Can you please answer 5-8 please LD(164) Koryn Hawth xcalorimetryArnazon.com Shop xwhat is the acessbi xG flexi/MTY3MZUXMDEOODI4/a/MjAwMjlzNjE50TYZ/detailsDOpenwitnDoc-ub-PDF Sign a.5) How many joules are required to heat 200 grams of water from 25 °C to 125 "C? (The specific heatcapacity of steam is 1.84 J/g °C)6) How many joules are given off when 120 grams of water are cooled from 25 °C to -25°C? (Thespecific heat capacity of ice is 2.09 J/g °C).7) How many joules are required to heat 75 grams of water from -85 'C to 185 C? (The heat capacity ofsteam is 1.84 J /g °C and The specific heat capacity of ice is 2.09 J/g °C).8) How many joules are required to heat a frozen can of juice (360 grams) from -5°C (the temperatureof an overcooled refrigerator) to 110 "C (the highest practical temperature within a microwave oven).)How many joules are released when 450 grams of water are cooled from 4 x 10 "C (the hottest

"Since you have asked multiple questions, we will solve the first question for you. If you want any…

Answered: 5) How many joules are required to heat…

5) How many joules are required to heat 200 grams of water from 25 °C to 125 C? (The specific heat capacity of steam is 1.84 J/g C)

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter6: Thermochemistry

Section: Chapter Questions

Problem 143IP: A cubic piece of uranium metal (specific heat capacity = 0.117 J/C g) at 200.0C is dropped into...

See similar textbooks

Related questions

Q: How much energy as heat is required to raise the temperature of 50.00 mL of water from 25.04 °C to…

A: Given: Density of water at this temperature is 0.997 g/mL The specific heat capacity of liquid water…

Q: .32 The material typically used to heat metal radiators is water. If a boiler generates water at…

Q: Temperature of 150. g of iron increased from 27.1 °C to 33.1 °C after absorbing 406 J of heat, what…

A: Given data,Mass of iron=150gInitial temperature=27.1oCFinal temperature=33.1oCHeat (Q)=406J

Q: 7.00 Jof heat is added to 10.00g of gold, which is initially at 25°C. The heat capacity of gold is…

Q: How much heat energy would be needed to raise the temperature of a 32.0 g sample of gold [C = 0.129…

A: Given: Mass of sample of gold, m =32.0 g Initial temperature, T1=21.8°C Final temperature, T2=75.0°C…

Q: The specific heat of a certain type of cooking oil is 1.75 J/ (g.°C). How much heat energy is needed…

A: We have to predict the energy needed.

Q: 4. How much heat is absorbed by a 15.5 g piece of gold as it is heated from 4.5 °C to 177.4°C?

A: Given data contains, Mass of gold sample is 15.5g. Specific heat capacity of gold is 0.129 J/g°C.…

Q: ter by 10.0 C? The heat capacity of water is 4.185 J/g C

A: Energy is defined as the ability to do work. Energy can be found in many things and can take…

Q: The specific heat of a certain type of cooking oil is 1.75 J/(g⋅°C).1.75 J/(g⋅°C). How much heat…

A: Answer :- 5.88 × 105 The amount of heat energy needed to raise the temperature of 2.00 kg of…

Q: The specific heat of a certain type of cooking oil is 1.75 J/ (g.ºC). How much heat energy is needed…

Q: How much energy is gained by copper when 68.4 g of copper is warmed from 13.4 °C to 78.4 °C? The…

A: The amount of heat absorbed (or released) by a fixed amount of a substance to change its temperature…

Q: The heat capacity of platinum (Pt, 195.1 g mol-1), is 26.0 J mol-1 K-1. Calculate the energy needed…

A: Q = n S ∆T where m = mass of the given metal = 66.6 g n = W/M = 66.6 g/ 195.1 g/mol = 0.341 mol…

Q: 20.0 J of heat is added to 10.00 g of gold, which is initially at 25°C. The heat capacity of gold…

A: Q = n . s . (T2 - T1) Where, Q = heat absorbed; s = specific heat of substance; n = number of moles…

Q: The specific heat of a certain type of cooking oil is 1.75 J/(g-°C). How much heat energy is needed…

A: Given, Specific heat capacity, c = 1.75 J/g oC Mass, m = 2.59 Kg = 2590 g Change in temperature =…

Q: A 531.6 g sample of sodium undergoes a temperature change of +86.75 °C while absorbing 857.4 joules…

Q: The specific heat of a certain type of cooking oil is 1.75 J/(g·°C). How much heat energy is needed…

A: Amount of heat energy required to raise the temperature of a substance is given by,

Q: 2. How much heat, in joules, is required to raise the temperature of 1.82 Kg of water by 3.32°C?

A: Rise in Temperature (∆T) =3.32 °C Mass of water (m) = 1.82 kg = 1.82 × 103 g Heat (q) =?

Q: A 69.5 g piece of iron at 525°C is put into 627 grams of water at 15.0°C. What is the final…

A: Given Mass of iron = 69.5 g Mass of water = 627 g Initial temperature of iron = 525°C Initial…

Q: The specific heat of a certain type of cooking oil is 1.75 J/(g-°C). How much heat energy is needed…

A: Given: Specific heat of oil = 1.75 J/goC Mass of oil = 2.92 kg Initial temperature = 23oC Final…

Q: How much energy is gained by copper when 68.4 g of copper is warmed from 13.4°C to 78.4 °C? The…

Q: energy (in joules) is needed to heat 200.0 g of water by 10.0 C? The heat capacity of water is…

A: The energy in joules that is needed to heat 200.0 g of water by 10.0 degrees Celsius is to be…

Q: 9. Calculate the energy required to lower the temperature of 23.5 g of Al from 25 °C to 1.0 °C. The…

A: The energy required to lower the temperature of 23.5 g of Al from 25 °C to 1.0 °C is to be…

Q: 9.31 A metal radiator is made from 26.0 kg of iron. The specific heat of iron is 0.449 J/g °C. How…

A: Since you are posted with multiple questions and also you are mentioned as answer item 9.31 only. So…

Q: 7. When 0.63 g of solid LiCI (AHsoln = – 37.1 kJ/mol) dissolves in 5 L of water, how much heat is…

A: Answer :- Heat released (q) when 0.63 g LiCl dissolved in 5 L water = -552.8 (J) = -0.5528 (kJ)…

Q: The specific heat of a certain type of cooking oil is 1.75 J/(g-°C). How much heat energy is needed…

Q: A 24.0 g sample of granite at 100.0 °C was added to 100.0 g of water at 25 °C, and the temperature…

Q: A piece of aluminum with a mass of 4.39 grams is heated to raise its temperature from 21.7°C to…

A: a) Since specific heat capacity of Al is 0.9 J/g.°C Since quantity of heat absorbed is given by Q =…

Q: If 29.00 g of aluminum at 76.45 °C is dropped into 125.7 g of water at 34.04 °C, what will be the…

Q: Which of the following would show the largest temperature change upon gaining 200 J of heat? (s is…

A: The heat is given as the following formula: Q=m×specific heat capacity×∆TQ=Heatm=mass of…

Q: How much heat is required to increase the temperature of a 10.0 gram piece of iron from 25°C to…

A: Heat energy can be calculated as follows

Q: The specific heat of a certain type of cooking oil is 1.75 J/(g⋅°C).1.75 J/(g⋅°C). How much heat…

A: Heat of reaction is difference of energy of product and energy of Reactant.

Q: The specific heat of a certain type of cooking oil is 1.75 J/(g-°C). How much heat energy is needed…

A: The specific heat of cooking oil is = 1.75 J/(g.oC) The mass of cooking oil is = 2.62 kg The…

Q: 9. What would be the final temperature if 8.94 x 103 joules of heat were added to 454 grams of…

Q: How much heat energy is required to raise the temperature of 0.366 kg of copper from 23.0 C to 60 C?…

A: The mass of copper is = 0.366 kg The raise in temperature is = 60-23 = 37oC The heat capacity of…

Q: Calculate the amount of heat (in J) required to raise the temperature of 38 g of iron from 26°C to…

A: q = mc∆T q is the amount of heat energy required m is the mass of substance c is the specific…

Q: 1. A 15.75-g piece of iron absorbs 1086.75 joules of heat energy, and is temperature changes from…

A: Since you have posted multiple questions, we will solve only the first question for you according to…

Q: The specific heat of a certain type of cooking oil is 1.75 J/(g⋅°C).1.75 J/(g⋅°C). How much heat…

A: Q = m . s . (T2 -T1) Where, Q = heat absorbed; m = mass of substance in g; s = specific heat of…

Q: The specific heat of a certain type of cooking oil is 1.75 J/(g⋅°C). How much heat energy is needed…

A: Given data, Mass of oil=2.04kg=2040gInitial temperature=23oCFinal temperature=191oCCoil=1.75J/goC

Q: A 763.9 g sample of hydrogen experiences a temperature change of +27.05 °C. The specific heat…

A: Note : Since you have posted multiple questions, we are entitled to answer the first only. Please…

Q: What is the amount of heat (value of q) when 22.8 g of aluminum is heated from 20.0℃ to 425℃?

A: Given :- mass (m) = 22.8 g Initial temperature (T1) = 20.0 oC Final temperature…

Q: The specific heat capacity of lead is 0.13 J/g-K. How much heat (in J) is required to raise the…

Q: A 340.9 g sample of silver is subjected to a temperature change of -34.29 °C. The specific heat…

A: Note : Since you have posted multiple questions, we are entitled to answer the first only. Please…

Q: 8. How much heat energy is required to raise the temperature of 200 g of water (C = 4.184 J/g-°C)…

A: Applying formula Q= mc∆t

Q: The specific heat of a certain type of cooking oil is 1.75 J/ (g.°C). How much heat energy is needed…

A: We can solve the problem from the following formula : If we consider Heat required = q, then : q = m…

Q: 15.0 J of heat is added to 10.00 g of gold, which is initially at 25°C. The heat capacity of gold…

A: Given: Heat energy (Q) = 15.0 J Mass of metal (m) = 10.0 g Initial temperature of metal = 25.0 oC…

Q: A 158 g sample of gold at some temperature was added to 28.7 g of water. The initial water…

A: Assuming the initial temperature of gold is T. Since the heat lost by gold is gained by water to…

Q: The specific heat of a certain type of cooking oil is 1.75 J/(g-°C). How much heat energy is needed…

Q: What mass of water could be warmed from 24.7°C to 50.6°C by the pellet dropped inside it? Heat…

A: Energy given up by the pellet is equal to heat capacity multiplied with change in temperature, is…

Concept explainers

Analytical Tools

Analytical tools or analysis tools help one to get into a conclusion or results from the data collected. Analytical tools can be applied for simple data sets and also in the case of big data analytics.

Question

Can you please answer 5-8 please

LD(164) Koryn Hawth x
calorimetry
Arnazon.com Shop x
what is the acessbi x
G flexi
/MTY3MZUXMDEOODI4/a/MjAwMjlzNjE50TYZ/details
DOpenwitnDoc-ub-PDF Sign a.
5) How many joules are required to heat 200 grams of water from 25 °C to 125 "C? (The specific heat
capacity of steam is 1.84 J/g °C)
6) How many joules are given off when 120 grams of water are cooled from 25 °C to -25°C? (The
specific heat capacity of ice is 2.09 J/g °C).
7) How many joules are required to heat 75 grams of water from -85 'C to 185 C? (The heat capacity of
steam is 1.84 J /g °C and The specific heat capacity of ice is 2.09 J/g °C).
8) How many joules are required to heat a frozen can of juice (360 grams) from -5°C (the temperature
of an overcooled refrigerator) to 110 "C (the highest practical temperature within a microwave oven).
)How many joules are released when 450 grams of water are cooled from 4 x 10 "C (the hottest

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

Step 2

Step 3

Step 4

Step 5

Step 6

Trending now

This is a popular solution!

Step by step

Solved in 6 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Peanuts and peanut oil are organic materials and bum in air. How many burning peanuts does it take to provide the energy to boil a cup of water (250 mL of water)? To solve this problem, we assume each peanut, with an average mass of 0.73 g, is 49% peanut oil and 21% starch; the remainder is noncombustible We further assume peanut oil is palmitic acid, C16H32O2, with an enthalpy of formation of 848.4 kJ/mol. Starch is a long chain of C6H10O5 units, each unit having an enthalpy of formation of 960 kJ.
A 237-g piece of molybdenum, initially at 100.0 C, is dropped into 244 g of water at 10.0 C. When the system comes to thermal equilibrium, the temperature is 15.3 C. What is the specific heat capacity of molybdenum?
Microwave ovens convert radiation to energy. A microwave oven uses radiation with a wavelength of 12.5 cm. Assuming that all the energy from the radiation is converted to heat without loss, how many moles of photons are required to raise the temperature of a cup of water (350.0 g, specific heat =4.18J/gC) from 23.0C to 99.0C?
If the heat capacity varies withtemperature, abetter form ofequation 2.9 isto solve q=TiTfnCT-t A 50.0-g sample of white phosphorus is heated from 298 K to 350K. If its molar heat capacity is CT- = 56.990.1202T J/mol.K, how much heat is needed?
How many moles of isooctane must be burned to produce loo U of heat under standard state conditions?
Nitrogen gas is confined in a cylinder with a movable piston under a constant pressure of 9.95 104 Pa. When 695 J of energy in the form of heat is transferred from the gas to the surroundings, its volume decreases by 1.88 L. What is the change in internal energy of the gas?
The enthalpy of combustion of diamond is -395.4 kJ/mol. C s, dia O2 g CO2 g Determine the fH of C s, dia.
A sample of ethanol, C2H5OH, weighing 2.84 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 33.73C. If the heat capacity of the calorimeter and contents was 9.63 kJ/C, what is the value of q for burning 1.00 mol of ethanol at constant volume and 25.00C? The reaction is C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) Is q equal to U or H?
The complete combustion of acetylene, C2H2(g), produces 1300. kJ of energy per mole of acetylene consumed. How many grams of acetylene must be burned to produce enough heat to raise the temperature of 1.00 gal water by 10.0c if the process is 80.0% efficient? Assume the density of water is 1.00 g/cm3
When one mol of KOH is neutralized by sulfuric acid, q=56 kJ. (This is called the heat of neutralization.) At 23.7C, 25.0 mL of 0.475 M H2SO4 is neutralized by 0.613 M KOH in a coffee-cup calorimeter. Assume that the specific heat of all solutions is 4.18J/gC, that the density of all solutions is 1.00 g/mL, and that volumes are additive. (a) How many mL of KOH is required to neutralize H2SO4? (b) What is the final temperature of the solution?
Combustion reactions involve reacting a substance with oxygen. When compounds containing carbon and hydrogen are combusted, carbon dioxide and water are the products. Using the enthalpies of combustion for C4H4 ( 2341 kJ/mol), C4H8 (2755 kJ/mol), and H2 (286 kJ/mol), calculate H for the reaction C4H4(g)+2H2(g)C4H8(g)
Would the amount of heat absorbed by the dissolution in Example 5.6 appear greater, lesser, or remain the same if the heat capacity of the calorimeter were taken into account? Explain your answer.