Write down the net ionic equation for the reaction below 2+Cu(s) + 4NH3 (aq)+ H2O2(aq) → Cu(NH3)4"(aq)+20H (aq)

Answer Cu(s) + 4NH3(aq) →Cu(NH3)42+(aq)

Answered: 2+ Cu(s) + 4NH3 (aq)+ H2O2(aq) →…

Science

Chemistry

2+ Cu(s) + 4NH3 (aq)+ H2O2(aq) → Cu(NH3)4“(aq)+2OH (aq)

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 129AE: One of the few industrial-scale processes that produce organic compounds electrochemically is used...

See similar textbooks

Related questions

Q: The following chemical reaction takes place in aqueous solution: Fe, (so,),(aq)+3…

A: Process to write net ionic equation 1. Break the aqueous species into ions in a Balance reaction…

Q: Identify the oxidizing agent and reducing agent, respectively, in the following reaction: Cl2 (aq) +…

A: In a chemical reaction, the oxidizing agent is a substance that oxidizes other substance by…

Q: Complete and balance the following redox reaction in acidic solution…

A: The complete and balanced redox reaction in acidic solution for a given equation has to written.

Q: The following chemical reaction takes place in aqueous solution: Fe(NO3)₂(aq) + (NH4), S (aq) → FeS…

Q: The following chemical reaction takes place in aqueous solution: 2 AgNO3(aq)+(NH,),CO;(aq)…

Q: The following chemical reaction takes place in aqueous sol 2 FeBr3(aq)+3 (NH,,S(aq) →Fe,S3(5)+6…

A: The net ionic equation is the chemical equation that shows only those compounds, elements and ions…

Q: The quantity of antimony in a sample can be determined by an oxidation-reduction titration with an…

A: Solution: Sb3+ reacts with bromate in 1:3 mole ratio i.e. 3 mol bromate ion reacts with 1 mol Sb3+.

Q: Complete and balance the following reactions. Also write ionic and net ionic reactions _____…

A: According to the law conservation of matter, a reaction is said to be balanced if all the atoms of…

Q: In the following reaction, which species is the reducing agent? 3 Cu (s) + 6 H* (aq) + 2 HNO3 (aq) →…

A: Reducing agent The element which gets oxidised acts as a reducing agent. Given 3Cu (s) + 6H+ (aq) +…

Q: The following chemical reaction takes place in aqueous solution: CuBr, (aq)+2 NAOH(aq) → Cu…

Q: Identify the oxidizing and reducing agents in the following reaction; (a) 8H*(aq) + 6CI (aq) + Sn(s)…

Q: The following molecular equation represents the reaction that occurs when aqueous solutions of…

A: The compound which present in aquleous solution present as Ionic form, but the solid compound does…

Q: If 25.5 g of NaOH is added to 0.650 L of 1.00 M Cu(NO3)2, how many grams of Cu(OH)2 will be formed…

A: Given, Mass of NaOH = 25.5 grams Molarity of Cu(NO3)2 = 1M Volume of Cu(NO3)2 = 0.650 liter…

Q: 2. Write the balanced ionic equation for this reaction, and identify the spectator ions in the…

A: The given reaction is, CaCl2aq+2AgNO3aq→CaNO32aq+2AgCls......(1) In the aqueous solution, CaCl2…

Q: Complete & balance the equation for the ionization of Ba(OH), in water. Ba(OH), (aq)

A: Given, Ionisation of Ba(OH)2 in water.

Q: РЫ(ОН)д (аq) 2- + CIO (aq) > РЬО2 (s) + Cl* (aq)

Q: In the following redox reaction, what are the reducing agent, and the oxidizing agent, respectively?…

A: The reaction given is Cl2 (aq) + 2 Fe2+ (aq) → 2 Cl‾ (aq) + 2 Fe3+ (aq)

Q: Complete and balance the following molecular reaction. Write the ionic and net ionic reactions.…

A: HNO3 is a strong acid and Ba(OH)2 is a base. Thus they reacts and undergo neutralisation reaction to…

Q: The following chemical reaction takes place in aqueous solution: FeBr,(aq)+K,S(aq) →FES(s)+2 KBr(aq)…

Q: The amount of I (aq) in a solution can be determined by titration with a solution containing a known…

Q: Balance the following equation and write the sum of the coefficients of the reactants and products…

A: A balanced chemical equation is an equation which has an equal numbers of atoms on both side…

Q: ionic equations

Q: The following reaction occurs in basic solution: _ H2O(aq) + _ MnO4–(aq) + _ ClO–(aq) → _ MnO2(s) +…

A: The oxidation number of the Mn in MnO4- ion and Cl in ClO- ion is +7 and +1 respectively. Also, the…

Q: Balance the reaction in both in acid solution and in basic solution. CrO42 (aq) + SO3² (aq) →…

Q: The following chemical reaction takes place in aqueous solution: 2 AgF(aq)+(NH,),CO;(aq)…

Q: Te following chemical reaction takes place in aqueous solution: MnCl, (aq)+2 KOH(ag) →…

A: Write the balanced molecular equation Split electrolytes to their corresponding ions to achieve…

Q: The quantity of antimony in a sample can be determined by an oxidation-reduction titration with an…

A: Given Mass of sample = 6.05 g Volume of KBrO3 = 23.7 ml Molarity of KBrO3 = 0.145 M Standard values…

Q: Balance the following in both acidic and Basic solutions. N2O4(2) + Br(aq) + Br (aq) NO2 (aq) + BrO3…

A: The given redox reaction is: N2O4g+Braq-⇌NO2aq-+BrO3aq-

Q: What concentration of Zn is present in solution when 5.93 g of zinc metal is used to displace…

Q: The following chemical reaction takes place in aqueous solution: AgF(aq)+KI(aq) →AgI(s)+KF(aq) Write…

A: The reaction given is AgF (aq) + KI (aq) -----> AgI (s) + KF (aq)

Q: The following chemical reaction takes place in aqueous solution: 2 AgF(aq)+K,S(aq) → Ag,S(s)+2…

A: To determine whether or not a reaction occurs, we use the solubility rules. If both products are…

Q: What is the net ionic equation for the neutralization reaction that occurs between HCHO2 (aq) and…

Q: e following chemical reaction takes place in aqueous solution: Sn (NO,),(aq)+2 KOH(aq) → Sn…

A: The given reaction is:Sn(NO3)2 (aq) + 2KOH(aq) →Sn(OH)2 (s) +2KNO3 (aq)

Q: Write the net ionic equation, including phases, that corresponds to the reaction Cu(NO,),(aq) +…

A: GIVEN: Reaction:

Q: In the following chemical reaction, which element is the reducing agent? 2 Ag(s) + 2CI(aq) + 2…

Q: In the following reaction, what ions (if any) are spectator ions? AgNO3 (aq) + 2NaI (aq) -> AgI…

A: The ionic reaction for the above molecular reaction will be as shown below Ag+ + NO3- + Na+ + I-…

Q: The following chemical reaction takes place in aqueous solution: AgF(aq)+KBr(aq) →AgBr(s)+KF(aq)…

A: An aqueous solution of silver fluoride reacts with the aqueous solution of potassium bromide to form…

Q: The following chemical reaction takes place in aqueous solution: AGNO3(aq)+NaBr(aq)AgBr(s)+NaNO,(aq)…

A: Given: The reaction is as follows: AgNO3(aq) + NaBr(aq)---------->AgBr(s) + NaNO3(aq)

Q: 1. What are the spectator ions and the net ionic equation in the reaction between Mg(OH)2 (aq) and…

A: The spectator ions are one which do not undergo any chemical change in the reaction, they remain the…

Q: Balance the following equation, in basic solution, BrO (aq) + C8H18O2(aq) → BrO¯(aq) + HCO3(aq)

Q: Complete and balance the following redox reaction in acidic solution…

A: A redox reaction is that reaction in which there is simultaneous oxidation and reduction. The…

Q: The following chemical reaction takes place in aqueous solution: 2 FeBr,(aq)+3 (NH,) S(aq)…

A: Balanced equation means number of atom in reactant side is equal to number of atom in product side.

Q: Write a balanced net ionic equation for a redox reaction that results in the formation of potassium…

A: Here we have to write balanced net ionic equation for above given reaction-

Q: The amount of (aq) in a solution can be determined by titration with a solution containing a known…

A: 1) As the balanced chemical equation shows, 2 moles of requires 1 mole of ions. Thus, 1 mole of…

Q: Balance the following oxidation–reduction equation in basic solution. ClO−(aq) + Cr2+(aq) →…

A: In this question, we want to balanced the Redox Reaction in basic medium.

Q: In the following equation Zn(s)+2HCl(aq) → ZnCl2(aq)+H2(g), what is the -species reduced -the…

A: The objective of the question is to figure out from the given chemical equation for the reaction,…

Q: Complete and balance the following redox reaction in acidic solution…

Q: In the following chemical reaction, which element is the reducing agent? 3 Sn(NO₃)₂(aq) + 2 Fe(s) →…

A: The element which helps in reduction of the other element is known as reducing agent And since the…

Q: The following chemical reaction takes place in aqueous solution: MgCl,(aq)+2 KOH(aq)…

A: We have to predict the net ionic equation.

Q: what is the balance chemical equation, complete ionic equation, and net ionic equation for CuSO4…

A: Product is CuCl2 (s) and (NH4)2SO4 (aq)

Question

Write down the net ionic equation for the reaction below

2+
Cu(s) + 4NH3 (aq)+ H2O2(aq) → Cu(NH3)4"(aq)+20H (aq)

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Answer

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Identify the oxidizing agent and reducing agent, respectively, in the following reaction: Cl2 (aq) + 2I negative (aq) to 2Cl negative (aq) + I2 (aq)
Describe the reaction Cu(NO3)2 (aq) + NaOH (aq) →
please give the E° of this equation! Cr(NO3)2 + AgNO3 → Cr(NO3)3 + Ag
2 Cr(s) + 3 Pb²⁺(aq) ⟶ 3 Pb(s) + 2 Cr³⁺(aq), what is the value of n in the Nernst equation?
In the following chemical reaction, which element is the reducing agent? 3 Sn(NO₃)₂(aq) + 2 Fe(s) → 2 Fe(NO₃)₃(aq) + 3 Sn(s)
Balance the following reaction in acidic solution. Cr2O72-(aq)+HNO2(aq)→Cr3+(aq)+NO3−(aq) Fill in the coefficients and substances for the balanced overall equation. .
The following reaction occurs in basic solution: _ H2O(aq) + _ MnO4–(aq) + _ ClO–(aq) → _ MnO2(s) + _ ClO4–(aq) + _ OH–(aq) When the equation is properly balanced, what is the sum of the lowest whole-number coefficients? a. 9 b. 10 c. 20 d. 12 e. 6
In the following equation Zn(s)+2HCl(aq) → ZnCl2(aq)+H2(g), what is the -species reduced -the reducing agent -the species oxidized -the oxidizing agent
Cr(OH)3 (s) + Cl2 (g) → Na2CrO4 (aq) + NaCl (aq) balance in basic solution
Balance the following oxidation–reduction equation in basic solution. ClO−(aq) + Cr2+(aq) → Cr2O72−(aq) + Cl2(g)
Compose the balanced reaction equation for the following reaction occuring in basic aqueous medium.Reduce all coefficients to the lowest possible integers. Fe(CN)64−(aq)+Ce4+(aq) → Ce(OH)3(s)+Fe(OH)3(s)+CO32−(aq)+NO3−(aq)
net ion 4