galvanic cell is made using 0.25M ZnSO4 and an unknown amount of CuSO4. The cell potential is 105V at 50oC. What is the concentration of CuSO4 in the cathode compartment? Zn(s) + Cu(aq)2+ -------> Zn(aq)2+ + Cu(s) Eo = 1.10 V Use: E = Eo - (RT/nF) + lnQ

galvanic cell is made using 0.25M ZnSO4 and an unknown amount of CuSO4. The cell potential is 105V at 50oC. What is the concentration of CuSO4 in the cathode compartment? Zn(s) + Cu(aq)2+ -------> Zn(aq)2+ + Cu(s) Eo = 1.10 V Use: E = Eo - (RT/nF) + lnQ

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 18.98QE

See similar textbooks

Related questions

Q: For the following half-reactions: Fe²+ (aq) → Fe(s) Zn²+ (aq) → Zn(s) a. What will be the overall…

Q: Consider the galvanic cell based on the following half-reactions: Zn2+ + 2e → Zn ɛ° = -0.76 V Cd²+ +…

A: Here the standard reduction potential of Cd2+ is higher than standard reduction potential of Zn2+.…

Q: For the galvanic (voltaic) cell Cd²⁺(aq) + Fe(s) ⟶ Cd(s) + Fe²⁺(aq) (E° = 0.0400 V), what is the…

Q: Consider the following pairs of reactions: Fe2+ (aq) + 2 e- → Fe (s) E° = – 0.44 V Au3+ (aq) + 3…

A: “Since you have posted a question with multiple sub-parts, we will solve first three subpartsfor…

Q: A voltaic cell employs the following redox reaction:Sn2+(aq) + Mn(s) ¡ Sn(s) + Mn2+(aq)Calculate the…

A: The redox reaction takes place as- Cathode -Sn2+ (aq)+2e- →Sn (s)…

Q: What is the calculated value of the cell potential at 298 K for an electrochemical cell with the…

Q: What is the cell potential (EO) for a galvanic cell formed from the following two half-reactions?…

A: Interpretation- We have to determine the cell potential (Eo ) of the galvanic cell from the given…

Q: Calculate the emf at 298 K generated by a voltaic cell in which the reaction isCr2O72-(aq)+ 14…

Q: If an alkaline battery produces a cell potential of 1.70 V, what is the value of ΔGcell? The…

A: The cell reactions given are ZnO (s) +H2O (l) + 2 e− --------> Zn (s) + 2 OH− (aq) 2 MnO2 (s) +…

Q: A student decides to measure the solubility of lead sulfate in water and sets up the electrochemical…

A: The anode reaction for given cell is, The cathode reaction for given cell is, The given cell…

Q: Calculate the emf at 298 K generated by a voltaic cell in which the reaction isCr2O72-(aq)+ 14…

A: The chemical reaction in which a substance loses an electron is known as an oxidation reaction. The…

Q: . Calculate the cell potential of a cell operating with the following reaction at 25°C, in which…

Q: For the galvanic (voltaic) cell Cd²⁺(aq) + Fe(s) ⟶ Cd(s) + Fe²⁺(aq) (E° = 0.0400 V), what is the…

A: Use Nernst equation to calculate the emf of the cell: Ecell = Eocell - 0.0592n log Q where,…

Q: A galvanic cell is set up by making 1 M solutions of FeSO4 and ZnSO4, with an iron (Fe) electrode in…

A: Interpretation-E0cell value. Concept introduction- Equation of half cell reaction anode-…

Q: A voltaic cell employs the following redox reaction: 2Fe3+(aq)+3Mg(s)→2Fe(s)+3Mg2+(aq) Calculate the…

A: The Ecell can be calculated as,

Q: What is the calculated value of the cell potential at 298 K for an electrochemical cell with the…

A: The standard cell potential of the cell is: Reaction E0red/V Pb+2 + 2e- → Pb -0.13…

Q: The cell potential of the following electrochemical cell depends on the pH of the solution in the…

A: The question is based on the concept of redox reactions reactions. Reactions in which simultaneous…

Q: Calculate the cell potential of a cell operating with the following reaction at 25°C, in which…

A: Answer

Q: A spontaneous galvanic cell consists of a Pb electrode in a 1.0 M Pb(NO3)2 solution and a Cd…

A: Given The concentration of Pb(NO3)2 and Cd(NO3)2 solution is 1.0 M. The reduction potential…

Q: For the galvanic (voltaic) cell Cd²*(aq) + Fe(s) – Cd(s) + Fe2*(aq) (E° = 0.0400 V), what is the…

Q: Consider these two entries from a fictional table of standard reduction potentials.…

A: To calculate standard potential of a galvanic cell:

Q: Write the balanced reaction occurring in the voltaic cell. Compute the standard cell potential,…

A: Given : Concentration of Ni(NO3)2 = 0.25 M Concentration of Pb(NO3)2 = 0.50 M E°Ni+2/Ni = -0.25 V…

Q: For the reaction: Pb2+(aq) + Fe(s) → Pb(s) + Fe2+(aq) E°cell = 0.31 V Imagine a Voltaic cell is set…

A: Ecell = Eocell - 0.0591nLog[Fe2+][Pb2+] Ecell = Eocell + 0.0591nLog[Pb2+][Fe2+]…

Q: The cell potential of the following electrochemical cell depends on the gold concentration in the…

A: Concentration of Au3+ can be easily calculated using the nernst equation of cell.

Q: For the galvanic (voltaic) cell Cd²"(aq) + Fe(s) → Cd(s) + Fe²"(aq) (E° = 0.0400 V), what is the…

A: we have given the reaction as follow Cd2+ + Fe → Cd + Fe2+…

Q: What are the overall cell reaction and the cell potential for this voltaic cell? Mg(s)|Mg+ (aq) ||…

Q: 6. Given the following galvanic cell: The Mn electrode is immersed in 0.40 M Mn²+. The other…

Q: For the galvanic (voltaic) cell Cd²⁺(aq) + Fe(s) ⟶ Cd(s) + Fe²⁺(aq) (E° = 0.0400 V), what is the…

A: Given galvanic cell is: Cd²⁺(aq) + Fe(s) ⟶ Cd(s) + Fe²⁺(aq) The standard reduction…

Q: voltaic cell consists of a Pb/Pb^2+ half-cell and a Cu/Cu^2+ half-cell at 25 ∘C. The initial…

A: Given : We have to calculate the cell potential.

Q: Consider the galvanic cell in the following reaction Zng) + 2H* (? M) => Zn²* ( 1M) + H2 (1 M) Where…

A: Given that, for a galvanic cell, the cell reaction is Zn(s)+2H+(?M) →Zn2+(1M) + H2(1M). Where,…

Q: Use the data in Standard Electrode (Half-Cell) Potentials to calculate equilibrium constants for the…

A: Hello. Since your question has multiple sub-parts, we will solve the first three sub-parts for you.…

Q: The galvanic cell consisting of a lead electrode and a zinc electrode was set up and connected by a…

A: We have been asked to provide short hand notation for the given electrochemical cell reaction and to…

Q: Co0/Co2+ and Au0/Au+ Chose the anode and cathode. b)Calculate k, Eo and DGO for this reaction. c)…

Q: For the galvanic (voltaic) cell Cd²⁺(aq) + Fe(s) ⟶ Cd(s) + Fe²⁺(aq) (E° = 0.0400 V), what is the…

A: The reaction given is Cd²⁺(aq) + Fe(s) ⟶ Cd(s) + Fe²⁺(aq) Hence in the above reaction, Cd2+ is…

Q: Q2+/Q and D+/D electrodes. Q and D are symbols of hypothetical elements. What is the overall cell…

A: Loss of electrons is oxidation which takes place at anode and gain of electrons reduction which take…

Q: Consider the following reactions at 298 K: Co^ 2+ (aq)+2 e^ —>Co(s) K^ + (aq) +e^ - -->K (s) a.…

A: The half reactions given are 1) Co2+ (aq) + 2 e- -------> Co (s) Eored =…

Q: What is the cell potential (E) for a galvanic cell formed from the following two half-reactions?…

Q: Dariana Using the Nernst equation to calculate nonstandard cell voltage A galvanic cell at a…

A: Galvanic cell:

Q: Mercuric oxide dry-cell batteries are often used where aflat discharge voltage and long life are…

A: The two half cell reaction would be;Reduction at cathodeHgO(s) +H2O(l) +2e-→Hg(l) +2OH- Oxidation…

Q: Calculate the cell potential of a cell operating with the following reaction at 25°C, in which…

Q: 1. Calculate the Gibbs free energy changes, AG, by using the potential differences measured in Part…

Q: nO4– + Sn ----> MnO2 + Sn2+ A) Identify the half-reaction that occurs at the cathode. B) Identify…

A: Electrochemistry is branch of chemistry that deals with chemical changes produced by electricity…

Q: A voltaic cell consists of a Pb/Pb2+ half-cell and a Cu/Cu2+ half-cell at 25 ∘C. The initial…

A: The Nernst equation is shown below: Where: Ecell = cell potential E0cell = standard cell potential…

Q: The cell notation of a voltaic cell is: Zn(s) | Zn2+(aq; 0.02M) || Zn2+(aq; 1.0 M) | Zn (s) Draw a…

A: Hello. Since your question has multiple sub-parts, we will solve the first three sub-parts for you.…

Q: 4. A cell uses the following reaction: a. Zn (s) + 2 H* (aq) → Zn²* (aq) + H2 (g) (a) Determine the…

Q: Use the Nernst equation to Calculate the cell potential E for the Galvanic cell at 25ºC U=while…

A: The cell given is Al Ι Al3+(aq) ΙΙ Au3+(aq) Ι Au. Given: [Al3+ ] = 3.00 M [Au3+ ] = 5.00 × 10-5 M.…

Q: From the reaction as shown below, calculate the Standard Cell Potential of a Galvanic Cell that uses…

A: Cr3+ + 3e- ==> Cr E°= -0.73V Al3+ + 3e- ==> Al E°= -1.66 V

Q: Consider the galvanic cell based on the following half-reactions: Zn2+ + 2e + Zn e° = -0.76 V Ca2+ +…

Q: MnO4– + Sn ---> MnO2 + Sn2+ a) What is the half reaction that takes place at the cathode? b) What…

A: Recall the given reaction Mn7+O4- + Sn0 → Mn4+O2 + Sn2+ Recall values of standard electrode…

Q: The cell notation of an electrochemical cell is given as below. Zn(s)|Zn²*(aq, 1.0 M)|| H*(aq, 1.0…

A: Cell reaction:- Anode:- Zn(s) ------> Zn+2(aq) + 2e- Cathode:- 2H+(aq) ---> H2(g) Net cell…

Question

100%

A galvanic cell is made using 0.25M ZnSO₄ and an unknown amount of CuSO₄. The cell potential is 105V at 50^oC. What is the concentration of CuSO₄ in the cathode compartment?

Zn_(s) + Cu_(aq)²⁺ -------> Zn_(aq)²⁺ + Cu_(s) E^o = 1.10 V

Use:
E = E^o - (RT/nF) + lnQ

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

Consider a voltaic cell in which the following reaction occurs. Zn(s)+Sn2+(aq)Zn2+(aq)+Sn(s) (a) Calculate E° for the cell. (b) When the cell operates, what happens to the concentration of Zn2+? The concentration of Sn2+? (c) When the cell voltage drops to zero, what is the ratio of the concentration of Zn2+ to that of Sn2+? (d) If the concentration of both cations is 1.0 M originally, what are the concentrations when the voltage drops to zero?
The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.
The saturated calomel electrode. abbreviated SCE. is often used as a reference electrode in making electrochemica1 measurements. The SCE is composed of mercury in contact with a saturated solution of calomel (Hg2Cl2). The electrolyte solution is saturated KCI. is +0.242 V relative to the standard hydrogen electrode. Calculate the potential for each of the following galvanic cells containing a saturated calomel electrode and the given half-cell components at standard conditions. In each case. indicate whether the SCE is the cathode or the anode. Standard reduction potentials are found in Table 17.1. a. Cu2++2eCu b. Fe3++e-Fe2+ c. AgCl+e-Ag+Cl- d. Al3++3eAl e. Ni2++2eNi
Calculate the theoretical potential of each of the following cells. Is the cell reaction spontaneous as written or spontaneous in the opposite direction? (a) Pt|Cr3+(2.00 10-4M),Cr2+(1.50 10-3 M)||Pb2+ (5.60 0215 10-2M)|Pb (b) Hg|Hg22+(2.00 10-2 M)||H+(1.50 10-2 M),V3+ (2.00 10-2M),VO2+(3.00 10-3M)|Pt (e) Pt|Fe3+(3.00 10-2 M), Fe2+ (4.00 10-5M)||Sn2+ (3.50 10-2M), Sn4+ (5.50 10-4 M)|Pt
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
Calculate the theoretical potential of each of the following cells.Is the cell reaction spontaneous as written or spontaneous in the opposite direction? (a) Bi|BiO+ (0.0300 M),H+ (0.100 M)||I- (0.100 M), AgI(sat’d)|Ag (b) Zn|Zn2+(5.75 10-4M)||Fe(CN)64-(530 10-2 M),Fe(CN)63-(6.75 10-2M)|Pt (c) Pt,H2O (0.200 atm)|HCI(8.25 10-4M), AgCI(sat’d)| Ag
Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
Calculate the electrode potentials of the following half-cells. (a) Ag+(0.0436 M)|Ag (b) Fe3+ (5.34 10-4M),Fe2+ (0.090 M)|Pt (c) AgBr(sat’d),Br- (0.037 M)|Ag
An alloy made up of tin and copper is prepared by simultaneously electroplating the two metals from a solution containing Sn(NO3)2 and Cu(NO3)2.If 20.0% of the total current is used to plate tin, while 80.0% is used to plate copper, what is the percent composition of the alloy?
For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Zn(s)+Fe2+(aq)Zn2+(aq)+Fe(s) (b) AgCl(s)+Fe2+(aq)Ag(s)+Fe3+(aq)+Cl(aq) (c) Br2(l)+2Cl(aq)Cl2(g)+2Br(aq)