Aluminum sulfide reacts with water to form aluminumhydroxide and hydrogen sulfide. (a) Write the balancedchemical equation for this reaction. (b) How many grams ofaluminum hydroxide are obtained from 14.2 g of aluminumsulfide?

Aluminum sulfide reacts with water to form aluminumhydroxide and hydrogen sulfide. (a) Write the balancedchemical equation for this reaction. (b) How many grams ofaluminum hydroxide are obtained from 14.2 g of aluminumsulfide?

World of Chemistry

7th Edition

ISBN:9780618562763

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter9: Chemical Quantities

Section: Chapter Questions

Problem 49A

See similar textbooks

Related questions

Q: 4. How many grams of magnesium oxide can be produced by reacting 0.643 g magnesium that is 94.5%…

A: Please note- As per our company guidelines we are supposed to answer only one question. Kindly…

Q: How many grams of potassium chlorate are there At the completion of reactions?

A: Given that, the decomposition reaction of potassium chlorate, KClO3. We have to tell the amount of…

Q: If 6.1 × 10²⁵ molecules of CO₂ are produced in a combustion reaction, what is the mass in kg of CO₂…

A: Given: 6.1 × 10²⁵ molecules of CO₂ are produced in a combustion reaction. To determine : The mass…

Q: When 14.0 g of calcium metal is reacted with water, 5.00 g of calcium hydroxide is produced. Using…

A: Given: Actual yield = 5g

Q: What is the limiting reactant in a reaction that produces sodium chloride from 8 g of sodium and 8 g…

A: The balanced reaction for sodium and diatomic chlorine producing sodium chloride can be given as

Q: Aluminum sulfide reacts with water to form aluminum hydroxide and hydrogen sulfide. (a) Write a…

A: The chemical formula of Aluminium suffide=AL2S3The chemical formula of water=H2OThe chemical…

Q: What mass of CO2 can be produced from the combustion of 7.25 moles of O2

A: A numerical problem based on mole concept, which is to be accomplished.

Q: When hydrochloric acid reacts with oxygen, water and chlorine are produced. The balanced equation…

Q: Balance the following equation: Al+O2=Al2O3 and determine how many moles of aluminum oxide can be…

Q: A reaction of 15.2 grams of ferrous sulfate heptahydrate (278 g / mol) and 5 grams of ammonium…

A: Welcome to bartleby !

Q: What is the percentage yield of a reaction in which 200 g of phosphorus trichloride reacts with…

Q: What is the mass percentage of O in CO2? Provide an answer to two decimal places.

A: Given, The mass percentage of O in CO2 is:

Q: if 9.3×10^25 molecules of CO2 are produced in a combustion reaction , what is the mass in kg of CO2…

A: Applying mole concept and avogadro number.

Q: C4H10S(l) + O2(g)= complete and balance the combustion reaction.

A: Due to combustion reaction oxidation of the compound takes place.

Q: How many grams of sulfur (S) are needed to react completely with 45.0 g of aluminum (Al) in the…

A: Aluminum reacts with sulfur to form aluminum sulfide. The equation for the balanced chemical…

Q: Butane C4H10 burns with Oxygen to produce CO2 and H2O. Write out the chemical equation for this…

A: The reactants given are C4H10 and O2 i.e oxygen and products are CO2 and H2O hence the reaction…

Q: If 74.3 g of butane is burned in 132 kg of oxygen, a. Which is the limiting reagent? b. What is the…

Q: In the manufacture of ammonia, nitrogen and hydrogen gases react over an iron/potassium oxide…

A: Chemical reaction between N2 and H2 to form NH3 is:

Q: a) Name all the products of this reaction. Do not name the reactants. b) If 1267.1g of the titanium…

Q: How much CO2 is produced when 1 tonne of benzene (C,H6) is combusted in an oxygen-only atmosphere?

A: The amount of product produced can be obtained using the stoichiometry coefficient in the balanced…

Q: How many moles of glucose can be formed from 2.53x1024 H atoms?

A: Given that: atoms of H = 2.53×1024 atoms Formula of glucose = C6H12O6 Now, it can be seen that, each…

Q: Ammonium perchlorate (NH4ClO4 or AP) is the principal component of solid rocket propellant. Suppose…

A: Given: Mass of NH4ClO4 = 63.3 g Molar mass of NH4ClO4 = 117.49 g/mol Molar mass of H2O = 18.01528…

Q: The poisonous gas hydrogen cyanide (HCN) is producedby the high-temperature reaction of ammonia with…

A: The gas HCN is very dangerous and never try to inhale it.

Q: Write a balanced chemical equation based on the following description:solid C₄H₁₀O is burned with…

A: Given reaction is shown below,C₄H₁₀O is burned with oxygen gas to produce gaseous carbon dioxide and…

Q: How many grams of Zn can be produced by heating 81g Al with zinc chloride?

A: Aluminium reacts with zinc chloride to form zinc metal and aluminium chloride. The equation for the…

Q: If 6.5 kg of CO₂ are produced during a combustion reaction, how many molecules of CO₂ would be…

A: Given, Amount of CO2 =6.5 kg =6500 gwe are asked to calculate the number of molecules of CO2 in the…

Q: How many grams of aluminum sulfide are formed if 22.00g of aluminum reacts with sulfur in a…

A: Mass of Al = 22 g Mass of Al2S3 = ?

Q: What mass of magnesium chloride is produced from the reaction of 20.7 g of Mg? Balance the equation:…

A: This can be done as

Q: If 4.9 kg of CO2 are produced during a combustion reaction, how many molecules of CO2 would be…

A: To solve this problem first we have to calculate the number of moles of CO2 in 4.9 kg then we will…

Q: The balanced chemical equation for the reaction between potassium hydroxide and phosphoric acid is:…

A: When an acid reacts with a base it produces salt and water. Such reactions are known as acid-base…

Q: The corrosion of aluminum in cookware is prevented as the 110 g of aluminum metal reacts with oxygen…

Q: Calculate the number of grams of Al203 that could be produced if 5.5 g of aluminum and 5.5 g of…

A: Given :- amount of Al = 5.5 g Amount of O2 = 5.5 g To be calculated :- number of…

Q: That mass of C;Hg is needed to produce 5.25 moles of carbon dioxide?

A: Combustion of hydrocarbons: C3H8 + 5O2 → 3 CO2 + 4 H2O moles of carbon dioxide = 5.25 moles

Q: If 226.1 g of tin(II) chloride was the actual amount obtained in a reaction for which the…

Q: How many moles of electrons are required to produce 18.1 g of potassium metal from a sample of…

A: We are hereby asked that how many moles of electrons are required to produce 18.1 g of potassium…

Q: If 0.35g of Al reacts with excess diatomic oxygen, how many grams of the product Al2O2 are formed

A: Given, Mass of Al = 0.35 g Moles of Al can be calculated as :

Q: b. How many grams of copper(i) sulfide could be produced from 28.0 g of copper(1) chloride reacting…

A: Given :- mass of copper(I)chloride reacting with excess hydrogen sulfide = 28.0 g To calculate :-…

Q: If 1.50 x 102 g of N2H4 and 2.00 x 102g of N2O4 are mixed, which is the limiting reaction?

A: Any certain reacting species that is available in particular chemical equation and has potential to…

Q: Hydrogen peroxide decomposes to produce oxygen gas and water. What mass of hydrogen peroxide (H2O2)…

A: H2O2 : Hydrogen peroxide H2O : Water Oxygen : O2

Q: In a reaction, 0.77 kg of V,O, are reacted with 0.88 kg of Ca as the following chemical Equation:…

A: Since you have posted a question with multiple sub-parts, we will solve first three subparts for…

Q: what is the theoritical yield of dinitrogen pentoxide in grams if 13.2g of nitrogen reacts with…

A: Amount of nitrogen = 13.2 g Theoretical yield of dinitrogen pentoxide (N2O5) = ?

Q: Methylhydrazine, N2H3CH3(l), is used with the oxidizer dinitrogentetroxide, N2O4(l), to power the…

A: Methylhydrazine, N2H3CH3 (l), is reacted with dinitrogen tetroxide, N2O4(l), to produce N2, CO2, and…

Q: Butane C4H10 burns with Oxygen to produce CO2and H2O. Write out the chemical equation for this…

Q: If 100 grams of CH4 is made to react with 200 grams of O2, what mass of CO2 (in grams) is formed?

A: Methane reacts with oxygen to form carbon dioxide and water. The equation for the balanced chemical…

Q: If the theoretical yield for a reaction is 100.0 g of a product, and the amount collected when the…

A: Percent yield is defined as measurement in quantity of moles of product formed in chemical reaction…

Q: 2. How many grams of sodium sulfate can be produced when 120 g of sodium hydroxide reacts with…

A: 2) The balanced chemical equation for the reaction of sodium hydroxide with sulfuric acid is, 2…

Q: What mass of carbon dioxide is produced from the complete combustion of 2.40×10−3 g of methane?

A: The formula for the mass of carbon dioxide as follows:

Q: If 7.7*10^25 molecules of CO2 are produced in a combustion reaction, what is the mass in kg of CO2…

A: 6.022 ×1023 molecules are present in 1 mole of a compound So, no of moles in 7.7× 1025 molecules of…

Q: Balance the following reaction and predict the amounts of excess (XS) reactant used and products, in…

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

Aluminum sulfide reacts with water to form aluminum
hydroxide and hydrogen sulfide. (a) Write the balanced
chemical equation for this reaction. (b) How many grams of
aluminum hydroxide are obtained from 14.2 g of aluminum
sulfide?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Nitric acid is produced commercially by the Ostwald process, represented by the following equations: 4NH3(g)+5O24NO(g)+6H2O(g)2NO(g)+O2(g)2NO2(g)3NO2(g)+H2O(l)2HNO3(aq)+NO(g) What mass of NH3 must be used to produce 1.0 106 kg HNO3 by the Ostwald process? Assume 100% yield in each reaction, and assume that the NO produced in the third step is not recycled.
4.8 In an experiment carried out at very low pressure, 13x1015 molecules of H2 are reacted with acetylene, C2H2, to form ethane, C2H6, on the surface of a catalyst. Write a balanced chemical equation for this reaction. How many molecules of acetylene are consumed?
4.24 Ammonia gas can be prepared by the reaction CaO(s)+2NH4Cl(s)2NH3(g)+H2O(g)+CaCl2(s) If 112 g of CaO reacts with 224 g of NH4Cl, how many moles of reactants and products are there when the reaction is complete?
Bacterial digestion is an economical method of sewage treatment. The reaction is an intermediate step in the conversion of the nitrogen in organic compounds into nitrate ions. What mass of bacterial tissue is produced in a treatment plant for every 1.0 104 kg of wastewater containing 3.0% NH4+ ions by mass? Assume that 95% of the ammonium ions are consumed by the bacteria.
When potassium chlorate is subjected to high temperatures, it decomposes into potassium chloride and oxygen. (a) Write a balanced equation for the decomposition. (b) In this decomposition, the actual yield is 83.2%. If 198.5 g of oxygen are produced, how much potassium chlorate decomposed?
Phosphoric acid, H3PO4, can be prepared by the reaction of phosphorus(V) oxide, P4O10, with water. 14P4O10(s)+32H2O(l)H3PO4(aq);H=96.2kJ What is H for the reaction involving 1 mol of P4O10? P4O10(s)+6H2O(l)4H3PO4(aq)
Write the balanced chemical equation for the complete combustion of adipic acid, an organic acid containing 49.31% C, 6.90% H, and the remainder O, by mass.