A galvanic cell is set up using the redox reaction below at 298 K. If the cell has a standard cell potential of 0.83, what is the value of AG°? 2X (s) + Y2+ (aq) - 2x* (aq) + Y (s) Report your answer in kJ/mol to one decimal place. AG= - nFE F = 96485 mol e

A galvanic cell is set up using the redox reaction below at 298 K. If the cell has a standard cell potential of 0.83, what is the value of AG°? 2X (s) + Y2+ (aq) - 2x* (aq) + Y (s) Report your answer in kJ/mol to one decimal place. AG= - nFE F = 96485 mol e

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 137CWP: Consider a galvanic cell based on the following half-reactions: a. What is the standard potential...

See similar textbooks

Related questions

Q: Mg(s) + Fe2+(aq) – Mg2+(aq) + Fe(s) The galvanic cell described above has a standard cell potential…

A: Galvanic cell is electrochemical cell where, current is supplied to carry out some chemical…

Q: A galvanic cell at a temperature of 25.0 °C is powered by the following redox reaction: 3Cu?* (aq)…

A: Since in the above reaction, Cu2+ is being reduced to Cu and Al is being oxidised to Al3+ Hence the…

Q: calculate the standard cell potential for the galvanic cell reaction given below, and determine…

A: Standard EMF of the cell can be calculated using the formula: E°=E°(cathode) - E°(anode)…

Q: Given: NO3 -> NO(g) ɛ° = 0.96 V - Sn4+ -> Sn2+ ɛ° = 0.13 V The two half cells were coupled to…

A: Given, NO3- ---------> NO, E0 = 0.96 V Sn4+----------> Sn2+, E0 = 0.13 V 4). Nernst…

Q: For the following redox reaction, calculate E0cell, ∆G0rxn and the equilibrium constant, K. The…

A: The effect of all ions' concentration present in any electrochemical cell is governed by the use of…

Q: For the following half-reactions: Cr3-(aq) – Cr(s) Zn2«(aq) → Zn(s) a. What will be the overall…

Q: A galvanic cell is based on the following half-reactions. Fe2+ (aq) +…

A: The standard reduction potentials of half- cell reactions are, The most positive standard reduction…

Q: A voltaic cell employs the redox reaction: 2Fe+3(aq) + 3Mg(s) --- 2Fe(s) + 3Mg2+(aq) Calculate the…

Q: Your mystery voltaic cell has a standard cell potential of 0.741 V and can be written in cell…

A: The importance of Gibbs energy is that it gives information about the spontaneity of the reaction or…

Q: (a) How many moles of mercury will be produced by electrolysing 1.0 M Hg(NO3)2 solution with a…

A: According to conversion of units, 1 hour is equal to 3600 s. The mass of mercury deposited by…

Q: Provide the half-reactions and calculate the potential for the following galvanic cell.…

A: When we take a reaction there are two half cell for that reaction which are connected by external…

Q: « < 26 of 1M Zn(NO3)2 1M AGNO3 2 Ag* (aq) + Zn(s)→ 2 Ag(s) + Zn²+(aq) Under standard conditions, the…

A: In galvanic cells, chemical energy is converted into electrical energy. Galvanic cells are made by…

Q: If we are to construct a galvanic cell using Cu and Sn, what will be the cell potential? Cu2*(aq) +…

A: The given values are of reduction potentials of the half cells.

Q: Consider the battery represented by the following notation. Ni(s) | Ni*"(aq) || Ag*(aq) | Ag(s)…

Q: (0.43 M) as the anode and the half-cell Sn2+(x M) | Sn(s) as the cathode; the measured cell voltage…

Q: (a) How many moles of mercury will be produced by electrolysing 1.0 M Hg(N03)2 solution with a…

A: The quantity of charge passed is calculated as follows, Q=I×t Where,…

Q: A galvanic cell at a temperature of 25.0 °C is powered by the following redox reaction: 2Cr3+ (aq) +…

A: We can use Nerst Equation to solved the above problem.

Q: For the reaction: Pb2+(aq) + Fe(s) → Pb(s) + Fe2+(aq) E°cell = 0.31 V Imagine a Voltaic cell is set…

A: Ecell = Eocell - 0.0591nLog[Fe2+][Pb2+] Ecell = Eocell + 0.0591nLog[Pb2+][Fe2+]…

Q: A galvanic cell at a temperature of 25.0 °C is powered by the following redox reaction: 3Cu**…

Q: Calculate the standard Gibbs free energy change, AGº, in kJ for the following reaction occurring in…

Q: An electrolytic cell was constructed from zinc and copper half-cells. The equation of the reaction…

A: The deviation from the standard cell potential (1.10 V) can be accounted to the nonstandard…

Q: Following is a diagram of a voltaic cell. If the standard reduction potentials for Zn2+ (aq, 1 M) +…

A: A Galvanic cell is made up of an anode and a cathode. Reduction reaction occurs at cathode whereas…

Q: Consider the following galvanic cell at 25°C. Pt | Cr2+ (0.35 M), Cr3+ (2.0 M) || Co2+ (0.24 M) | Co…

A: The cell reaction is, The value of K is 2.79 ✕ 107 The reaction taking place at cathode is, The…

Q: Suppose a galvanic cell is established using the following cell reaction. Cu (s) + 2Ag^1 (0.100 M)…

A: Given the cell reaction is: Cu(s) + 2Ag+(aq) (0.100 M) <-----> Cu2+(aq) (0.200 M) + 2Ag(s)…

Q: Consider these two entries from a fictional table of standard reduction potentials. X3+ + 3 e X(s)…

A: E° cell = E° cathode + E° anode At anode always oxidation occur At cathode always reduction occur…

Q: A galvanic cell is set up using the redox reaction below at 298 K. If the cell has a standard cell…

A: Since the value of ΔG0 is given by ΔG0 = -nFE where E = standard cell potential = 0.31 F =…

Q: Q 2: Galvanic cell presented as Fe/Fe //Co/Co, If reduction potential of iron = - 0.409 V, and for…

Q: Q2+/Q and D+/D electrodes. Q and D are symbols of hypothetical elements. What is the overall cell…

A: Loss of electrons is oxidation which takes place at anode and gain of electrons reduction which take…

Q: The emf of a standard X-Y galvanic cell is -2.763V. If the standard half-cell emf for the oxidation…

A: The overall cell reaction is the sum of the two half-reactions, but the cell potential is the…

Q: Sketch the galvanic cell represented by the following line notation: Ag (s), AgCI(s) | KCI (aq, 0.1…

A: It is given that the cell is represented by the notation Ag (s), AgCl(s) | KCI (aq, 0.1 M)||FeCl2…

Q: Consider these two entries from a fictional table of standard reduction potentials. X3+ + 3e- X(s)…

A: The solution is as follows :

Q: 6. For the following half-reactions: Cr*(aq) - Cr(s) Zn (aq) → Zn(s) a. What will be the overall…

Q: Determine K for each of the following reactions Determine AGa for each of the following reactions…

Q: Dariana Using the Nernst equation to calculate nonstandard cell voltage A galvanic cell at a…

A: Galvanic cell:

Q: Consider a galvanic cell based on the following half reactions: E (V) M+. + 4e M 0.66 N3+ ++3e N…

A: Answer is explained below. For the given problem reaction at cathode and anode and the net reaction…

Q: Consider the following galvanic cell at 25°C. Pt | Cr2+ (0.35 M), Cr3+ (2.0 M) || Co2+ (0.24 M) | Co…

A: The overall cell reaction contains oxidation half reaction and reduction half reaction.

Q: A galvanic cell at a temperature of 25.0 °C is powered by the following redox reaction: 2Cr3+ (aq) +…

Q: At 25C and pH 7, a solution containing compound A and its reduced form AH2 has standard electrode…

A: (i) The standard potentials are given for A and B which can be represented as; A+2H++2e-→AH2…

Q: 1. Calculate the Gibbs free energy changes, AG, by using the potential differences measured in Part…

Q: Consider the following cell: | Zn (s) | Ca²* (aq) , SO3²- (aq) || Hg2+ (aq) , F` (aq) | Pt (s) | a)…

A: In this question, we have to find out the correct answer of given problem by the help of the…

Q: Use the standard reduction potentials shown here to answer the questions. A copper, Cu(s), electrode…

A: Given that standard hydrogen electrode acts as cathode and hence copper electrode will act as anode…

Q: Consider the battery represented by the following notation. Ni(s) | Ni²*(aq) || Ag*(aq) | Ag(s)…

Q: What is the calculated value of the cell potential at 298 K for an electrochemical cell with the…

A: Ecell = 2.15 V The cell reaction as written above is spontaneous for the concentration given.

Q: Consider an electrochemical cell involving Copper and Iron. Cu2+(aq) + 2e- → Cu(s) Eo = 0.34…

Q: If we are to construct a galvanic cell using Cu and Sn, what will be the cell potential? Cu2*(aq)- +…

A: A galvanic cell is an electrochemical cell that converts chemical energy into electrical energy. A…

Q: Cr3+(aq) → Cr(s) Zn2+(aq) → Zn(s) a. What will be the overall balanced reaction if you want to…

A: The two half reactions are as follows: The oxidation half reaction is, Zn(s)------>Zn2+(aq) +2 e-…

Q: The cell notation for the Galvanic cell is The Standard Reduction Potential are as follows:…

A: The cell given is Cd(s) | Cd2+ || I2 (s) | I-.

Q: A galvanic cell is given by the following cell diagram: Zn (s) | Zn? + (aq) (4.0-10-3 M) | Ag +1…

Q: Use the standard reduction potentials given below to predict if a reaction will occur between Sn(s)…

Question

A galvanic cell is set up using the redox reaction below at 298 K. If the cell has a standard cell potential of 0.83, what is the value of AG°?
2X (s) + Y2+ (aq) - 2x* (aq) + Y (s)
Report your answer in kJ/mol to one decimal place.
AG= - nFE
F = 96485
mol e

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Similar questions

Given this reaction, its standard potential, and the standard half-cell potential of 0.34 V for the Cu2+ |Cu half-cell, calculate E° for the Fe(s)|Fe2+(aq) half-cell.
An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
Consider a galvanic cell based on the following half-reactions: a. What is the standard potential for this cell? b. A nonstandard cell is set up at 25C with [Mg2+] = 1.00 105 M. The cell potential is observed to be 4.01 V. Calculate [Au3+] in this cell.
A galvanic cell is based on the following half-reactions: In this cell, the copper compartment contains a copper electrode and [Cu2+] = 1.00 M, and the vanadium compartment contains a vanadium electrode and V2+ at an unknown concentration. The compartment containing the vanadium (1.00 L of solution) was titrated with 0.0800 M H2EDTA2, resulting in the reaction H2EDTA2(aq)+V2+(aq)VEDTA2(aq)+2H+(aq)K=? The potential of the cell was monitored to determine the stoichiometric point for the process, which occurred at a volume of 500.0 mL H2EDTA2 solution added. At the stoichiometric point, was observed to be 1 .98 V. The solution was buffered at a pH of 10.00. a. Calculate before the titration was carried out. b. Calculate the value of the equilibrium constant, K, for the titration reaction. c. Calculate at the halfway point in the titration.
Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
The standard potential for the reduction of AgSCN is 0.0895 V. AgSCN(s)+eAg(s)+SCN(aq) Find another electrode potential to use together with the above value and calculate Kspfor AgSCN.
What is the standard cell potential you would obtain from a cell at 25C using an electrode in which Hg22+(aq) is in contact with mercury metal and an electrode in which an aluminum strip dips into a solution of Al3+(aq)?
Calculate the cell potential of a cell operating with the following reaction at 25C, in which [MnO4] = 0.010 M, [Br] = 0.010 M. [Mn2] = 0.15 M, and [H] = 1.0 M. 2MNO4(aq)+10Br(aq)+16H+(aq)2MN2(aq)+5Br2(l)+8H2O(l)
A voltaic cell is constructed in which one half-cell consists of a silver wire in an aqueous solution of AgNO3.The other half cell consists of an inert platinum wire in an aqueous solution containing Fe2+(aq) and Fe3+(aq). (a) Calculate the cell potential, assuming standard conditions. (b) Write the net ionic equation for the reaction occurring in the cell. (c) Which electrode is the anode and which is the cathode? (d) If [Ag+] is 0.10 M, and [Fe2+] and [Fe3+] are both 1.0 M, what is the cell potential? Is the net cell reaction still that used in part (a)? If not, what is the net reaction under the new conditions?
An electrochemical cell consists of a silver metal electrode immersed in a solution with [Ag+] = 1.0 M separated by a porous disk from a copper metal electrode. If the copper electrode is placed in a solution of 5.0 M NH3 that is also 0.010 M in Cu(NH3)42+, what is the cell potential at 25C? Cu2+(aq)+4NH3(aq)Cu(NH3)42+(aq)K=1.01013