4. Glucose containing 4Catoms was added to isolated hepatocytes in an experiment.Ifthe glucose was added in excess, the rate of triacylglycerol synthesis increased.The determination of carbon atoms in the triacylglycerol molecule confirmedthat all carbon atoms in glycerol and fatty acids were "C atoms. Explain theresults of the experiment. For that:a) name the mectabolites required for triacylglycerol synthesis, which areproduced by glucose catabolism;b) draw the scheme of glucose catabolism to metabolites required fortriacylglycerol synthesis which would explain the appearance of 4C atoms inthe triacylglycerol molecule;c) draw the scheme representing the conversion of extra glucose totriacylglycerols in the liver.

Triglyceride molecules are the most common way for fatty acids to be stored and transported within…

Answered: 4. Glucose containing Catoms was added…

Biology: The Dynamic Science (MindTap Course List)

4th Edition

ISBN:9781305389892

Author:Peter J. Russell, Paul E. Hertz, Beverly McMillan

Publisher:Peter J. Russell, Paul E. Hertz, Beverly McMillan

Chapter7: Cellular Respiration: Harvesting Chemical Energy

Section: Chapter Questions

Problem 7TYK

See similar textbooks

Similar questions

4. What is the role of decarboxylation in fatty acid synthesis? Describe another process discussed in this Biochemistry I course that uses decarboxylation for the same purpose.
1.One of the main sources of sphingosine in the body is in the cell membrane. What complication could arise from the biological synthesis of ceramide?
1. Draw the structure of a cholesterol ester where cholesterol is esterified with palmitic acid. is this polar or nonpolar acid 2. Draw the strucutre of lecithin containing stearic acid on carbon 1 and arachidonic acid on carbon 2 of glycerol. is this polar or nonpolar acid 3.Disccuss the medical sginificance of cholesterol , cholesterol ester,l ecithin and choline . 4. Give examples of phosphoglycerides and sphingolipids of biological importance .
1. What is the number of ATP molecules that will be produced from the beta oxidation of a 22 carbon saturated fatty acid?
1. Assuming that everything that’s needed to make tripalmitin comes from glucose, how many glucose would be used by adipose tissue in the synthesis of 1 mol tripalmitin? 2. How many ATP would be used (net of produced and used)? 3. If an animal absorbs 35 g glucose (MW = 180 g/mol) from drinking a can of pop, how many grams of tripalmitin (MW = 807 g/mol) can be produced from it in adipose tissue? Please provide only typed answer solution no handwritten solution needed allowed
1. Compare the β-oxidation of fatty acid with that of the fatty acid synthesis.
1. Name the process by which rice can become porridge or congee. Give details of the process in relation to the example. 2.(a) What is the name of the fat after hydrogenation? Draw a hydrogenated fatty acid. (Please include the atoms involved in the molecule) 2.(b) Give an example of hydrogenated fats from vegetable oil. How are these fats harmful to our health? 4. Briefly describe the digestion of this form of carbohydrate described in (iv) in mouth and small intestine before absorption. 6. Part Stomach secretes a chemical that makes it to have a low pH. Name this chemical and give TWO functions of this chemical. 6.e One structural feature in F facilitates absorption of nutrients. Name this structure.
1.Linoleic acid and linoleic acid cannot be synthesized in human tissues, because of _____. * a.Human cells cannot synthesize unsaturated fatty acids. b.Human cells can synthesize only mono-unsaturated fatty acids. c.The corresponding biosynthetic pathway was lost during evolution. d.Humans are diploid organisms; only polyploidy organisms have enough genes for the synthesis of these fatty acids 2.What product could be formed from the breakdown of amylopectin and cellulose? * a.Cellulose could be broken down into chitin b.Cellulose could be broken down into sucrose c.Amylopectin could be broken down into maltose d.Amylopectin could be broken down into glucosamine 3. Which characteristics distinguishes amylopectin and glycogen? * a.Only glycogen has a coiled shape. b.They have different degrees of branching c.Only amylopectin can form hydrogen bonds d.They have different types of glycosidic bond
1. Draw the structure of triglyceride containing the fatty acids palmitic, oleic, and linoleic. How many Hydrogen atoms are needed in the its catalytic hydrogenation? 2. Draw the structure of Phosphatidylserine that contains oleic and arachidonic acid. What role does it play in the cell?
When glucose reacts with ATP to form glucose-6-phosphate: a. the synthesis of glucose-6-phosphate is exergonic. b. ADP is at a higher energy level than ATP. c. glucose-6-phosphate is at a higher energy level than glucose. d. because ATP donates a phosphate to glucose, this is not a coupled reaction. e. the reaction is spontaneous.
1. In Clinical Chemistry, are enzymatic methods for determining glucose, cholesterol and uric acid more preferred than non-enzymatic methods? Why or Why not?
3. One of the triacylglycerols found in corn oil contains palmitic acid, linoleic acid, and linolenic acid. During the production of spreadable margarine, all of the double bonds in this triacylglycerol are converted from cis to trans isomers. Linoleic acid: CH3(CH2)4CH=CHCH2CH=CH(CH2)7COOHLinolenic acid: CH3CH2CH=CHCH2CH=CHCH2CH=CH(CH2)7COOH Palmitic acid: CH3(CH2)14COOH a. Identify the unsaturated fatty acid(s) listed above and provide the associated omega designation. b. Draw an accurate representation of the structure of the triacylglycerol present in spreadable margarine. Circle all ester bonds in the structure you have drawn.

SEE MORE QUESTIONS

Recommended textbooks for you

Biology: The Dynamic Science (MindTap Course List)

Biology

ISBN:

9781305389892

Author:

Peter J. Russell, Paul E. Hertz, Beverly McMillan

Publisher:

Cengage Learning

Biology: The Dynamic Science (MindTap Course List)

Biology

ISBN:

9781305389892

Author:

Peter J. Russell, Paul E. Hertz, Beverly McMillan

Publisher:

Cengage Learning

SEE MORE TEXTBOOKS