Cations of which of the following categories will form oxides with only acidic character? Select one or more: a. moderately acidic cations b. feebly acidic cations c. very strongly acidic cations d. weakly acidic cations e. nonacidic cations f. strongly acidic cations

Q: Which ionization process requires the most energy?   a) At(g) → At+(g) + e- b) At+(g) → At2+(g) + e-…

A: Concept is based on ionization energy:

Q: ummary hydroxyapatites and ensure to put the following?? Location of metal in the periodic table  -…

A: Hydroxyapatites have formula Ca5(PO4)3OH. It contain the metal Calcium. This calcium lies in the…

Q: A pH of 4 is times more acidic than a pH of 7. Aside from hydrogen and helium, a stable atom has…

A: Matching be done as follows: A. Ionic bonds D. Polar Covalent bonds B.Covalent bonds O.…

Q: Compare the radius of the atom of Germanium with its ion and explain your answer.

A:

Q: Claim: Reactivity of alkali metals increase down a group, or column, in the periodic table.…

A: The alkali metals are six chemical elements in Group 1, the leftmost column in the periodic table.…

Q: Classify the oxides as acidic or basic.

A: A basic oxide is an oxide that shows basic properties in opposition to acidic oxides and that either…

Q: (ii) In Complete the table below giving the formulae of the oxides of the elements Element Li Be в C…

A: The question is based on the concept of periodic  properties of elements. we have to write formula…

Q: Summarize the physical properties of the elements ingroup 14.

A: The elements present in group 15 are Carbon (C), Silicon (Si), Germanium (Ge), Tin (Sn), Lead (Pb),…

Q: Write a first draft summary summarizing the properties ofeach of the following groups Group 4A,Group…

A: ------> Group 4 elements AppearanceThe expected similarity in appearence bewteen elements in the…

Q: a. Which is larger? i. F Be or

A: Atomic radius specifies the size of the element. It is the distance from center of the nucleus to…

Q: A hypothetical element A has these properties: first ionization energy= 850 kJ/mol second…

A: In the question given, that third Ionisation energy of element A is exceptionally very high as…

Q: Why do nonmetals oxides tend to form acids and metal oxides tend to form bases? O Metal oxides tend…

A: Metal oxides are basic beacuse metal looose electron and oxygen gain electron and oxide is formed…

Q: Predict whether each of the following oxides is ionic ormolecular: SnO2, Al2O3, CO2, Li2O, Fe2O3,…

A: The compounds made up of a metal and a non metal tend to be ionic substance and compounds made up of…

Q: A metal oxide will form and a nonmetal oxide will form in aqueous solution. A) an acid, an acid B)…

A: METAL OXIDE WILL FORM A BASE AND NON METAL OXIDE WILL FORM A ACID IN AQUEOUS SOLUTION

Q: Mercury(I) chloride and all other Hg(I) salts are diamagnetic. Explain how this can be true.

A: A substance is said to be diamagnetic if it's atoms have net dipole moment is zero .

Q: Assign each species on the left to a category on the right.

A: Strong acid is an acid that ionizes completely in aqueous solution. It always loses a proton (H+ )…

Q: Summary of cation analysis of group V:

A: Group 5 Common cations, which do not react with reagents of the previous groups, form the last group…

Q: Salts of hypoiodite ion behave as a weak base, undergoing hydrolysis in water according to the…

A: Given Reaction:-  IO-  + H2O  <----------> HIO + OH-  Kh = 0.00044  Kh = [HIO ] [ OH- ] / […

Q: The atomic radii of elements when one moves from right to left in a period Increase Decrease Remain…

A: The answers are given below

Q: An is a magnet that is created by wrapping a current-carrying wire around a ferromagnetic. O a…

A: Given answer of choices, a. electromagnet b. electric motor c. electric current

Q: Choose the answer in which the oxides are arranged in order of increasing acidity (least acidic…

A: Different type of oxides when dissolved in water , they give acidic ,basic , amphoteric or neutral…

Q: Number of conjoined electrons in furan

A: This question is demanding the expression of total number of conjoining electrons in Furan molecule.…

Q: (a) Why is ZnO called a amphoteric oxide? Name another amphoteric oxide(b) What are alkali’s? Give…

A: We’ll answer the first question since the exact one wasn’t specified. Please submit a new question…

Q: Nitric acid, sulfuric acid and phosphoric acid are all example of oxoacids. Predict their pKa…

A: 1. Write the formula in following format.    EOp(OH)q 2. pKa = 8-5p 3. If q > 1, successive Ka…

Q: Place the following elements in order of increasing atomic radius. As O B   O < As < B As < O < B B…

A:

Q: 34. Classify the following oxides as acidic, basic, or amphoteric: (a) ZnO, (b) P,O10, (c) CaO. 35.…

A: Metallic oxides are basic in nature while nonmetallic oxides are acidic in nature. Different…

Q: With specific reference to the boiling and melting point temperatures, explain the difference in the…

A: Melting point and boiling point of alkaline earth metals

Q: Elements number 17 and 20 form compounds with hydrogen. Write the formulas for these two compounds…

A: Answer is given below.

Q: briefly explain why the oleic acid molecules organize themselves into a monolayer?

A: Oleic acid is a fatty acid with the molecular formula CH3(CH2)7CH=CH(CH2)7COOH.

Q: Account for the following: (i) Ammonia is more basic than phosphine. (ii) Elements of Group 16…

A: i) Central atom in ammonia is nitrogen and central atom in phosphine is phosphorus. Nitrogen and…

Q: Write a net ionic equation to show that hydroiodic acid, HI, behaves as an acid in water. (1)0²H +…

A: HI is a strong acid, thus it gives H+ ion on dissociation. HI→H++I-

Q: The perecent of ionization of 0.2 MNH3 is (Hint K, = 0.000018) (Write your answer to 1 d.p e.g 1.2)

A: Percentage ionisation can be calculated as follows

Q: 1600- 1400- 1200- 1000 - 800- 600- 400- 200- Na Mg Al Si CI Ar Element

A: Ionization energy or Ionization potential is the minimum amount of energy that is required to remove…

Q: Classify the compounds below as acid, base, salt or oxide of Na₂O

A: Metal oxides are basic in nature. Increasing of metallic nature increase its basic nature of oxide.

Q: Classify each situation by whether the simplifying assumption can be used or whether the quadratic…

A:

Q: The chemical properties of the metallic elements can be considered as arising from the ability of…

A: Group 14 contains carbon,silicon,germanium,tin  lead.

Q: Which of the following will have the largest magnitude of first ionization constant, Ka1 ? Select…

A: Acid is substance which release hydrogen ions when dissociate. Strong acid has large magnitude of…

Q: Choose the group that matches the following description: reacts with F2 to form compounds with the…

A: The rule that you have to follow while writing chemical formula are → The valencies or charge must…

Q: What generalization can be given regarding the type of compounds formed when metallic, non-metallic…

A: Answer - 1. metallic react with water - Metals react with water and produce a metal oxide and…

Q: 18. How many grams of ammonium nitrate must be weighed out to make 415 g of a 58.0% by mass…

A: A solution consists of solute and solvent. A solute is defined as the component that is present in a…

Q: Sodium hydroxide is described as a strong alkali because it reacts with strong acid only. В. А. is…

A: “Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: 1. Which antacid was more effective on a per gram basis? Explain. Show your calculations.

A: An antacid is a substance which neutralizes stomach acidity and is used to relieve heartburn,…

Q: Which of these oxides would produce a basic solution in water? A) Na2O  b)  SiO2   c)  SO2   d)…

A:

Q: 1. Calculate the hydronium-ion concentration: (9 points) а. b. apple juice, pOH = 10.24 pH [OH]…

A:

Q: This explains which of the following: O A) H* formed from the ioniozation of water is immediately…

A: Interpretation: To choose the right option for the given image.

Q: How odd and even electron species can be cleaved?

A: The carbon atom which consists positive charge and bonded with three bonds is known as cation. The…