Consider the following reaction: 2H₂S(g) + SO₂(g) = 3S(s) + 2H₂O(g) A reaction mixture initially containing 0.520 M H₂S and 0.520 M SO₂ was found to contain 1.2x10-3 M H₂O at a certain temperature. A second reaction mixture at the same temperature initially contains [H₂S] = 0.255 M and [SO₂] = 0.315 M. Part A Calculate the equilibrium concentration of H₂O in the second mixture at this temperature. Express your answer using two significant figures. [5] ΑΣΦ [H₂O] = Submit Request Answer ? M

Consider the following reaction: 2H₂S(g) + SO₂(g) = 3S(s) + 2H₂O(g) A reaction mixture initially containing 0.520 M H₂S and 0.520 M SO₂ was found to contain 1.2x10-3 M H₂O at a certain temperature. A second reaction mixture at the same temperature initially contains [H₂S] = 0.255 M and [SO₂] = 0.315 M. Part A Calculate the equilibrium concentration of H₂O in the second mixture at this temperature. Express your answer using two significant figures. [5] ΑΣΦ [H₂O] = Submit Request Answer ? M

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter17: Spontaneity, Entropy, And Free Energy

Section: Chapter Questions

Problem 121CP: If wet silver carbonate is dried in a stream of hot air. the air must have a certain concentration...

See similar textbooks

Similar questions

Show that the complete chemical equation, the total ionic equation, and the net ionic equation for the reaction represented by the equation KI(aq)+I2(aq)KI3(aq) give the same expression for the reaction quotient. KI3 is composed of the ions K+ and I3-.
If wet silver carbonate is dried in a stream of hot air. the air must have a certain concentration level of carbon dioxide to prevent silver carbonate from decomposing by the reaction Ag2CO3(s)Ag2O(s)+CO2(g) H for this reaction is 79.14 kJ/mol in the temperature range of 25 to 125C. Given that the partial pressure of carbon dioxide in equilibrium with pure solid silver carbonate is 6.23 103 torr at 25C, calculate the partial pressure of CO2 necessary to prevent decomposition ofAg2CO3 at 110C. (Hint: Manipulate the equation in Exercise 79.)
5.12. True or false: If all the partial pressures of reactants and products drop by half, the value of Q drops by half. Give an example of a chemical reaction to support your answer.
Consider a metal ion A2+ and its nitrate salt, In an experiment, 35.00 mL of a 0.217 M solution of A(NO3)2 is made to react with 25.00 mL of 0.195 M NaOH. A precipitate, A(OH)2, forms. Along with the precipitation, the temperature increases from 24.8C to 28.2C. What is H for the precipitation of A(OH)2? The following assumptions can be made. â€¢ The density of the solution is 1.00 g/mL. â€¢ Volumes are additive. â€¢ The specific heat of the solution is 4.18 J/g C.
Consider the following equilibria involving SO2(g) and their corresponding equilibrium constants. SO2(g) + 12 O2(g) SO3(g) K1 2SO3(g) 2SO2(g) + O2(g) K2 Which of the following expressions relates K1 to K2? (a) K2=K12 (b) K22=K1 (c) K2 = K1 (d) K2 = 1/K1 (e) K2=1/K12
The atmosphere consists of about 80% N2 and 20% O2, yet there are many oxides of nitrogen that are stable and can be isolated in the laboratory. (a) Is the atmosphere at chemical equilibrium with respect to forming NO? (b) If not, why doesnt NO form? If so, how is it that NO can be made and kept in the laboratory for long periods?
The following two diagrams represent the composition of an equilibrium mixture for the reaction A2 + B2 2AB at two different temperatures. Based on the diagrams, is the chemical reaction endothermic or exothermic? Explain your answer using Le Chteliers principle. (A atoms are red and B atoms are green in the diagrams.)
For the decomposition of Ag2O: 2Ag2O(s)4Ag(s)+O2(g)(a) Obtain an expression for G as a function of temperature. Prepare a table of G values at 100 K intervals between 100 K and 500 K. b) Calculate the temperature at which G =0.
12.42 The following reaction is in equilibrium in lake water: HCO,_(aq) + H+(aq)«=*H,CO,(aq) Predict the change in the reaction quotient, Q, for each disturbance below and use that prediction to explain how the equilibrium is shifted by the stress. NaHCOj is added to the lake. H,CO}is added. NaOH is added.
. Plants synthesize the sugar dextrose according to the following reaction by absorbing radiant energy from the sun (photosynthesis). 6CO2(g)+6H2O(g)C6H12O6(g)+6O2(g)Will an increase in temperature tend to favor or discourage the production of C6H12O6(s)?
Write the mathematical expression for the reaction quotient, QC, for each of the following reactions: (a) CH4(g)+CI2CH3CI(g)+HCI(g) (b) N2(g)+O2(g)2NO(g) (c) 2SO2(g)+O2(g)2SO3(g) (d) BaSO3(s)BaO(s)+SO2(g) (e) P4(g)+5O2(g)P4O10(s) (f) Br2(g)2Br(g) (g) CH4(g)+2O2(g)CO2(g)+2H2O(l) (h) CuSO45H2O(s)CuSO4(s)+5H2O(g)
Write the mathematical expression for the reaction quotient, QC, for each of the following reactions (a) N2(g)+3H2(g)2NH3(g) (b) 4NH3(g)+5O2(g)4NO(g)+6H2O(g) (C) N2O2(g)2NO2(g) (d) CO2(g)+H2CO(g)+H2O(g) (e) NH4CI(s)NH3(g)+HCI(g) (f) 2Pb( NO3)2(s)2PbO(s)+4NO2(g)+O2(g) (g) 2H2(g)+O2(g)2H2O(g) (h) S8(g)8S(g)