Ans. f(t) = te' -0.51 e %3D

Q: ZX= 2.5 5.59

A:

Q: Points A and B have symmetry with respect to the x-axis. If A = (4.5,-6.3), find the coordinates of…

A: We can answer the correct option in the following steps.

Q: he probability that a subject was a stude al media was not important? draw on the table to show your…

A: Topic:- probability

Q: Roger inscribes a square in a circle whose diameter is 12 meters. What is the length of each side of…

A: We can find the sides of the square in the following steps.

Q: What is the center and radius of the circle? (x-5) +y? = 36 The center of the circle is (Type an…

A: We have to find the center and radius

Q: Find the area of the shaded region of circle W below. Round your answer to the nearest tenth if…

A: This question is related to Circles, we will solve it using given information.

Q: Calculate the y-coordinate of the centroid of the shaded area. The triangle is equilateral. -32 107…

A:

Q: Murtralial a parabolic arch that is 16 meters high at the apex and at a height of 6 meters, the…

A:

Q: 5. An event that has only one outcome is called alan A. Event B. Compound Event C. Sample space D.…

A: Note:- Since you have asked multiple question As per our policy, we will solve the first question…

Q: 10.Determine the vector equation of the plane that contains the origin and the intersection of:…

A:

Q: The playing field for a particular spprt is rectangle whose length is 5 feet more than twice the…

A: To find sides of rectangular  playing field.

Q: Part a) Plot the point given in polar coordinates. (8, -pi/3) Part b) Find three additional polar…

A:

Q: = 12 sin 8t i - 12 cos 8t j O It is a circle of radius 12 in the xy-plane, with center at the point…

A:

Q: Two sides and an angle (SSA) of a triangle are given. Determine whether the given measurements…

A: Find the number of possible triangle formed??

Q: F(s)=-4s²

A: find

Q: Find the total surface area of each solid below. Round your answer to the nearest whole number. 4 m…

A: To find the total surface area of the given solid.

Q: The image below shows a square pyramid being pushed into the corner of a box.If the pyramid has a…

A:

Q: 1. A line, passing through point (6, 3, 2) and is perpendicular to the yz-plane. Find a point on…

A: ------------------------------------------------------------------------- Line ⊥ to yz plane is ∥ to…

Q: Find the unknown angle measure. 57⁰ 41° Drawing is not to scale. X =

A:

Q: 1. Center: (2, 8), Radius: 3 2. Center: (5, -13), Radius: 11 3. Center: (-9, -7), Diameter: 34

A: We know that equation of a circle with center h, k and radius r is defined as  x-h2+y-k2=r2

Q: Decide if the points given in polar coordinates are the same. If they are the same, enter T. If they…

A: A)6, π3  (quadrant-1)-6,-π3 -6 cosπ3, 6 sinπ3(quadrant-2)B)2, 35π4=2, 3π4 (quadrant-2)2, -35π42…

Q: 11. 120

A:

Q: THANKS

A:

Q: The area of a sector of a circle with a central angle of 2?/11 rad is 19 m2. Find the radius of the…

A: Given: Area of the sector =19Central angle =2π11 To Find the radius of the circle.

Q: proof that d sech u Sech u tanhu. du dx dx

A:

Q: radius, diameter, chord, secant, tangent, major arc minor arc, or semicricle? P M 3. Line ZY

A: We can name the line ZY as below.

Q: A circle that contains the point (2, 7) is centered at the point (10, 1). Solve for the equation…

A:

Q: Ans. f(t)= 2e" + cos(1) + sin(1)

A: Given: F(s)=3s2-2s-1(s-3)(s2+1)F(s)=3s2-2s-1(s-3)(s2+1)  Writing into partial fractions   Writing…

Q: 13. Solve for the mPHL P W m/LTP 100° L Your answer H Jaddav

A:

Q: Problem 1 YOU TRY - CHARACTERISTICS OF LINEAR FUNCTIONS Given a function, f(x) = mx + b, respond to…

A: To answer the given question using the given details. Here, the given function is: f(x)=y=mx+c

Q: A right triangle is in the first quadrant with a vertex at the origin and the other two vertices on…

A:

Q: Find the length s of the circular arc. (Assume r = 5 and ? = 130°.)

A:

Q: Find the value of x. Round your answer to the nearest tenth. 12 X

A: Given a right angled triangle.    Tan x = opposite side/ Adjacent side

Q: Find the volume of a right circular cone that has a height of 6.5 cm and a base with a radius of 8.5…

A: A right circular cone that has height of 6.5cm and a base radius of 8.5cm

Q: Given the points A(5,-8), B(-2,-10), C(-6,-13) and D(-2, 1). Is AB Perpendicular to CD? Yes or no

A: Given query is to find AB is perpendicular to CD or not.

Q: 35. The vehicle of a triangle have polar coordinates of (0,0), (6,30º) and (9,70°). Find the…

A: This is a problem related to polar coordinates of the triangle. Based on the general formula and…

Q: Obtain an equation for a straight line that passes through the point (3,5) and has a gradient of -4.

A: As we know that; The equation of the line (point-slope form): y-y1=mx-x1 Where; m is the slope or…

Q: 53 60

A:

Q: Inuerse Laplace Trmsformn 3s 19) F(s) = Ans. f( s² +2s – 8 %3D

A: To find inverse Laplace transform of the given function.

Q: The figure of ⒸA shown below has diameter PR which intersects QS at point & and the measurements…

A:

Q: Find the value of x. 6.

A: Theorem: The perpendicular from the centre of a circle to a chord bisects the chord.  Therefore,…

Q: Identify the number of faces, edges and vertices of the polyhedron.

A:

Q: A home builder wants to create a foyer window in the shape of a rhombus. The window will have…

A:

Q: Write the standard equation for the circle whose center is at (10,7) and whose radius is 2. Choose…

A: We have to find the standard equation of the circle.

Q: What is the simplified form of 4 * log_3(y) - 6 * log_3(x) + 7 * log_3(z) ?

A: Find the simplified form

Q: 1. 15 10 9:46 PM / 56 48 36 9:46 PM / 28 39 24 3.

A:

Q: Find the measure of ZP.

A: Here we have to find the m∠P=?

Q: Find mCE B 20⁰ 62⁰ D E

A:

Q: The cone below has a base area of 8piπ cm2 and a slant height of 12 cm. Find the volume, rounded to…

A:

Q: A container in the shape of a (right) cylindrical can with an open top of volume 87 cm³ is to be…

A: