant…

Applications of Molecular Spectroscopy

When light sources pass through the diffraction grating then light splits into different wavelengths. The light source produces two types of patterns that are shown as destructive and non-destructive. The light source is in the form of quanta that is quantitation.