Explain the basis for the selective formation. of the product shown over the alternative product. H₂B CH3 CH₂ D + BH3 Preferred to !!!! + Hun CH3 HB H CH3 CH?

Q: Start with condensed structural formula CH3-CH(OH)-CH(CH3)-CH2-C(CH3)3 and react it first with H₂SO4…

A: Alkene hydrogenation occurs at a temperature of around 150°C, the reaction takes place in the…

Q: The intermetallic compound FeTi has the CsCl-type structure with a=0.308nm. Calculate its density

A: Given FeTi has CsCl type structure .

Q: enus equation The rate constant of a certain reaction is known to obey the Arrhenius equation, and…

A: Activation energy (Ea) = 45.0 KJ/mol.  Final rate constant (k2) = 1.2 × 106 M-1 s-1. Final…

Q: Chemistry  (i) For T = 298K ΔG° = -8.314 x 298 x ln (2.83x10-3) = 14.524 KJ/mol (ii) For T =…

A: The thermodynamic equation for Gibbs free energy is,∆G=∆H-T∆SFrom the graph of ∆G vs T, Comparing…

Q: What is the molecular formula of the given empirical formula CH2 if the molar mass is 42g/mol?

A: Given that -  Empirical formula of the compound = CH2  Molecular weight of this compound = 42 g/mol…

Q: Problem 17 C3H6O 개 H ddt, 1H 6.0 H H 나 5.0 dd, 1H dd, 1H 재 4.0 d, 2H 3.0 H brs, 1H

A: The proton NMR gives signal for different types of hydrogen atoms.  This helps to know the different…

Q: Fire is an example of X a. exothermic; entering b. exothermic; leaving c. endothermic; entering d.…

A: Exothermic reaction and endothermic reaction: Exothermic reaction : Exothermic reactions are…

Q: Chemistry Adam generated oxygen gas in the thermal decomposition of potassium chlorate. At 24°C and…

A:

Q: The density of alcohol is 0.8171 g/ml at 20 0C. Find the mass of a sample of alcohol that has a…

A:

Q: 4. Tap water contains the sulfate ion 50 at about 0.00400 mol/L. If 15 mL of 0.00100 of barium…

A:

Q: (a) the concentration gradient of hydrogen and (b) the flux of hydrogen through the foil.

A:

Q: Predict the product Me Br Ph. 1. KOtBu A 2. Cl₂, MeOH Me Please let me know the detailed process…

A:

Q: 3. Write the product and the mechanism for reaction: OH H3PO4 H3C CH3

A: In this question, we will draw the structure of the product with mechanism. In this reaction…

Q: 13.T/I A weak monoprotic acid has a K₁ value of 2.9 x 10-4. Determine the concentration of the…

A:

Q: A chemist measures the pH of various solutions in a laboratory setting. The results are as follows:…

A: pH is used to measure the acidity or basicity of a solution. The range of a pH scale is from 1 to…

Q: A bubble of helium gas has a volume of 0.650 mL near the bottom of a large aquarium where the…

A:

Q: 18.A chemical reaction rate compares a. the temperature of the reactants to the rate of the reaction…

A: As per our guidelines, we are allowed to answer the first three questions for multiple-choice…

Q: Balance the following the chemical equation: Mg + _ F₂ → _ MgF₂ O a O b 0. 1:2:1 Od

A: In the balanced chemical equation, the number of each atom is same in both reactant side as well as…

Q: What is the IR and HNMRAndCNMR and mass in this example explain

A:

Q: The maximum recommended single dose for acetaminophen is 15.0mg per kilogram of body weight for…

A:

Q: hy Alternative X BU Homepage INTRC X b Success Confirmati P Introduction: React X +…

A:

Q: 22. The trial ion product, Q, when compared to the Solubility Product Constant, K., will indicate if…

A: 22. The trial ion product, Q. when compared to the Solubility Product Constant, K sp. will…

Q: 4. Write the product and the mechanism for reaction. Write the names of starting material and…

A:

Q: To draw the deformation curve resulting from 10 mL of 0.1 normal sodium hydroxide with 0.1 normal…

A: At Equivalence point the amount of titrant is completely neutralized by the analyte solution.   13…

Q: Alkene reacts with chlorine to form alcohol chloride 1-Error 2-true

A: Alkene reacts with halogens ( Cl, F, Br, I ) to form haloalkanes.

Q: The rate constant k for a certain reaction is measured at two different temperatures: temperature k…

A:

Q: The equilibrium constant, Ke, for the reaction N2O4 (g) 2NO2(g) is 4.8 x 10-3 If the equilibrium…

A:

Q: The range of the evidence is 6-8 if the value of its dissociation constant is о 1 x 10-9 1 x 10-7 1…

A: Range given, 6-8 What is the value of dissociation constant ?

Q: What is the number of grams of aluminum sulfate needed to prepare a standard solution with a…

A: Given that -  Molarity of Solution = 0.15 M  Volume = 1 L = 1000 mL  Atomic weight of Al = 27 g/mol…

Q: A student weighs out a 9.08 g sample of ZnSO4, transfers it to a 250. mL volumetric flask, adds…

A:

Q: To plot the deformation curve resulting from 10 mL of 0.1 normal sodium hydroxide with 0.1 normal…

A: Equivalence point is the point of titration at which amount of titrant added totally neutralizes the…

Q: What amino acid is found at this position: 148 of 4ALD? Explain why this position in your protein is…

A: 4 ALD also known as Human muscle protein. ( FRUCTOSE 1,6 - BIPHOSPHATE ALDOLASE) It has a sequence…

Q: The buffer solution has a volume of PH2. Calculate the molarity of NaF and 0.72 HF of 0.5 HF if you…

A: A buffer solution is formed by the mixing of weak acid with its conjugate or by the mixing of weak…

Q: Grams of plant tissue analyzed and found to contain 92.6 micrograms of zinc. The concentration of…

A: Here we have to find grams of plant tissue (sample) for different PPM given in the question for…

Q: 4. Complete the following table. Indicate the dipole moment on the structural diagram... Molecule…

A:

Q: 2. Write the product and the mechanism for reaction. Write the names of starting material and…

A: According to Markovnikov's rule, when Hydrogen halide is added with alkene , then negative part…

Q: Alkanes are soluble in polar solvents True Error

A:

Q: Question 3 Your research project involves the synthesis of a family of organometallic reagents so…

A: Phenyllithium is an organometallic reagent. It is used as a metalating agent and it introduces…

Q: Choose which bond represents an intermolecular bon b neither a nor b Choose which bond represents a…

A:

Q: (k) (1) (m) 1) NaNO2, H₂SO4, 0 °C 2) HBF4, A H₂PO₂ 1) Fe, HCI 2) NaOH 1) H₂C CI 2) H₂NNH₂, KOH, A 3)…

A:

Q: Place the steps of glycolysis in the order that they occur. Last step Answer Bank Glucose is…

A:

Q: 2 3 Compound Structure H CIH H |||| H-C-C-C-C-H |||| HHH CH3 C₂H₂ H F TIL H CH3-C-C-C=C || H F H Br…

A: The correct nomenclature  of the above organic compounds according to the IUPAC rule is given below

Q: 1.   Given the reaction 2SO2(g) + O2(g)  2SO3(g) + energy, a decrease in pressure will cause the…

A: As per our guidelines, we are supposed to answer only one question with three subparts. Kindly…

Q: Calculate the molarity of 28.0% ammonia if you know that its specific gravity is 0.898 and that the…

A: Given that -  Percentage of Ammonia NH3 = 28.0%  Specific gravity of the Solution = 0.898  Atomic…

Q: 1. Write the product, side products and the mechanism for reaction. Write the names of starting…

A:

Q: If a solution containing 109.90 g of mercury(II) nitrate is allowed to react completely with a…

A: Here, we have to find the mass of the precipitate that will be formed when 109.90 g of mercury(II)…

Q: Part A For the reaction at 225 °C the equilibrium contar Express your answer to two s HÅ [NH3] =…

A:

Q: What types of chemical reactions are the Column A 1. 2. 3. 4. 5. - Al + + GaP → Ga + AIP 2 Mg + O₂ →…

A:

Q: Octahedral complexes usually undergo nucleophilic substitution reactions through a dissociative or…

A: To design an octahedral complex following associative mechanism we need to find the difference…

Q: needed What is the number of grams of aluminum sulfate to prepare a 0.15 standard solution per…

A: Given that -  Molarity of aluminium sulfate Solution = 0.15 M  Atomic weight of different elements…

Designing a Synthesis

Organic synthesis is a branch of chemical synthesis that involves the planned construction of organic compounds/molecules from smaller units that possess functional groups. Friedrich Wöhler was the first scientist who designed the synthesis of an organic compound, urea from inorganic starting materials silver cyanate with ammonium chloride via a simple, one-step synthesis.