3. Calculate the standard enthalpy of formation of acetylene (C2H2) from its elements:C(graphite) + O2(g) → CO2(g)H2(g) + 0,(g)2C,H2(g) + 502(g)H,O(I)→ 4CO2(g) + 2H2O(l) AHn =AHan = -393.5 kJ/molAHan = -285.8 kJ/mol- 2598.8 kJ/mol%3!

3. Calculate the standard enthalpy of formation of acetylene (C2H2) from its elements: C(graphite) + 02(g) H2(g) + 0;(g) 2C,H2(g) + 502(g) CO2(g) H,O(1) AHan = - 393.5 kJ/mol AHan = ΔΗ - 285.8 kJ/mol → 4CO2(g) + 2H;O(1) AHan - 2598.8 kJ/mol %3D

3. Calculate the standard enthalpy of formation of acetylene (C2H2) from its elements: C(graphite) + 02(g) H2(g) + 0;(g) 2C,H2(g) + 502(g) CO2(g) H,O(1) AHan = - 393.5 kJ/mol AHan = ΔΗ - 285.8 kJ/mol → 4CO2(g) + 2H;O(1) AHan - 2598.8 kJ/mol %3D

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter6: Thermochemistry

Section: Chapter Questions

Problem 77E: Give the definition of the standard enthalpy of formation for a substance. Write separate reactions...

See similar textbooks

Related questions

Q: Calculate the standard enthalpy of formation of NO(g) (in kJ/mol) from the following data. N2(9) + 2…

A: N2(g) + 2O2(g) -------> 2NO2(g). ∆H0298 = 66.4 kJ 2NO(g)+ O2(g)---------> 2NO2(g).…

Q: Calculate the enthalpy of combustion of propane, C3H8(g), for the formation of H2O(g) and CO2(g).…

A: The standard enthalpy of formation is also known as the standard heat of formation of a compound. It…

Q: Indicate the sign of the enthalpy change, ΔH, in the following processes carried out under…

A: When a reaction takes place, various bonds are formed and broken. Due to this, the energy of…

Q: Ethane is flamed off in abundance from oil wells, because it is unreactive and difficult to use…

A: Given:

Q: Many portable gas heaters and grills use propane, C3H8(g), asa fuel. Using standard enthalpies of…

A: Thermodynamic is the branch of chemistry that mainly deals with the heat transfer between system and…

Q: 3. Calculate the standard enthalpy of formation of acetylene (C2H2) from its elements: - 393.5…

A: Given equation are:

Q: The heats of combustions of carbon and carbon oxide are: C(s) + O2(g) --> CO2(g) H= -393 kJ…

A: Solution is based on Hell's law i,e., whether the reaction occurs in single step or in certain small…

Q: 2. Determine the standard enthalpy of formation for the following reaction! CH3CI + C12 →CH2C12 +…

Q: 5. From the following heats of combustion, 3 CH,OH + Oe → COue) +2H,Ou 2(8) AH° =-726.4kJ (1) 2(g) 2…

A: If we reverse any reaction sign will change of ∆H but magnitude remain same We multipy may equation…

Q: (b) (i) Acetylene, C2H2 is a colourless gas which is widely used as a fuel and a chemical building…

A: Given, ∆Hof of CO2 = - 393.5 KJ mol-1 ∆Hof of H2O = - 393.5 KJ mol-1 ∆Hof of C2H2 = - 393.5 KJ mol-1…

Q: Calculate the standard enthalpy of combustion for the following reaction: C6H12O6(s) + 6O2(g) --->…

A: Introduction: The enthalpy of combustion is the amount of energy released when one mole of a…

Q: Given the enthalpies of combustion of propane (C3 H8), carbon and hydrogen, C3H3(g) + 502(g) →…

Q: Part 3 out of 3 (e) Determine the standard enthalpy of formation of ethanol (C₂H5OH) from its…

Q: The Martian In the motion picture The Martian, a stranded astronaut uses hydrazine, N,H4, to produce…

Q: 5. The enthalpy change for the oxidation of naphthalene, C10H8, is AH =-5156kJ /mol C1, H) +120e)…

Q: The standard enthalpy of combustion of octane, C8H180 is -5471 kJ-mol-1. The standard enthalpies of…

A: Given, Standard enthalpy of combustion of C8H18 (l) = ΔH0 = -5471 KJ/mole Standard enthalpy of…

Q: Combustion of table sugar produces CO2 (g) and H2O( l). When 1.46 g table sugar is combusted in a…

A: a) The balanced chemical equation is,

Q: Find the standard enthalpy of formation of ethylene, C2H4(g), given the following data:

A: The given problem relates to Hess's law, which states that the amount of heat evolved or absorbed in…

Q: From the following heats of combustion, CH3OH(1) + 02(g) → CO;(g) + 2H,O(1) AH =-726.4 kJ/mol rxn…

Q: A scientist measures the standard enthalpy change for the following reaction to be -1152.8 kJ:…

Q: 12) From the following heats of combustion, CH,OH(1) + 0,(8) CO.(g) + 2H,0(1) AHn = -726.4 kJ/mol →…

A: 12) Given chemical reaction is, C(graphite) + 2H2(g) + 1/2O2 ---> CH3OH(l) The given reactions…

Q: Ethanol, C2H5OH, undergoes combustion in oxygen to produce carbon dioxide gas and liquid water…

Q: A scientist measures the standard enthalpy change for the following reaction to be -145.7 kJ :…

A: The enthalpy of the reaction is considered as the state function that is it depends only on the…

Q: A scientist measures the standard enthalpy change for the following reaction to be 80.1 kJ:…

A: Solution- ∆Hreaction=2∆HofFe2O4+∆Hof(H2O)- 3∆HofFe2O4+∆Hof(H2)∆Hreaction=2∆HofFe2O4+(-241.818kJ)-…

Q: 5b. The Standard Molar Enthalpy of Formation (AH° f ) of hydrogen cyanide, (HCN(g)), cannot be…

Q: A scientist measures the standard enthalpy change for the following reaction to be -184.6 kJ :…

A: Applying standard condition of change in entropy of reaction.

Q: Ammonium sulfate, (NH,),SO4, is used as a fire retardant and wood preservative; it is prepared…

A: Molar mass of (NH4)2SO4 = 132 g/mol Standard enthalpy of formation of ammonium sulfate ( in…

Q: A 0.05mol sample of methane, CH4, is combusted under a calorimeter containing 250mL of H20. If the…

Q: 3. A coffee-cup calorimeter is used to determine the heat of reaction for the acid-base…

Q: nearly odorless, but the commercial product smells vile. Carbon disulfide is used in the manufacture…

A: Form given data , calculate the standard enthalpy change for given reaction :

Q: . Calculate the standard enthalpy of formation of hexane 6C(s) + 7H2(g) ---> C6H14(ℓ) Eq1.…

A: According to Hess's law, the enthalpy change of the final reaction can be calculated by adding the…

Q: A 222.5 mg sample of sucrose (C12H2O11) is combusted in a bomb calorimeter. The temperature of the…

A: According to the mole concept, in terms of mass, the amount of substance in moles is equal to the…

Q: 11.00 g of Compound X with molecular formula C,H, are burned in a constant-pressure calorimeter…

A: 11.00 g of C3H5 is burned in a constant pressure calorimeter, contains 50.00 Kg of water at 25 ◦ C.…

Q: A student burnt 0.40 g of ethanol using a calorimeter filled with 150 cm³ of water and noted a…

Q: calculate the standard enthalpy of reaction for the imaginary reaction XxA2(g) + 2 Z2(I) -->…

A: Given, XxA2(g) + 2 Z2(I) --> XxZ4(g) + 2 A(g) Standard enthalpy of the reaction (∆H°rxn) = ?…

Q: Given information 4C (s) +3 H2 (g) - The standard enthalpy of formation for H;0 (e) is b k/mol. CHe…

A: By using experiement we can get required equation

Q: For a particular isomer of C,H8, the combustion reaction produces 5113.3 kJ of heat per mole of…

A: Given C8H18 (g) + 25/2 O2 (g) -> 8 CO2 (g) + 9H2O (g) Enthalpy of reaction = -5113.3 KJ mol-1 To…

Q: 73. Calculate the enthalpy of combustion of butane, C4H10(g) for the formation of H2O(g) and CO2(g).…

A: Balanced Combustion RxnC4H10g+B2O2g→5H2O+4CO2g2C4H10g+BO2g→10H2Og+8CO2gStandard Enthalpy of…

Q: The standard molar enthalpy of formation of diborane, B₂H₁ (g), cannot be determined directly…

Q: 3. A quantity of 2.00 x 10² mL of 0.862 M HCl is mixed with 2.00 x 10² mL of 0.445 M Ba(OH), in a…

Q: Use the following thjt Fermentation of fruits and grains converts glucose to ethanol and carbon…

A: Given, Fermentation of fruits and grains converts glucose to ethanol and carbon dioxide. The…

Q: Calculate the enthalpy of combustion (kJ/mol) of methyl linoleate (C₁₉H₃₄O₂), an important component…

Q: Methanol (CH3OH) is an organic solvent and is also used as a fuel in some automobile engines. From…

A: Welcome to bartleby !

Q: From the following heats of combustion, CH;OH(1) + 3/2O2(g) → CO2(g) + 2H2O(1) A,H° = -726.4 kJ mol…

Q: 2.Use standard enthalpies of formation from Table 1 to determine the standard enthalpy hanges in the…

A: The problem is solved by enthalpy change concept.

Q: Consider the combustion of liquid C₅H₈ in oxygen gas to produce carbon dioxide gas and water vapor.…

A: Specific heat capacity C is defined as the amount of heat that must be supplied in order to raise…

Q: (a) What is the value of the standard enthalpy of formationof an element in its most stable form?…

A: At standard condition, the enthalpy (energy) change essential for producing any compound's 1-mole…

Q: Calculate the enthalpy of reaction for the combustion of 9.25 g of butane, C4H10, using the…

A: Given data - Enthalpy of formation - CO2(g) = -394 kJ/mol; H2O(l) = - 286 kJ/mol; C4H10(g) = -484…

Q: E2C.2(b) The standard enthalpy of formation of phenol is -165.0kJ mol. Calculate its standard…

A: Given: Standard enthalpy of formation of phenol = -165.0 kJ/mol The combustion of a compound gives…

Q: 2. Calculate the molar enthalpy of combustion in a reaction where the enthalpy change is -109KJ and…

Question

3. Calculate the standard enthalpy of formation of acetylene (C2H2) from its elements:
C(graphite) + O2(g) → CO2(g)
H2(g) + 0,(g)
2C,H2(g) + 502(g)
H,O(I)
→ 4CO2(g) + 2H2O(l) AHn =
AHan = -393.5 kJ/mol
AHan = -285.8 kJ/mol
- 2598.8 kJ/mol
%3!

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

The enthalpy of combustion of diamond is -395.4 kJ/mol. C s, dia O2 g CO2 g Determine the fH of C s, dia.
White phosphorus, P4, ignites in air to produce P4O10. When 3.56 g P4 is burned, 85.8 kJ of thermal energy is evolved at constant pressure. Calculate the combustion enthalpy of P4.
In a constant-volume calorimeter, 35.0g of H2cools from 75.3C to25.0C. Calculate w, q, U, and H for the process.
The head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?
Another reaction that is used to propel rockets is N2O4(l)+2N2H4(l)3N2(g)+4H2O(g) This reaction has the advantage that neither product is toxic, so no dangerous pollution is released. When the reaction consumes 10.0 g liquid N2O4, it releases 124 kJ of heat. (a) Is the sign of the enthalpy change positive or negative? (b) What is the value of H for the chemical equation if it is understood to be written in molar quantities?
One of the components of jet engine fuel is n-dodecane, C12H26(), which has a standard enthalpy of combustion of 8080.1 kJ/mol. (a) Write the thermochemical equation for the combustion of n-dodecane. (b) Use the standard enthalpies of formation in Appendix G to calculate the standard enthalpy of formation of n-dodecane.
Combustion reactions involve reacting a substance with oxygen. When compounds containing carbon and hydrogen are combusted, carbon dioxide and water are the products. Using the enthalpies of combustion for C4H4 ( 2341 kJ/mol), C4H8 (2755 kJ/mol), and H2 (286 kJ/mol), calculate H for the reaction C4H4(g)+2H2(g)C4H8(g)
A sample of ethanol, C2H5OH, weighing 2.84 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 33.73C. If the heat capacity of the calorimeter and contents was 9.63 kJ/C, what is the value of q for burning 1.00 mol of ethanol at constant volume and 25.00C? The reaction is C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) Is q equal to U or H?
Chloroform, CHCl3, is formed from methane and chlorine in the following reaction. CH4(g) + 3 Cl2(g) 3 HCl(g) + CHCl3(g) Calculate rH, the enthalpy change for this reaction, using the enthalpies of formation of CO2(g), H2O(), CHCI3(g) (fH = 103.1 kJ/mol), and the enthalpy changes for the following reactions: CH4(g) + 2 O2(g) 2 H2O() + CO2(g) rH = 890.4 kJ/mol-rxn 2 HCl(g) H2(g) + Cl2(g) rH = +184.6 kJ/mol-rans
Ethylene glycol, HOCH2CH2OH, is used as antifreeze. It is produced from ethylene oxide, C2H4O, by the reaction C2H4O(g)+H2O(l)HOCH2CH2OH(l) Use Hesss law to obtain the enthalpy change for this reaction from the following enthalpy changes: 2C2H4O(g)+5O2(g)4CO2(g)+4H2O(l);H=2612.2kJHOCH2CH2OH(l)+52O2(g)2CO2(g)+3H2O(l);H=1189.8kJ
Ethanol, C2H5OH, is used as a fuel for motor vehicles, particularly in Brazil. (a) Write the balanced equation for the combustion of ethanol to CO2(g) and H2O(g), and, using the data in Appendix G, calculate the enthalpy of combustion of 1 mole of ethanol. (b) The density of ethanol is 0.7893 g/mL. Calculate the enthalpy of combustion of exactly 1 L of ethanol. (c) Assuming that an automobile’s mileage is directly proportional to the heat of combustion of the fuel, calculate how much farther an automobile could be expected to travel on 1 L of gasoline than on 1 L of ethanol. Assume that gasoline has the heat of combustion and the density of n—octane, C8H18(Hf=208.4kJ/mol;density=0.7025g/mL).
sample of natural gas is analyzed and found to be88.4% methane (CH4) and 11.6% ethane (C2H6) bymass. The standard enthalpy of combustion of methaneto gaseous carbon dioxide (CO2) and liquid water (H2O) is -891 kJ/mol. Write the equation for the combustionof gaseous ethane to carbon dioxide and water.Calculate the standard enthalpy of combustion of ethaneusing standard enthalpies of formation from Table R-11on page 975. Using that result and the standard enthalpyof combustion of methane in Table 15.3, calculate theenergy released by the combustion of 1 kg of natural gas.

SEE MORE QUESTIONS

Recommended textbooks for you

Chemistry

ISBN:

9781133611097

Author:

Steven S. Zumdahl

Publisher:

Cengage Learning

Chemistry

ISBN:

9781305957404

Author:

Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:

Cengage Learning

Chemistry: An Atoms First Approach

Chemistry

ISBN:

9781305079243

Author:

Steven S. Zumdahl, Susan A. Zumdahl

Publisher:

Cengage Learning

Chemistry & Chemical Reactivity

Chemistry

ISBN:

9781337399074

Author:

John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Publisher:

Cengage Learning

General Chemistry - Standalone book (MindTap Cour…

Chemistry

ISBN:

9781305580343

Author:

Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; Darrell

Publisher:

Cengage Learning

Chemistry: Principles and Practice

Chemistry

ISBN:

9780534420123

Author:

Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:

Cengage Learning

Chemistry

ISBN:

9781133611097

Author:

Steven S. Zumdahl

Publisher:

Cengage Learning

Chemistry

ISBN:

9781305957404

Author:

Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:

Cengage Learning

Chemistry: An Atoms First Approach

Chemistry

ISBN:

9781305079243

Author:

Steven S. Zumdahl, Susan A. Zumdahl

Publisher:

Cengage Learning

Chemistry & Chemical Reactivity

Chemistry

ISBN:

9781337399074

Author:

John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Publisher:

Cengage Learning

General Chemistry - Standalone book (MindTap Cour…

Chemistry

ISBN:

9781305580343

Author:

Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; Darrell

Publisher:

Cengage Learning

Chemistry: Principles and Practice

Chemistry

ISBN:

9780534420123

Author:

Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:

Cengage Learning

SEE MORE TEXTBOOKS