A tank is utilized for mixing sugar solutions which can initially contain 80 gallons of water. A sugar-water containing 1.5 lbs of sugar per gallon enters the tank at a rate of 2 gallons per minute. The tank is kept well mixed. Sugar-water is pumped out of the tank at 3 gallons per minute. Find the amount of sugar in the tank after 10 minutes? a. What is the working equation for the mixing problem? b. What is the linear form of the differential equation? c. What is the integrating factor for the differential equation.?

Q: Set f(x) = xª for x ≥ 0 and f(x) = 0 for x < 0. For which values of a is f continuous at 0, and for…

A:

Q: . Determine the Fourier transform of the following: (t) = {e ¹³6, -1 < t < 1 elsewhere

A: We know formula for Fourier transform of f(t) F(ω)=∫-∞∞f(t).ejωtdt we have…

Q: The general solution of the second-order differential equation y"-y-12y = 0 is: y = c₁e³x + c₂e-4x…

A:

Q: When I put 2+1 or 3 as the answer it said I got the question wrong? Did I perhaps misread your…

A:

Q: □ Use the definition of integral to prove that for = f'/h 1/x if X FO (x) is NOT if x=0 Riemann…

A: Consider the given function, fx=1x      if x≠00        if x=0 Here we need to prove that f is not…

Q: (a) Find the direction for which the directional derivative of the function f(x, y) = 9xy + 2y is a…

A: Formula for directional derivative Du→fP=∇f(P).u^=∇f(P)u^cosθ Du→fP to be maximum angle θmust be 0.…

Q: The indicated function y(x) is a solution of the given differential equation. Use reduction of order…

A:

Q: 1. Evaluate the following integral S² a. Analytically b. Numerically using: -20 20x7 + 5x5 + 15x³ +…

A:

Q: 7. Consider the following table that displays the binary operation on the set (x, y, z). *…

A:

Q: A baseball team plays in a stadium that holds 60000 spectators. With the ticket price at $9 the…

A: We have to find the maximize revenue.

Q: A sharp-crested weir 1meter high extends across a rectangular channel 6m wide in which there is…

A:

Q: Verify the line integral and surface integral by relating them to the Stokes' Theorem where C is the…

A: Stokes theorem    ∫CF→.dr→=∫∫ScurlF→.dS→ Where S  be a smooth surface  bounded by a closed, smooth…

Q: (a) For all n € N and a + 0, show that (b) For a sequence (x) in R, suppose that there exists an b €…

A: Given that: xn in R, suppose that there exists be b∈0,1such that, xn+1-xn≤bn for all n∈N. The…

Q: (4) Suppose xo = 2√3, yo = 3, Prove that 2xn-14-1 Xn-1+Yn-1 and Yn √n Yn-1 for all n € N. = (b) x =…

A:

Q: City high school had a student reduction and lost 1/10 of its students. if 198 of its students were…

A: The original number of students were = 220

Q: Yn+24yn = 3n-5, yo = y₁ = 0

A: given difference equation yn+2-4yn=3n-5, y0=y1=0

Q: Write using summation or product notation (24) (34) (44-) (54-) (64) 6 1 ΟΣ2[(1 + 1)^ - th] k k=2…

A:

Q: EX LeT X= {1,2,3,4} find The Possible Topology That Contain ses [1,2], [2,3],[1,3,4} .

A:

Q: Use the Laplace transform to solve the given differential equation subject to the indicated initial…

A:

Q: 1.3 In each case, determine whether or not the given is a binary operation on the given set S. a)…

A:

Q: 4. Let a and b be integers. If a and b are relatively prime and if each divides an integer n, prove…

A:

Q: (27) Each of the following matrices determines a linear transformation 1 2 0 1 1 0 2 A2 -1 2 -1 2 3…

A: M=abcd we can naturally define a plane transformation TM:R2→R2 by TM(v)=Mv. That is, TM takes a…

Q: y" + 4y = 1² + 8e', y(0) = 0, y'(0) = 7

A: we are given second order non homogeneous linear differential equation with constant coefficients to…

Q: The poaching model for Species Z is Z' = 0.000923 Z(1- Z) -0.002 where the variable Z represents the…

A:

Q: Use the Integral Test to determine the convergence or divergence of the following series, or state…

A:

Q: 1. Pretend that in a certain city the number of new cases of COVID was reported to be 200 new cases…

A: The number of new cases on sunday = 200 Increment of cases on monday = 22% Deduction of cases on…

Q: A solid, G is bounded in the first octant by the cylinder x² + z² = a², plane y = x, and y = 0.…

A:

Q: An appropriate integrating factor µ(x) for the following differential equation (2y² + 3x)x+ 2xydy=0…

A:

Q: For any sets A and B, which statement is false? OA NA = {} OAUB CANB OAN BC B OA CAUB

A: Remark:  We know that The union of two sets A and B is the set of all those elements which are…

Q: What is the P(k+1) statement used in the proof by mathematical induction of the ormula: ²-¹² i (i +…

A: P(k+1) statement

Q: anges Worked: ent Scor mpts: Solve the given linear programming problem using the table method. A…

A: Fundamental  theorem of linear  programming  states that if a linear  programming  problem  admits a…

Q: Use Stokes's Theorem to evaluate  Integral of the curve from the force vector:  F · dr. or the…

A:

Q: Determine a suitable form for Y(t) if the method of undetermined coefficients is to be used. y"-81y'…

A: Sol:- y'''-81y'=te-9t+10cos9tFirst , find the yh:-yh is the solution to the homogeneous ODE…

Q: Given ƒ(x) = √²; t² - 25 1 + cos² (t) At what value of a does the local max of f(x) occur? x = dt

A: Ans : x= -5     we use Leibnitz's Rule to solve this problems .

Q: 2Q. (a) Using Lagrange Inverse Interpolation method, find the value of x when y=20 for the following…

A: # As  per the guidelines we are entitled to solve one question at a time, please resubmit the other…

Q: 12 What is the coefficient of ¹2 in (x+2)¹5 ? a

A:

Q: Using the method of undetermined coefficients, The general form of a particular solution of the…

A:

Q: Determine the particular solution. O y = 2e-x/2 3 - 4ex 3 y = 4e-(x/2) 3 + ²ex 3 O y = 4e-(x/2) -…

A:

Q: a. I b. | function f(x, y) = y² − x² + - the critical points of the function f(x, y) = y² − x² + -…

A:

Q: Find the altitude of the aircraft in the problem introduced at the beginning of this section, shown…

A: To solve this problem, introduce an arbitrary variable and formulate equations based on the…

Q: Let D CR and (x₂) be a sequence in R. Show that x→x such that x € D if and only if D is closed.

A:

Q: QUESTION 4 Suppose f is differentiable at a; set d(x) = f(x) - f'(a)(x - a)-f(a). What is d' (a)? O…

A:

Q: For positive acute angles A and B, it is known that tan A = and 5 cos B=3. Find the value of sin(A -…

A: Sol:- tan(A)=pb=409 ; h = 402+92=41Therefore , sin(A)=ph=4041cos(B)=bh=513 ; p = 132-52=12Therefore…

Q: Drug Concentration When a drug is injected into the bloodstream of a patient through the right arm,…

A: Introduction: Calculus uses a function's derivative to determine whether a function is increasing or…

Q: *Use the following property of the definite integral to estimate the definite integral: f/4 cos x dx…

A:

Q: Consider all 5-letter "words" made from the letters a through h. (Recall, words are just strings of…

A: Note: Since you have posted a question with multiple sub-parts, we will solve the first three…

Q: Use Newton's method to find the root of the function 2X³+6X²+6X-1=0 if Xo=-0.5 correct to 3 decimal…

A: As per the question we are given the following polynomial equation : f(x) = 2x3 + 6x2 + 6x - 1 = 0…

Q: Q2. Find the Fourier series for the function f(x) = |x-x² for −1 < x < x<π]

A:

Q: Find the Fourier series expansion of the following periodic function: -2<t<0 0<t<2 t, f(t) = {_3

A:

Q: i=1 let fi [a, b] →> IR and a) Suppose of and g Prove that fog b) Suppose I and we is g до…

A: let f:a,b→ℝ and g:c,d→a,b (a) suppose f and g are continuous . prove that f∘g is integrable on c,d…