S. When 10.0g of aluminum reacts with excess oxygen it produces aluminum oxide.A)What is the theoretical yieldof aluminum oxide for this reaction?B)Ir17.8g are produced, what is the percentage yield of aluminum oxide?C) Why might an actual yield differ from a theoretical yield?

Answered: Image /qna-images/answer/5807b12d-de98-4857-a575-755588304df5.jpg

5. When 10.0 g of aluminum reacts with excess oxygen it produces aluminum oxide. A) What is the theoretical yield of aluminum oxide for this reaction? B) If 17.8g are produced, what is the percentage yield of aluminum oxide? C) Why might an actual yield differ from a theoretical yield?

5. When 10.0 g of aluminum reacts with excess oxygen it produces aluminum oxide. A) What is the theoretical yield of aluminum oxide for this reaction? B) If 17.8g are produced, what is the percentage yield of aluminum oxide? C) Why might an actual yield differ from a theoretical yield?

Chemistry: Matter and Change

1st Edition

ISBN:9780078746376

Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Publisher:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Chapter11: Stoichiometry

Section11.4: Percent Yield

Problem 29PP

See similar textbooks

Related questions

Q: 8. In a chemical reaction, what is the limiting reactant? What do wemean when we say a reactant is…

A: Solution- reactant which is used up completely in the reaction called limiting reagent .and…

Q: The reaction of iron (III) oxide reacts with carbon to produce iron metal and carbon dioxide. What…

Q: For the following reaction, 6.76 grams of chlorine gas are mixed with excess bromine. The reaction…

A: Bromine reacts with chlorine to form bromine monochloride. The equation for the balanced chemical…

Q: Nitrogen (N2) can be reacted with hydrogen (H2) to form ammonia (NH3). Given the following…

A: In a given chemical reaction, the estimation of quantitative or measurable relationships of the…

Q: 20 grams of iron reacted with 15 grams of chlorine. 22 grams of iron (III) chloride were recovered…

Q: 1. The combustion of carbon monoxide gas in oxygen gas is represented by the following balanced…

A: Note : As per guidelines we are supposed to answer first question. please repost the other question…

Q: A gaseous mixture containing 4.15 mol of hydrogen gas and 7.13 mol of oxygen gas reacts to form…

A: given moles of H2 = 4.15 mol moles of O2 = 7.13 mol

Q: Methanol (CH3C In a certain experiment, from the reaction of 2.91 mL of methanol with 2.88 g of…

A: Introduction : Since carbon is reacting with oxygen to give carbon dioxide. given: Volume of…

Q: In the lab, a student generates 0.450 g of a product in an experiment. The student then calculates…

A: Given :- product obtained from an experiment = 0.450 g Theoretical yield of product = 0.398 g To…

Q: A sample of 1.52g of solid aluminum reacts with 3.55g of aqueous hydrochloric acid to form aqueous…

A: Given mass of Al = 1.52 g Mass of HCl = 3.55 g Molar mass of Al = 26.98 g/mol Molar mass of HCl =…

Q: Consider the reaction between sulfur dioxide gas and oxygen gas to form sulfur trioxide gas. If…

A: The balanced equation is 2SO2(g) + O2(g) ——> 2SO3(g)

Q: Gaseous methane (CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (Co,)…

Q: For the following reaction, 0.173 moles of nitrogen gas are mixed with 0.453 moles of hydrogen gas.…

A: Given,

Q: What is the difference between actual yield and theoretical yield? A) Actual yield has to do only…

A: Actual yield: When a chemical reaction occurs in the laboratory and the products formed are…

Q: (CH;(CH.),CH;) Liquid octane CH;) reacts with gaseous oxygen gas (0,) to produce gaseous carbon…

Q: For the following reaction, 0.271 moles of nitrogen gas are mixed with 0.565 moles of hydrogen gas.…

A: To find limitng reagent mole-mole analysis is applied on balanced chemical reaction.

Q: O CHEMICAL REACTIONS Theoretical yield of chemical reactions Gaseous methane (CH) reacts with…

A: Combustion Reaction of methane with O2: CH4(g) + 2O2(g) ....> CO2(g) + 2H2O(g) Mass of CH4 =…

Q: Gaseous butane (CH;(CH,),CH;) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide…

Q: When hydrogen chloride reacts with magnesium, magnesium chloride and hydrogen gas are formed. 1.…

A: “Since you have posted a question with multiple sub-parts, we will solve first three sub- parts for…

Q: Gaseous ethane (CH,CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,)…

A: Number of moles = mass/molar mass Mass = moles × molar mass Molar mass of ethane = 30.0 g/mol…

Q: For the following reaction, 6.09 grams of hydrogen sulfide are mixed with excess oxygen gas. The…

A: Interpretation- Here given 6.09g of hydrogen sulfide are mixed with excess of oxygen gas . The…

Q: Stu Dent, your fellow classmate, calculated the theoretical yield of a reaction to be 28.52 grams.…

Q: When potassium chlorate is subjected to high temperatures, it decomposes into potassium chlorode and…

A: Potassium chlorate decomposes into potassium chloride and oxygen in presence of heat. The balanced…

Q: What is the difference between the actual yield and theoretical yield? Choose the best answer. (A)…

A: The amount of the products which is actually produced in a chemical reaction is called actual yield.…

Q: For the following reaction, 5.06 grams of bromine are mixed with excess chlorine gas . The reaction…

Q: Calcium carbonate decomposes on heating as shown in the chemical equation. When 50 g of calcium…

A: Recall the equation %yield = (Experimental yield/Theoretical yield)×100

Q: Gaseous ethane (CH,CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,)…

A: The balanced chemical reaction of ethane and oxygen is as follows: The stoichiometry of the…

Q: e. The patient consumed 1.25 g of calcium iodide and 2.93 g of sodium oxalate in the past 3 days.…

A: Given, Mass of calcium iodide = 1.25g. Mass of sodium oxalate = 2.93g. Moles of calcium iodide and…

Q: (CH,(CH),CH,) Gaseous butane (CH. reacts with gaseous oxygen gas (0,) to produce gaseous carbon…

A: Given :- amount of CH3CH2CH2CH3 = 1.7 g amount of O2 = 4.7 g To calculate :- theoretical yield…

Q: When octane (C,H,5) is burned, the yield of products (carbon dioxide and water) is 93%. What mass of…

A: Calculate the moles of octane, Moles of octane = Calculate the moles of oxygen, Moles of oxygen gas…

Q: a. If 1.00 g of aluminum hydroxide reacts with 3.00 g of sulfuric acid, what is the mass of water…

Q: Carbon dioxide can be created by burning carbon in oxygen: C+ O2 → CO2 Approximately how many moles…

A: Given : C + O2 → CO2 Mass of C reacts with excess O2 = 24 g To calculate : No.of moles of CO2…

Q: In a chemical reaction, what is the theoretical yield?

A: Yield The quantity of product that is obtained from a chemical reaction is expressed as yield.…

Q: Consider the given reaction for the synthesis of Aspirin (C9H8O4)(hint!: Make sure the equation is…

A: Given reaction is balanced. C7H6O3 + C4H6O3 -----> C9H8O4 + C2H4O2 Calculating moles of…

Q: A student weighs out 2.082 g salicylic acid. This reacts with an excess amount of acetic anhydride.…

Q: The corrosion of aluminum in cookware is prevented as the 110 g of aluminum metal reacts with oxygen…

Q: If the theoretical yield of a reaction is 23.6 g and the actual yield is 17.4 g , what is the…

A: • The values provided in the question are:- i) Theoretical yield of a reaction, T = 23.6 g…

Q: "In our bodies, sugar is broken down with oxygen to produce water and carbon dioxide." For the…

A: Balanced reaction : C6H12O6 + 6O2...> 6CO2 + 6H2O Mass of oxygen gas = 5.36g Molar mass of…

Q: Gaseous ethane (CH,CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,)…

A: Answer:- This question is answered by using the simple concept of stoichiometry which involves the…

Q: For the following reaction, 5.92 grams of hydrogen gas are mixed with excess nitrogen gas . The…

Q: 8. The illustration to the left represents a mixture of nitrogen ( blue ) and hydrogen ( light blue…

Q: The mass of the product formed in an experiment is theoretical yield? True or false?

A: Given : Theoretical yield. To find : statement is True or false. Solution : As we know that, when…

Q: Consider the following unbalanced equation for the combustion of pentane: if a 20.4 g sample of…

A: Given that 20.4 g pentane react with excess oxygen.

Q: Gaseous ethane (CH;CH;) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO)…

A: In Balanced chemical equation number of atoms of each species are equal on both reactant and…

Q: Carbon disulfide react with oxygen to form carbon dioxide and sulfur dioxide. A mixture of 3.5 g…

Q: For the following reaction, 0.191 moles of carbon monoxide are mixed with 0.541 moles of oxygen gas.…

A: Given Reaction CO(g) + O2(g) → CO2(g) Number of mole of CO = 0.191 mole Number of mole of…

Q: Consider the mixture of propane, C,Hg, and O2 shown below. (a) Write a balanced equation for the…

A: Limiting reactants are those reactants that are consumed in a chemical reaction. It depends upon…

Q: Gaseous butane (CH,(CH,) CH, reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide…

A: Theoretical yield is the quantity of a product obtained from the complete conversion of the limiting…

Q: For the following reaction, 3.19 grams of ammonia are mixed with excess oxygen gas. The reaction…

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

S. When 10.0g of aluminum reacts with excess oxygen it produces aluminum oxide.
A)What is the theoretical yieldof aluminum oxide for this reaction?
B)Ir17.8g are produced, what is the percentage yield of aluminum oxide?
C) Why might an actual yield differ from a theoretical yield?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

An air bag is deployed by utilizing the following re tion the nitrogen gas produced inflates the air bag): :math>2NaN3(s)2Na(s)+3N2(g) 10.5 g of NaN1 is decomposed, what theoretical mass of sodium should be produced? If only 2.84 g of sodium is actually collected, what is the percent yield?
Solid calcium carbide (CaC2)reacts with liquid water to produce acetylene gas (C2H2)and aqueous calcium hydroxide. l type='a'> Write the balanced equation for the reaction that is (occurring. including all phases. If a 100.0-g sample of calcium carbide (CaC2)is initially reacted with 50.0 g of water, which reactant is limiting? Prove that mass is conserved for the reactant amounts used in pan b.
The text explains that one reason why the actual yield for a reaction may be less than the theoretical yield is side reactions. Suggest some other reasons why the percent yield for a reaction might not be 100%.
When 9.59 g of a certain vanadium oxide is heated in the presence of hydrogen, and a new oxide of vanadium are formed. This new vanadium oxide has a mass of 8.76 g. When the second vanadium oxide undergoes additional heating in the presence Of hydrogen, 5.38 g of vanadium metal forms, a. Determine the empirical formulas for the two vanadium oxides. b. Write balanced equations for the Steps of the reaction. c. Determine the mass of hydrogen needed to complete the steps of this reaction.
When potassium chlorate is subjected to high temperatures, it decomposes into potassium chloride and oxygen. (a) Write a balanced equation for the decomposition. (b) In this decomposition, the actual yield is 83.2%. If 198.5 g of oxygen are produced, how much potassium chlorate decomposed?
Citric acid, C6H5CH3, a component of jams, jellies, and fruity soft drinks, is prepared industrially via fermentation of sucrose by the mold Aspergillus niger . The equation representing this reaction is C12H22O11+H2O+3O22C6H8O7+4H2O What mass of citric acid is produced from exactly 1 metric ton (1.000103kg) of sucrose if the yield is 92.30%?
Lead(ll) oxide is obtained by roasting galena, lead(ll) sulfide, in air. The unbalanced equation is: PbS(s)+O2(g)PbO(s)+SO2(g) ) a. Balance the equation, and determine the theoretical yield of PbO if 200.0 g of PbS is heated. b. What is the percent yield if 170.0 g of PbO is obtained?
Sodium borate decahydrate, Na2B4O710H2O is commonly known as borax. It is used as a deodorizer and mold inhibitor. A sample weighing 15.86 g is heated until a constant mass is obtained indicating that all the water has been evaporated off. (a) What percent, by mass of Na2B4O710H2O is water? (b) What is the mass of the anhydrous sodium borate, Na2B4O7?
What is the theoretical yield for a reaction, and how does this quantity depend on the limiting reactant?
4.44 Industrial production of hydrogen gas uses the reaction shown below. If 1.00 metric ton of propane reacting with excess water yields 270 kg of H2, what is the percentage yield? C3H8(g)+3H2O(l)3CO(g)+7H2(g)
The first step in the manufacture of nitric acid by the Ostwald process is the reaction of ammonia gas with oxygen, producing nitrogen oxide and steam. The reaction mixture contains 7.60 g of ammonia and 10.00 g of oxygen. After the reaction is complete, 6.22 g of nitrogen oxide are obtained. (a) Write a balanced equation for the reaction. (b) How many grams of nitrogen oxide can be theoretically obtained? (c) How many grams of excess reactant are theoretically unused? (d) What is the percent yield of the reaction?
For each of the following balanced chemical equations, calculate how many grams of the product(s) would be produced by complete reaction of 0.125 mole of the first reactant. msp;AgNO3(aq)+LiOH(aq)AgOH(s)+LiNO3(aq) msp;Al2(SO4)3(aq)+3CaCl2(aq)2AlCl3(aq)+3CaSO4(s) msp;CaCO3(s)+2HCl(aq)CaCl2(aq)+CO2(g)+H2O(l) msp;2C4H10(g)+13O2(g)8CO2(g)+10H2O(g)