Answered: 9. Fuels used in automobiles release…

9. Fuels used in automobiles release different amounts of energy when burned. Explain some tradeoffs that must be considered when deciding whether to use fuels that release greater amounts of energy.

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter9: Energy And Chemistry

Section: Chapter Questions

Problem 9.40PAE

See similar textbooks

Related questions

Q: A piece of metal with mass 20.00 g at room temperature [25.0oC] was heated up to 90.0oC. This metal…

A: a) The amount of heat water gained is given by Q as Q = mCΔT where m = mass of water = density X…

Q: C2H5OH + 3O2 → 2CO2 + 3H2O ΔH⁰ = - 791.4kJ/mol How much heat will be released when 10.0g of…

A: Given that,ΔH⁰ = - 791.4 kJ/molOxygen present already is in excess, so don't do anything about…

Q: What are the primary considerations in the selection of a fuel for a certain process?

A: The substance which catches fire easily and on burning produces energy in the form of heat and…

Q: The heat of combustion for 1.00 mole of carbon to carbon dioxide is -410. kJ. How many kJ of heat…

A: Given : Moles of carbon = 1 mole

Q: How much heat (in kJ) is produced by the complete combustion of 52.2 g of CH4? Use 1.01 g/mol for…

Q: To treat a burn on his hand, a person decides to place an ice cube on the burned skin. The mass of…

Q: A chemist measures the energy change ΔH during the following reaction:…

A: The reaction is, C3H8 + 5O2 -----> 3CO2 + 4H2O ∆H = -2220 kJ Since the change in enthalpy is…

Q: In a good calorimeter with a lid, 50.0 gram sample of liquid water at 25.0 °C is mixed with 32.87…

A: a. It gained by cold water b. Heat lost by hot water c. According to law of thermodynamics the total…

Q: = 378g d. The specific heat of the resulting solution is 3.87 J/g °C. If the temperature change was…

A: Heat absorbed by the solution = mass × temperature change × Specific heat capacity

Q: A chemist measures the energy change AH during the following reaction: 2 NO,(9) → N,O4(9) AH=-55.3…

A: Chemical reactions are associated with the liberation or intake of energy. If the energy is added to…

Q: What happens when Ethanol burns and what happens after it burns? What happens to the matter in…

A: Ethanol is a chemical substance made up of carbon, hydrogen and oxygen atoms. The chemical formula…

Q: To treat a burn on his hand, a person decides to place an ice cube on the burned skin. The mass of…

A: Step : 1 How much heat is absorbed by the ice cube and resulting water?

Q: A chemical reaction shifts left upon heating. What does that tell you about the enthalpy of…

A: If reaction is endothermic heat is required to form product and reaction is written as Reactant +…

Q: A chemist measures the energy change AH during the following reaction: Cl,(g)+H,(g) → 2 HCl(g)…

A: Exothermic reactions are those in which energy is released.

Q: Which of these processes releases the largest amount of energy? (A) F + e– --> F–;…

Q: Why are renewable resources a better source of energy?

A: Renewable resources are the resources which are present in unlimited quantity in nature and can be…

Q: An exothermic reaction causes the surroundings to: A. become basic B. decrease in temperature C.…

Q: Iron converts to iron (iii) oxide in this reaction: 2 Fe (s) + 3 CO (g) -> Fe2O3 (s) + 3 CO2 (g)…

Q: Which of these descriptions of heat energy is not correct?a. Heat energy flows between objects that…

A: Thermodynamic is the branch of chemistry that mainly deals with the heat transfer between system and…

Q: energy (in joules) is needed to heat 200.0 g of water by 10.0 C? The heat capacity of water is…

A: The energy in joules that is needed to heat 200.0 g of water by 10.0 degrees Celsius is to be…

Q: Ice at 0°C is placed in a Styrofoam cup containing 361 g of a soft drink at 23°C. The specific heat…

A: Answer:- This question is answered by using the simple concept of calorimetry which states that heat…

Q: The formation of water is an exothermic reaction: 2H2 (g) + O2 (g) à 2H2O (g) a) For an…

A: Balanced Reaction for the formation of water 2H2 (g) + O2 (g) --> 2H2O (g) Hydrogen gas and…

Q: A chemist measures the energy change AH during the following reaction: Cl2(9)+H2(9) → 2 HCl(g)…

Q: Complete combustion of 1.0 metric ton ofcoal (assuming purecarbon) to gaseous carbon dioxide…

A: 3.3×1010 J = 3.3×107 KJ

Q: 1.5 L of water is heated from 22.4°C to 98.5°C to make a cup of tea. How much heat in megajoules…

Q: Is the reaction exothermic or endothermic will any he be released or absorbed. If you said heat will…

A: Given:Mass of CH4 = 87.8 g.Chemical reaction:

Q: fuel emits the most carbon dioxide

A: When a fuel is burned, the amount of CO2 (carbon dioxide) produced is a function of the content of…

Q: How much heat, in kilojoules, is needed to raise the temperature of 236 g of silver from 8.5 o C to…

A: Applying formula Q=m c∆t

Q: A 120 gram sample of gold absorbs absorbs 1.2 kJ of heat. How many much does the temperature of the…

A: Given: Mass of the sample= 120 g Heat absorbed= 1.2 kJ Specific heat capacity of gold= 0.129 To…

Q: 12. Calculate the amount of coke,(carbon) needed to be burned in order to heat 500.kg of water from…

A: One calorie or one kJ is needed to raise the temperature of one kg of water by one degree celsius.…

Q: For exothermic reactions,the products have lower energy than reactants. explain why

A: The question is based on the concept of chemical thermodynamics. we have to explain why products…

Q: 150. g of water (Cs = 4.184 J/g°C) at 20.0 °C is added to a coffee cup calorimeter. A 35.0 g sample…

A: We use conservation of heat law in order to achieve equilibrium :- -Heat released by the solid =…

Q: A chemist measures the energy change AH during the following reaction: 2 Fe,O3(s) → 4 FeO(s)+O2(g)…

A: Exothermic reaction: If the energy is released in the reaction. Endothermic reaction: If the energy…

Q: A 5.90-g chunk of potassium is dropped into 1.00 kg water at 24.7°C. What is the final temperature…

A: 1.A 5.90-g chunk of potassium is dropped into 1.00 kg water at 24.7°C. 2. Tobfind out the final…

Q: Consider the decomposition of liquid hydrogen peroxide (H2O2)to form water and oxygen.a. What is the…

A: a) The heat of formation for hydrogen peroxide is ∆Hf0 = -187.34 kJ/mol (at 298 K)

Q: Define specific heat capacity. the quantity of heat required to raise the temperature of 1 mole of a…

A: specific heat is the property of the substance and is different for different substances

Q: A serving size of eight cookies contains 7 g of fat, 17 g of carbohydrates, and 8 g of protein. If…

Q: 1

A: The specific heat capacity for a given chemical substance or a solution refers to the amount of the…

Q: Consider the combustion of compressed methane, and liquid hydrogen. Which one will release more…

A: A question based on chemical thermodynamics that is to be accomplished.

Q: A chemist measures the energy change AH during the following reaction: C,Hg(9)+50,(9) → 3 CO 2(g)+…

A: Answer :- a) Exothermic b) Yes, released c) 1.83 × 103 kJ…

Q: Household gas stoves burn methane. Write the complete equation for the combustion of methane and…

A: when any hydrocarbon is burned in presence of Oxygen is known as combustion which produce carbon di…

Q: Nitrogen gas and oxygen gas can combine to form nitrogen monoxide gas. Nitrogen monoxide gas can…

A: Energy taken for the reaction N + O2 ----> NO2 Is equals to the to energy taken by the two…

Q: What are the two factors that determine the change in energy of a system? O heat and temperature O…

A: By the first law of thermodynamics, The change in energy of a system equals the net heat transfer…

Q: 1. Cite at least three processes or reactions that require energy. 2. Cite at least three processes…

A: NOTE

Q: Explain at the molecular level what happens when a body absorbs heat. 3. What do we call thermal…

A: The process of heat transfer is primarily a molecular process and the state of a body after heat is…

Q: The energy released by a reaction is 657 kJ/mol. Is this reaction endothermic or exothermic? Please…

A: Given: Amount of energy released by reaction = 657 KJ/mol.

Q: A metal with a specific heat of 0.899 J/g oC had an initial temperature of 76.67 oC. When it was…

A: The heat transferred during the reaction can be determined from the given equation. The temperature…

Q: A chemist measures the energy change AH during the following reaction: Cl(g)+H2(g) → 2 HCl(g)…

A: Given reaction: Cl2 (g) + H2 (g) → 2HCl (g) ∆H = -184. kJ We have to find whether this reaction…

Q: A metal object with mass of 21.4 g is heated to 97.0 °C and then transferred to an insulated…

Question

Need help

9. Fuels used in automobiles release different amounts of energy when burned.
Explain some tradeoffs that must be considered when deciding whether to use
fuels that release greater amounts of energy.
UNIT PROJECT
Detu

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

The “Chemistry in Focus” segment Nature Has Hot Plants discusses thermogenic, or heat-producing, plants. For some plants, enough heat is generated to increase the temperature of the blossom by 15 °C. About how much heat is required to increase the temperature of 1 L of water by 15 °C?
A 110.-g sample of copper (specific heat capacity = 0.20 J/C g) is heated to 82.4C and then placed in a container of water at 22.3C. The final temperature of the water and copper is 24.9C. What is the mass of the water in the container, assuming that all the heat lost by the copper is gained by the water?
The BTU (British thermal unit) is the unit of energy most commonly used in the United States. One joule=9.48104 BTU. What is the specific heat of water in BTU/lbF? (Specific heat of water is 4.18 J/g C.)
Copper is used in building the integrated circuits, chips, and printed circuit boards for computers. When 228 J of heat are absorbed by 125 g of copper at 22.38C, the temperature rises to 27.12C. What is the specific heat of copper?
Which produces more heat? Os(s)2O2(g)OsO4(s)orOs(s)2O2(g)OsO4(g) for the phase change OsO4(s)OsO4(g)H=56.4kJ
From the data in Table 5.2, determine which of the following fuels produces the greatest amount of heat per gram when burned under standard conditions: CO(g) , CH4(g) , or C2H2(g) .
Limestone, CaCO3, when subjected to a temperature of 900C in a kiln, decomposes to calcium oxide and carbon dioxide. How much heat is evolved or absorbed when one gram of limestone decomposes? (Use Table 8.3.)
9.30 For the example of shallow water and sandy beaches, which material has a larger heat capacity or specific heat? How does a hot day at the beach provide evidence for your answer?
An iron skillet weighing 1.63 kg is heated on a stove to 178C. Suppose the skillet is cooled to room temperature, 21C. How much heat energy (in joules) must be removed to affect this cooling? The specific heat of iron is 0.449 J/(gC).
Hydrogen is an ideal fuel in many respects; for example, the product of its combustion, water, is nonpolluting. The heat given off in burning hydrogen to gaseous water is 5.16 104 Btu per pound. What is this heat energy in joules per gram? (1 Btu = 252 cal; see also Table 1.4.)
You wish to heat water to make coffee. How much heat (in joules) must be used to raise the temperature of 0.180 kg of tap water (enough for one cup of coffee) from 30C to 96C (near the ideal brewing temperature)? Assume the specific heat is that of pure water, 4.18 J/(gC).
A 70.0-g piece of metal at 80.0 °C is placed in loo g of water at 22.0 °C contained in a calorimeter like that shown in Figure 5.12. The metal and water come to the same temperature at 24.6 °C. How much heat did the metal give up to the water? What is the specific heat of the metal?