4. What is the correct formula for the ester produced when ethyl alcohol, CH3CH2-OH, is reacted with butyric acid (CH,CH,CH,-Ĉ-OH)

Q: Consider the molecule N-ethyl-N-methyl-3-iodo-4-methyl hexanamide. Draw it and give the two…

A:

Q: b) CH-CH-CH-OH 5. Complete the following oxidation reactions for alcohols. Draw the structure of the…

A: These are the Reactions in Which alcohol group is oxidized to Ketone or aldehyde  depending  upon…

Q: Select the general class of compounds you would expect to have the highest boiling point. A.…

A: Ans - > D) Alcohol  Because alcohol have Intermolecular  hydrogen bonding. Required high energy…

Q: CH,OH O CH,OH Но ÓCH,CH, ΟΗ ΟΗ b. НОСН OCH,CH,CH, OH OH

A: The explanation is given below-

Q: Fill in the blanks: Identify the functional groups. CH2C-OCH3

A: A functional group are group of atoms or molecules which are used to determine the properties of an…

Q: OH

A:

Q: TRUE OR FALSE: Dilute phosphoric acid is a dehydrating agent * O TRUE O FALSE Grignard Synthesis is…

A: 1. False .  Because concentrated phosphoric acid acts as dehydrating agent. 2. False. Grignard…

Q: Consider the following compounds: ОН B C A E F H OH A) Which of these compounds can be reduced to…

A: There are some organic molecules  which are as follows --- A) It is a compound containing alcohol…

Q: Name the functional group Si-O-Si and C-O-O

A: The groups which are responsible for the characterstics of a compound are called functional groups.

Q: CH3 CH-CH-CH-ОН

A: Condensed structural formula for given alchol is (CH3)2CHCH2OH OXIDATION OF ALCHOL

Q: Often the main functional group of a molecule can be determined from the name. Fill in the blank of…

A: 1. Functional group in glycerol = -OH (alcohol)  Glycerol contains 3 -OH groups in its structure.…

Q: The monomers and H2N- -NH2 но— -(CH2)«- would react with each other to form a polycarbonate a…

A: The reactant monomers given are,

Q: 3. Write the condensed structural formula of the organic products for ethyl ethanoate when it reacts…

A: On reaction of NaOH and H2O/HCl the following products are formed

Q: The monomers NH2 and HO-C (CH FOH would react with each other to form a polyamide a polycarbonate a…

A:

Q: what is the name of CH3COO-

A: CH3COOH (aq) + H2O(l) <---> CH3COO-(aq) + H3O+(aq)  According to Lewis Concept, A substance…

Q: Are n-hexane and 1-hexene lipids?

A: The question is based on the concept of biomolecules. we have to identify whether the given…

Q: Name each carboxylic acid or ester. c. CH;-CH-CH2-CH2-CH2-C-OH CH,

A: Given,

Q: Q2 Decide whether it's True or False in each of the following? 1- Reaction of 2,3-dibromohexane with…

A: Note: Since we only answer up to 3 sub-parts, we’ll answer the first 3. Please resubmit the question…

Q: 3. The reaction of water with alkene to produce an alcohol is a/an C. Combustion D. Addition…

A: Addition reaction is the reaction which helps in conversion of alkene into alcohol.

Q: 2. Can tertiary alcohols be oxidized? Why or why not?i beh

A: In tertiary alcohols, the -OH group is attached to the carbon that is attached to the three alkyl…

Q: Consider erucic acid whose formula is CH3(CH2)7CH=CH(CH2)11COOH. It is a. Two of the choices are…

A: Omega fatty acids- these are long chain of hydrocarbons in which the fatty acids are attached at the…

Q: Refer to the following structures: K cont mo NH₂ CH₂-CH-C-OH OI, II, III OI, VI O III, V OI, IV OVI…

A: Esters are compounds with R-CO-R group.

Q: what are the functional groups in Adenosine Triphosphate

A: Adenosine triphosphate is known as ATP.

Q: Explain the Functional group of Compounds Containing a C=O Group ?

A: Carbonyl group  It is a functional group containing carbon atom double bonded to oxygen atom. The…

Q: Is the compound CH3CH=CH2 saturated or unsaturated? Explain.

A: Saturated Hydrocarbons — contain only carbon- carbon single bonds. Saturated hydrocarbons are named…

Q: what is the correct IUPAC name for Ca(C₂H₃O₂)₂?

A: The IUPAC nomenclature of inorganic chemistry is a systematic method of naming inorganic chemical…

Q: 3. What is the clinical significance of the sodium nitroprusside test? 4. What is the basis of the…

A:

Q: Draw the chemical structures for ethyl acetate, acetone, methyl alcohol, and n-hexane.

A:

Q: When an carboxylic acid reacts with an alcohol, the product is called a(n) a. amide b. diester c.…

A: Carboxylic acid has carboxyl group (C(=O)(OH) attached to an R-group. General formula is R-COOH,…

Q: 24.48 Circle and name the functional group in cach compound. a. CH-C-OH b, 0=C-OH 16,17 CH,CHCH,

A:

Q: Draw the structure of 5‑methyl‑3‑heptyne.

A: Parent chain (Longest chain) contains seven carbons. triple bond (C≡C)  is at 3rd carbon and Methyl…

Q: CH-C-CH;-CH, 16. Name the functional group shown in the figure above. e aldehyde d. ketone A ester b…

A: The functional groups in any organic molecule are the substituent that causes the molecule to show…

Q: Question 32 Chemical reactions involving alkanes in which hydrogen atoms are removed and the product…

A:

Q: Write the structural formula of the ester that, when hydrolyzed, would yield the following:

A: Ester under hydrolysis gives carboxylic acid and alcohol. In ester the carbonyl carbon group…

Q: 1. What is the product of this reaction? Also, name the functional groups present in the product. O…

A: Since you are posted with multiple questions. As per the rule, I am answering the first question…

Q: Draw structures for the following compounds.  Show all of the  hydrogen atoms in the molecules.…

A:

Q: Which of the following compounds is a fatty acid? А. HO, В. NH2 C. С. HOʻ D. /

A: Compounds containing -COOH group in their structure is considered as carboxylic acid. Fatty acids…

Q: Write the reaction equation of hydrochloric acid, HCl, reacting with triethylamine (CH3CH2)3N.

A: CH3CH23NTriethyl amineAmines are considered as a derivative of Ammino replacement of one , Two or…

Q: 4. The organic starting materials for the preparation of an ester could be C. a ketone and alcohol A…

A: The organic starting materials for the preparation of an ester is by reaction of an acid and alcohol…

Q: `H A В а. Which of the following compounds are considered non-polar? b. Which of these compounds has…

A: The questions are based on the concepts of organic chemistry. amines contain intermolecular hydrogen…

Q: 3) the complete combustion of ethanol 4) an elimination reaction of 2-butanol

A: Alcohols are the compounds that contain the functional group -OH. Alcohols undergo combustion…

Q: what is the major product formed in the hydration reaction of 5-ethyl-2-methyl-2-hexane?

A: Acid  catalyzed  hydration of alkene. Correction  in question  it's  hexene not hexane  if hexane…

Q: Give the name for this molecule: ОН CH3CH2CH2-C- CH2CH3 | CH,CH3

A: The name of the given Molecule will be completely based on IUPAC Nomenclature -

Q: A carboxylic acid reacts with water to form a carboxylate ion and H,O*. Complete the reaction.…

A: Acids dissociate in water to form hydronium ions and a conjugate base.  Strong acids dissociate…

Q: -C - CH2 - C

A: As the compound contains C=O  And this group is bonded with carbon in both sides.

Q: 5- Write down the type of 2-methyl-2-propanol?

A: The presence of one or more hydroxyl (-OH) groups attached to the carbon atom in a chain of…

Diol

In chemistry there are so many chemical compounds that have a hydroxyl group but a chemical compound having two hydroxyl groups (-OH) is termed as a diol. It also implies the presence of two alcohols whereas polyols contain two or more than two hydroxyl groups (-OH). Glycol or 1,2-diol is an aliphatic diol that has two alcohol groups on adjacent carbon atoms. In industries, the most commonly used diol is ethylene glycol.