Answered: For the chemical reaction…

For the chemical reaction 2NaOH+H2SO4⟶Na2SO4+2H2O, how many moles of sodium sulfate will be produced from 26.0 g of sodium hydroxide?

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter4: Stoichiometry

Section: Chapter Questions

Problem 4.24PAE: 4.24 Ammonia gas can be prepared by the reaction CaO(s)+2NH4Cl(s)2NH3(g)+H2O(g)+CaCl2(s) If 112 g of...

See similar textbooks

Related questions

Q: How many moles of ammonia would be required to react exactly with 0.248 moles of copper(II) oxide in…

A: Stoichiometry, in balanced chemical reaction is defined by the ratio at which reactants are reacting…

Q: How many grams of CaCl2 can be produced by reacting 1.34 moles of CaO and 2.47 moles of HCL by the…

A: We are given a reaction., CaO+2HCL= CaCl2 + H2O Now from the reaction we can say that 1 mole of CaO…

Q: When 14.0 g of calcium metal is reacted with water, 5.00 g of calcium hydroxide is produced. Using…

A: Given: Actual yield = 5g

Q: Calculate how many moles of Ca(OH)2 are needed to produce 4.8 x 1024 NH3 molecules

Q: For the chemical reaction: 2KI+Pb(NO3)2⟶PbI2+2KNO3 how many moles of lead(II) iodide will be…

A: Given. the balanced chemical equation - We know that the values of the molar mass of the compounds…

Q: How many grams of CuO would be required to produce 63.5 moles of nitrogen gas in the following…

A: GIVEN : Reaction: NH₃(g) + 3 CuO(s) → 3 Cu(s) + N₂(g) + 3 H₂O(g) To Solve: Mass of CuO required=?…

Q: Consider the reaction 3X + 2Y → 5C + 4D With excess Y, how many moles of X are needed to produce…

Q: How many moles of ammonia would be required to react exactly with 0.468 moles of copper(II) oxide in…

Q: For the chemical reaction 3 KOH + H, PO, K,PO, +3 H,0 what mass of potassium phosphate is produced…

Q: A reaction of 15.2 grams of ferrous sulfate heptahydrate (278 g / mol) and 5 grams of ammonium…

A: Welcome to bartleby !

Q: Consider the reaction 3X + 2Y → 5C + 4D How many moles of C can be synthesized from 37.0 moles of Y…

Q: How many moles of N2O4 can be formed from 4.25 g NO2?

Q: Calculate the maximum amount in grams of H₂O that can be produced by the reaction of 550 mg of H₂…

A: Given, H2(g) + O2(g) ➝ H2O(g) Balancing the above equation: 2H2(g) + O2(g) ➝ 2H2O(g) Note: 1000 mg =…

Q: How many grams Of water are required to form 9.00 moles of TiOa according to the reaction described…

Q: What mass of phosphorus pentachloride would be produced by the complete reaction of 15.2 g of P4?

A: The balanced chemical equation from the above question is P4 + 10 Cl2 → 4 PCl5 Molar mass of P4 =…

Q: How many grams of magnesium chloride can be produced from 3.54 moles of chlorine gas reacting with…

Q: what mass in grams of H2O can be produced from 9.00 moles of O2?

A: In the given question we have to calculate the mass in gram of H2O. the balanced equation will be 2…

Q: Consider the reaction 3X + 2Y→ 5C + 4D With excess Y, how many moles of X are needed to produce…

A: The given reaction is : The number of moles of D to be produced = 21.00 mol

Q: Given the reaction: 4NH3 (g) + 5 O2 (g) → 4 NO (g) + 6 H2O (l) When 1.25 mole of ammonia reacts,…

Q: Consider the following equation: Na 0 + H,0 → 2NAOH How many grams of Na,0 are required to produce…

Q: Ammonia, NH3, is prepared by the following reaction: 2 NO2(g) + 5 H2(g) - 2NH3(g) + 2 H2O(I)…

Q: How many moles of glucose can be formed from 2.53x1024 H atoms?

A: Given that: atoms of H = 2.53×1024 atoms Formula of glucose = C6H12O6 Now, it can be seen that, each…

Q: How many grams of CuO would be required to produce 22.5 moles of nitrogen gas in the following…

A: The reaction given is 2 NH3 (g) + 3 CuO (s) ------> 3 Cu (s) + N2 (g) + 3 H2O (g)

Q: How many grams of aluminum sulfide are formed if 22.00g of aluminum reacts with sulfur in a…

A: Mass of Al = 22 g Mass of Al2S3 = ?

Q: Consider the reaction: 3A+4B -> 3C What is the limiting reactant if 1 mole of A is allowed to…

Q: How many moles of ammonia would be required to react exactly with 0.692 moles of copper(II) oxide in…

A: Moles of ammonia required is calculated as follows

Q: How many moles of ammonia would be required to react exactly with 0.550 moles of copper(II) oxide in…

A: Given chemical reaction, 2NH3(g) + 3CuO(s) ---> 3Cu(s) + N2(g) + 3H2O(g) Moles of Copper (II)…

Q: How many moles of ammonia would be required to react exactly with 0.740 moles of copper(II) oxide in…

A: The given reaction is, 2NH₃(g) + 3CuO(s)---->3Cu(s) + N₂(g)+3H₂O(g)

Q: How many grams of alum can be obtained from 25.0 g of aluminum when the reaction proceeds with 100%…

A: mass of alum is calculated by mole mole relationship (mole concept)

Q: How many moles of ammonia would be required to react exactly with 0.816 moles of copper(II) oxide in…

A: The balance chemical reaction : 2NH3(g) + 3CuO(s) ----> 3Cu(s) + N2(g) + 3H2O(g) Number of moles…

Q: If 5.1 kg of CO2 are produced during a combustion reaction, how many molecules of CO2 would be…

A: The number of moles of a substance is given as the mass of the substance upon its molar mass. The…

Q: For the chemical reaction, 2NaOH+H2SO4⟶Na2SO4+2H2O what mass of sulfuric acid in grams is…

A: Mole is the amount of the substance that contains the same number of particles or atoms or…

Q: What is the mass in grams of H2 that can be formed from 55.8 grams of NH: in the following reaction?…

A: To solve this problem we will use the given balanced chemical equation .

Q: Calculate how many grams of O2 can be produced from 92.1 g H2O

Q: How many moles of ammonia would be required to react exactly with 0.598 moles of copper(II) oxide in…

A: The given reaction is - - > 2 NH₃(g) + 3 CuO(s) → 3 Cu(s) + N₂(g) + 3H₂O(g) 2 moles NH3 reacts…

Q: How many moles of glucose can be formed from 2.53 × 1024 H atoms?

Q: Consider the reaction 3X + 2Y→ 5C + 4D With excess Y, how many moles of X are needed to produce…

A: Reaction: 3X + 2Y → 5C + 4D According to the reaction: 4 mol of D is produced when = 3 mol of…

Q: If 5.467 g of KAl(OH)4 was the limiting reagent in the synthesis of Alum, calculate the mass of Alum…

A: Mass of KAl(OH)4 = 5.467 g Given that yield of reaction is 98.00 % We need to find mass of Alum…

Q: How many moles of ammonia would be required to react exactly with 0.158 moles of copper(II) oxide in…

A: Well-balanced chemical reaction: 2 NH₃(g) + 3 CuO(s) → 3 Cu(s)…

Q: How many grams KCl can be produced from 179.88g KClO3 ?

A: Mass of KClO3=179.88g Molar mass of KClO3 =122.55g/mol Molar mass of KCL =74.55g/mol Mass of KCl=?

Q: For the chemical reaction CaI2+2AgNO3⟶2AgI+Ca(NO3)2 what mass of silver iodide is produced…

A: Applying concept of limiting reagent and mole concept.

Q: How much HNO3 can be formed in the following reaction if 1.55 kg of NO2 gas is bubbled through 1.25…

A: Given: Weight of NO2 = 1.55 kg Weight of water = 1.25 kg Molecular weight of HNO3 (W) = 63 g/mol…

Q: How many moals of c7h602 are needed to make 10 Moles of co2

A: Given : Moles of CO2 = 10 mol. And the compound used to produce CO2 is C7H6O2.

Q: What mass of CCI4 is formed by the reaction of 5.14 g of methane (CH4) with an excess of chlorine?

A: Given :- mass of CH4 = 5.14 g To calculate :- mass of CCl4 produced Molar mass of CCl4 is 153.82…

Q: What mass of CuCl2 is obtained from the reaction between 73 grams of HCl and 31,775 g of Cu?

A: We have given that Mass of HCl = 73 g Mass of Cu = 31,775 g Molar mass of HCl = 36.5 g/mole…

Q: How many grams of magnesium oxide can be produced by reacting 0.248 g magnesium that is 97.5% pure…

Q: Cryolite (Na3AlF6) is used in the production of aluminum from its ores. It is made by the reaction 6…

A: First, calculate the moles of Al2O3 Moles = Mass/Molar mass = 287 g/(101.96gmol-1) = 2.815 moles

Q: How many moles of ammonia would be required to react exactly with 0.610 moles of copper(II) oxide in…

Q: If 9.250 g Fe is mixed with 13.39 g O2, calculate the theoretical yield (g) of FeO produced by the…

A: Given :- mass of Fe = 9.250 g mass of O2 = 13.39 g To be calculated :- theoretical yield or mass…

Q: What mass of carbon dioxide is produced from the complete combustion of 2.40×10−3 g of methane?

A: The formula for the mass of carbon dioxide as follows:

Question

For the chemical reaction 2NaOH+H2SO4⟶Na2SO4+2H2O, how many moles of sodium sulfate will be produced from 26.0 g of sodium hydroxide?

Definition Definition Transformation of a chemical species into another chemical species. A chemical reaction consists of breaking existing bonds and forming new ones by changing the position of electrons. These reactions are best explained using a chemical equation.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 3 steps

SEE SOLUTION Check out a sample Q&A here

Similar questions

How many grams of beryllium (Be) are needed to react completely with 45.0 g of nitrogen (N2) in the synthesisof Be3N2?
Tungsten (W) metal, which is used to make incandescent bulb filaments, is produced by the reaction WO3+3H23H2O+W How many grams of H2 are needed to produce 1.00 g of W?
Nitric acid is produced commercially by the Ostwald process, represented by the following equations: 4NH3(g)+5O24NO(g)+6H2O(g)2NO(g)+O2(g)2NO2(g)3NO2(g)+H2O(l)2HNO3(aq)+NO(g) What mass of NH3 must be used to produce 1.0 106 kg HNO3 by the Ostwald process? Assume 100% yield in each reaction, and assume that the NO produced in the third step is not recycled.
Nitrogen monoxide is oxidized in air to give brown nitrogen dioxide. Starting with 2.2 mol NO, calculate how many moles and how many grams of O2 are required for complete reaction. Calculate what mass of NO2, in grams, is produced.
4.24 Ammonia gas can be prepared by the reaction CaO(s)+2NH4Cl(s)2NH3(g)+H2O(g)+CaCl2(s) If 112 g of CaO reacts with 224 g of NH4Cl, how many moles of reactants and products are there when the reaction is complete?
Hydrogen cyanide is produced industrially from the reaction of gaseous ammonia, oxygen, and methane: 2NH3(g)+3O2(g)+2CH4(g)2HCN(g)+6H2O(g) If 5.00 103 kg each of NH3, O2, and CH4 are reacted, what mass of HCN and of H2O will be produced, assuming 100% yield?
Phosphoric acid, H3PO4, can be prepared by the reaction of phosphorus(V) oxide, P4O10, with water. 14P4O10(s)+32H2O(l)H3PO4(aq);H=96.2kJ What is H for the reaction involving 1 mol of P4O10? P4O10(s)+6H2O(l)4H3PO4(aq)
Bacterial digestion is an economical method of sewage treatment. The reaction is an intermediate step in the conversion of the nitrogen in organic compounds into nitrate ions. What mass of bacterial tissue is produced in a treatment plant for every 1.0 104 kg of wastewater containing 3.0% NH4+ ions by mass? Assume that 95% of the ammonium ions are consumed by the bacteria.
Urea is used as a fertilizer because it can react with water to release ammonia, which provides nitrogen to plants. (NH2)2CO(s) + H2O() 2 NH3(aq) + CO2(g) (a) When 300. g urea and 100. g water are combined, calculate the mass of ammonia and the mass of carbon dioxide that form. (b) Calculate the mass of the excess reactant that remains after reaction.
4.30 Copper reacts with nitric acid via the following equation: 3Cu(s)+8HNO3(aq)3Cu( NO3)2(aq)+2NO(g)+4H2O(l) What mass of NO(g) can be formed when 10.0 g of Cu reacts with 115 g of HNO3?
Many cereals are made with high moisture content so that the cereal can be formed into various shapes before it is dried. A cereal product containing 58% H2O by mass is produced at the rate of 1000. kg/h. What mass of water must be evaporated per hour if the final product contains only 20.% water?