Bromine forms three compounds with phosphorus. The compounds have the molecularformulae PBR3, PBr5 and PBR4.(i)Explain what is meant by the term molecular formula.(ii)PBR3 can be prepared by heating bromine with phosphorus, P4-Write a balanced equation for this reaction.(iii) Compound A is one of the three bromides of phosphorus above. It has thefollowing percentage composition by mass: P, 16.2%; Br, 83.8%.Use this percentage composition to calculate the empirical formula and todetermine the identity of compound A.empirical formula.identity of compound ABic sOF YFeel bad

Answered: Image /qna-images/answer/d5dd8c29-6a73-4c52-8439-0dbd1539aa8d.jpg

Bromine forms three compounds with phosphorus. The compounds have the molecular formulae PBR3, PBr5 and P2BR4. (i) Explain what is meant by the term molecular formula. (ii) PBr3 can be prepared by heating bromine with phosphorus, P4- Write a balanced equation for this reaction.

Bromine forms three compounds with phosphorus. The compounds have the molecular formulae PBR3, PBr5 and P2BR4. (i) Explain what is meant by the term molecular formula. (ii) PBr3 can be prepared by heating bromine with phosphorus, P4- Write a balanced equation for this reaction.

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter4: Stoichiometry

Section: Chapter Questions

Problem 4.87PAE

See similar textbooks

Related questions

Q: Octane (C8H8), a component of gasoline, reacts with oxygen toform carbon dioxide and water. Write…

A: BALANCING CHEMICAL EQUATION 1- The number of atoms on both sides of the chemical equation must be…

Q: What is the theoretical yield of SO3 produced by 4.58g of S?

A: Balanced chemical equation:2S+3O2 --------------à2SO3From the balance chemical equation,2…

Q: Write a balanced chemical equation based on the following description: the reaction of gasesous…

A: Given, gaseous sulfur dioxide react with solid potassium telluride to give gaseous sulfur…

Q: What substances are present, and what are their masses, after the reaction of 10.00 g ofmagnesium…

A: THE IDEA HERE IS THAT CHEMICAL REACTIONS MUST OBEY THE LAW OF MASS CONSERVATION , WHICH STATES THAT…

Q: Methylhydrazine, N2H3CH31l2, is used with the oxidizer dinitrogen tetroxide, N2O41l2, to power the…

A: Methylhydrazine, N2H3CH3 (l), is reacted with dinitrogen tetroxide, N2O4(l), to produce N2, CO2, and…

Q: What is the mass percentage of Cl in hydrochlorothiazide, C₇H₈ClN₃O₄S₂?

Q: + 7 02 → 4 CO, + 6 H,0

A: Balancing a reaction means the number of each type of atoms must be same on left and right hand side…

Q: When would nitrogen become a nitrite ion, as opposed to nitrate or nitride

A: Given: Anions of Nitrogen: Nitride Nitrate Nitride

Q: СІО, + Ca(CIO,), Са(ОН), H.O 4) +

A: balance the chemical equation

Q: A 5.276 g sample of Al-Mg alloy is digested in nitric acid (to Al*3 and Mg*²). The solution is…

A: Given: Mass of sample = 5.276 g The solution is diluted = 500 mL three 100 mL of solution titrated…

Q: How many grams of sodium iodide, NaI, must be used to produce 56.2 g of iodine, I2?

Q: Iron(III) chloride is used to test the purity of your aspirin. Why does salicylic acid reacts with…

A: Given Test = FeCl3 is used to test Aspirin

Q: Write the balanced chemical equation for the reaction between magnesium metal and hydro- chloric…

A: Metal reacts with acid to gives salt and hydrogen gas.The reaction between magnesium and…

Q: 4. How many grams of chlorine will react completely with 9.650 grams of magnesium to produce 1.00…

Q: Write a balanced equation for the reaction of molecular nitrogen (N2) and oxygen (O2) to form…

A: The reaction between Molecular Nitrogen (N2) and Oxygen (O2) to form dinitrogen pentoxide is given…

Q: What % fraction of the electrons would you have to remove from a 5.0 mg sphere iron in order to make…

A: Given: mass of Fe sphere = 5 mg = 0.005 g charge on sphere= 3C we know that, atomic mass of…

Q: Differentiate between Oxides and Oxyacids of Nitrogen?

A: Oxides: Oxides are that organic and inorganic compound that contains at least one O atom along with…

Q: What is Manganese ?

A: The arrangement of elements in increasing order of atomic number in the tabular form is termed…

Q: Is boron the sole nonmetallic element of group 3A?

A: A nonmetal is an element that mostly lacks the characteristics of a metal. Physical characteristics…

Q: There are two steps in the usual industrial preparation of acrylic acid, the immediate precursor of…

A: The two reaction is as follows: First reaction: CaC2(s) + 2H2O(g) →C2H2(g) + Ca(OH)2(s) Second…

Q: 2Cl2) is formed from sulfur I atoms in the reactants an

Q: what is a balanced equation for the reaction of nonane,C9H20 , with oxygen O2?

A: The reaction of nonane with oxygen is a combustion reaction. In combustion reaction, a hydrocarbon…

Q: what mass in grams of H2O can be produced from 9.00 moles of O2?

A: In the given question we have to calculate the mass in gram of H2O. the balanced equation will be 2…

Q: What is the mass percentage of Na in Na2SO3?

A: To calculate the mass percent of an element in a compound, we divide the mass of the element in 1…

Q: Complete and balance: Manganese Sulfate + Aluminum Phosphate

A: We will write molecular equation, then balance it.

Q: b if [OH ] — 7.6 х 10 4 м then РОН =

Q: Write the balanced equation for the photosynthesis reaction in which gaseous carbon dioxide and…

A: A chemical reaction is symbolic representation of the conversion of substances to new substances. In…

Q: Give the chemical formula for (a) carbonic acid, (b) sodiumcyanide, (c) potassium hydrogen…

A: The composition of a chemical compound can be presented in a very precise was with the use of…

Q: 2. Write a balanced chemical equation for the reaction of bromine and triolein, a triglyceride of…

A: Given; structure

Q: For the reaction N, + 3H, 2NH, what is the Mole ratio of nitrogen to hydrogen? t. Mole ratio of…

A: In a balanced chemical equation , the stoichiometric coefficients of reactants and products…

Q: Reaction of propylene, C3H6 with nitrogen monoxide produces acrylonitrile, C3H3N , water and…

A: A balanced chemical equation contains equal number of atoms on both the reactant and product side.…

Q: A metal sulfide M 2 S contains 14.3% of sulfur by massWhat is the identity of the metal in this…

Q: Chlorine reacts with oxygen to form Cl2O7. (a) What is the name of this product (see Table…

A: a. Chlorine reacts with oxygen to form Cl2O7. Given oxide has two chlorine atoms and seven oxygen…

Q: Write balanced equations for the following reactions:(a) barium oxide with water, (b) iron(II) oxide…

A: The balanced equations are as follows: (a) Barium oxide with water.

Q: what is the mass percentage of C in hydrochlorothiazide, C7H8ClN3O4S2?

A: Mass percentage=Mass of particular speciesTotal massx100Hydrochlorothiazide molecular…

Q: Write a balanced chemical equation for the reaction of propane (C 3H 8) with oxygen (O 2) to form…

A: Given: Reaction of propane (C3H8) with oxygen (O2) to form carbon dioxide (CO2) and water (H2O)

Q: balanced chemical equation of Group IV cation Ba 2+ with(NH4)2HPO4 balanced chemical equation of…

A: (NH4)2HPO4 (DAP): Diammonium phosphate is one of water soluble ammonium-phosphate salt. This salt is…

Q: Write the chemical equation for the word equation below. Each blank should be a different substance…

A: We have to react molybdenum(IV) chromate with lithium telluride to form molybdenum(IV) telluride and…

Q: u. Magnesium and sulfuric acid V. Calcium sulfide and nitric acid w. Reacting magnesium and chlorine…

A: U. Magnesium with Sulfuric acid: Magnesium (Mg) reacts with sulfuric acid to form magnesium sulfate…

Q: what is the mass percent of chlorine in C2Cl4F2

A: The given molecule is = C2Cl4F2 The mass percent of chlorine is =?

Q: Carbon disulfide is produced by reacting carbon with sulfur dioxide according to the equation: 5C+2…

A: The objective of the question is to choose the statement which best follows the reaction given in…

Q: If 5.3 g of gallium reacts with 5.3 g of oxygen to produce gallium oxide, what will we be left with…

A: Limiting reactant :- A reactant whose number of moles are less than the number of moles required…

Q: 2. Write a chemical equation showing the transfer of electrons from sodium atoms to sulfur atoms to…

Q: Write the formula for the compound formed between an alkaline earth metal (represented by "A") and a…

A: Observing the periodic table shows that alkaline group metals are group 2 elements. Therefore, the…

Q: 6. Consider the following reaction Cas(PO.)2 + 3 H,so, → 3 Caso, + 2 H;PO, a. What masses of calcium…

A: Limiting reagent It is a reagent that will be consumed completely in a reaction and determines the…

Concept explainers

Mole Concept

Mole concept is a method to determine the amount of any substance that consists of some elemental particles using a grouping unit called ‘mole’. The mole concept enables one to handle the large amount of small elementary particles. The mole concept can be used in many calculations related to mole calculation, molar amount, mole ratio, and so on, which are significant in chemistry.

Question

Bromine forms three compounds with phosphorus. The compounds have the molecular
formulae PBR3, PBr5 and PBR4.
(i)
Explain what is meant by the term molecular formula.
(ii)
PBR3 can be prepared by heating bromine with phosphorus, P4-
Write a balanced equation for this reaction.
(iii) Compound A is one of the three bromides of phosphorus above. It has the
following percentage composition by mass: P, 16.2%; Br, 83.8%.
Use this percentage composition to calculate the empirical formula and to
determine the identity of compound A.
empirical formula.
identity of compound A
Bic sOF YFeel bad

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Nitrogen fixation in the root nodules of peas and other legumes occurs with a reaction involving a molybdenum-containing enzyme named nitrogenase. This enzyme contains two Mo atoms per molecule and is 0.0872% Mo by mass. Calculate the molar mass of the enzyme.
Phosphoric acid, H3PO4, can be prepared by the reaction of phosphorus(V) oxide, P4O10, with water. 14P4O10(s)+32H2O(l)H3PO4(aq);H=96.2kJ What is H for the reaction involving 1 mol of P4O10? P4O10(s)+6H2O(l)4H3PO4(aq)
Write balanced chemical equations for the following reactions: (a) zinc metal heated in a stream of oxygen gas (b) zinc carbonate heated until loss of mass stops (c) zinc carbonate added to a solution 0f acetic acid, CH3CO2H (d) zinc added to a solution of hydro-bromic acid
what is the mass percentage composition of the elements in the following compounds? Round to the nearest tenth. Caffeine, C8H10N4O2
Methylhydrazine, N2H3CH3(l), is used with the oxidizer dinitrogentetroxide, N2O4(l), to power the steering rockets of theSpace Shuttle orbiter. The reaction of these two substancesproduces N2, CO2, and H2O. Write a balanced equation forthis reaction.
If you mass 0.430 g of Co(NO3)2 x 6H2O and dissolve it in water, what further information would you need to calculate: a. The number of moles of Co(NO3)2 in the solution? b. The molarity of the solution?
how many moles of Fe3O4 are required to supply enough iron to prepare .260 mol Fe2O3?
The percentage composition by mass (to the nearest 0.1) of C in sugar, C8H10O7, is ______________.