Give the IUPAC name for following compound.       CH3(CH2)3CH(CH2CH2CH3)CH(CH3)2

Q: Provide IUPAC names for the following compounds.(a) (CH3)2CHCH2CH3                          (b)…

A: Organic compounds are the compounds which are mainly composed C and H atoms. The branch of chemistry…

Q: Draw the skeletal structure of: 3-methyl-1,2-cyclobutanediol

A:

Q: C2H5CHCHCN

A:

Q: CH3 CH₂CHCH₂CH₂CH =O

A: Rule of IUPAC-   1) Longest chain as parent chain. 2) Numbering start from those side where more…

Q: Give the complete IUPAC name for each of the following compounds:  A. CH3CH2CBr2CH3 B.…

A: There are some basic rules for the naming the organic compounds. They are as follows. Find the…

Q: Write the IUPAC names of the following compounds   1.CH3CH2CH2CH2OH 2. CH3 -O- CH2CH3

A: Rule 1: Consider a longest carbon chain consisting of maximum number of side chain and functional…

Q: What is the IUPAC names of  1. CH3CH2COOCH2CH3 2. CH3CH2-CO-O-CO-CH2-CH2-CH3

A: The given first compound belongs to the class of esters in various organic compounds and the given…

Q: CH3CH2CHCH,CH,CH CH2CH3 CH

A:

Q: Give the IUPAC name for the organic compound shown here: CH3CHBrCH(CH3)CH2CH3

A: Answer

Q: What is the IUPAC (systematic) name of the molecule depicted below? CH2CH3 Br NO2

A:

Q: Give the correct IUPAC name for the following compound: CH3CH2CH2 CH3CCH2CH2 CH2CH3 CH3CH2…

A: We have a structure of compound, we have To decide the correct IUPAC nomenclature of the given…

Q: iupac name and structural formula for CH3CH2CH(CH3)2CH2CH(CH3)2CH3

A: In this question, the formula of an organic compound is provided and its IUPAC name and structural…

Q: What is the IUPAC name of the following compound? CH3CH2CH2C-H

A: In this question, we will name the compound by according to IUPAC rule.  You can see below.

Q: CH2CH3 H3C CH2CO2H

A: IUPAC naming for the organic compounds is done as follows: Select the longest chain in the…

Q: Write the IUPAC name for the compound below. Be sure to use correct punctuation. CH2CH3…

A:

Q: What is the IUPAC name for each of the following compounds? a.C6H5CH2(CH2)3COOH b. Br(CH2)3COOH D-CH…

A: In this question, we will give the IUPAC name of the given three compounds.  You can see the…

Q: Write the IUPAC name for the compound below. Be sure to use correct punctuation. CH3…

A: Steps involved: 1. Identify the parent chain, which is the longest carbon chain with C=C 2. Label…

Q: Give IUPAC names for the following compounds.(a)(a) CH3 SHCH3CHCH2CHCH3

A: IUPAC names for the given compound can be shown below

Q: CH2CH3 Br SE

A:

Q: What is the structure of a compound with the formula C7H14O that has an ether and cyclobutane ring,…

A: The possible chemical structure of the compound with the given molecular formula, C7H14O, is;

Q: A. Give the IUPAC name for the following compounds. OH NH2 OCH2CH2CH3 CI

A: We have given the organic compounds we have to find the IUPAC Name of the given compound.   Priority…

Q: Use the References to access importa What is the IUPAC name for the following compound?…

A:

Q: What are the systematic (IUPAC) names for the compounds shown? A. он systematic (IUPAC) name: В.…

A: IUPAC names can be assigned as follows: The longest chain is selected first in the compound.…

Q: Draw the structures for each of the following molecules. (a) 2-fluorotoluene; (b) 4-ethoxytoluene;…

A: (a) 2-fluorotoluene, the fluoro substituent is present in the second position. The structure of…

Q: CH3(CH2)4Br

A: The name will be hept-1-ene

Q: Give the systematic (IUPAC) names for these molecules. -OCH2CH3

A: As you have posted multiple questions in a single request, we will solve the first part for you. To…

Q: NHCH2CH3

A: We are having a structure from which we have to decide a nomenclature for this compound. We have to…

Q: Write correct IUPAC names for the following structures. (a) CH₂CH₂CH=CHCHCH=CHCH, I CH,CHCH, (b) 3…

A: Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…

Q: What is the IUPAC name of the following substance? CH3CH2 CH3CH2 CHCH2C=CCH3

A:

Q: What is the IUPAC name for the compound shown? CH3 H2 H3C H3C CH3 CH3 fo

A:

Q: What is the IUPAC classification of CH3 CH2 CH2 OH

A:

Q: Provide the appropriate IUPAC name for the following organic molecules CH₂CH₂C=CCHCH₂CH₂ L CH₂ I CH₂…

A:

Q: What is the IUPAC name of the following substance? CH3 HC=CCH2CHCH3

A: The IUPAC Name of the Compound is written in the following format: locant + prefix + root + locant +…

Q: What is the IUPAC name of each of the the following? CH;CH2CHCNH2 CH2CH 3-ethyl-2-methyl…

A: for IUPAC naming, choose the longest carbon chain. the naming the substituent in priority of…

Q: What is the correct IUPAC name for 1. N 2. 3. СН3СН 3 | CH3CH₂CHCH₂CHCH3 H3C CH3

A:

Q: An isomer of CH3CH=CHCH2_OH is

A:

Q: What is the correct IUPAC name for (CH3)2CH(CH2)3CH3?

A: We have given that the organic compound we have to find the IUPAC Name of the given compound. 1.…

Q: What is the IUPAC name of CH₂CH3 CH3CHCHCH₂CH₂CH₂CH₂CH3 3 CH3 O2-ethyl-3-methyloctane…

A:

Q: CH2CH3 CH;CHCH2CH,CHo The IUPAC name is

A:

Q: Give the IUPAC name for this molecule. CH3 T CH3CHCH2CH₂CH || FURLO

A: For IUPAC naming following steps are required-> Identify the longest carbon chain containing…

Q: b) 2-methylbutane c) 3-methylbutane d) pentane e)2,3-dimethylbutane 1b)Which of the following…

A:

Q: Use the IUPAC rules to draw and -or name the following organic moleculeEthananoic acid CH2C=OCH2CH3

A: Part a:IUPAC name of the given molecule: Ethanoic acid (Eth +ane+oic acid)Structure:From the given…

Q: Give the IUPAC name of the compound. CH±CH3 CH3 1. 2. 3. ÇH3 CH;-t-CH-CHz-ċ-CHCHCC4 CH2 CH2CH2CH2CH3…

A: Given that : We have to give the IUPAC name of the following compounds :

Q: CH3CH2 C=CHCH2CH3 CH3CH2 he IUPAC name is

A: Given : We have to write the name of the given compound.

Q: CHS CH3 CH2CH2 CH3 b. CH;CHCH a.

A: Isomers: Compounds having same molecular formula but differ in their chemical structure. Isomerism…

Q: What is the IUPAC name of the following compound? CH2CH3 CH3CH,CHCH2OH

A:

Q: Give IUPAC names for the following compounds. a) (CH3CH₂)3CCH₂CH₂CH(CH3)2 b)…

A:

Q: Which of the following compounds has the IUPAC name hexane? O CH3(CH2)4CH3 O CH3CH2CH2CH3 O CH3CH3 O…

A:

Q: what is the IUPAC name of: 1. CH3(CH2)5CHO 2. CH3CH2O(CH2

A: What is the IUPAC name of: 1. CH3(CH2)5CHO 2. CH3CH2O(CH2)5CH3

Q: Give the IUPAC names of the following alkaneCH3C(CH3)2CH(CH2CH3)CH2CH2CH(CH3)2

A: While writing the IUAC name first identify the parent name and then the functional groups.