A galvanic cell is powered by the following redox reaction: 2 Cl₂(g) + N₂H₂(aq) + 4 OH (aq) 4 Cl(aq) + N₂(g) + 4H₂O(1) Answer the following questions about this cell. If you need any electrochemical data, be sure you get it from the ALEKS Data tab. Write a balanced equation for the half-reaction that takes place at the cathode. Write a balanced equation for the half-reaction that takes place at the anode. Calculate the cell voltage under standard conditions. Round your answer to 2 decimal places. 0 E Ov ローロ X

A galvanic cell is powered by the following redox reaction: 2 Cl₂(g) + N₂H₂(aq) + 4 OH (aq) 4 Cl(aq) + N₂(g) + 4H₂O(1) Answer the following questions about this cell. If you need any electrochemical data, be sure you get it from the ALEKS Data tab. Write a balanced equation for the half-reaction that takes place at the cathode. Write a balanced equation for the half-reaction that takes place at the anode. Calculate the cell voltage under standard conditions. Round your answer to 2 decimal places. 0 E Ov ローロ X

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 156IP: An electrochemical cell is set up using the following unbalanced reaction: Ma+(aq)+N(s)N2+(aq)+M(s)...

See similar textbooks

Similar questions

Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?
An electrochemical cell is set up using the following unbalanced reaction: Ma+(aq)+N(s)N2+(aq)+M(s) The standard reduction potentials are: The cell contains 0.10 M N2+ and produces a voltage of 0.180 V. If the concentration of Ma+ is such that the value of the reaction quotient Q is 9.32 103, calculate [Ma+]. Calculate wmax for this electrochemical cell.
Find the potentials of the following electrochemical cell: Cd|Cd2+,M=0.10Ni2+,M=0.50|Ni
A fuel cell designed to react grain alcohol with oxygen has the following net reaction: C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) The maximum work that 1 mole of alcohol can do is 1.32 103 kJ. What is the theoretical maximum voltage this cell can achieve at 25C?
The standard potential for the reduction of AgSCN is 0.0895 V. AgSCN(s)+eAg(s)+SCN(aq) Find another electrode potential to use together with the above value and calculate Kspfor AgSCN.