Answered: For the reaction Na₂CO3 + 2HCl-NaCl +…

Science

Chemistry

For the reaction Na₂CO3 + 2HCl-NaCl + CO₂ + H₂O ΔH is -144.1 kJ. What is ΔU

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter17: Chemcial Thermodynamics

Section: Chapter Questions

Problem 17.36QE: For a process, w = 34 J and q = 109 J. What is E for this process?

See similar textbooks

Related questions

Q: Ng t = N- ミーミ

A: Answer:- The entropy is the degree of randomness or disorderness . Higher the randomness , higher…

Q: Determine the standard free energy change, ΔG°,

A: Δ G = Δ H − T Δ S Δ H = 625.5 kJ ∆S° = 450.0 J/K = 450 x 10-3 KJ/K T = 25.0°C + 273 = 298K

Q: A reaction has ΔH∘rxn= -134 kJ and ΔS∘rxn= 320 J/K. At what temperature is the change in entropy…

A: Given: -ΔH°rxn = -134 KJΔS°rxn = 320 J/KIf everything is carried out at a constant temperature and…

Q: A chemical reaction has a standard entropy change, ΔSo, of -287.8 J/(molK) and a standard enthalpy…

A: The given data you have - ΔSo = -287.8 J/K-mol ΔHo = -138.1 kJ/mol

Q: ΔG = ΔH - T ΔS is the equation for the Gibbs free energy of reaction for a chemical process. If the…

A: The reaction that leads to the formation of the products under the reaction conditions is termed as…

Q: ΔG = ΔH - T ΔS is the equation for the Gibbs free energy of reaction for a chemical process. If the…

A: For a reaction, if Gibbs free energy of reaction <0 , then the reaction is spontaneous. So…

Q: Suppose some cells are assembling a certain protein made of 23 amino acids. Calculate The MAXIMUM…

A: During the combustion of 1 mole of glucose, 2872 kJ energy is released. Hence, energy released…

Q: 4. How much propane (in grams) wnuld have to be combusted to increase the temperature 300 mL of…

Q: 14 For a process with AH 0 ΟΔΕ >0 O AS > 0 O Never. 20 The standard enthalpy of reaction, AHf pen,…

Q: The balanced chemical equation for the combustion of propane gas is: C3H8 (g) + 5 O2 (g) --> 3 CO2…

Q: For a reaction, ΔHrxn = -107 kJ and ΔSrxn = 285 J>K. At what temperature is the change in entropy…

Q: 2 ClO2 (g) + 2 TiCl4 (l) → 2 TiO2 (s) + 5 Cl2 (g) Delta H = – 343.8 kJ when…

A: Please have a look on the solutiion:

Q: It refers to how a circumstance can occur without the help of any external factors? a. Enthalpy O b.…

Q: The mathematical equation that best defines the first law of thermodynamics is ΟΑΔU -ΔΗ-pAV O B. AH…

A: What is the best define the mathematical equation of first law of thermodynamics ?

Q: For the decomposition of mercury(II) oxide, HgO, to mercury and oxygen: 2HgO(s) → 2Hg(l) + O2(g)…

A: Standard entropy change is the difference of standard entropy of product from standard entropy of…

Q: he tollowig beaction: ー3 K)

Q: Consider the reactions 1. C(graphite) + O2(g) --> CO2(g) delta H xrn = -393.5 kJ 2. H2(g) +…

A: Thermodynamics can be defined as the brach of chemistry that deals with heat evolved or absorbed…

Q: 2Al(s) + 3Cl2(g) → 2AlCl3(s) Find the change in internal energy for this reaction. Enter in kJ.

A: The given equation is:

Q: o The following reaction proceeds in a beaker. Naclag) + AGNO3(aq) → NANO3(aq) + AgCl) a) What is…

A: Since you have posted question with multiple subparts as per guideline we can answer only three…

Q: It is determined that a particular chemical reaction has AH°rxn = 105 kJ and As°rxn = 252 JK1.…

A: For spontaneous reaction delta G must be negative....

Q: A certain reaction has ∆?°= -19.5KJ and ∆S°= 42.7 J/K, does the reaction lead to an increase or…

A: here in given question change in entropy is given positive it means as reaction move forward entropy…

Q: The entropy of reaction for XeF6 (g) ⇌ XeF4 (g) + F2 (g) is 49 J/mol·K. If the equilibrium constant…

A: Feasibility of a reaction depends on the change in Gibbs free energy. The value of change in Gibbs…

Q: If the Delta*H = 135kJ / m * ol and AS 92 J/K mol, at what temperature does this reaction become…

Q: The standard enthalpy change for the following reaction is 1.39x10* kJ at 298 K Mn304(s)3 Mn(s) + 2…

A: Hess's law:The enthalpy change of a reaction is equal to the sum of enthalpy changes in each step.

Q: 4. Find the standard molar enthalpy for the reaction C(s) + 2 O2(g) CO2(g) CO(g) C(s) + O2(g)→CO2(g)…

A: According to Hess's law, the enthalpy change of the final reaction can be calculated by adding the…

Q: Define gibbs free energy in a reaction.

A: Thermodynamic is the branch of chemistry that mainly deals with the heat transfer between system and…

Q: Gibbs free energy in chemistry is symbolized G. It is related to the enthalpy (H) and entropy (S)…

Q: The balanced chemical equation for the combustion of propane gas is: C3H8 (g) + 5 O2 (g) --> 3 CO2…

A: Given reaction: C3H8 (g) + 5 O2 (g) → 3 CO2 (g) + 4 H2O (g) ∆G°RXN = -2385 kJ Temperature = 17.0 °C…

Q: Consider the reaction Cl2(g) + Br2(g) → 2 BrCI(g) at 25 °C. Using the information in the table,…

A: Cl2 +Br2 →2BrCl at 25 0C △SCl2 = 223.0 J/mol-K△SBr2 = 245.5 J/mol-K△SBrCl = 240.0 J/mol-K

Q: For the reaction, A + B → C, AH = +30 kJ; AS = +50 J/K. Therefore the reaction is:

A: For the case when both standard enthalpy and entropy change is positive - In order to be a…

Q: the decomposition of ammonia to nitrogen and hydrogen gas. Substance S° (J/mol · K) H2(g) 130.7…

A: Entropy measures the randomness of the molecule. Gaseous molecule have higher entropy than liquid…

Q: Gibbs free energy in chemistry is symbolizedG. It is related to the enthalpy (H) and entropy (S)…

A: The reaction given is In the above reaction, since production of gaseous molecules takes place.…

Q: The industrial synthesis of chloroform by the reaction of methane with Cl2 is carried out according…

A: The given equation is not balanced, so the first step is to balance the equation. CH4 (g) + 3Cl2…

Q: Standard molar entropies for CO(g), CO2(g), and O2(g) are 197.9, 214.0, and 205.0 in J/mol K,…

A: Entropy Entropy is the measure of disorder in a reaction. When an amount of energy is added to a…

Q: For the oxidation of iron to form iron(III) oxide: 4Fe(s) + 3O2(g) ⟷⟷ 2Fe2O3(s)…

A: ΔSo = –549.73 J∙K–1 T = 298K ΔH = –824.2 kJ∙mol–1 = -824200 Jmol-1

Q: The heats of the following reactions at 25°C are: Na(s) + 1/2Cl,(g) → NaCl(s) AH° = - 98230 cal…

A: The heat of the reaction is the energy that is released or absorbed when chemicals compounds are…

Q: Calculate ΔH for the process: N2(g) + 2O2(g) ⟶…

A: According to the Hess's law, the enthalpy change of final reaction can be calculated by sum of the…

Q: he balanced chemical equation for the combustion of propane gas is: C3H8 (g) + 5 O2 (g) --> 3 CO2…

A: The standard free energy (G) and the Gibbs free energy change (∆G°) can be related by the equation…

Q: Is the dissolution of NaOH endothermic or exothermic

A: We have to tell Is the dissolution of NaOH endothermic or exothermic

Q: ΔG = ΔH - T ΔS is the equation for the Gibbs free energy of reaction for a chemical process. If the…

Q: Determine the entropy of the reaction: H2(g) + CuO(s) → Cu(s) + H2O(g)

Q: The standard Gibbs free energy (∆G°rxn) for the formation of sulfur trioxide from sulfur dioxide and…

A: Given reaction: SO2 (g) + ½ O2 (g) → SO3 (g) The standard Gibbs free energy (∆G°rxn) for the…

Q: For a given reaction, dH = 32 kJ/mol and dS = 117 J/mol. At approximately what temperature would…

A: The spontaneity of the reaction can be determined by the change in Gibbs free energy. The relation…

Q: The standard enthalpy of reaction, AH for the reaction, CaO(s) + SO3(3) – CaSO,(s) is 401.5 kJ mol1.…

Q: A certain reaction is spontaneous at 65 ° C. If the enthalpy change for the reaction is 15…

Q: A reaction has AH = -112 kJ and ASan = 354 J/K. At what temperature is the change in entropy for the…

A: The given data contains, ∆H°reaction=-112 kJ∆S°reaction=354 J/K

Q: A chemical reaction proceeds with decrease in both the enthalpy and entropy. This reaction will be…

A: In thermochemistry, we explain the spontaneity of the reaction by means of heat change and…

Q: Explain Thermodynamic Processes?

A: The four types of thermodynamic process are isobaric, isochoric, isothermal and adiabatic.

Question

For the reaction

Na₂CO3 + 2HCl-NaCl + CO₂ + H₂O

ΔH is -144.1 kJ. What is ΔU?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

The formation of aluminum oxide from its elements is highly exothermic. If 2.70 g Al metal is burned in pure O2 to give A12O3, calculate how much thermal energy is evolved in the process (at constant pressure).
For a process, w = 34 J and q = 109 J. What is E for this process?
Calculate the standard Gibbs free-energy change when SO3 forms from SO2 and O2 at 298 K. Why is sulfur trioxide an important substance to study? (Hint: What happens when it combines with water?)
What are the two ways that a final chemical state of a system can be more probable than its initial state?
When 1.000 g of ethylene glycol, C2H6O2, is burned at 25C and 1.00 atmosphere pressure, H2O(l) and CO2(g) are formed with the evolution of 19.18 kJ of heat. a Calculate the molar enthalpy of formation of ethylene glycol. (It will be necessary to use data from Appendix C.) b Gf of ethylene glycol is 322.5 kJ/mol. What is G for the combustion of 1 mol ethylene glycol? c What is S for the combustion of 1 mol ethylene glycol?
Explain why absolute entropies can be measured.
2. Which of the following is true for a spontaneous process but not for a nonspontaneous process? Energy in the universe is concentrated conserved dispersed not conserved
For the reaction BaCO3(s) BaO(s) + CO2(g), rG = +219.7 kJ/mol-rxn. Using this value and other data available in Appendix L, calculate the value of fG for BaCO3(s).
Would the amount of heat absorbed by the dissolution in Example 5.6 appear greater, lesser, or remain the same if the heat capacity of the calorimeter were taken into account? Explain your answer.
For the process A(l) A(g), which direction is favored by changes in energy probability? Positional probability? Explain your answers. If you wanted to favor the process as written, would you raise or lower the temperature of the system? Explain.
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the combustion of acetaldehyde? CH3CHO(l)+52O2(g)2CO2+2H2O(l)
A pot of cold water is heated on a stove, and when the water boils, a fresh egg is placed in the water to cook. Describe the events that are occurring in terms of the zeroth law of thermodynamics.