From the following data, C(graphite) + O,(g) CO,(g) AH=-393.5 kJ/mol H,(g) + 0,(g)-H,O(1) AH=-285.8 kJ/mol Fxn 2C,H,(g) +70,(g)-4C0,(g) + 6H,O() AH -3119.6 kJ/mol calculate the enthalpy change for the reaction 2C(graphite) + 3H,(g) C,H,(g)

From the following data, C(graphite) + O,(g) CO,(g) AH=-393.5 kJ/mol H,(g) + 0,(g)-H,O(1) AH=-285.8 kJ/mol Fxn 2C,H,(g) +70,(g)-4C0,(g) + 6H,O() AH -3119.6 kJ/mol calculate the enthalpy change for the reaction 2C(graphite) + 3H,(g) C,H,(g)

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter5: Thermochemistry

Section: Chapter Questions

Problem 5.52QE

See similar textbooks

Related questions

Q: 4. The explosive nitroglycerin decomposes rapidly according to the reaction 4 C3H5N3O9 (1) → 12…

Q: Determine AH pclst3pcl, + Clz AH = +157 KJ %3D Py+ 6cl, 3 upCla AH =-1207 3.

A: Answer:- This question is answered by using the simple concept of Hess law of constant heat…

Q: A chemist measures the enthalpy change AH during the following reaction: 8 SO,(g) + 16 H,S(g)→3…

Q: The diagram below shows a system that is made up of 3 molecules (labeled A, B, and C) that contains…

A: Hello. Since the question contains more than three sub-parts, the first three sub-parts shall be…

Q: What energy in kilojoules per mole are associated with this frequency (4.37 x 10^14 Hz)? A. 2.91 x…

A: Energy is related to the frequency by the relation E=hν where E=Energy of the wave or particle…

Q: Oluşum Entalpileri (kJ/mol) CHs (g) -103.8 02() CO2 (g) H,O (s) -393.5 -285.8 Using the table above,…

A: Given : ∆fH° (C3H8, g) = -103.8 KJ/mole ∆fH° (O2, g) = 0 KJ/mole ∆fH° ( CO2, g) = -393.5 KJ/mole…

Q: A scientist measures the standard enthalpy change for the following reaction to be -168.0 kJ:…

A: The given equation is, NH4NO3aq→N2Og+2H2Ol The standard enthalpy formation is -168.0 kJ.

Q: Using the table of bond dissociation energies below, calculate the heat of reaction, AH in units of…

A: bond dissociation energy is or required to break the bond. Heat of reaction equal to total bond…

Q: Using the equations N, (g) + 3 H, (g) → 2 NH, (g) AH° = -91.8 kJ/mol C(s) + 2 H, (g) – CH, (g) AH° =…

Q: oses of this energy to or from er absorbing heat. gy, in the form of e. The total e heat and work:…

A: Given ΔH = -75 kJ Pressure = 43 atm Change in volume = 5L to 2L

Q: How much work is done at 25 °C during the combustion of 2.03 g of ethanol, C2H5OH?

Q: What is the electrostatic potential energy between an electron and a proton that are separated by 53…

A: The electrostatic potential energy between an electron and a proton is calculated as,

Q: III. Heat of Fusion. 5. Complete the table below. a. Mass of empty calorimeter 3.41 g b. Mass…

Q: 7. The standard enthalpy of formation of NH, is - 46.0 kJ mol. If the enthalpy of formation of H,…

Q: If the energy of the products of a chemical reaction is 1,105 kJ/mol and the energy of the reactants…

A: During a chemical reaction, the product formation is takes place either by absorbing energy or by…

Q: Which of the following statement is correct? Select all the correct statements, wrong choices will…

A: Thermodynamics : it is the branch of science where the relationship between heat , energy , work…

Q: If the complete consumption of 22.7 g of C,H, liberates-1178 kl of heat energy at constant pressure…

A: Weight of C2H6 = 22.7 g Heat energy liberated = -1178 kJ Reaction: 2C2H6(g) + 7 O2(g) ------->…

Q: Given the following reaction enthalpies: P,(s) + 6 Cl,(g) → 4 PCI,(g) =-1225.6moi → PO,(s) → PCI,(g)…

Q: Calculate the standard enthalpy change AH°, for the formation of 1 mole POCI, . PCl4g) + H,Oe)…

Q: What is the energy of one mole of photons having a wavelength of 550 nm and also find 2.045 g of a…

A: Given data Wavelength of photon =550 nm And for Combustion of C9H8O2 mass = 2.045 g Initial…

Q: Question attached

A: Given: The given reaction is

Q: & 2. Calculate the energy released, q, using the formula q = m C, AT Cp = 4.18J/gº Convert joules to…

Q: ethanol (CH3CH2OH) has been suggested as an alternative fuel source. ethanols enthaply of combustíon…

A: The ratio of mass to the volume is known as density.

Q: 11. A strip of magnesium weighing o.200 g is added to 3.00 mL of 5.00 M hydrochloric acid. During…

A: Since you have posted a question with multiple questions, we will solve first question for you. To…

Q: You are given 2 kg of water (roughly 2 liters) and a 2 kg piece of silver both at room temperature.…

A: Heat transfer or heat capacity

Q: In a reaction between water and lithium, 82.14 J of energy was released. The molar enthalpy change…

A: Interpretation - Mass of Li reacted. Concept introduction- Molar mass- The mass of one mole of a…

Q: 4HCN + 50 2(g) 2H2OG) + 4CO2(e) + 2N2 Calculate AS using the table provided. Compound S re HCN HČN…

Q: 6.62 From the following data, TARIS → CO2(g) AHan = -393.5 kJ/mol C(graphite) + O2(g) H,(g) + 0,(g)…

A: Hess's law states that the enthalpy change for a reaction is the sum of the enthalpy changes of the…

Q: Write thermochemical equations for the formation of one mole of the following compounds from the…

A: Since you have posted a question with multiple sub-parts, we will solve first three subpartsfor you.…

Q: Write the balanced chemical equation for the following reaction: The exothermic combustion reaction…

A: Exothermic reaction that means energy is realised so the ∆H comes product side. For exothermic…

Q: 2. Use the AH information provided to calculate AHpn° for the following. SHOW YOUR WORK!! SO,Cl.(g)…

A: Answer = c. -62 kJ

Q: What is the energy that is produced from the frequency of 9.47 x 10° Hz? 0.317 J 1.43 x 1042 J 6.28…

A: Given, the frequency of radiation ν =9.47×108 Hzwe are asked to calculate the energy corresponding…

Q: Soog x 10369 14539 = 0.5kg 1. Calculate the kinetic energy (in J) of a bird weighing 500 g flying at…

A: Given -> Weight= 500 gm = 0.500 kg (1kg=1000gm) Velocity= 60.0 m/s

Q: :Example of a state function is .A 5 I to ED AU .B ΔΗ AS .D All

A: The solution of the given question is

Q: A sample of 39.44 mg of liquid phenyl acetylene, C6H5CCH( molecular weight=102.14 g/mole) is burned…

A: C6H5CCH (l)+152 O2(g)→6CO2(g) +3H2O(l) ∆n = gaseous product - gaseous reactant = 6 - 7.5…

Q: If it takes 420 J to heat a reaction and the microwave emits photons that are 2.5 GHz, how many…

Q: Given the following data, DH°f SiCl4(l)= -640.1 kJ/mol, DH°f H2O(l) = -285.8 kJ/mol, DH°f SiO2(s) =…

A: Interpretation: From the given data, ∆H° for the following reaction is to be calculated. Reaction:…

Q: The following information is given to you: A+B C AH=32 kJ/mol What is the enthalpy change for the…

A: Given equation is A + B → C Reactants react with each other to give products.

Q: Brz (CHs)a COH, heat 2. 1. light 2.1) Os ; i) Me ,s' Cs Hio O Na OCHs CH30H, heat 3.

A: Organic chemistry involves a vast collection of oxidizing and reducing agents. The type of base…

Q: Can you please help me understand how to get the answer to this question? 12. Calculate the kinetic…

A: Given, Mass of a ball = 0.25lbs. Velocity of moving of ball = 1.3mi/hr. Kinetic energy of the ball…

Q: Using the following equations, N,04(g) 2NO,(g) AH° =+57.93 kJ 2NO(g) + O,(g)– 2NO,(g) AH° = -113.14…

Q: Suppose you burned 0.300 g of C(s) in an excess of O (8) in a constant-volume calorimeter to give…

A: Mass of carbon = 0.3g Molar mass of carbon = 12.01g/mol Mass of water = 767g Ti = 26.15°C Tf =…

Q: Without doing any calculations or using Sf data, predict whether the DS for each process would be…

A: A. Si(s) + 2Cl2(g) = SiCl4(g) ΔS is negative here. As no of gaseous molecules decrease in forward…

Q: How much energy is evolved during the reaction of 26.3 g of Al, according to the reaction below?…

A: The enthalpy of reaction is negative if the energy is released in the reaction.

Q: Using the data provided below, calculate the standard enthalpy change for the following reaction:…

A: We will use enthaply of formation of both products and reactants to calculate enthalpy of reaction.

Q: 8. What is the symbol for energy/heat flow in the field of thermochemistry? O Hf E H

A: It is the enthalpy that denotes heat in thermochemistry.

Q: rences) Suppose you burned 0.300 g of C(s) in an excess of O,(R) in a constant-volume calorimeter to…

Q: 10. When a stable diatomic molecule spontaneously forms from its atoms, what are the signs (+ or -)…

A: The importance of Gibbs energy is that it gives information about the spontaneity of the reaction or…

Concept explainers

Solutions

Solutions can be considered as homogeneous mixtures which contain two or more than two chemical substances. The chemical substance which is the greater part is defined as solvent. And the chemical substance that is dissolved in a solvent is referred to as solute. Solution chemistry plays an important role in chemistry since it supports many commercial applications of solutions.

Question

6.62, 6.63, 6.64

From the following data,
C(graphite) + O,(g) CO,(g)
AH=-393.5 kJ/mol
H,(g) + 0,(g)-H,O(1)
AH=-285.8 kJ/mol
Fxn
2C,H,(g) +70,(g)-4C0,(g) + 6H,O()
AH -3119.6 kJ/mol
calculate the enthalpy change for the reaction
2C(graphite) + 3H,(g) C,H,(g)

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

Step 2

Step 3

Step 4

Trending now

This is a popular solution!

Step by step

Solved in 4 steps with 5 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Find the enthalpies of the combustion reactions for methane through n-octane. Plot them versus the number of carbon atoms in the molecule, and determine an equation that gives H for the combustion of a given hydrocarbon. Then use the equation to predict the enthalpy of combustion for n-C12H26 and compare it to experimental values.
A sample of ethanol, C2H5OH, weighing 2.84 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 33.73C. If the heat capacity of the calorimeter and contents was 9.63 kJ/C, what is the value of q for burning 1.00 mol of ethanol at constant volume and 25.00C? The reaction is C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) Is q equal to U or H?
How many milliliters of water at 23 C with a density of 1.00 g/mL must be mixed with 180 mL (about 6 oz) of coffee at 95 C so that the resulting combination will have a temperature of 60 C? Assume that coffee and water have the same density and the same specific heat.
A 0.692-g sample of glucose, C6H12O6, was burned in a constant-volume calorimeter. The temperature rose from 21.70 C to 25.22 C. The calorimeter contained 575 g of water, and the bomb had a heat capacity of 650 J/K. What is U per mole of glucose?
Although the gas used in an oxyacetylene torch (Figure 5.7) is essentially pure acetylene, the heat produced by combustion of one mole of acetylene in such a torch is likely not equal to the enthalpy of combustion of acetylene listed in Table 5.2. Considering the conditions for which the tabulated data are reported, suggest an explanation.
A sample of benzene, C6H6, weighing 3.51 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 37.18C. If the heat capacity of the calorimeter and contents was 12.05 kJ/C, what is the value of q for burning 1.00 mol of benzene at constant volume and 25.00C? The reaction is C6H6(l)+152O2(g)6CO2(g)+3H2O(l) Is q equal to U or H?
Niagara Falls has a height of 167 ft (American Falls). What is the potential energy in joules of 1.00 lb of water at the top of the falls if we take water at the bottom to have a potential energy of zero? What would be the speed of this water at the bottom of the falls if we neglect friction during the descent of the water?
Define the following terms: potential energy, kinetic energy, path-dependent function, state function, system, surroundings.
The enthalpy change for the following reaction is 393.5 kJ. C(s,graphite)+O2(g)CO2(g) (a) Is energy released from or absorbed by the system in this reaction? (b) What quantities of reactants and products are assumed? (c) Predict the enthalpy change observed when 3.00 g carbon burns in an excess of oxygen.