Balance each of the following equations according to the half-reaction method: (a) Sn2+(aq)+Cu2+(aq)⟶Sn4+(aq)+Cu+(aq)Sn2+(aq)+Cu2+(aq)⟶Sn4+(aq)+Cu+(aq) (b) H2S(g)+Hg22+(aq)⟶Hg(l)+S(s)(in acid)H2S(g)+Hg22+(aq)⟶Hg(l)+S(s)(in acid) (c) CN−(aq)+ClO2(aq)⟶CNO−(aq)+Cl−(aq)(in acid)CN−(aq)+ClO2(aq)⟶CNO−(aq)+Cl−(aq)(in acid)

Balance each of the following equations according to the half-reaction method: (a) Sn2+(aq)+Cu2+(aq)⟶Sn4+(aq)+Cu+(aq)Sn2+(aq)+Cu2+(aq)⟶Sn4+(aq)+Cu+(aq) (b) H2S(g)+Hg22+(aq)⟶Hg(l)+S(s)(in acid)H2S(g)+Hg22+(aq)⟶Hg(l)+S(s)(in acid) (c) CN−(aq)+ClO2(aq)⟶CNO−(aq)+Cl−(aq)(in acid)CN−(aq)+ClO2(aq)⟶CNO−(aq)+Cl−(aq)(in acid)

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 18.60QE

See similar textbooks

Similar questions

The following reaction occurs in basic solution. Balance it by adding only OH− or H2O. (enter your answer as the sum of the coefficients) MnO4−(aq) + NO2−(aq) → MnO2(s) + NO3−(aq)
Balance the following reaction in basic solution: MnO4- (aq) +C2O42- (aq) ⟶MnO2(s) +CO32-(aq)
Balance the following equations in acidic solution. SO32-(aq) + MnO4-(aq) --> SO42-(aq) + Mn2+(aq) Fe2+(aq) + MnO4-(aq) --> Fe3+(aq) + Mn2+(aq)
Balance each of the following ionic equations for basic conditions. Identify the oxidizing agent and the reducing agent in each case. 6. H2O2(aq) + ClO2(aq) → ClO−(aq) + O2(g) 8. Al(s) + NO−(aq) → NH3(g) + AlO2−(aq)
The following reaction occurs in basic solution: _ H2O(aq) + _ MnO4–(aq) + _ ClO–(aq) → _ MnO2(s) + _ ClO4–(aq) + _ OH–(aq) When the equation is properly balanced, what is the sum of the lowest whole-number coefficients? a. 9 b. 10 c. 20 d. 12 e. 6
Compose the balanced reaction equation for the following reaction occuring in basic aqueous medium.Reduce all coefficients to the lowest possible integers. Fe(CN)64−(aq)+Ce4+(aq) → Ce(OH)3(s)+Fe(OH)3(s)+CO32−(aq)+NO3−(aq)
Balance the following equation for acid conditions by the half-reaction method. Identify the oxidizing agent and the reducing agent. SO32-(aq) + MnO4-(aq) → SO42-(aq) + Mn2+(aq)
Balance the following equations in basic solution. MnO4-(aq) + CN-(aq) --> MnO2(s) + OCN-(aq) S(s) + OCl-(aq) --> SO32-(aq) + Cl-(aq)
Balance each of the following equations according to the half-reaction method:(a) MnO4−(aq) + NO2−(aq) ⟶ MnO2(s) + NO3−(aq) (in base)(b) MnO42−(aq) ⟶ MnO4−(aq) + MnO2(s) (in base)(c) Br2(l) + SO2(g) ⟶ Br−(aq) + SO42−(aq) (in acid)
Balance the following redox reaction in basic condition. (b) After balancing the equation, indicate which species is a reducing agent and an oxidizing agent.PO3 3- (aq) + MnO4 – (aq) ---> PO4 3- (aq) + MnO2 (s)
Balance the given reactions by change in the ox. no. method. Identify the oxidizing agent and reducing agent. PbO2 + HI → PbI2 + I2 + H2O
Balance each of the following ionic equations for acidic conditions. Identify the oxidizing agent and the reducing agent in each case. 2. Hg(l) + NO3−(aq) + Cl−(aq) → HgCl42−(s) + NO2(g) 4. I2(s) + ClO−(aq) → IO3−(aq) + Cl−(aq) 6. H2O2(aq) + ClO2(aq) → ClO−(aq) + O2(g)