6. Using an equation, define the standard enthalpy of formation of water, H₂O.2+7. The standard enthalpies of formation of Zn² (aq)and Cu²+ (aq) from zinc and copper metals,respectively are -152 kJ/mol and 64.4 kJ/mol. Use this data to calculate the AH° of thereaction; Zn(s) + Cu²+ (aq) → Cu(s) + Zn²+( (aq)

Standard enthalpy of formation is the enthalpy change when 1 mole of a pure substance forms from its…

6. Using an equation, define the standard enthalpy of formation of water, H₂O. (aq) and Cu²+ (aq) 7. The standard enthalpies of formation of Zn²+( from zinc and copper metals, respectively are -152 kJ/mol and 64.4 kJ/mol. Use this data to calculate the AH° of the reaction; Zn(s) + Cu²+ (aq) → Cu(s) + Zn²+ (aq)

6. Using an equation, define the standard enthalpy of formation of water, H₂O. (aq) and Cu²+ (aq) 7. The standard enthalpies of formation of Zn²+( from zinc and copper metals, respectively are -152 kJ/mol and 64.4 kJ/mol. Use this data to calculate the AH° of the reaction; Zn(s) + Cu²+ (aq) → Cu(s) + Zn²+ (aq)

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter4: Energy And Chemical Reactions

Section: Chapter Questions

Problem 74QRT

See similar textbooks

Similar questions

Using the data in Appendix G, calculate the standard enthalpy change for each of the following reactions: (a) Si(s)+2F2(g)SiF4(g) (b) 2C(s)+2H2(g)+O2(g)CH3CO2H(l) (c) CH4(g)+N2(g)HCN(g)+NH3(g) ; (d) CS2(g)+3Cl2(g)CCl4(g)+S2Cl2(g)
Assume 200. mL of 0.400 M HCl is mixed with 200. mL of 0.400 M NaOH in a coffee-cup calorimeter The temperature of the solutions before mixing was 25.10 C; after mixing and allowing the reaction to occur, the temperature is 27.78 C. What is the enthalpy change when one mole of acid is neutralized? (Assume that the densities of all solutions are 1.00 g/mL and their specific heat capacities are 4.20 J/g K.)
The standard enthalpy of formation of solid barium oxide, BaO, is 553.5 kJ/mol, and the standard enthalpy of formation of barium peroxide, BaO2, is 634.3 kJ/mol. (a) Calculate the standard enthalpy change for the following reaction. Is the reaction exothermic or endothermic? 2 BaO2(s) 2 BaO(s) + O2(g) (b) Draw an energy level diagram that shows the relationship between the enthalpy change of the decomposition of BaO2, to BaO and O2, and the enthalpies of formation of BaO2(s) and BaO2(s).
The first step in the preparation of lead from its ore (galena, PbS) consists of roasting the ore. PbS(s)+32O2(g)SO2(g)+PbO(s) Calculate the standard enthalpy change for this reaction, using enthalpies of formation (see Appendix C).
What mass of acetylene, C2H2(g), must be burned to produce 3420 kJ of heat, given that its enthalpy of combustion is 1301 kJ/mol? Compare this with the answer to Exercise 5.91 and determine which substance produces more heat per gram.
When lightning strikes, the energy can force atmospheric nitrogen and oxygen to react to make NO: N2(g)+O2(g)2NO(g)H=+181.8kJ (a) Is this reaction endothermic or exothermic? (b) What quantities of reactants and products are assumed if H = +181.8 kJ? (c) What is the enthalpy change when 3.50 g nitrogen is reacted with excess O2(g)?
The enthalpy change for the following reaction is 393.5 kJ. C(s,graphite)+O2(g)CO2(g) (a) Is energy released from or absorbed by the system in this reaction? (b) What quantities of reactants and products are assumed? (c) Predict the enthalpy change observed when 3.00 g carbon burns in an excess of oxygen.
A 0.470-g sample of magnesium reacts with 200 g dilute HCl in a coffee-cup calorimeter to form MgCl2(aq) and H2(g). The temperature increases by 10.9 C as the magnesium reacts. Assume that the mixture has the same specific heat as water and a mass of 200 g. (a) Calculate the enthalpy change for the reaction. Is the process exothermic or endothermic? (b) Write the chemical equation and evaluate H.
A piece of lead of mass 121.6 g was heated by an electrical coil. From the resistance of the coil, the current, and the Time the current flowed, it was calculated that 235 J of heat was added to the lead. The temperature of the lead rose from 20.4C to 35.5C. What is the specific heat of the lead?
For the reaction HgO(s)Hg(l)+12O2(g),H=+90.7kJ: a.What quantity of heat is required to produce 1 mole of mercury by this reaction? b.What quantity of heat is required to produce 1 mole of oxygen gas by this reaction? c.What quantity of heat would be released in the following reaction as written? 2Hg(l) + O2(g) 2HgO(s)
9.41 Under what conditions does the enthalpy change equal the heat of a process?
A 50-mL solution of a dilute AgNO3 solution is added to 100 mL of a base solution in a coffee-cup calorimeter. As Ag2O(s) precipitates, the temperature of the solution increases from 23.78 C to 25.19 C. Assuming that the mixture has the same specific heat as water and a mass of 150 g, calculate the heat q. Is the precipitation reaction exothermic or endothermic?