Calculate Kp for the reaction C(s) + CO2(g) = 2C0(g) at 1200K in a 2.00L vessel if the partial pressures of the gases at equlibrium are 93.5 atm for CO2 and 76.8 atm for CO, and the vessel contains 3.55 g of carbon.

Calculate Kp for the reaction C(s) + CO2(g) = 2C0(g) at 1200K in a 2.00L vessel if the partial pressures of the gases at equlibrium are 93.5 atm for CO2 and 76.8 atm for CO, and the vessel contains 3.55 g of carbon.

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter16: Spontaneity Of Reaction

Section: Chapter Questions

Problem 100QAP: Consider the reaction 2HI(g)H2(g)+I2(g)At 500C a flask initially has all three gases, each at a...

See similar textbooks

Related questions

Q: After a mixture of hydrogen and nitrogen gases in a reaction vessel is allowed to attain equilibrium…

Q: Write expressions for K and Kp for the following reaction. I2(g) + 5CO2(g) (double arrow) 5CO(g) +…

A: The equilibrium constant of a chemical reaction is the value of its reaction quotient at chemical…

Q: Write the expressions for the equilibrium constants KP of these thermal decompositions: 2NaHCO3(s)…

A: Kp is equilibrium constant used when equilibrium concentrations are expressed in atmospheric…

Q: Kc for the reaction 2Br(g) to Br2(g) is 9.1 x 10^2 at 1280 degrees C. Calculate the value of Kp for…

A: For the reaction: 2Br(g) ⇌Br2 (g) For this reaction Kc=9.1 x 102 Temperature, T=1280 +273=1553 K

Q: For the reaction A (g) → 3 B (g), Kp = 0.681 at 298 K. What is the value of ∆G for this reaction at…

A: The energy associated with the reaction to do work is called as Gibbs free energy, it is denoted by…

Q: The following equilibrium pressures at 50C were observed for the reaction: ___NO2(g) ←> ___NO +…

Q: The equilibrium constant for the reaction given below can be determined experimentally when a known…

Q: After a mixture of hydrogen and nitrogen gases in a reaction vessel is allowed to attain equilibrium…

A: Equilibrium constant is defined as the ratio of partial pressures of products to the partial…

Q: Write the expression for the equilibrium constant Kp for the following reaction. Enclose pressures…

A: Given :- 2 F2(g) + O2(g) ↔ 2 OF2(g) To determine :- equilibrium constant expression i.e. Kp…

Q: 2. The partial equilibrium pressures for N2, 02, and NO in the reaction: N2(g) + 02(g) 2NO(g) are…

A: Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: Fill in the expression for the equilibrium constant K, for the reaction given. А+ 2B— 2С +D D 2 C K.…

A: We have to predict the Equilibrium constant expression.

Q: Ammonium carbamate (NH4CO2NH2) decomposes according to the equation: NH4CO2NH2(s) ⇄ 2NH3(g) + CO2(g)…

A: The species partial pressure is expressed as multiplication association between the vessel total…

Q: When heated at high temperatures, iodine vapor dissociates as follows: I2 (g)⇌2I (g). In one…

A: Given, When heated at high temperatures, iodine vapor dissociates as follows: I2 (g)⇌2I (g). In one…

Q: The equilibrium concentrations for the reaction between carbon monoxide and chlorine to form…

A: Equilibrium Constant (Kc) is the ratio between the product of the concentration of the products to…

Q: For the reaction: 2 A (g) + B (g) =2 C (g) + 2 D (g), the constant Kp is 1.9 x 10^19. Calculate K'p…

A: Equilibrium constant is a constant which represent the ratio of concentration of product to the…

Q: Explain the difference between K, and Kp. For a given reaction, how are the two constants related?

A: A reversible chemical reaction can move in either forward or backward direction. The stage of a…

Q: The equilibrium constant Kc for C + CO2 <=> 2CO is 1.9 at 1000 K and 0.133 at 298K. If a…

A: The given reaction is, C + CO2 <=> 2CO Since on decreasing the volume of the vessel, the…

Q: what is the equilibrium partial pressure of Cl2?

A: The equilibrium partial pressure of Cl2 is 1.984 atm.

Q: For the ideal gas reaction A + B ↔ 2C + 2D, it is given that ∆Gθ500= 1250 cal mol-1. If 1.0 mol of A…

A: From given datas With temperature and pressure values, equilibrium constant is calculated as…

Q: At 327°C, the equilibrium concentrations are [CH3OH] = 0.15 M, [CO] = 0.24 M, and [H2] = 1.1 M for…

A: Given:

Q: The equilibrium partial pressures for the reaction below are P(CO)=0.598atm and P(CO2)=0.159atm at…

A: To solve this problem we will first write the equilibrium expression of the given chemical equation…

Q: Write the expression for the equilibrium constant Kp for the following reaction. Enclose pressures…

Q: Hydrogen can be produced commercially by reforming methanol with water vapor, according to the…

A: The given equilibrium reaction is: CH3OH(g)+H2O(g)⇌CO2(g)+3H2(g) Using the given table of values,…

Q: The diagram represents a reaction going to completion. Let A represent the red spheres and B…

A: The equilibrium constant can be written as the ratio of concentration of products to the…

Q: At a given temperature, the equilibrium constant (Kp) for the decomposition of dinitrogen tetraoxide…

A: Initially partial pressure of N2O4 is 0.224 atm, suppose x is change in partial pressure of N2O4 at…

Q: The chemical equation for the water-gas shift reaction is CO (g) + H2O (g) ⇌ CO2 (g) + H2 (g). What…

A: Given: Partial pressure of CO = 1.31 atm Partial pressure of water = 10.0 atm Partial pressure of…

Q: The equilibrium constant Kp for the oxidation of sulfur dioxide into sulfur trioxide is 5.6x10 4 at…

A: Given : 2SO2+O2→2SO3 PSO2=0.64 atm PSO3=0.58 atm Kp=5.6×104

Q: The equilibrium constant Kp for dissociating SO2Cl2 (g) ⇌ SO2 (g) + Cl2 (g) at 30 deg is 2.65 x 10^-…

Q: Consider the gaseous reaction CO(g) + Cl2(g) <-> COCl2(g). What is the expression for Kp in…

A: Difference between the number of moles of product and reaction is obtained as above.

Q: In the reaction of the equation attached: At 1200K, it was observed that when the equilibrium…

A: According to Dalton’s law of partial pressure, the total pressure in the gaseous mixture is the sum…

Q: For the reaction A (g) → 3 B (g), Kp = 0.821 at 298 K. What is the value of ∆G for this reaction at…

A: The reaction given is, => A (g) ------> 3 B (g)…

Q: For the reaction A (g) → 3 B (g), Kp = 0.717 at 298 K. What is the value of ∆G for this reaction at…

A: Given Reaction A → 3B Temp = 298 K, P(A) = 5.70 atm, P(B) = 0.250 atm To Find : - ∆G value for this…

Q: X(g) + 2Y(g) = Z(g) ' AH =+175kJmol· sion for Kc for this reaction is: K. = [Z] [X] [Y]* %3D f K,…

A: X(g) + 2Y(g) -----> Z(g) Kc = 2.70mol-2dm6 Equilibrium concentration of X = 0.400moldm-3 Z =…

Q: Methanol (CH3OH) is manufactured industrially by the reaction CO(g) + 2H2(g) ⇌ CH3OH(g) The…

A: Chemical reaction: CO(g) + 2H2(g) ⇌ CH3OH(g) Given data: The equilibrium constant of the reaction Kc…

Q: For the reaction: CH3CH3(g) + 2H20(g) +Ni(s) ⇌ 2CO(g) + 5H2(g) +Ni(s) ∆H= +300 kJ/mol Write the…

A: Given reaction is : CH3CH3 (g) + 2H2O (g) + Ni (s) ⇌ 2CO (g) + 5H2 (g) + Ni (s) , ∆H= +300 kJ/mole…

Q: Consider the equilibrium system described by the chemical reaction below. At equilibrium, a 2.0 L…

A: The equilibrium constant will be equal to the ratio between the equilibrium concentration of the…

Q: At 200 °C, the equilibrium constant KP for the reaction below is 2.40 x 103. 2 NO(g) ⇌ ƒ N2(g)…

A: Given, Equilibrium constant, Kp = 2.40*103. Initial pressure of NO = 36.1atm. The ICE table can be…

Q: The equilibrium constant KP for the decomposition of phosphorus pentachloride tophosphorus…

A: The equation can be written as: PPCl5 = 0.973 atm PPCl3= 0.548 atm Kp = 1.05

Q: (5b) Write the expression for the equilibrium constant Kp for the following reaction. Enclose…

A: Since you have asked multiple question, we will solve the first question for you.If you want any…

Q: The equilibrium constant Kp for the oxidation of sulfur dioxide into sulfur trioxide is 5.6 X 104 at…

Q: The equilibrium constant of the reaction between hydrogen gas and iodine gas is 6.2 x 10² at 25 °C.…

A: For the given reaction between Hydrogen gas and Iodine gas- H2g + I2g ⇔ 2HIg…

Q: For the reaction of 2NO2 (g) ↔ 2NO (g) + O2 (g), since Kc = 1.8 × 10-6 at 184 ° C, What is the…

Q: Write the Kp expression for the following reaction: CACO3(s) = CaO(s) + CO2(g)

A: The expression for the equilibrium constant in the terms of pressure (Kp) depends on the partial…

Q: Calculate Kp for the reaction C(s) + CO2(g) ⇌ 2CO(g) at 1200K in a 2.00L vessel if the partial…

Q: The equilibrium constant (Kp) for the reaction C(s) + CO2(g) =2 CO(g) is 2.3 at 743°C. What total…

Q: The equilibrium constant KP for the oxidation of sulfur dioxide into sulfur trioxide is 5.6 x 104 at…

Q: The equilibrium constant (KP) for the formation of the air pollutant nitric oxide (NO) in an…

Q: Write the expression for the equilibrium constant Kp for the following reaction.

A: Kp is equilibrium constant in terms of partial pressure and is equal to the ratio of partial…

Question

Calculate Kp for the reaction C(s) + CO2(g) = 2CO(g) at 1200K in a
2.00L vessel if the partial pressures of the gases at equlibrium are 93.5 atm
for CO2 and 76.8 atm for CO, and the vessel contains 3.55 g of carbon.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

For the decomposition of Ag2O: 2Ag2O(s)4Ag(s)+O2(g)(a) Obtain an expression for G as a function of temperature. Prepare a table of G values at 100 K intervals between 100 K and 500 K. b) Calculate the temperature at which G =0.
The equilibrium constant for the butane iso-butane equilibrium at 25 C is 2.50. Calculate rG at this temperature in units of kJ/mol.
If wet silver carbonate is dried in a stream of hot air. the air must have a certain concentration level of carbon dioxide to prevent silver carbonate from decomposing by the reaction Ag2CO3(s)Ag2O(s)+CO2(g) H for this reaction is 79.14 kJ/mol in the temperature range of 25 to 125C. Given that the partial pressure of carbon dioxide in equilibrium with pure solid silver carbonate is 6.23 103 torr at 25C, calculate the partial pressure of CO2 necessary to prevent decomposition ofAg2CO3 at 110C. (Hint: Manipulate the equation in Exercise 79.)
For the given chemical equilibrium, these data are determined experimentally: T K 350K 3.76102 450K 1.86101 Determine H for this reaction.
For the reaction C(s)+CO2(g)2CO(g) K=168 at 1273 K. If one starts with 0.3 atm of CO2 and 12.0 g of C at 1273 K, will the equilibrium mixture contain (a) mostly CO2? (b) mostly CO? (c) roughly equal amounts of CO2 and CO? (d) only C?
Use data given in Tables 6.2 and 18.1 to obtain the value of Kp at 2000C for the reaction N2(g)+O2(g)2NO(g) Nitric oxide is known to form in hot flames in air, which is a mixture of N2 and O2. It is present in auto exhaust from this reaction. Are the data in agreement with this result? Explain.
Predict the temperature at which the reaction in Exercise 17.67 comes to equilibrium. Consider the equation G = H TS. At some value of T, G equals zero and the reaction is at equilibrium. Set G = 0, substitute for H and S (assuming that they do not vary much with temperature) and solve for T. CH3CHO(l)+52O2(g)2CO2(g)+2H2O(l)
When calcium carbonate is heated strongly, CO2 gas is evolved. The equilibrium pressure of CO2 is 1.00 bar at 897 C, and rH at 298 K is 179.0 kJ/mol-rxn. CaCO3(s) CaO(s) + CO2(g) Estimate the value of rS at 897 C for the reaction.
Obtain the value of Kc for the following reaction at 900 K: 2SO2(g)+O2(g)2SO3(g) Use the data given in Problem 14.33.
Carbon tetrachloride, an important industrial solvent, is prepared by the chlorination of methane at 850 K. CH4(g)+4Cl2(g)CCl4(g)+4HCl(g) What is the equilibrium constant for the reaction at 850 K? Would the reaction vessel need to be heated or cooled to keep the temperature of the reaction constant?
Consider the formation of HI(g) from H2(g) and I2(g). H2(g)+I2(g)2HI(g) For this reaction, K at 333C is 98, while K at 527C is 62.5. Find S for I2(g) at 527C.
Consider the decomposition of CaCO3(s) into CaO(s) and Co2(g). What is the equilibrium partial pressure of CO2 at room temperature?