C3H60(1)+402(g)→3CO2(g)+3H2O(g) AH.rxn=-1790kJ Part A If a bottle of nail polish remover contains 265 mL of acetone, how much heat would be released by its complete combustion? The density of acetone is 0.788 g/mL.

Q: A 1.00-L solution contains 3.75×10-4 M Cu(NO3)2 and 2.00×10-3 M ethylenediamine (en). The Kf for…

A:

Q: Above: FTIR of L-menthol. 3500 3000 2500 Wavenumber cm-1 2000 1500 1000 500 3246.67 2953.97 2925.63…

A: IR spectra provides the information of functional groups of unknown compound based on the…

Q: A study of the rate of the reaction represented as 2 A ⟶ B gave the following data: Time (s) 0.0…

A:

Q: A 4.0-liter rigid metal can is filled with nitrogen gas at 45 °C to a pressure of 1.125 atm. The can…

A:

Q: Propose an efficient synthesis for the given transformation. x This transformation can be performed…

A: The question is based on organic synthesis. we need to synthesize the product based on reagents…

Q: Calculate E∘cell�cell∘ for a redox reaction with n� = 2 that has an equilibrium constant of K� = 24…

A:

Q: Any substance that is an electrolyte must dissolve to form ions when placed in water. Answer: TRUE,…

A: An electrolyte is a substance which when dissolve in water give ions and can conduct electricity.…

Q: Calculate ΔrG∘Δr�∘ for a redox reaction with n=4�=4 that has an equilibrium constant of K� = 0.044…

A:

Q: Why pyrrole is only weakly basic? a. Due to the absence of lone pair c. Lone pair is used for…

A: The basicity of heterocyclic compounds depends on the availability of lone pair on the heteroatom.

Q: Complete the table below by writing the symbols for the cation and anion that make up each ionic…

A:

Q: Which of the following are biologically-important ions present in the solutions that conducted…

A: When an ionic compound dissolves in water, it dissociates into its constituent ions, which can carry…

Q: Start with condensed structural formula: CH3-CH(OH)-CH(CH3)-CH22-CH(CH3)2 React it first with…

A:

Q: 14. What is the molar mass of Ca? 16. 078 15. What is the molar mass of H₂SO4? What is the mass of 3…

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: Decide whether the Lewis structure proposed for each molecule is reasonable or not. Note: If two or…

A: We have to check if the given structures are reasonable or not.

Q: Calculate the molarity of each of the following ions: a) 0.33 g Na+ in 100.0mL of solution  b)…

A: Note: Since you have posted a question with multiple sub-parts, we will solve the first three…

Q: Attempt 3 Calculate the pH of the resulting solution when 25.0 mL of 0.30 M HCl*O_{4} is added to…

A: A buffer is a solution which resist any change in pH on adding a small amount of acid or base .  it…

Q: Suppose 0.753 g of sodium chloride is dissolved in 100. mL of a 57.0 m M aqueous solution of…

A:

Q: 5. Provide a step-by-step reaction mechanism for the following transformation. You must show all…

A: Ketals are prepared by reacting a ketone with alcohol in the presence of an acid catalyst. In this…

Q: Pressure oxygen 765.3 torr Volume water displaced 49.7 mL Temperature oxygen 297 K What is the…

A:

Q: Tutored Practice Problem 18.2.3 COUNTS TOWARDS GRADE Use the reaction quotient to predict whether a…

A: Given :  Volume of Ba(OH)2 = 12 ml  Concentration of Ba(OH)2 = 1.10 x 10-4 M  Volume of Na2CO3 =…

Q: Which of these has the most acidic proton?

A: Identify the most acidic proton in the given organic compounds.

Q: Draw the Lewis structure for the chlorite ion (ClO2-). What is the molecular geometry and shape for…

A:

Q: If the ?a of a monoprotic weak acid is 5.7×10^−6 ,what is the pH of a 0.27 M solution of this acid?…

A: Consider the given information as follows; Ka of a monoprotic weak acid = 5.7×10-6 Concentration of…

Q: Where did 8.67 moles get calculated

A: To determine the volume of 0.85 M NaOH required to exceed the buffer capacity, we need to first…

Q: An unknown compound has the following chemical formula: PCI where x stands for a whole number.…

A:

Q: Write the equilibrium-constant expression for the reaction A(s) + 3 B(1) 2 C(aq) + D(aq) in terms of…

A: We have to determine the expression for the equilibrium constant Kc

Q: Why does H not have a physical state

A: Hydrogen always exist in the form of molecular H2. Not as H in the atomic state. Hydrogen is known…

Q: Calculate the pH in the titration of 100.0 mL of 0.20 M HCIO (Ka = 4.0 × 10^-8) with 0.20 M KOH…

A: Answer: This question is based on salt hydrolysis where salt of weak acid and strong base gets…

Q: The formation constant* of [M(CN) 6 ]4− is 2.50 × 10 17 , where M is a generic metal. A 0.140 mole…

A: Given ,  Formation constant of [M(CN)6]4-=2.50×1017

Q: To convert an alcohol to an alkene, one would use a hydrolysis reaction. Answer: FALSE, can you…

A: The given statement: Alcohols are converted to alkenes by hydrolysis reaction. The given statement…

Q: 2) Find the pH, the pOH, [H*] and [OH-] for the following strong acids or bases. a. A solution of…

A: pH is equal to negative logarithmic value of hydrogen ions concentration.                     pOH is…

Q: Identify the isomeric relationship between each pair of molecules below. The options are:…

A:

Q: Which of the following transport systems allows small molecules such as urea and O₂ to cross the…

A: By the passive diffusion process small molecule cross the cell membrane without expanding energy .…

Q: What would be the Michael donor and acceptor?

A: Given that, a reaction scheme is shown below We have to identify the reactants A and B. Also, we…

Q: Using the appropriate bond energies, calculate the heat of reaction AH for the following reaction: H…

A:

Q: The standard free energy of the hydrolysis of ATP to ADP: ATP (aq) → ADP (aq) + (aq) phosphate in…

A:

Q: In a study of the decomposition of ammonia on a tungsten surface at 1100 °C NH3 1/2 N₂ + 3/2 H₂ the…

A:

Q: What is the conjugate base of [Fe (H2O)6]^3+ (aq

A: According to Bronsted and Lowry concept an Acid is a substance that has the tendency to donate a…

Q: 2. Calculate the mass of 2-methylcyclohexanol that represents 0.033 mole

A:

Q: Gaseous ethane (CH₂CH3) will react with gaseous oxygen (O₂) to produce gaseous carbon dioxide (CO₂)…

A:

Q: Draw major product for each Rxn below

A: We have been given two organic reactions band we have been asked to draw major product for each…

Q: Indicate, reasoning your answer based on the mechanisms of the reactions involved, which is the best…

A: A compound that contains a double bond between two carbon atoms is known as an alkene. The formation…

Q: for column 3 did i do these correctly or should i be using M1V1=M2V2? im just trying to figure out…

A:

Q: please make a T-chart   Explain in jot notes special rules or laws to predict predominant products…

A: Here's a T-chart with jot notes of special rules or laws to predict predominant products for both…

Q: Sam drops a sugar cube into a jar with hot water and a sugar cube into a jar with cold water. Both…

A: Given Sam drops a sugar cube into a jar with hot water and a sugar cube into a jar with cold water.…

Q: Find the Molecular Equation, Ionic Equation, and Net Ionic equation of Copper (II) sulfate +…

A:

Q: Explain what you understand about vapor pressure and atmospheric pressure..

A: we have to define and explain vapour and atmosphereic pressure .

Q: An unknown compound has the following chemical formula: PbOx where x stands for a whole number.…

A:

Q: What is the pH of a solution that is 0.080 M in NaClO at 25 °C? The Ka for HClO is 4.0*10^-8

A:

Q: 22-90. Calculate the equilibrium mercury(I) ion con- centration in a solution made by mixing 100.0…

A: Equilibrium concentration  of Hg + ion is.