sechZCalculate the change in enthalpy associated with the combustion of 322 g of ethanol.• Report your answer in scientific notation.• Your answer should have three significant figures.2Provide your answer below:WContent attributionSF3kJ#3AltC₂H₂OH(1)+30₂(g) → 2 CO₂(g) + 3 H₂O(1) AH = -1366.8 kJ/molEOE enF4$4RF5D F%5TF66GF7YF8& 77HU 48FEEDBACKF981(59F109OX CV BN MOJ1 K 246°FAltMORE INSTRUCTION)06F11L<GActivate WinGo to Settings to act WindowsP6 PF12SUBMITQud) ENG=Ctrl7:09 PM11/14/2022RBackspa

Answered: Image /qna-images/answer/ada98fed-55c3-4e1a-8738-af7bca0a4885.jpg

Calculate the change in enthalpy associated with the combustion of 322 g of ethanol. Report your answer in scientific notation. Your answer should have three significant figures. ● C₂H₂OH(1)+30₂(g) → 2 CO₂(g) + 3 H₂O(1) AH = -1366.8 kJ/mol Provide your answer below:

Calculate the change in enthalpy associated with the combustion of 322 g of ethanol. Report your answer in scientific notation. Your answer should have three significant figures. ● C₂H₂OH(1)+30₂(g) → 2 CO₂(g) + 3 H₂O(1) AH = -1366.8 kJ/mol Provide your answer below:

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter6: Thermochemistry

Section: Chapter Questions

Problem 90E: Methanol (CH3OH) has also been proposed as an alternative fuel. Calculate the standard enthalpy of...

See similar textbooks

Similar questions

Peanuts and peanut oil are organic materials and bum in air. How many burning peanuts does it take to provide the energy to boil a cup of water (250 mL of water)? To solve this problem, we assume each peanut, with an average mass of 0.73 g, is 49% peanut oil and 21% starch; the remainder is noncombustible We further assume peanut oil is palmitic acid, C16H32O2, with an enthalpy of formation of 848.4 kJ/mol. Starch is a long chain of C6H10O5 units, each unit having an enthalpy of formation of 960 kJ.
Nitrogen gas is confined in a cylinder with a movable piston under a constant pressure of 9.95 104 Pa. When 695 J of energy in the form of heat is transferred from the gas to the surroundings, its volume decreases by 1.88 L. What is the change in internal energy of the gas?
In a coffee-cup calorimeter, 100.0 mL of 1.0 M NaOH and 100.0 mL of 1.0 M HCI are mixed. Both solutions were originally at 24.6C. After the reaction, the final temperature is 31.3C. Assuming that all the solutions have a density of 1.0 g/cm3 and a specific heat capacity of 4.18 J/Cg, calculate the enthalpy change for the neutralization of HCl by NaOH. Assume that no heat is lost to the surroundings or to the calorimeter.
One of the components of jet engine fuel is n-dodecane, C12H26(), which has a standard enthalpy of combustion of 8080.1 kJ/mol. (a) Write the thermochemical equation for the combustion of n-dodecane. (b) Use the standard enthalpies of formation in Appendix G to calculate the standard enthalpy of formation of n-dodecane.
Ethanol, C2H5OH, is used as a fuel for motor vehicles, particularly in Brazil. (a) Write the balanced equation for the combustion of ethanol to CO2(g) and H2O(g), and, using the data in Appendix G, calculate the enthalpy of combustion of 1 mole of ethanol. (b) The density of ethanol is 0.7893 g/mL. Calculate the enthalpy of combustion of exactly 1 L of ethanol. (c) Assuming that an automobile’s mileage is directly proportional to the heat of combustion of the fuel, calculate how much farther an automobile could be expected to travel on 1 L of gasoline than on 1 L of ethanol. Assume that gasoline has the heat of combustion and the density of n—octane, C8H18(Hf=208.4kJ/mol;density=0.7025g/mL).
The octane number of gasoline is based on a comparison of the gasolines behavior with that of 2,2,4-trimethylpentane, C8H18(), which is arbitrarily assigned an octane number of 100. The standard enthalpy of combustion of this compound is 5456.6 kJ/mol. (a) Write the thermochemical equation for the combustion of 2,2,4-trimethylpentane. (b) Use the standard enthalpies of formation in Appendix G to calculate the standard enthalpy of formation of 2,2,4-trimethylpentane.
The head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?
Acetylene (C2H2) and butane (C4H10) are gaseous fuels with enthalpies of combustion of 49.9 kJ/g and 49.5 kJ/g. respectively. Compare the energy available from the combustion of a given volume of acetylene to the combustion energy from the same volume of butane at the same temperature and pressure.
Nitrogen gas (2.75 L) is confined in a cylinder under constant atmospheric pressure (1.01 105 pascals). The volume of gas decreases to 2.10 L when 485 J of energy is transferred as heat to the surroundings. What is the change in internal energy of the gas?
A bomb calorimetric experiment was run to determine the enthalpy of combustion of ethanol. The reaction is C2H5OH() + 3 O2(g) 2 CO2(g) + 3 H2O() The bomb had a heat capacity of 550 J/K, and the calorimeter contained 650 g of water. Burning 4.20 g of ethanol, C2HsOH() resulted in a rise in temperature from 18.5 C to 22.3 C. Calculate U for the combustion of ethanol, in kJ/mosl.
A piece of titanium metal with a mass of 20.8 g is heated in boiling water to 99.5 C and then dropped into a coffee-cup calorimeter containing 75.0 g of water at 21.7 C. When thermal equilibrium is reached, the final temperature is 24.3 C. Calculate the specific heat capacity of titanium.
sample of natural gas is analyzed and found to be88.4% methane (CH4) and 11.6% ethane (C2H6) bymass. The standard enthalpy of combustion of methaneto gaseous carbon dioxide (CO2) and liquid water (H2O) is -891 kJ/mol. Write the equation for the combustionof gaseous ethane to carbon dioxide and water.Calculate the standard enthalpy of combustion of ethaneusing standard enthalpies of formation from Table R-11on page 975. Using that result and the standard enthalpyof combustion of methane in Table 15.3, calculate theenergy released by the combustion of 1 kg of natural gas.