%24 When 21.6 mL of 0.500 M H,SO, is added to 21.6 mL of 1.00M KOH in a coffee-cup calorimeter at 23.50°C, the temperature rises to 30.17°C. Calculate AH of this reaction. (Assume that the total volume is the sum of the individual volumes and that the density and specific heat capacity of the solution are the same as for pure water.) (d for water = 1.00 g/mL; c for water = 4.184 J/g-°C.) kJ/mol H20 # 4. 5 IIO 9- 0O 8. In

%24 When 21.6 mL of 0.500 M H,SO, is added to 21.6 mL of 1.00M KOH in a coffee-cup calorimeter at 23.50°C, the temperature rises to 30.17°C. Calculate AH of this reaction. (Assume that the total volume is the sum of the individual volumes and that the density and specific heat capacity of the solution are the same as for pure water.) (d for water = 1.00 g/mL; c for water = 4.184 J/g-°C.) kJ/mol H20 # 4. 5 IIO 9- 0O 8. In

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter9: Energy And Chemistry

Section: Chapter Questions

Problem 9.50PAE: 9.50 When a 13.0-g sample of NaOH(s) dissolves in 400.0 mL of water in a coffee cup calorimeter, the...

See similar textbooks

Similar questions

A sample of ethanol, C2H5OH, weighing 2.84 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 33.73C. If the heat capacity of the calorimeter and contents was 9.63 kJ/C, what is the value of q for burning 1.00 mol of ethanol at constant volume and 25.00C? The reaction is C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) Is q equal to U or H?
A 237-g piece of molybdenum, initially at 100.0 C, is dropped into 244 g of water at 10.0 C. When the system comes to thermal equilibrium, the temperature is 15.3 C. What is the specific heat capacity of molybdenum?
A sample of benzene, C6H6, weighing 3.51 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 37.18C. If the heat capacity of the calorimeter and contents was 12.05 kJ/C, what is the value of q for burning 1.00 mol of benzene at constant volume and 25.00C? The reaction is C6H6(l)+152O2(g)6CO2(g)+3H2O(l) Is q equal to U or H?
The reaction SO3(g)+H2O(l)H2SO4(aq) is the last step in the commercial production of sulfuric acid. The enthalpy change for this reaction is 227 kJ. In designing a sulfuric acid plant, is it necessary to provide for heating or cooling of the reaction mixture? Explain.
9.50 When a 13.0-g sample of NaOH(s) dissolves in 400.0 mL of water in a coffee cup calorimeter, the temperature of the water changes from 22.6°C to 30.7C Assuming that the specific heat capacity of the solution is the same as for water, calculate (a) the heat transfer from system to surroundings and (b) H for the reaction NaOH(s)Na+(aq)+OH(aq)
One of the components of jet engine fuel is n-dodecane, C12H26(), which has a standard enthalpy of combustion of 8080.1 kJ/mol. (a) Write the thermochemical equation for the combustion of n-dodecane. (b) Use the standard enthalpies of formation in Appendix G to calculate the standard enthalpy of formation of n-dodecane.
Calculate the enthalpy of combustion of butane, C4H10(g) for the formation of H2O(g) and CO2(g). The enthalpy of formation of butane is 126 kJ/mol.
What is the difference between the enthalpy of reaction and the enthalpy of formation? For what chemical reaction(s) are the two quantities the same?
In a coffee-cup calorimeter, 100.0 mL of 1.0 M NaOH and 100.0 mL of 1.0 M HCI are mixed. Both solutions were originally at 24.6C. After the reaction, the final temperature is 31.3C. Assuming that all the solutions have a density of 1.0 g/cm3 and a specific heat capacity of 4.18 J/Cg, calculate the enthalpy change for the neutralization of HCl by NaOH. Assume that no heat is lost to the surroundings or to the calorimeter.