17. The enthalpy of formation for H20(g), CO2(g), and C2H5OH(1), in kJ/mol, are given as follows:DH;°[H2O(g)] = -241.8; DH;°[CO2(g)] = -393.5, and DH;°[C2H5OH(1)] = -277.6How much energy is produced when 2.50 g of ethanol (C2H5OH) is completely burned?C2H5OH(I) + 3O2{g)2CO2(g) + 3H20(g);-->(A) 19.4 kJ(B) 49.5 kJ(C) 97.1 kJ(D) 67.0 kJ

Answered: Image /qna-images/answer/73085e0c-432f-4895-8721-ad3e78a20c8d.jpg

17. The enthalpy of formation for H20(g), CO2(g), and C2H5OH(1), in kJ/mol, are given as follows DH°[H2O(g)] = -241.8; DH;°[CO2(g)] = -393.5, and DH;°[C2H;OH(1)] = -277.6 How much energy is produced when 2.50 g of ethanol (C2H5OH) is completely burned? C2H5OH(I) + 302(g) 2CO2(g) + 3H2O(g); --> (A) 19.4 kJ (B) 49.5 kJ (C) 97.1 kJ (D) 67.0 kJ

17. The enthalpy of formation for H20(g), CO2(g), and C2H5OH(1), in kJ/mol, are given as follows DH°[H2O(g)] = -241.8; DH;°[CO2(g)] = -393.5, and DH;°[C2H;OH(1)] = -277.6 How much energy is produced when 2.50 g of ethanol (C2H5OH) is completely burned? C2H5OH(I) + 302(g) 2CO2(g) + 3H2O(g); --> (A) 19.4 kJ (B) 49.5 kJ (C) 97.1 kJ (D) 67.0 kJ

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter6: Thermochemistry

Section: Chapter Questions

Problem 111AE: At 298 K, the standard enthalpies of formation for C2H2(g) and C6H6(l) are 227 kJ/mol and 49 kJ/mol,...

See similar textbooks

Similar questions

From the data given in Appendix I, determine the standard enthalpy change and the standard free energy change for each of the following reactions: (a) BF3(g)+3H2O(l)B(OH)3(s)+3HF(g) (b) BCl3(g)+3H2O(l)B(OH)3+3HCl(g) (c) B2H6(g)+6H2O(l)2B(OH)3(s)+6H2(g)
Consider the Haber process: N2(g)+3H2(g)2NH3(g);H=91.8kJ The density of ammonia at 25C and 1.00 atm is 0.696 g/L. The density of nitrogen, N2, is 1.145 g/L, and the molar heat capacity is 29.12 J/(mol C). (a) How much heat is evolved in the production of 1.00 L of ammonia at 25C and 1.00 atm? (b) What percentage of this heat is required to heat the nitrogen required for this reaction (0.500 L) from 25C to 400C, the temperature at which the Haber process is run?
How much will the temperature of a cup (180 g) of coffee at 95 C be reduced when a 45 g silver spoon (specific heat 0.24 J/g C) at 25 C is placed in the coffee and the two are allowed to reach the same temperature? Assume that the coffee has the same density and specific heat as water.
At 298 K, the standard enthalpies of formation for C2H2(g) and C6H6(l) are 227 kJ/mol and 49 kJ/mol, respectively. a. Calculate H for C6H6(l)3C2H2(g) b. Both acetylene (C2H2) and benzene (C6H6) can be used as fuels. Which compound would liberate more energy per gram when combusted in air?
Given: 2Cu2O(s) + O2(g) 4CuO(s)H = 288 kJ Cu2O(s) CuO(s) + CuO(s)H = 11kJ Calculate the standard enthalpy of formation (Ht) for CuO(s).
Calculate H for the reaction N2H4(l)+O2(g)N2(g)+2H2O(l) given the following data: Equation H(KJ) 2NH3(g)+3N2O(g)4N2(g)+3H2O(l) 1010 N2O(g)+3H2(g)N2H4(l)+H2O(l) 317 2NH3(g)+12O2(g)N2H4(l)+H2O(l) 143 H2(g)+12O2(g)H2O(l) 286
The combustion of methane can be represented as follows: a. Use the information given above to determine the value of H for the combustion of methane to form CO2(g) and 2H2O(l). b. What is Hf for an element in its standard state? Why is this? Use the figure above to support your answer. c. How does H for the reaction CO2(g) + 2H2O (1) CH4(g) + O2(g) compare to that of the combustion of methane? Why is this?
Using data from Appendix 4, calculate H, S and G for the following reactions that produce acetic acid: Which reaction would you choose as a commercial method for producing acetic acid (CH3CO2H) at standard conditions? What temperature conditions would you choose for the reaction? Assume H and S do not depend on temperature.
Principles of Heat Flow Titanium is a metal used in jet engines. Its specific heat is 0.523 J/g C. If S.SS g of titanium absorb 4.78 J, what is the change in temperature?
The thermochemical equation for the burning of methane, the main component of natural gas, is CH4(g)+2O2(g)CO2(g)+2H2O(l)H=890kJ (a) Is this reaction endothermic or exothermic? (b) What quantities of reactants and products are assumed if H = 890 kJ? (c) What is the enthalpy change when 1.00 g methane burns in an excess of oxygen?
When a gas expands, what is the sign of w? Why? When a gas contracts, what is the sign of w? Why? What are the signs of q and w for the process of boiling water?
9.56 Using heats of formation tabulated in Appendix E, calculate the heats of reaction for the following. (a) C2H2(g)+52O2(g)2CO2(g)+H2O(l) (b) PCl3(g)+Cl2(g)PCl5(g) (c) C2H4(g)+H2O(g)C2H5OH(g) (d) Fe2O3(s)+2Al(s)Al2O3(s)+2Fe(l)