Determine the rate law and the value of k for the following reaction using the data provided. S2O82-(aq) + 3 I-(aq) → 2 SO42-(g) + I3-(aq)                          [S2O82-]i (M)                  [I-]i (M)                  Initial Rate (M/s)                                                                                                                                                            0.30                                          0.42                                           4.54                                                                                                                                                            0.44                                          0.42                                           6.65                                                                                                                                                            0.44                                          0.21                                           3.33

Q: What mass of sodium acetate must be added to 435 mL of water to give a solution with pOH = 4.65? Kb ...

A:

Q: Classify each of the following compounds as ionic (1), molecular (M), binary acid (BA), or oxyacid (...

A: In binary acids, a hydrogen atom is connected to a non-metal whereas, in oxyacids, a hydrogen atom i...

Q: From the following chemical equation: Cl2 F+ G+H FeCl3 i) Draw the structure of F, G and H. ii) Base...

A: The reaction given is,  

Q: e concentration (in M)

A:

Q: A very strong nitric acid (HNO3=63.02 g/mol) solution is available as a 33.4 m solution. Given the d...

A: Given: Molality = 33.4 m  Density of solution = 1.33 g/mL  Molar mass of solute (HNO3) = 63.02 g/mL ...

Q: Types of volumetric analysis are. O Three. Four. Five.

A:

Q: 1) If a reaction mixture is prepared by a mixture of stock solution A (0.20 M), stock solution B (0....

A: 1) For reaction mixture 1, Volume of A=20mL Volume of B=20mL Total volume = 40 mL Concentration of A...

Q: How much heat energy is required to convert 44.9 g of solid ethanol at -114.5 °C to gasesous ethanol...

A: Given,  44.9 g of solid ethanol at -114°C is converted to gaseous ethanol at 160.8 °C  The molar hea...

Q: The reaction below reaches equilibrium in a closed reaction vessel. What is the effect of adding an ...

A: The correct option is:  

Q: Which element in the periodic table has a specific heat of 0.850

A:

Q: Dw many structural isomers are possible for a monochlorinated PCB molecule (a CB with one Cl atomsub...

A:

Q: How many grams of glucose are needed to prepare 400. mL of a 2.0%(m/v) glucose solution?

A: The amount of glucose needed to prepare 2%(m/v) glucose solution is given below

Q: Give the systematic name for the following compounds. 1. C(CH3)3CH(CH3)CH2CH(CH2CH3)CH2CH3  2. CH3...

A:

Q: Na2CrO4: ________ g/mole

A: Standard data: The atomic mass of sodium (Na) = 22.9898 u The atomic mass of chromium (Cr) = 51.996...

Q: what are the lewis structures of these: H3PO4 SO42- Palmitic acid (in pH 7.4) Glycerol Water A...

A: Lewis structure are drawn by making dots on the symbol of atom the number of dots are equal to their...

Q: A sample of commercial concentrated hydrochloric acid is 11.8M and has a density of 1.190 g/mL. Calc...

A:

Q: A 2.0 g of MgCO, was dissolved and diluted to exactly 500-mL volumetric flask. If 50-mL aliquot was ...

A: The mass of magnesium carbonate present in 500 mL solution is = 2.0 g The mass of magnesium carbonat...

Q: The H2-O2 reaction to produce H20 may be accounted for by the following mechanism: H2 +02 4 20H H2 +...

A: Solution -

Q: Define the following terms a) Elements Of Symmetry b) Achiral Molecule c) Polychromatic Light d) Pol...

A: Group theory can be defined as the branch of chemistry that deals with study of symmetry of a molecu...

Q: What mass of BaF2 (175.30 g/mol) must be added to 1275 g of water to lower the freezing point of the...

A:

Q: 1. What is the pH of a water that contains 120 mg/L of bicarbonate and 15 mg/L of carbonate ions?

A: Given: Concentration of bicarbonate i.e. HCO3- = 120 mg/L. And concentration of carbonate i.e. CO32-...

Q: 3. Consider the directing effects of the substituents on salicylamide and predict the possible struc...

A: Iodination is an electrophilic aromatic substitution reaction. Alcohol on Benzene ring is ortho, par...

Q: 2I– (aq) + H2O2 (aq) + 2H3O + (aq) → I2 (aq) + 4H2O (l) (slow) C6H8O6 (aq) + 2H2O (l) + I2 (aq) → C...

A:

Q: Calculate the pH after addition of 0.00, 5.00, 25.00, 45.00, 49.00, 50.00, 51.00 and 55.00 mL of 0.1...

A: Weak acids are the acids that do not dissociate completely in aqueous medium. In these cases, there ...

Q: At a certain temperature, the K, for the decomposition of H, S is 0.725. H,S(g) = H,(g)+S(g) Initial...

A: First of all we have to construct ICE table to calculate the equilibrium pressure of each component....

Q: Question 1.. A solution is prepared in a 50 mL volumetric flask by mixing 3 mL of 0.00427 M sodium t...

A: Molarity of sodium thiocyanate = 0.00427M Volume of sodium thiocyanate = 3mL  

Q: How does increasing the temperature of a liquid affect the rate of vaporization? The rate of vaporiz...

A: 1) Effect of increasing the temperature on vaporization.  

Q: For EACH Renetion. A> Write a word eauntion Write the balmced olecular eavntion write the balmced to...

A: 1) The reactants given are Cu(NO3)2 i.e. Copper (II) nitrate and Na2S i.e. sodium sulfide.  

Q: 5. ? 6. 1) Excess NaNH2/NH3 2) ВНз, THF 3) H2О2, NaOH

A: Given, 

Q: For the gas phase decomposition of hydrogen peroxide at 400 °C 2 H202 2 H20 + 02 the average rate of...

A: Since you have posted multiple questions, we are entitled to answer the first only.  

Q: concentration

A:

Q: Calculate strain energy for the conformer pictured below, using strain energy increments from the ta...

A: The molecule given is,

Q: Name these organic compounds: structure name CH, 3-methyl-1-butyne CH,- CH – c= CH CH, CH, — сн, — с...

A: The steps to name the given molecules are shown in the next step  

Q: An aqueous solution containing 17.5 g of an unknown molecular (nonelectrolyte) compound in 100 ml of...

A:

Q: m the following reaction, ОН OH H,SO4 A + B Draw a correct structure of A and B.

A:

Q: How many 1H NMR signals/shifts will the following molecule produce? [Note: enter a whole digit integ...

A: The chemically similar protons produce single nmr peak whereas chemically different peaks produce di...

Q: At 1 bar, how much energy is required to heat 75.0 g of H,O(s) at -18.0 °C to H,O(g) at 175.0 °C?

A:

Q: What mass of water (sweat) is required to cool a body weighing 74.1 kg from an initail temperature o...

A: Given that : Mass of body (mbody)= 74.1 kg Initial temperature of the body = 39.7˚C Final temperatur...

Q: d) 1.EtMgBr. 2. HО PCC CH2Cl2 A

A:

Q: sbucture of vitamin A Cre tinol), ReHnol Into write the is Converted Retinal in the body Draw the Sh...

A: The functional group of a molecule is a key component that is responsible for providing various chem...

Q: How many mL of 4.50 M sodium hydroxide must be added to 250 mL of a 0.200 M nitrous acid solution to...

A:

Q: why is ethane a nonpolar covalent bond? I get that it is because they have "equal" shared valence el...

A: Ethane (C2H6 ) is made of Carbon(C) and Hydrogen(H).  

Q: Sulfur dioxide and nitrogen dioxide react at 298 K via the reaction SO,(g) + NO, (g) = SO;(g)+NO(g) ...

A: Given,  At equilibrium  moles of SO2 = 0.368mol moles of NO2 = 0.368 mol Moles of SO3 = 0.762 mol mo...

Q: e equilibrium constant

A:

Q: Consider a reaction A + B → C with corresponding rate law rate = k[A]n [B]m If n = 2, m = 1: (a) W...

A: Given : Rate law is given as : rate = k[A]n [B]m

Q: How many valence electrons does hydrogen need to complete its shell? Which group is most similar to ...

A: To explain: How many valence electrons does hydrogen need to complete its shell.  

Q: It is

A: Equilibrium constant is only dependent of temperature, it does not depend on concentration.

Q: A+B product Given that reactant A is first order and reactant B is second order, calculate the react...

A: Reaction involved is A + B ---> Product [A] = 0.122 M [B] = 0.241 M Rate constant = 4.12 x 10-3 M...

Q: The indicator of Moher regent is. KMN04. О Ксго4.

A: Mohr's method: Mohr's method is a direct method of titration. In this method potassium chromate (KCr...

Q: Answer questions a-c about the Bronsted acid-base reaction below using the identifying letters A-D b...

A: