Ammonia was produced by reacting nitrogen and hydrogen gases at 350°C according to the reaction below: N2(g) + 3H2(g) = 2NH3(g) In a laboratory experiment, the system was allowed to reach equilibrium and the equilibrium concentration of each compound was measured and found to be equal to 0.683 M N₂, 8.8 M H₂, and 1.05 M NH3. The concentration of NH3 was then increased to 3.65 M. a) What is the reaction quotient when the concentration of NH3 was increased? b) Calculate the concentration of each compound when equilibrium is re-established.

Ammonia was produced by reacting nitrogen and hydrogen gases at 350°C according to the reaction below: N2(g) + 3H2(g) = 2NH3(g) In a laboratory experiment, the system was allowed to reach equilibrium and the equilibrium concentration of each compound was measured and found to be equal to 0.683 M N₂, 8.8 M H₂, and 1.05 M NH3. The concentration of NH3 was then increased to 3.65 M. a) What is the reaction quotient when the concentration of NH3 was increased? b) Calculate the concentration of each compound when equilibrium is re-established.

Chemistry & Chemical Reactivity

10th Edition

ISBN:9781337399074

Author:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Publisher:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Chapter15: Principles Of Chemical Reactivity: Equilibria

Section15.3: Determining An Equilibrium Constant

Problem 15.3CYU: A solution is prepared by dissolving 0.050 mol of diiodocyclohexane, C5H10I2, in the solvent...

See similar textbooks

Similar questions

At 2300 K the equilibrium constant for the formation of NO(g) is 1.7 103. N2(g) + O2(g) 2 NO(g) (a) Analysis shows that the concentrations of N2 and O2 are both 0.25 M, and that of NO is 0.0042 M under certain conditions. Is the system at equilibrium? (b) If the system is not at equilibrium, in which direction does the reaction proceed? (c) When the system is at equilibrium, what are the equilibrium concentrations?
You place 0.600 mol of nitrogen, N2, and 1.800 mol of hydrogen, H2, into a reaction vessel at 450C and 10.0 atm. The reaction is N2(g)+3H2(g)2NH3(g) What is the composition of the equilibrium mixture if you obtain 0.048 mol of ammonia, NH3, from it?
Methanol, a common laboratory solvent, poses a threat of blindness or death if consumed in sufficient amounts. Once in the body, the substance is oxidized to produce formaldehyde (embalming fluid) and eventually formic acid. Both of these substances are also toxic in varying levels. The equilibrium between methanol and formaldehyde can be described as follows: CH3OH(aq)H2CO(aq)+H2(aq) Assuming the value of K for this reaction is 3.7 1010, what are the equilibrium concentrations of each species if you start with a 1.24 M solution of methanol? What will happen to the concentration of methanol as the formaldehyde is further converted to formic acid?
At room temperature, the equilibrium constant Kc for the reaction 2 NO(g) ⇌ N2(g) + O2(g) is 1.4 × 1030. Is this reaction product-favored or reactant-favored? Explain your answer. In the atmosphere at room temperature the concentration of N2 is 0.33 mol/L, and the concentration of O2 is about 25% of that value. Calculate the equilibrium concentration of NO in the atmosphere produced by the reaction of N2 and O2. How does this affect your answer to Question 11?
The equilibrium constant for the dissociation of iodine molecules to iodine atoms I2(g) 2 I(g) is 3.76 103 at 1000 K. Suppose 0.105 mol of I2 is placed in a 12.3-L flask at 1000 K. What are the concentrations of I2 and I when the system comes to equilibrium?
The diagram represents an equilibrium mixture for the reaction N2(g) + O2(g) ⇌ 2 NO(g) Estimate the equilibrium constant.
A solution is prepared by dissolving 0.050 mol of diiodocyclohexane, C5H10I2, in the solvent CCl4.The total solution volume is 1.00 L When the reaction C6H10I2 C6H10 + I2 has come to equilibrium at 35 C, the concentration of I2 is 0.035 mol/L. (a) What are the concentrations of C6H10I2 and C6H10 at equilibrium? (b) Calculate Kc, the equilibrium constant.
In a 3.0-L vessel, the following equilibrium partial pressures are measured: N2, 190 torr; H2, 317 torr; NH3, 1.00103 torr. N2(g)+3H2(g)2NH3(g) (a) How will the partial pressures of H2, N2, and NH3 change if H2 is removed from the system? Will they increase, decrease, or remain the same? (b) Hydrogen is removed from the vessel until the partial pressure of nitrogen, at equilibrium, is 250 torr. Calculate the partial pressures of the other substances under the new conditions.
Because carbonic acid undergoes a second ionization, the student in Exercise 12.39 is concerned that the hydrogen ion concentration she calculated is not correct. She looks up the equilibrium constant for the reaction HCO,-(aq) «=* H+(aq) + COf'(aq) Upon finding that the equilibrium constant for this reaction is 4.8 X 10“H, she decides that her answer in Exercise 12.39 is correct. Explain her reasoning. A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H,CO,(aq) 5=6 H+(aq) + HCO,'(aq) K = 4.4 X 10'7She starts with 0.1000 A1 carbonic acid. W hat are the concentrations of all species at equilibrium?
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?