As you go higher in the Earth’s atmosphere, the ratio of N2 molecules to O2 molecules increases. Why?

Q: O2(g) --> O3(g) How much space will ozone take up if 682 g oxygen if converted in the atmosphere…

A: The space that ozone will take up if 682 g oxygen if converted in the atmosphere at 15 °C and 0.786…

Q: In the atmosphere, is it more common to find two oxygen molecule to joined together than find a…

A: Oxygen is found naturally as a molecule. Two oxygen atoms strongly bind together with a covalent…

Q: 2. Calculate the number of grams of O2 in a 100.0 L cylinder at STP a. 4.46 b. 71.4 с. 143 d. 7.17…

A:

Q: Describe the composition of the atmosphere in terms of the major components in dry air at sea level?

A: The charged or neutral particles combining together to form earth atmosphere is called its…

Q: >Do the reactions involved in ozone depletion involve changes in oxidation state of the O atoms?…

A: CFCs forms free radical on reacting with UV resulting in continues depletion of ozone layer.

Q: Chemist weighed out 5.14g of a mixture containing unknown amounts of BaO(s) and  CaO(s) and placed…

A: The question is based on quantitative estimation of calcium oxide and barium oxide present in a…

Q: (a) How are the boundaries between the regions of the atmosphere determined? (b) Explain why the…

A: a. The atmosphere is divided into four regions on the basis of their temperature profiles.The…

Q: Consider the following molecules that are found in our atmosphere. a. What key features can be u…

A: An element is made upof a single type of atom while compound consists of two or more than two types…

Q: Which ranks the gasses in the troposphere in order of increasing concentration?     A) CO2 < Ar < O2…

A:

Q: Why is the composition of the atmosphere is not uniform?

A: The reason why the composition of the atmosphere is not uniform has to be given,

Q: What volume of oxygen is produced from the decomposition of 472.65 grams of nitric acid (HNO)3

A: Decomposition of Nitric Acid (HNO3) as, 4 HNO3 (l) → 4 NO2 (g) + 2 H2O (l) + O2 (g)

Q: How many moles are there in 112 litres of hydrogen gas at STP? O5 O 112 O 61 01

A:

Q: We have two 22.4 liter flasks, one containing H2 gas and one containing CO2 gas. The gases are at…

A: At STP (standard temperature and pressure), 1 mole of gas occupies 22.4 L of volume.

Q: In which parts of the atmosphere would you expect gases to behave most ideally (ignoring any…

A: There are six layers of atmosphere present above the Earth’s surface given as Troposhere,…

Q: The overall cause of ozone depletion is associated with the presence of chlorofluorocarbons and…

A: The ozone in the atmosphere reacts with the chlorofluoro carbons to form the oxygen through…

Q: 2. Which of the two-cloud droplets or raindrops-would you expect to be more effective in scavenging…

A:

Q: What are the differences between anhydrous atmosphere and inert atmosphere?

A: Hbhhb

Q: The temperature starts decreasing in this layer of the atmosphere as the altitude increases reaching…

A: Troposphere is the lowest region of the atmosphere its boundary is fallen in the range of 10-18 km…

Q: Ozone molecules in the stratosphere absorb much of the harmful radiation from the sun. How many…

A: Given,Pressure, P = 1.59 × 10-3 atm     Volume, V = 1.00 LTemperature, T = 271 KNo. of moles (n) of…

Q: What is the mass (in grams) of 2.00 L of O₂ at STP? R = 0.08314 L･bar/mol･K

A: Solution :-The values provided in the question are :-i) volume of O2 gas, V = 2.00 Lii) Universal…

Q: Calculate the density of nitrogen gas, 2 points in grams per liter, at STP. * O 0.625 g/L O None of…

A:

Q: Explain why the concentration of CFCs increased in the atmosphere.

A: Chlorofluorocarbons(CFCs) are a chlorine-containing compound used in several appliances and cause…

Q: The estimated average concentration of carbon monoxide in air in the United States in 1991 was…

A: Given: Volume (V) of gas = 1.0 L Pressure (P) of gas = 754 torr                      P = 754 atm/760…

Q: Compare and contrast the roles of ozone (O3) and nitrogen dioxide (NO2) in the stratosphere and in…

A: Light emitted from the sum resembles that of a 6000 K black body. The intensity of the radiation…

Q: Which of the following is not one of the gases that Miller and Urey believed was part of the early…

A: Answer - The correct option is (d) oxygen Explanation - According to the question - Miller and Urey…

Q: Calculate the total mass (in kg) of nitrogen, oxygen, and carbon dioxide gases in the atmosphere.…

A: In chemistry, the mass fraction of a substance within a mixture is the ratio of the mass of that…

Q: Which of the relatinships are true about water boiling in a container that is open to the atmosphere…

A: When water boils in open container, the volume of water increases and randomness of molecules…

Q: What would happen to the plaster paste if there was no carbon dioxide in the atmosphere?

A: Solution Plaster is a building material used to protect or decorate walls and roofs and to mold and…

Q: What is the total pressure for a mixture of hydrogen, nitrogen, and ammonia? O PN2 + PH2 / PNH3 O…

A:

Q: Determine the density of O2 gas at 1.1 atm and 29 °C. O 2.2 g/L 0.28 g/L O 1.9 g/L O 0.98 g/L

A: Given, Pressure (P) = 1.1 atm  Temperature (T) = 29°C = (29 + 273.15) K = 302.15 K Density of O2 gas…

Q: What is the mass in gas of .098L of SO 2 at STP? (m=\#L, molar mass of SO 2 /22.4L)

A:

Q: If the concentration of carbon dioxide in the atmosphere is 400 ppm, how many CO2 molecules are…

A: To calculate molecules of CO2 , we would first calculate volume of CO2 using volume of air and ppm…

Q: what properties of CFC's make them ideal for various commercial application but also make them a…

A: Therefore the physical properties of CFC's make them ideal for various application like freezers,…

Q: a 12.2-L sample containing 0.50 mol O2 gas at a pressure of 1 atm and a temperature of 25 celsius.…

A: Given: moles of O2 = 0.50 mol          ( V =  12.2 L ,P = 1atm ,T = 25 celcius = 298K) From the…

Q: What is the approximate percentage of the following atmospheric gases? Joxygen A. 78% v Carbon…

A:

Q: Why are hydrofluorocarbons potentially less harmful to the ozone layer than CFCs?

A: As CFC's diffuse into the stratosphere, they are exposed to high energy radiation, which can cause…

Q: What is an ionic atmosphere?

A: Ionic atmosphere is defined as the area at which a charged entity is capable of attracting an entity…

Q: Calculate the grams of SO2 gas present at STP in a 5.9 L container. (Atomic weights: S=32, 0=16) O…

A:

Q: * The Ozone gas at STP contains (6.022 × 10^23) molecules. O True O Flase

A: