Determine E, AG, and K for the overall reaction from the balanced half-reactions and their standard reduction potentials.2 C0³+ + H₂ AsO3 + H₂O = 2 Co²+ + H₂AsO4 + 2H+Co³+ + eCo²+1.92 VH3 AsO4 + 2H+ + 2e¯ ⇒ H₂AsO3 + H₂OE° = 0.575 V1.3453.28 ×1045Is the overall reaction spontaneous as written?not spontaneousspontaneousE =AG =-25985IncorrectE° =V K =J

Given-> 2Co3+ + H3AsO3 +H2O <-------> 2Co2+ + H3AsO4 +2H+ Co3+ + e- ------> Co2+. E° =…

Determine E, AG, and K for the overall reaction from the balanced half-reactions and their standard reduction potentials. 2 Co³+ + H₂ AsO3 + H₂O = 2 Co²+ + H₂AsO4 + 2H+ Co³+ + e Co²+ E° = 1.92 V H₂ AsO4 + 2H+ + 2e¯ = H₂AsO3 + H₂O E = 0.575 V 1.345 K = 3.28 X1045 Is the overall reaction spontaneous as written? not spontaneous spontaneous E = AG = -25985 Incorrect V J

Determine E, AG, and K for the overall reaction from the balanced half-reactions and their standard reduction potentials. 2 Co³+ + H₂ AsO3 + H₂O = 2 Co²+ + H₂AsO4 + 2H+ Co³+ + e Co²+ E° = 1.92 V H₂ AsO4 + 2H+ + 2e¯ = H₂AsO3 + H₂O E = 0.575 V 1.345 K = 3.28 X1045 Is the overall reaction spontaneous as written? not spontaneous spontaneous E = AG = -25985 Incorrect V J

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 18.44QE: For each of the reactions, calculate E from the table of standard potentials, and state whether the...

See similar textbooks

Similar questions

At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)
A galvanic cell is based on the following half-reactions: In this cell, the copper compartment contains a copper electrode and [Cu2+] = 1.00 M, and the vanadium compartment contains a vanadium electrode and V2+ at an unknown concentration. The compartment containing the vanadium (1.00 L of solution) was titrated with 0.0800 M H2EDTA2, resulting in the reaction H2EDTA2(aq)+V2+(aq)VEDTA2(aq)+2H+(aq)K=? The potential of the cell was monitored to determine the stoichiometric point for the process, which occurred at a volume of 500.0 mL H2EDTA2 solution added. At the stoichiometric point, was observed to be 1 .98 V. The solution was buffered at a pH of 10.00. a. Calculate before the titration was carried out. b. Calculate the value of the equilibrium constant, K, for the titration reaction. c. Calculate at the halfway point in the titration.
For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Zn(s)+Fe2+(aq)Zn2+(aq)+Fe(s) (b) AgCl(s)+Fe2+(aq)Ag(s)+Fe3+(aq)+Cl(aq) (c) Br2(l)+2Cl(aq)Cl2(g)+2Br(aq)
An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
Given this reaction, its standard potential, and the standard half-cell potential of 0.34 V for the Cu2+ |Cu half-cell, calculate E° for the Fe(s)|Fe2+(aq) half-cell.
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
The following cell was found to have a potential of —0.492 V: Ag|AgCl(sat’d)||HA(0.200 M),NaA(0.300 M)|H2(1.00 atm),Pt Calculate the dissociation constant of HA, neglecting the junction potential.
Assume the following electrochemical cell simulates the galvanic cell formed by copper and zinc in seawater at pH 7.90 and 25 C. Zn | Zn(OH)2(s) | OH(aq) || Cu(OH)2(s) | Cu(s) a. Write a balanced equation for the reaction that occurs at the cathode. b. Write a balanced equation for the reaction that occurs at the anode. c. Write a balanced chemical equation for the overall reaction. d. Determine the potential (in volts) of the cell.